CA2068261A1 - Urea derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same - Google Patents
Urea derivatives, processes for the preparation thereof and pharmaceutical composition comprising the sameInfo
- Publication number
- CA2068261A1 CA2068261A1 CA002068261A CA2068261A CA2068261A1 CA 2068261 A1 CA2068261 A1 CA 2068261A1 CA 002068261 A CA002068261 A CA 002068261A CA 2068261 A CA2068261 A CA 2068261A CA 2068261 A1 CA2068261 A1 CA 2068261A1
- Authority
- CA
- Canada
- Prior art keywords
- substituted
- halogen
- aryl
- alkyl
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 5
- 238000000034 method Methods 0.000 title claims description 25
- 238000002360 preparation method Methods 0.000 title abstract description 28
- 150000003672 ureas Chemical class 0.000 title description 8
- -1 nitro, amino Chemical group 0.000 claims abstract description 113
- 150000001875 compounds Chemical class 0.000 claims abstract description 101
- 150000003839 salts Chemical class 0.000 claims abstract description 87
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 86
- 125000003118 aryl group Chemical group 0.000 claims abstract description 66
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 64
- 150000002367 halogens Chemical group 0.000 claims abstract description 64
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 29
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 28
- 239000001257 hydrogen Substances 0.000 claims abstract description 28
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 17
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 16
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 16
- 125000001424 substituent group Chemical group 0.000 claims abstract description 14
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 11
- 201000001320 Atherosclerosis Diseases 0.000 claims abstract description 8
- 125000004442 acylamino group Chemical group 0.000 claims abstract description 8
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 8
- 201000010099 disease Diseases 0.000 claims abstract description 8
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 8
- 208000031226 Hyperlipidaemia Diseases 0.000 claims abstract description 7
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract 7
- 239000003814 drug Substances 0.000 claims abstract 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 28
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 208000035150 Hypercholesterolemia Diseases 0.000 claims description 4
- 239000002168 alkylating agent Substances 0.000 claims description 4
- 229940100198 alkylating agent Drugs 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 claims description 3
- 238000006900 dealkylation reaction Methods 0.000 claims description 3
- 238000005755 formation reaction Methods 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 241000282414 Homo sapiens Species 0.000 claims description 2
- 241001465754 Metazoa Species 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- SQOZLNXPRXDMBU-UHFFFAOYSA-N 1-[[3-(4-bromophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-(furan-2-ylmethyl)-3-(2,4,6-trifluorophenyl)urea Chemical compound C=1C=C(Br)C=CC=1C=1C2=CC(C)=CC=C2OC=1CN(C(=O)NC=1C(=CC(F)=CC=1F)F)CC1=CC=CO1 SQOZLNXPRXDMBU-UHFFFAOYSA-N 0.000 claims 1
- GJRPAGNTTAPJCC-UHFFFAOYSA-N Fr 145237 Chemical compound C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1CN(C(=O)NC=1C(=CC(F)=CC=1F)F)CC1=CC=CC=C1 GJRPAGNTTAPJCC-UHFFFAOYSA-N 0.000 claims 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 287
- 101150041968 CDC13 gene Proteins 0.000 description 85
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 58
- 238000006243 chemical reaction Methods 0.000 description 43
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- 239000000203 mixture Substances 0.000 description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000002904 solvent Substances 0.000 description 33
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- 239000004202 carbamide Substances 0.000 description 29
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- 239000002253 acid Substances 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- 238000001816 cooling Methods 0.000 description 16
- 150000001412 amines Chemical class 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 14
- 238000001704 evaporation Methods 0.000 description 14
- 230000008020 evaporation Effects 0.000 description 14
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 10
- 238000010828 elution Methods 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000006722 reduction reaction Methods 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- 230000002411 adverse Effects 0.000 description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 7
- 150000002431 hydrogen Chemical group 0.000 description 7
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 125000004430 oxygen atom Chemical group O* 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 239000012280 lithium aluminium hydride Substances 0.000 description 5
- 150000007524 organic acids Chemical class 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 125000004434 sulfur atom Chemical group 0.000 description 5
- XZXRAQXNXSBHGU-UHFFFAOYSA-N 2-hydroxy-5-isopentylbenzaldehyde Natural products CC(C)CCC1=CC=C(O)C(C=O)=C1 XZXRAQXNXSBHGU-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 235000012000 cholesterol Nutrition 0.000 description 4
- 229910017052 cobalt Inorganic materials 0.000 description 4
- 239000010941 cobalt Substances 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 229910052697 platinum Inorganic materials 0.000 description 4
- 230000002265 prevention Effects 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 125000004360 trifluorophenyl group Chemical group 0.000 description 4
- PFVQTLVDWFDABZ-UHFFFAOYSA-N (2,4,6-trifluorophenyl)urea Chemical compound NC(=O)NC1=C(F)C=C(F)C=C1F PFVQTLVDWFDABZ-UHFFFAOYSA-N 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 239000012964 benzotriazole Substances 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 150000001840 cholesterol esters Chemical class 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- HNENEALJPWJWJY-UHFFFAOYSA-N 2,4-difluoro-1-isocyanatobenzene Chemical compound FC1=CC=C(N=C=O)C(F)=C1 HNENEALJPWJWJY-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- FXLGCNLTKNOTRY-UHFFFAOYSA-N 2-methoxy-5-(3-methylbutyl)benzaldehyde Chemical compound COC1=CC=C(CCC(C)C)C=C1C=O FXLGCNLTKNOTRY-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 2
- YNSCKPCDFIDINW-UHFFFAOYSA-N 3-[[2-[[1-[2-(dimethylamino)acetyl]-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-7-yl]amino]-7h-pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiophene-2-carboxamide Chemical compound COC1=CC(C(CCN2C(=O)CN(C)C)(C)C)=C2C=C1NC(N=C1NC=CC1=1)=NC=1NC=1C=CSC=1C(N)=O YNSCKPCDFIDINW-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000005236 alkanoylamino group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001728 carbonyl compounds Chemical class 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910010272 inorganic material Inorganic materials 0.000 description 2
- 239000011147 inorganic material Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 210000001589 microsome Anatomy 0.000 description 2
- OPYIUBFIPKDISO-UHFFFAOYSA-N n-[(3-phenyl-1-benzofuran-2-yl)methyl]heptan-1-amine Chemical compound CCCCCCCNCC=1OC2=CC=CC=C2C=1C1=CC=CC=C1 OPYIUBFIPKDISO-UHFFFAOYSA-N 0.000 description 2
- OIXXBUMPTWJBPH-UHFFFAOYSA-N n-heptyl-3-phenyl-1-benzofuran-2-carboxamide Chemical compound CCCCCCCNC(=O)C=1OC2=CC=CC=C2C=1C1=CC=CC=C1 OIXXBUMPTWJBPH-UHFFFAOYSA-N 0.000 description 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- XDUHQPOXLUAVEE-BPMMELMSSA-N oleoyl-CoA Chemical compound O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(=O)OP(O)(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCC\C=C/CCCCCCCC)O[C@H]1N1C2=NC=NC(N)=C2N=C1 XDUHQPOXLUAVEE-BPMMELMSSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- GANGXBRARYTWTE-UHFFFAOYSA-N (4-chlorophenyl)-(2-hydroxy-5-methylphenyl)methanone Chemical compound CC1=CC=C(O)C(C(=O)C=2C=CC(Cl)=CC=2)=C1 GANGXBRARYTWTE-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- XWROZLGLILOJGC-UHFFFAOYSA-N 1-[(3,5-diphenyl-1-benzofuran-2-yl)methyl]-1-heptyl-3-(2,4,6-trifluorophenyl)urea Chemical compound FC=1C=C(F)C=C(F)C=1NC(=O)N(CCCCCCC)CC=1OC2=CC=C(C=3C=CC=CC=3)C=C2C=1C1=CC=CC=C1 XWROZLGLILOJGC-UHFFFAOYSA-N 0.000 description 1
- CRGJRJQLQKNYFD-UHFFFAOYSA-N 1-[(5-chloro-3-phenyl-1-benzofuran-2-yl)methyl]-1-cyclobutyl-3-(2,4,6-trifluorophenyl)urea Chemical compound FC1=CC(F)=CC(F)=C1NC(=O)N(C1CCC1)CC1=C(C=2C=CC=CC=2)C2=CC(Cl)=CC=C2O1 CRGJRJQLQKNYFD-UHFFFAOYSA-N 0.000 description 1
- JKFCYAIASCADNA-UHFFFAOYSA-N 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-[(3,4-dichlorophenyl)methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1CN(C(=O)NC=1C(=CC(F)=CC=1F)F)CC1=CC=C(Cl)C(Cl)=C1 JKFCYAIASCADNA-UHFFFAOYSA-N 0.000 description 1
- LSNYULRAVOKSLV-UHFFFAOYSA-N 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-heptyl-3-(4-nitrophenyl)urea Chemical compound C=1C=C([N+]([O-])=O)C=CC=1NC(=O)N(CCCCCCC)CC=1OC2=CC=C(C)C=C2C=1C1=CC=C(Cl)C=C1 LSNYULRAVOKSLV-UHFFFAOYSA-N 0.000 description 1
- IPYSOJNRYIIXCT-UHFFFAOYSA-N 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-propyl-3-(2,4,6-trifluorophenyl)urea Chemical compound FC=1C=C(F)C=C(F)C=1NC(=O)N(CCC)CC=1OC2=CC=C(C)C=C2C=1C1=CC=C(Cl)C=C1 IPYSOJNRYIIXCT-UHFFFAOYSA-N 0.000 description 1
- YEMAPXYGFGASNV-UHFFFAOYSA-N 1-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1CNC(=O)NC1=C(F)C=C(F)C=C1F YEMAPXYGFGASNV-UHFFFAOYSA-N 0.000 description 1
- ZJDRDTZQVOCKPI-UHFFFAOYSA-N 1-benzofuran-2-carbonyl chloride Chemical compound C1=CC=C2OC(C(=O)Cl)=CC2=C1 ZJDRDTZQVOCKPI-UHFFFAOYSA-N 0.000 description 1
- QHKJIJXBJCOABP-UHFFFAOYSA-N 1-benzofuran-2-carboxamide Chemical compound C1=CC=C2OC(C(=O)N)=CC2=C1 QHKJIJXBJCOABP-UHFFFAOYSA-N 0.000 description 1
- FUJYRMIVTIGEIM-UHFFFAOYSA-N 1-benzyl-1-[(5-chloro-3-phenyl-1-benzofuran-2-yl)methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound FC1=CC(F)=CC(F)=C1NC(=O)N(CC=1C=CC=CC=1)CC1=C(C=2C=CC=CC=2)C2=CC(Cl)=CC=C2O1 FUJYRMIVTIGEIM-UHFFFAOYSA-N 0.000 description 1
- ARWZURNAMTYMSR-UHFFFAOYSA-N 1-benzyl-1-[[3-(4-chlorophenyl)-6-methyl-1-benzofuran-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound O1C2=CC(C)=CC=C2C(C=2C=CC(Cl)=CC=2)=C1CN(C(=O)NC=1C(=CC(F)=CC=1F)F)CC1=CC=CC=C1 ARWZURNAMTYMSR-UHFFFAOYSA-N 0.000 description 1
- IFQBVJMPDLBJMH-UHFFFAOYSA-N 1-benzyl-1-[[3-(4-fluorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound C=1C=C(F)C=CC=1C=1C2=CC(C)=CC=C2OC=1CN(C(=O)NC=1C(=CC(F)=CC=1F)F)CC1=CC=CC=C1 IFQBVJMPDLBJMH-UHFFFAOYSA-N 0.000 description 1
- BFZNREHEWSUWMJ-UHFFFAOYSA-N 1-cycloheptyl-1-[(3-phenyl-1-benzofuran-2-yl)methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound FC1=CC(F)=CC(F)=C1NC(=O)N(C1CCCCCC1)CC1=C(C=2C=CC=CC=2)C2=CC=CC=C2O1 BFZNREHEWSUWMJ-UHFFFAOYSA-N 0.000 description 1
- BNDOQHJJVFTLLU-UHFFFAOYSA-N 1-heptyl-1-[(3-phenyl-1h-indol-2-yl)methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound FC=1C=C(F)C=C(F)C=1NC(=O)N(CCCCCCC)CC=1NC2=CC=CC=C2C=1C1=CC=CC=C1 BNDOQHJJVFTLLU-UHFFFAOYSA-N 0.000 description 1
- RIOSCZLYNUMASM-UHFFFAOYSA-N 1-heptyl-1-[(3-phenyl-5-propan-2-yl-1-benzofuran-2-yl)methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound FC=1C=C(F)C=C(F)C=1NC(=O)N(CCCCCCC)CC=1OC2=CC=C(C(C)C)C=C2C=1C1=CC=CC=C1 RIOSCZLYNUMASM-UHFFFAOYSA-N 0.000 description 1
- HEAJIZKLBDEIIB-UHFFFAOYSA-N 1-heptyl-1-[(5-methyl-3-phenyl-1-benzofuran-2-yl)methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound FC=1C=C(F)C=C(F)C=1NC(=O)N(CCCCCCC)CC=1OC2=CC=C(C)C=C2C=1C1=CC=CC=C1 HEAJIZKLBDEIIB-UHFFFAOYSA-N 0.000 description 1
- DNZRCICTNAWFGT-UHFFFAOYSA-N 1-heptyl-1-[(6-phenyl-1-benzofuran-2-yl)methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound FC=1C=C(F)C=C(F)C=1NC(=O)N(CCCCCCC)CC(OC1=C2)=CC1=CC=C2C1=CC=CC=C1 DNZRCICTNAWFGT-UHFFFAOYSA-N 0.000 description 1
- LGZXMLDEWOSFJN-UHFFFAOYSA-N 1-heptyl-1-[(7-phenyl-1-benzofuran-2-yl)methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound FC=1C=C(F)C=C(F)C=1NC(=O)N(CCCCCCC)CC(OC1=2)=CC1=CC=CC=2C1=CC=CC=C1 LGZXMLDEWOSFJN-UHFFFAOYSA-N 0.000 description 1
- BVCYBLOGUAQBOM-UHFFFAOYSA-N 1-heptyl-1-[[3-(4-methylphenyl)-1-benzofuran-2-yl]methyl]-3-(2,4,6-trifluorophenyl)urea Chemical compound FC=1C=C(F)C=C(F)C=1NC(=O)N(CCCCCCC)CC=1OC2=CC=CC=C2C=1C1=CC=C(C)C=C1 BVCYBLOGUAQBOM-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- HLKLJTIAXKHOKZ-UHFFFAOYSA-N 1-methoxy-4-(3-methylbutyl)benzene Chemical compound COC1=CC=C(CCC(C)C)C=C1 HLKLJTIAXKHOKZ-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- BJSVKBGQDHUBHZ-UHFFFAOYSA-N 2,4,6-trifluoroaniline Chemical compound NC1=C(F)C=C(F)C=C1F BJSVKBGQDHUBHZ-UHFFFAOYSA-N 0.000 description 1
- GPWNWKWQOLEVEQ-UHFFFAOYSA-N 2,4-diaminopyrimidine-5-carbaldehyde Chemical compound NC1=NC=C(C=O)C(N)=N1 GPWNWKWQOLEVEQ-UHFFFAOYSA-N 0.000 description 1
- ZTNMHMGIOQMJHO-UHFFFAOYSA-N 2-(2-formyl-6-phenylphenoxy)acetic acid Chemical compound OC(=O)COC1=C(C=O)C=CC=C1C1=CC=CC=C1 ZTNMHMGIOQMJHO-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- KATFOKILHZAWGY-UHFFFAOYSA-N 3,5-diphenyl-1-benzofuran-2-carboxylic acid Chemical compound OC(=O)C=1OC2=CC=C(C=3C=CC=CC=3)C=C2C=1C1=CC=CC=C1 KATFOKILHZAWGY-UHFFFAOYSA-N 0.000 description 1
- KUXNSYMVRCJGQV-UHFFFAOYSA-N 3-(2,4-difluorophenyl)-1-heptyl-1-[(3-phenyl-1-benzofuran-2-yl)methyl]urea Chemical compound C=1C=C(F)C=C(F)C=1NC(=O)N(CCCCCCC)CC=1OC2=CC=CC=C2C=1C1=CC=CC=C1 KUXNSYMVRCJGQV-UHFFFAOYSA-N 0.000 description 1
- QDGUCIAQSOFFOM-UHFFFAOYSA-N 3-(2-chlorophenyl)-n-heptyl-1-benzofuran-2-carboxamide Chemical compound CCCCCCCNC(=O)C=1OC2=CC=CC=C2C=1C1=CC=CC=C1Cl QDGUCIAQSOFFOM-UHFFFAOYSA-N 0.000 description 1
- IDKHYBMPJPOQGM-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-n-heptyl-1-benzofuran-2-carboxamide Chemical compound CCCCCCCNC(=O)C=1OC2=CC=CC=C2C=1C1=CC=C(Cl)C(Cl)=C1 IDKHYBMPJPOQGM-UHFFFAOYSA-N 0.000 description 1
- NUKUCPOTIXHCBC-UHFFFAOYSA-N 3-(3-methylphenyl)-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC=CC(C=2C3=CC=CC=C3OC=2C(O)=O)=C1 NUKUCPOTIXHCBC-UHFFFAOYSA-N 0.000 description 1
- OYSZKVQEEOMJMJ-UHFFFAOYSA-N 3-(4-bromophenyl)-5-methyl-1-benzofuran-2-carboxylic acid Chemical compound C12=CC(C)=CC=C2OC(C(O)=O)=C1C1=CC=C(Br)C=C1 OYSZKVQEEOMJMJ-UHFFFAOYSA-N 0.000 description 1
- JPXWNDFCABJMDU-UHFFFAOYSA-N 3-(4-bromophenyl)-n-(furan-2-ylmethyl)-5-methyl-1-benzofuran-2-carboxamide Chemical compound C=1C=C(Br)C=CC=1C=1C2=CC(C)=CC=C2OC=1C(=O)NCC1=CC=CO1 JPXWNDFCABJMDU-UHFFFAOYSA-N 0.000 description 1
- XGYWUTFMRLNFOV-UHFFFAOYSA-N 3-(4-chlorophenyl)-1-benzofuran-2-carboxylic acid Chemical compound OC(=O)C=1OC2=CC=CC=C2C=1C1=CC=C(Cl)C=C1 XGYWUTFMRLNFOV-UHFFFAOYSA-N 0.000 description 1
- BNTDLGOTFKNWDP-UHFFFAOYSA-N 3-(4-chlorophenyl)-5,7-dimethyl-1-benzofuran-2-carboxylic acid Chemical compound C12=CC(C)=CC(C)=C2OC(C(O)=O)=C1C1=CC=C(Cl)C=C1 BNTDLGOTFKNWDP-UHFFFAOYSA-N 0.000 description 1
- QFAGZPDMNWZMKQ-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-ethyl-1-benzofuran-2-carboxylic acid Chemical compound C12=CC(CC)=CC=C2OC(C(O)=O)=C1C1=CC=C(Cl)C=C1 QFAGZPDMNWZMKQ-UHFFFAOYSA-N 0.000 description 1
- XTVFJVCJDICTCV-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-carboxamide Chemical compound C12=CC(C)=CC=C2OC(C(N)=O)=C1C1=CC=C(Cl)C=C1 XTVFJVCJDICTCV-UHFFFAOYSA-N 0.000 description 1
- XFEDIUCTCXQCRP-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-carboxylic acid Chemical compound C12=CC(C)=CC=C2OC(C(O)=O)=C1C1=CC=C(Cl)C=C1 XFEDIUCTCXQCRP-UHFFFAOYSA-N 0.000 description 1
- YVZKTMMMFGDESD-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-methyl-n-(2-phenylethyl)-1-benzofuran-2-carboxamide Chemical compound C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1C(=O)NCCC1=CC=CC=C1 YVZKTMMMFGDESD-UHFFFAOYSA-N 0.000 description 1
- UUUGOESRGPIQIC-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-methyl-n-(pyridin-3-ylmethyl)-1-benzofuran-2-carboxamide Chemical compound C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1C(=O)NCC1=CC=CN=C1 UUUGOESRGPIQIC-UHFFFAOYSA-N 0.000 description 1
- DBZLAKGOTZQYJP-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-methyl-n-pentyl-1-benzofuran-2-carboxamide Chemical compound CCCCCNC(=O)C=1OC2=CC=C(C)C=C2C=1C1=CC=C(Cl)C=C1 DBZLAKGOTZQYJP-UHFFFAOYSA-N 0.000 description 1
- LHHBIMQTCVQYFX-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-methyl-n-propyl-1-benzofuran-2-carboxamide Chemical compound CCCNC(=O)C=1OC2=CC=C(C)C=C2C=1C1=CC=C(Cl)C=C1 LHHBIMQTCVQYFX-UHFFFAOYSA-N 0.000 description 1
- BFFCNLPIQXOWOP-UHFFFAOYSA-N 3-(4-chlorophenyl)-6-methyl-1-benzofuran-2-carboxylic acid Chemical compound OC(=O)C=1OC2=CC(C)=CC=C2C=1C1=CC=C(Cl)C=C1 BFFCNLPIQXOWOP-UHFFFAOYSA-N 0.000 description 1
- NGKHEISLBBFYNE-UHFFFAOYSA-N 3-(4-chlorophenyl)-n-[(3,4-dichlorophenyl)methyl]-5-methyl-1-benzofuran-2-carboxamide Chemical compound C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1C(=O)NCC1=CC=C(Cl)C(Cl)=C1 NGKHEISLBBFYNE-UHFFFAOYSA-N 0.000 description 1
- KYYGZODJWOQSOF-UHFFFAOYSA-N 3-(4-chlorophenyl)-n-cycloheptyl-5-methyl-1-benzofuran-2-carboxamide Chemical compound C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1C(=O)NC1CCCCCC1 KYYGZODJWOQSOF-UHFFFAOYSA-N 0.000 description 1
- KFVBXHPLSJVMTG-UHFFFAOYSA-N 3-(4-chlorophenyl)-n-cyclohexyl-5-methyl-1-benzofuran-2-carboxamide Chemical compound C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1C(=O)NC1CCCCC1 KFVBXHPLSJVMTG-UHFFFAOYSA-N 0.000 description 1
- QMIJXQULXKTYCD-UHFFFAOYSA-N 3-(4-fluorophenyl)-5-methyl-1-benzofuran-2-carboxylic acid Chemical compound C12=CC(C)=CC=C2OC(C(O)=O)=C1C1=CC=C(F)C=C1 QMIJXQULXKTYCD-UHFFFAOYSA-N 0.000 description 1
- ZDADUTSMVANABE-UHFFFAOYSA-N 3-(4-fluorophenyl)-n-(furan-2-ylmethyl)-5-methyl-1-benzofuran-2-carboxamide Chemical compound C=1C=C(F)C=CC=1C=1C2=CC(C)=CC=C2OC=1C(=O)NCC1=CC=CO1 ZDADUTSMVANABE-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- WLOLLTQKWZQAEG-UHFFFAOYSA-N 3-phenyl-1-benzofuran-2-carbonyl chloride Chemical compound ClC(=O)C=1OC2=CC=CC=C2C=1C1=CC=CC=C1 WLOLLTQKWZQAEG-UHFFFAOYSA-N 0.000 description 1
- RBXLFWWJPFRSFC-UHFFFAOYSA-N 3-phenyl-1-benzofuran-2-carboxamide Chemical compound C1(=CC=CC=C1)C1=C(OC2=C1C=CC=C2)C(=O)N RBXLFWWJPFRSFC-UHFFFAOYSA-N 0.000 description 1
- CGVOSCKZFZRKIP-UHFFFAOYSA-N 3-phenyl-1-benzofuran-2-carboxylic acid Chemical compound OC(=O)C=1OC2=CC=CC=C2C=1C1=CC=CC=C1 CGVOSCKZFZRKIP-UHFFFAOYSA-N 0.000 description 1
- FEYRMXBCLPKSIJ-UHFFFAOYSA-N 3-phenyl-1h-indole-2-carboxylic acid Chemical compound OC(=O)C=1NC2=CC=CC=C2C=1C1=CC=CC=C1 FEYRMXBCLPKSIJ-UHFFFAOYSA-N 0.000 description 1
- STZLSXKBQIWHQE-UHFFFAOYSA-N 3-phenyl-5-propan-2-yl-1-benzofuran-2-carboxylic acid Chemical compound C12=CC(C(C)C)=CC=C2OC(C(O)=O)=C1C1=CC=CC=C1 STZLSXKBQIWHQE-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- SCXCTXWDFKOCIV-UHFFFAOYSA-N 5-(3-methylbutyl)-1-benzofuran-2-carboxylic acid Chemical compound CC(C)CCC1=CC=C2OC(C(O)=O)=CC2=C1 SCXCTXWDFKOCIV-UHFFFAOYSA-N 0.000 description 1
- NSOIYMWWHFFALJ-UHFFFAOYSA-N 5-chloro-3-(4-methylphenyl)-1-benzofuran-2-carboxylic acid Chemical compound C1=CC(C)=CC=C1C1=C(C(O)=O)OC2=CC=C(Cl)C=C12 NSOIYMWWHFFALJ-UHFFFAOYSA-N 0.000 description 1
- URKXSHCRWIOSAN-UHFFFAOYSA-N 5-chloro-3-phenyl-1-benzofuran-2-carboxylic acid Chemical compound OC(=O)C=1OC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 URKXSHCRWIOSAN-UHFFFAOYSA-N 0.000 description 1
- GEVIMRTVIHYOSY-UHFFFAOYSA-N 5-chloro-n-(furan-2-ylmethyl)-3-(4-methylphenyl)-1-benzofuran-2-carboxamide Chemical compound C1=CC(C)=CC=C1C1=C(C(=O)NCC=2OC=CC=2)OC2=CC=C(Cl)C=C12 GEVIMRTVIHYOSY-UHFFFAOYSA-N 0.000 description 1
- GGFJMWIOTHMTJR-UHFFFAOYSA-N 5-methyl-3-(4-methylphenyl)-1-benzofuran-2-carbonyl chloride Chemical compound C1=CC(C)=CC=C1C1=C(C(Cl)=O)OC2=CC=C(C)C=C12 GGFJMWIOTHMTJR-UHFFFAOYSA-N 0.000 description 1
- HWODRLGNTHACNU-UHFFFAOYSA-N 5-methyl-3-(4-methylphenyl)-1-benzofuran-2-carboxylic acid Chemical compound C1=CC(C)=CC=C1C1=C(C(O)=O)OC2=CC=C(C)C=C12 HWODRLGNTHACNU-UHFFFAOYSA-N 0.000 description 1
- GGMORVLQXVPBKE-UHFFFAOYSA-N 5-methyl-3-(4-propylphenyl)-1-benzofuran-2-carboxylic acid Chemical compound C1=CC(CCC)=CC=C1C1=C(C(O)=O)OC2=CC=C(C)C=C12 GGMORVLQXVPBKE-UHFFFAOYSA-N 0.000 description 1
- SJVGFKBLUYAEOK-SFHVURJKSA-N 6-[4-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]pyrimidine-4-carbonitrile Chemical compound FC=1C=C(C=C(C=1)F)[C@@H]1CC=NN1C(=O)C1CCN(CC1)C1=CC(=NC=N1)C#N SJVGFKBLUYAEOK-SFHVURJKSA-N 0.000 description 1
- UIYYKQBJXIXKGI-UHFFFAOYSA-N 7-phenyl-1-benzofuran-2-carboxylic acid Chemical compound C=12OC(C(=O)O)=CC2=CC=CC=1C1=CC=CC=C1 UIYYKQBJXIXKGI-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 206010008190 Cerebrovascular accident Diseases 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- WJYIASZWHGOTOU-UHFFFAOYSA-N Heptylamine Chemical compound CCCCCCCN WJYIASZWHGOTOU-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- LYAVXWPXKIFHBU-UHFFFAOYSA-N N-{2-[(1,2-diphenylhydrazinyl)carbonyl]-2-hydroxyhexanoyl}-6-aminohexanoic acid Chemical compound C=1C=CC=CC=1N(C(=O)C(O)(C(=O)NCCCCCC(O)=O)CCCC)NC1=CC=CC=C1 LYAVXWPXKIFHBU-UHFFFAOYSA-N 0.000 description 1
- NLLHXVBITYTYHA-UHFFFAOYSA-N Nitrofor Chemical group CCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O NLLHXVBITYTYHA-UHFFFAOYSA-N 0.000 description 1
- 241000283977 Oryctolagus Species 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 208000018262 Peripheral vascular disease Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 102000001494 Sterol O-Acyltransferase Human genes 0.000 description 1
- 108010054082 Sterol O-acyltransferase Proteins 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 1
- 206010048215 Xanthomatosis Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- IANQTJSKSUMEQM-UHFFFAOYSA-N benzofuran Natural products C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000007887 coronary angioplasty Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- FNJVDWXUKLTFFL-UHFFFAOYSA-N diethyl 2-bromopropanedioate Chemical compound CCOC(=O)C(Br)C(=O)OCC FNJVDWXUKLTFFL-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000004212 difluorophenyl group Chemical group 0.000 description 1
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 1
- QFEOTYVTTQCYAZ-UHFFFAOYSA-N dimanganese decacarbonyl Chemical group [Mn].[Mn].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] QFEOTYVTTQCYAZ-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- RXTHQMMATPEOFI-UHFFFAOYSA-N ethyl 2-(2-formyl-5-phenylphenoxy)acetate Chemical compound C1=C(C=O)C(OCC(=O)OCC)=CC(C=2C=CC=CC=2)=C1 RXTHQMMATPEOFI-UHFFFAOYSA-N 0.000 description 1
- IZBTWPXBLMDCAS-UHFFFAOYSA-N ethyl 2-[2-(4-bromobenzoyl)-4-methylphenoxy]acetate Chemical compound CCOC(=O)COC1=CC=C(C)C=C1C(=O)C1=CC=C(Br)C=C1 IZBTWPXBLMDCAS-UHFFFAOYSA-N 0.000 description 1
- QAYPDTSFAHGVML-UHFFFAOYSA-N ethyl 2-[2-(4-chlorobenzoyl)-4,6-dimethylphenoxy]acetate Chemical compound CCOC(=O)COC1=C(C)C=C(C)C=C1C(=O)C1=CC=C(Cl)C=C1 QAYPDTSFAHGVML-UHFFFAOYSA-N 0.000 description 1
- DPIPZBFHPILDJI-UHFFFAOYSA-N ethyl 2-[2-(4-chlorobenzoyl)-6-methylphenoxy]acetate Chemical compound CCOC(=O)COC1=C(C)C=CC=C1C(=O)C1=CC=C(Cl)C=C1 DPIPZBFHPILDJI-UHFFFAOYSA-N 0.000 description 1
- CCTGLYRLDNGGMI-UHFFFAOYSA-N ethyl 2-[4-chloro-2-(4-chlorobenzoyl)phenoxy]acetate Chemical compound CCOC(=O)COC1=CC=C(Cl)C=C1C(=O)C1=CC=C(Cl)C=C1 CCTGLYRLDNGGMI-UHFFFAOYSA-N 0.000 description 1
- BHLCYOKRXCVKEN-UHFFFAOYSA-N ethyl 5-(3-methylbutyl)-1-benzofuran-2-carboxylate Chemical compound CC(C)CCC1=CC=C2OC(C(=O)OCC)=CC2=C1 BHLCYOKRXCVKEN-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- FUKUFMFMCZIRNT-UHFFFAOYSA-N hydron;methanol;chloride Chemical compound Cl.OC FUKUFMFMCZIRNT-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- 230000031891 intestinal absorption Effects 0.000 description 1
- 230000007154 intracellular accumulation Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 239000000401 methanolic extract Substances 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- DTRNSTOFULHOHN-UHFFFAOYSA-N n-(furan-2-ylmethyl)-5-methyl-3-(4-methylphenyl)-1-benzofuran-2-carboxamide Chemical compound C1=CC(C)=CC=C1C1=C(C(=O)NCC=2OC=CC=2)OC2=CC=C(C)C=C12 DTRNSTOFULHOHN-UHFFFAOYSA-N 0.000 description 1
- PHYPQOQKCCRVJP-UHFFFAOYSA-N n-[(5-chloro-3-phenyl-1-benzofuran-2-yl)methyl]-1-phenylmethanamine;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C=1C2=CC(Cl)=CC=C2OC=1CNCC1=CC=CC=C1 PHYPQOQKCCRVJP-UHFFFAOYSA-N 0.000 description 1
- NXRAVXMTMKJLJG-UHFFFAOYSA-N n-[[3-(4-bromophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-phenylmethanamine;hydrochloride Chemical compound Cl.C=1C=C(Br)C=CC=1C=1C2=CC(C)=CC=C2OC=1CNCC1=CC=CC=C1 NXRAVXMTMKJLJG-UHFFFAOYSA-N 0.000 description 1
- SLFWDCBPBVCQKK-UHFFFAOYSA-N n-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-(3,4-dichlorophenyl)methanamine;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1CNCC1=CC=C(Cl)C(Cl)=C1 SLFWDCBPBVCQKK-UHFFFAOYSA-N 0.000 description 1
- LWSMWMPICRKYMV-UHFFFAOYSA-N n-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]-1-phenylmethanamine;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1CNCC1=CC=CC=C1 LWSMWMPICRKYMV-UHFFFAOYSA-N 0.000 description 1
- RKDKLZJMSANABZ-UHFFFAOYSA-N n-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]heptan-1-amine Chemical compound CCCCCCCNCC=1OC2=CC=C(C)C=C2C=1C1=CC=C(Cl)C=C1 RKDKLZJMSANABZ-UHFFFAOYSA-N 0.000 description 1
- RDJAOLABZMTZAT-UHFFFAOYSA-N n-[[5-chloro-3-(4-chlorophenyl)-1-benzofuran-2-yl]methyl]-1-phenylmethanamine Chemical compound C1=CC(Cl)=CC=C1C(C1=CC(Cl)=CC=C1O1)=C1CNCC1=CC=CC=C1 RDJAOLABZMTZAT-UHFFFAOYSA-N 0.000 description 1
- MIPZKWJAQILAEW-UHFFFAOYSA-N n-benzyl-3-(4-bromophenyl)-5-methyl-1-benzofuran-2-carboxamide Chemical compound C=1C=C(Br)C=CC=1C=1C2=CC(C)=CC=C2OC=1C(=O)NCC1=CC=CC=C1 MIPZKWJAQILAEW-UHFFFAOYSA-N 0.000 description 1
- GAVBGNGNIKISHF-UHFFFAOYSA-N n-benzyl-3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-carboxamide Chemical compound C=1C=C(Cl)C=CC=1C=1C2=CC(C)=CC=C2OC=1C(=O)NCC1=CC=CC=C1 GAVBGNGNIKISHF-UHFFFAOYSA-N 0.000 description 1
- VGVXKHQWQFYCLU-UHFFFAOYSA-N n-benzyl-3-phenyl-1h-indole-2-carboxamide Chemical compound N1C2=CC=CC=C2C(C=2C=CC=CC=2)=C1C(=O)NCC1=CC=CC=C1 VGVXKHQWQFYCLU-UHFFFAOYSA-N 0.000 description 1
- NVVLXVSYHQVIDC-UHFFFAOYSA-N n-benzyl-5-chloro-3-(4-methylphenyl)-1-benzofuran-2-carboxamide Chemical compound C1=CC(C)=CC=C1C1=C(C(=O)NCC=2C=CC=CC=2)OC2=CC=C(Cl)C=C12 NVVLXVSYHQVIDC-UHFFFAOYSA-N 0.000 description 1
- BKAOHGYDMVYQOO-UHFFFAOYSA-N n-benzyl-5-chloro-3-phenyl-1-benzofuran-2-carboxamide Chemical compound C=1C=CC=CC=1C=1C2=CC(Cl)=CC=C2OC=1C(=O)NCC1=CC=CC=C1 BKAOHGYDMVYQOO-UHFFFAOYSA-N 0.000 description 1
- NQCIDZQSEIZFQZ-UHFFFAOYSA-N n-benzyl-5-methyl-3-(4-methylphenyl)-1-benzofuran-2-carboxamide Chemical compound C1=CC(C)=CC=C1C1=C(C(=O)NCC=2C=CC=CC=2)OC2=CC=C(C)C=C12 NQCIDZQSEIZFQZ-UHFFFAOYSA-N 0.000 description 1
- OEKGQRFASQZMPX-UHFFFAOYSA-N n-cycloheptyl-3-phenyl-1-benzofuran-2-carboxamide Chemical compound O1C2=CC=CC=C2C(C=2C=CC=CC=2)=C1C(=O)NC1CCCCCC1 OEKGQRFASQZMPX-UHFFFAOYSA-N 0.000 description 1
- FKLLGEKQBFLBCD-UHFFFAOYSA-N n-heptyl-1-benzofuran-2-carboxamide Chemical compound C1=CC=C2OC(C(=O)NCCCCCCC)=CC2=C1 FKLLGEKQBFLBCD-UHFFFAOYSA-N 0.000 description 1
- COIOKAIUDHYXPB-UHFFFAOYSA-N n-heptyl-3-(2-methylphenyl)-1-benzofuran-2-carboxamide Chemical compound CCCCCCCNC(=O)C=1OC2=CC=CC=C2C=1C1=CC=CC=C1C COIOKAIUDHYXPB-UHFFFAOYSA-N 0.000 description 1
- ZCJVSXVLWLRQJD-UHFFFAOYSA-N n-heptyl-3-(3-methylphenyl)-1-benzofuran-2-carboxamide Chemical compound CCCCCCCNC(=O)C=1OC2=CC=CC=C2C=1C1=CC=CC(C)=C1 ZCJVSXVLWLRQJD-UHFFFAOYSA-N 0.000 description 1
- PRHVAFFNLJXUHJ-UHFFFAOYSA-N n-heptyl-5-methyl-3-(4-methylphenyl)-1-benzofuran-2-carboxamide Chemical compound CCCCCCCNC(=O)C=1OC2=CC=C(C)C=C2C=1C1=CC=C(C)C=C1 PRHVAFFNLJXUHJ-UHFFFAOYSA-N 0.000 description 1
- IDUSGINZDWZWPC-UHFFFAOYSA-N n-heptyl-5-methyl-3-phenyl-1-benzofuran-2-carboxamide Chemical compound CCCCCCCNC(=O)C=1OC2=CC=C(C)C=C2C=1C1=CC=CC=C1 IDUSGINZDWZWPC-UHFFFAOYSA-N 0.000 description 1
- ZUOABJZZWXGVDI-UHFFFAOYSA-N n-heptyl-5-phenyl-1-benzofuran-2-carboxamide Chemical compound C=1C=C2OC(C(=O)NCCCCCCC)=CC2=CC=1C1=CC=CC=C1 ZUOABJZZWXGVDI-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 125000001196 nonadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005942 tetrahydropyridyl group Chemical group 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 125000001680 trimethoxyphenyl group Chemical group 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940116269 uric acid Drugs 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/18—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/20—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/81—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/58—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Obesity (AREA)
- Urology & Nephrology (AREA)
- Vascular Medicine (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919110133A GB9110133D0 (en) | 1991-05-10 | 1991-05-10 | New urea derivatives,a process for the preparation thereof and pharmaceutical composition comprising the same |
| GB9110133.7 | 1991-05-10 | ||
| GB9112823.1 | 1991-06-14 | ||
| GB919112823A GB9112823D0 (en) | 1991-06-14 | 1991-06-14 | New urea derivatives,a process for the preparation thereof and pharmaceutical composition comprising the same |
| GB919127277A GB9127277D0 (en) | 1991-12-23 | 1991-12-23 | New urea derivatives,processes for the preparation thereof and pharmaceutical composition comprising the same |
| GB9127277.3 | 1991-12-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2068261A1 true CA2068261A1 (en) | 1992-11-11 |
Family
ID=27265636
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002068261A Abandoned CA2068261A1 (en) | 1991-05-10 | 1992-05-08 | Urea derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same |
Country Status (10)
| Country | Link |
|---|---|
| EP (1) | EP0512570B1 (enExample) |
| JP (1) | JPH05140102A (enExample) |
| KR (1) | KR920021523A (enExample) |
| CN (1) | CN1067886A (enExample) |
| AT (1) | ATE128975T1 (enExample) |
| CA (1) | CA2068261A1 (enExample) |
| DE (1) | DE69205327T2 (enExample) |
| IL (1) | IL101785A0 (enExample) |
| MX (1) | MX9202142A (enExample) |
| TW (1) | TW200456B (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1993024458A1 (en) * | 1992-05-28 | 1993-12-09 | Pfizer Inc. | New n-aryl and n-heteroarylurea derivatives as inhibitors of acyl coenzyme a:cholesterol acyl transferase (acat) |
| TW234123B (enExample) * | 1992-12-16 | 1994-11-11 | Takeda Pharm Industry Co Ltd | |
| NZ250916A (en) * | 1993-02-27 | 1995-08-28 | Nihon Nohyaku Co Ltd | N-heteroaryl-n'-phenylureas, their use as acat inhibitors |
| US5346914A (en) * | 1993-05-14 | 1994-09-13 | Abbott Laboratories | (4-alkoxypyran-4-yl) substituted arylalkylaryl-, arylalkenylaryl-, and arylalkynylarylurea inhibitors of 5-lipoxygenase |
| IL109568A0 (en) * | 1993-05-19 | 1994-08-26 | Fujisawa Pharmaceutical Co | Urea derivatives, pharmaceutical compositions containing the same and processes for the preparation thereof |
| ES2076865B1 (es) * | 1993-07-05 | 1996-08-01 | Pfizer | Nuevos derivados de n-aril- y n-heteroaril-urea como inhibidores de acil-coenzima a: colesterol acil transferasa (acat). |
| JP3720395B2 (ja) | 1994-09-20 | 2005-11-24 | 京都薬品工業株式会社 | 新規ヘテロ環誘導体、その製造方法およびその医薬用途 |
| PL185943B1 (pl) * | 1995-08-04 | 2003-09-30 | Warner Lambert Co | Zastosowanie pochodnych kwasu amidosulfonowego, sulfonamidów acylowych lub karbaminianów sulfonylowych do produkcji leku do obniżenia poziomu lipoprotein |
| CZ292632B6 (cs) * | 1995-10-05 | 2003-11-12 | Kyoto Pharmaceutical Industries, Ltd. | Indolinový, indolový nebo tetrahydrochinolinový derivát a farmaceutický přípravek s jeho obsahem |
| AU9002798A (en) * | 1997-09-19 | 1999-04-12 | Ono Pharmaceutical Co. Ltd. | Fused or nonfused benzene compounds |
| EP1308438B9 (en) | 2000-08-10 | 2012-03-28 | Mitsubishi Tanabe Pharma Corporation | 3-substituted urea derivatives and medicinal use thereof |
| CN1474803B (zh) | 2000-09-14 | 2012-11-21 | 田边三菱制药株式会社 | 酰胺衍生物及其制备药物的用途 |
| EP2258694A1 (en) * | 2001-03-16 | 2010-12-08 | Abbott Laboratories | Amines as histamine-3 receptor ligands and their therapeutic applications |
| US6969730B2 (en) | 2001-03-16 | 2005-11-29 | Abbott Laboratories | Amines as histamine-3 receptor ligands and their therapeutic applications |
| TWI224101B (en) | 2001-06-20 | 2004-11-21 | Wyeth Corp | Substituted naphthyl indole derivatives as inhibitors of plasminogen activator inhibitor type-1 (PAI-1) |
| DK1397130T3 (da) | 2001-06-20 | 2007-11-12 | Wyeth Corp | Substituerede indolsyrederivater som inhibitorer af plasminogenaktivatorinhibitor-1 (PAI-1) |
| US7429612B2 (en) | 2002-07-17 | 2008-09-30 | Kyoto Pharmaceutical Industries, Ltd. | Indoline compound and medicinal use thereof |
| CN1726190A (zh) | 2002-12-10 | 2006-01-25 | 惠氏公司 | 作为纤溶酶原激活物抑制剂-1(pai-1)的抑制剂的取代3-羰基-1h-吲哚-1-基乙酸衍生物 |
| DK1569901T3 (da) | 2002-12-10 | 2009-02-16 | Wyeth Corp | Aryl-, aryloxy- og alkoxysubstituerede 1H-indol-3-yl-glyoxylsyrederivater som inhibitorer af plasminogenaktivatorinhibitor-1 (PAI-1) |
| DE60327550D1 (de) | 2002-12-10 | 2009-06-18 | Wyeth Corp | Substituierte indoloxoacetylaminoessigsäurederivate als inhibitoren des plasminogenaktivatorinhibitors-1 (pai-1) |
| ATE331708T1 (de) | 2002-12-10 | 2006-07-15 | Wyeth Corp | Substituierte 3-alkyl- und 3-arylalkyl-1h-indol-1-yl-essigsäure-derivate als plasminogen aktivator inhibitor-1 (pai-1) inhibitoren |
| UA80453C2 (en) | 2002-12-10 | 2007-09-25 | Derivatives of substituted dyhydropyranoindol-3,4-dion as inhibitors of plasminogen activator inhibitor-1 (pai-1) | |
| US7332521B2 (en) | 2003-09-25 | 2008-02-19 | Wyeth | Substituted indoles |
| US7442805B2 (en) | 2003-09-25 | 2008-10-28 | Wyeth | Substituted sulfonamide-indoles |
| US7582773B2 (en) | 2003-09-25 | 2009-09-01 | Wyeth | Substituted phenyl indoles |
| US7342039B2 (en) | 2003-09-25 | 2008-03-11 | Wyeth | Substituted indole oximes |
| US7265148B2 (en) | 2003-09-25 | 2007-09-04 | Wyeth | Substituted pyrrole-indoles |
| US7268159B2 (en) | 2003-09-25 | 2007-09-11 | Wyeth | Substituted indoles |
| US7420083B2 (en) | 2003-09-25 | 2008-09-02 | Wyeth | Substituted aryloximes |
| US7446201B2 (en) | 2003-09-25 | 2008-11-04 | Wyeth | Substituted heteroaryl benzofuran acids |
| US7163954B2 (en) | 2003-09-25 | 2007-01-16 | Wyeth | Substituted naphthyl benzothiophene acids |
| US7411083B2 (en) | 2003-09-25 | 2008-08-12 | Wyeth | Substituted acetic acid derivatives |
| US7351726B2 (en) | 2003-09-25 | 2008-04-01 | Wyeth | Substituted oxadiazolidinediones |
| US7141592B2 (en) | 2003-09-25 | 2006-11-28 | Wyeth | Substituted oxadiazolidinediones |
| US7534894B2 (en) | 2003-09-25 | 2009-05-19 | Wyeth | Biphenyloxy-acids |
| US7435837B2 (en) | 2003-10-24 | 2008-10-14 | Wyeth | Dihydrobenzofuranyl alkanamine derivatives and methods for using same |
| US7605172B2 (en) | 2004-08-23 | 2009-10-20 | Wyeth | Thiazolo-naphthyl acids |
| BRPI0514549A (pt) | 2004-08-23 | 2008-06-17 | Wyeth Corp | ácidos de pirrol-naftila como inibidores de pai-1 |
| KR20070055563A (ko) | 2004-08-23 | 2007-05-30 | 와이어쓰 | 혈전증 및 심혈관 질병의 치료에 유용한 플라스미노겐활성화제 억제제 타입-1(pai-1)의 조절제로서의옥사졸로-나프틸 산 |
| BRPI0606871A2 (pt) | 2005-01-27 | 2009-07-21 | Wyeth Corp | "processos e compostos para a preparação de derivados de naftilindol substituìdos |
| US7683091B2 (en) | 2005-08-17 | 2010-03-23 | Wyeth | Substituted indoles and methods of their use |
| ES2467693T3 (es) | 2009-04-09 | 2014-06-12 | Nestec S.A. | Cápsula para la preparación de una bebida con junta de deslaminación o que se puede romper en la pared de distribución |
| MX2024006739A (es) * | 2021-12-01 | 2024-06-19 | Pfizer | Derivados de acido 3-fenil-1-benzotiofeno-2-carboxilico como inhibidores de alfa cetoacido deshidrogenasa quinasa de cadena ramificada para el tratamiento de diabetes, enfermedad renal, esteatohepatitis no alcoholica (nash) e insuficiencia cardiaca. |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4623662A (en) * | 1985-05-23 | 1986-11-18 | American Cyanamid Company | Antiatherosclerotic ureas and thioureas |
| IE892088L (en) * | 1988-07-12 | 1990-01-12 | William Henry Deryk Morris | Quinoline derivatives, their production and use |
| AU632809B2 (en) * | 1989-05-25 | 1993-01-14 | Takeda Chemical Industries Ltd. | Benzocycloalkane benzopyran and benzothiopyran urea derivatives and production thereof |
| AU7440691A (en) * | 1990-03-12 | 1991-10-10 | Yamanouchi Pharmaceutical Co., Ltd. | Monourea derivative and its salt |
-
1992
- 1992-05-05 IL IL101785A patent/IL101785A0/xx unknown
- 1992-05-07 KR KR1019920007739A patent/KR920021523A/ko not_active Withdrawn
- 1992-05-08 CA CA002068261A patent/CA2068261A1/en not_active Abandoned
- 1992-05-08 JP JP4116348A patent/JPH05140102A/ja active Pending
- 1992-05-08 MX MX9202142A patent/MX9202142A/es unknown
- 1992-05-08 TW TW081103591A patent/TW200456B/zh active
- 1992-05-09 CN CN92104292A patent/CN1067886A/zh active Pending
- 1992-05-11 EP EP92107863A patent/EP0512570B1/en not_active Expired - Lifetime
- 1992-05-11 DE DE69205327T patent/DE69205327T2/de not_active Expired - Fee Related
- 1992-05-11 AT AT92107863T patent/ATE128975T1/de active
Also Published As
| Publication number | Publication date |
|---|---|
| AU1528292A (en) | 1992-11-12 |
| MX9202142A (es) | 1993-06-01 |
| TW200456B (enExample) | 1993-02-21 |
| CN1067886A (zh) | 1993-01-13 |
| DE69205327T2 (de) | 1996-03-28 |
| ATE128975T1 (de) | 1995-10-15 |
| DE69205327D1 (de) | 1995-11-16 |
| IL101785A0 (en) | 1992-12-30 |
| JPH05140102A (ja) | 1993-06-08 |
| EP0512570A1 (en) | 1992-11-11 |
| EP0512570B1 (en) | 1995-10-11 |
| AU653019B2 (en) | 1994-09-15 |
| KR920021523A (ko) | 1992-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2068261A1 (en) | Urea derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| US5223510A (en) | Alkylaminoalkyl derivatives of benzofuran, benzothiophene, indole and indolizine, process for their preparation and compositions containing them | |
| US5095031A (en) | Indole derivatives which inhibit leukotriene biosynthesis | |
| WO1994026738A1 (en) | N'-heterocyclyl-n-benzofuranyl urea derivatives and their analogs as acat inhibitors | |
| EP2114869B1 (en) | Rho kinase inhibitors | |
| JP2760903B2 (ja) | 異項環置換アシルアミノチアゾール | |
| KR101762574B1 (ko) | 플라즈미노겐 액티베이터 인히비터-1 저해제 | |
| JP5603849B2 (ja) | アミノアルキルベンゾイル−ベンゾフランまたはベンゾチオフェン誘導体を含む医薬組成物 | |
| EP0635018B1 (en) | 4-(1H-2-METHYLIMIDAZO[4,5-c]PYRIDINYLMETHYL)PHENYLSULPHONAMIDE DERIVATIVES AS ANTAGONISTS OF PAF | |
| EP1012147B1 (en) | O-substituted hydroxycumaranone derivatives as antitumor and antimetastatic agents | |
| JPH10502653A (ja) | 5ht2b/2c受容体アンタゴニストとしてのベンゾ縮合5員複素環カルボキシアミド | |
| WO2008074413A2 (en) | Heteroarylacrylamides and their use as pharmaceuticals for the stimulation of the expression of endothelial no synthase | |
| MXPA04004428A (es) | Derivados de 2,3-diamino-2-hidroxipropano n,n`-sustituidos. | |
| CA2396257A1 (en) | Novel compounds and compositions as protease inhibitors | |
| US5364875A (en) | Imidazoles linked to bicyclic heterocyclic groups for the treatment of atherosclerosis | |
| HRP20030748A2 (en) | Derivatives of n-(arylsulfonyl)beta-aminoacids comprising a substituted aminomethyl group, the preparation method thereof and the pharmaceutical compositions containing same | |
| KR970011580B1 (ko) | 항알레르기 활성을 갖는 신규의 벤조티오펜 | |
| PL187490B1 (pl) | Zastosowanie pochodnej 1,2-etanodiolu lub jej soli do wytwarzania środka wzmacniającego aktywność czynnika wzrostowego nerwu | |
| JP2003510320A (ja) | 薬剤活性のあるスルホニルアミノ酸誘導体 | |
| EP1939181A1 (en) | Heteroaryl-substituted carboxamides and use thereof for the stimulation of the expression of NO synthase | |
| JP2790926B2 (ja) | スルホンアミド誘導体 | |
| JP2709530B2 (ja) | 抗炎症薬としてのオキシンドール1−[n−(アルコキシカルボニル)]カルボキサミド類および1−(n−カルボキサミド)カルボキサミド類 | |
| JPH10316647A (ja) | グアニジン誘導体およびその用途 | |
| HU204520B (en) | Process for producing pharmaceutically active compounds and pharmaceutical compositions containing them | |
| US4096263A (en) | 1,2,3,4-Tetrahydroisoquinolines and the preparation thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |