CA1341164C - 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides - Google Patents
1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides Download PDFInfo
- Publication number
- CA1341164C CA1341164C CA000617114A CA617114A CA1341164C CA 1341164 C CA1341164 C CA 1341164C CA 000617114 A CA000617114 A CA 000617114A CA 617114 A CA617114 A CA 617114A CA 1341164 C CA1341164 C CA 1341164C
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- radical
- halogen
- plants
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims abstract description 47
- 230000008569 process Effects 0.000 title claims abstract description 29
- GNBNHUUABUEZGZ-UHFFFAOYSA-N 1-(1h-pyrrol-2-yl)ethanol Chemical class CC(O)C1=CC=CN1 GNBNHUUABUEZGZ-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 238000002360 preparation method Methods 0.000 title abstract description 21
- 239000000417 fungicide Substances 0.000 title abstract description 6
- 239000005648 plant growth regulator Substances 0.000 title abstract description 5
- -1 alkyl radical Chemical class 0.000 claims abstract description 69
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 67
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 26
- 239000002253 acid Substances 0.000 claims abstract description 25
- 125000005843 halogen group Chemical group 0.000 claims abstract description 25
- 150000003839 salts Chemical class 0.000 claims abstract description 25
- 229910052751 metal Chemical class 0.000 claims abstract description 19
- 239000002184 metal Chemical class 0.000 claims abstract description 19
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 16
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims abstract description 9
- 150000003254 radicals Chemical class 0.000 claims abstract description 8
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 6
- 230000000737 periodic effect Effects 0.000 claims abstract description 4
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 122
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 30
- 230000008635 plant growth Effects 0.000 claims description 23
- 239000003085 diluting agent Substances 0.000 claims description 21
- 230000001105 regulatory effect Effects 0.000 claims description 20
- 241000233866 Fungi Species 0.000 claims description 18
- 239000000460 chlorine Substances 0.000 claims description 13
- 239000002689 soil Substances 0.000 claims description 13
- 230000009471 action Effects 0.000 claims description 12
- 150000002367 halogens Chemical group 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 8
- 239000011737 fluorine Substances 0.000 claims description 8
- 229910052731 fluorine Inorganic materials 0.000 claims description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 7
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 229910052725 zinc Inorganic materials 0.000 claims description 7
- 239000011701 zinc Substances 0.000 claims description 7
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 5
- 230000000855 fungicidal effect Effects 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- 239000012433 hydrogen halide Substances 0.000 claims description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 4
- 239000001117 sulphuric acid Substances 0.000 claims description 4
- 235000011149 sulphuric acid Nutrition 0.000 claims description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 claims description 3
- 239000011777 magnesium Substances 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 239000011135 tin Substances 0.000 claims description 3
- 229910052718 tin Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 claims 2
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 claims 2
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 claims 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims 2
- 231100001184 nonphytotoxic Toxicity 0.000 claims 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 claims 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 abstract description 2
- 241000196324 Embryophyta Species 0.000 description 59
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 239000003630 growth substance Substances 0.000 description 21
- 230000012010 growth Effects 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- 230000017066 negative regulation of growth Effects 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 235000013399 edible fruits Nutrition 0.000 description 11
- 238000003306 harvesting Methods 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 239000003995 emulsifying agent Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 125000001309 chloro group Chemical group Cl* 0.000 description 8
- 150000002924 oxiranes Chemical class 0.000 description 8
- 235000013339 cereals Nutrition 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 230000009105 vegetative growth Effects 0.000 description 6
- 240000005979 Hordeum vulgare Species 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- YMWUJEATGCHHMB-UHFFFAOYSA-N dichloromethane Natural products ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 241000221785 Erysiphales Species 0.000 description 4
- 244000068988 Glycine max Species 0.000 description 4
- 235000007340 Hordeum vulgare Nutrition 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 241000221787 Erysiphe Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 244000061176 Nicotiana tabacum Species 0.000 description 3
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 235000021536 Sugar beet Nutrition 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 244000038559 crop plants Species 0.000 description 3
- 230000035613 defoliation Effects 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- ZDZOJEUYRFMJHH-UHFFFAOYSA-N 2-tert-butyl-2-[(4-chlorophenoxy)methyl]oxirane Chemical compound C=1C=C(Cl)C=CC=1OCC1(C(C)(C)C)CO1 ZDZOJEUYRFMJHH-UHFFFAOYSA-N 0.000 description 2
- 244000099147 Ananas comosus Species 0.000 description 2
- 235000007119 Ananas comosus Nutrition 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000299507 Gossypium hirsutum Species 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 206010037888 Rash pustular Diseases 0.000 description 2
- 240000000111 Saccharum officinarum Species 0.000 description 2
- 235000007201 Saccharum officinarum Nutrition 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- UHZZMRAGKVHANO-UHFFFAOYSA-M chlormequat chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 125000004438 haloalkoxy group Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229920000126 latex Polymers 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- LGRLWUINFJPLSH-UHFFFAOYSA-N methanide Chemical compound [CH3-] LGRLWUINFJPLSH-UHFFFAOYSA-N 0.000 description 2
- ANXKZXRDXAZQJT-UHFFFAOYSA-M methyl sulfate;trimethylsulfanium Chemical compound C[S+](C)C.COS([O-])(=O)=O ANXKZXRDXAZQJT-UHFFFAOYSA-M 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 208000029561 pustule Diseases 0.000 description 2
- 230000005070 ripening Effects 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical compound OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XBIAGSJDARBSKG-UHFFFAOYSA-N 1-hydroxypyrrole Chemical class ON1C=CC=C1 XBIAGSJDARBSKG-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ANHAEBWRQNIPEV-UHFFFAOYSA-N 2-chloroethyl dihydrogen phosphate Chemical compound OP(O)(=O)OCCCl ANHAEBWRQNIPEV-UHFFFAOYSA-N 0.000 description 1
- QLCGXXYDHCTVKP-UHFFFAOYSA-N 2-tert-butyl-2-[2-(4-chlorophenyl)ethyl]oxirane Chemical compound C=1C=C(Cl)C=CC=1CCC1(C(C)(C)C)CO1 QLCGXXYDHCTVKP-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000760356 Chytridiomycetes Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 240000007154 Coffea arabica Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000233654 Oomycetes Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 240000006064 Urena lobata Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000003974 aralkylamines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 235000016213 coffee Nutrition 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000036512 infertility Effects 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 230000008659 phytopathology Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 229960003351 prussian blue Drugs 0.000 description 1
- 239000013225 prussian blue Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000005068 transpiration Effects 0.000 description 1
- 238000009369 viticulture Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/50—1,3-Diazoles; Hydrogenated 1,3-diazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/647—Triazoles; Hydrogenated triazoles
- A01N43/653—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/04—Compounds containing oxirane rings containing only hydrogen and carbon atoms in addition to the ring oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/08—Compounds containing oxirane rings with hydrocarbon radicals, substituted by halogen atoms, nitro radicals or nitroso radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Plant Pathology (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3018866.0 | 1980-05-16 | ||
| DE19803018866 DE3018866A1 (de) | 1980-05-16 | 1980-05-16 | 1-hydroxyethyl-azol-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenwachstumsregulatoren und fungizide |
| DEP3106076.5 | 1981-02-19 | ||
| DE19813106076 DE3106076A1 (de) | 1981-02-19 | 1981-02-19 | 1-hydroxyethyl-azol-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenwachstumsregulatoren und fungizide |
Related Parent Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000617114A Division CA1341164C (en) | 1980-05-16 | 1981-05-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000617114A Division CA1341164C (en) | 1980-05-16 | 1981-05-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1341164C true CA1341164C (en) | 2001-01-02 |
Family
ID=25785513
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000617114A Expired - Lifetime CA1341164C (en) | 1980-05-16 | 1981-05-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
| CA000377689A Expired - Fee Related CA1341521C (en) | 1980-05-16 | 2005-08-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000377689A Expired - Fee Related CA1341521C (en) | 1980-05-16 | 2005-08-15 | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides |
Country Status (24)
| Country | Link |
|---|---|
| US (8) | US4532341A (OSRAM) |
| EP (3) | EP0087148B1 (OSRAM) |
| JP (2) | JPH02167270A (OSRAM) |
| AR (2) | AR227310A1 (OSRAM) |
| AT (3) | ATE25522T1 (OSRAM) |
| AU (3) | AU542623B2 (OSRAM) |
| BR (1) | BR8103049A (OSRAM) |
| CA (2) | CA1341164C (OSRAM) |
| DD (2) | DD205602A5 (OSRAM) |
| DE (1) | DE3164696D1 (OSRAM) |
| DK (4) | DK158152C (OSRAM) |
| EG (1) | EG14836A (OSRAM) |
| ES (1) | ES502234A0 (OSRAM) |
| FI (3) | FI73421C (OSRAM) |
| GR (1) | GR78229B (OSRAM) |
| HU (3) | HU191671B (OSRAM) |
| IE (3) | IE52450B1 (OSRAM) |
| IL (6) | IL75521A (OSRAM) |
| NL (1) | NL971022I2 (OSRAM) |
| NZ (4) | NZ197083A (OSRAM) |
| OA (1) | OA06809A (OSRAM) |
| PH (3) | PH17636A (OSRAM) |
| PT (1) | PT72979B (OSRAM) |
| TR (4) | TR22042A (OSRAM) |
Families Citing this family (198)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0158741A3 (en) * | 1980-11-19 | 1986-02-12 | Imperial Chemical Industries Plc | Intermediates for fungicidal triazole and imidazole compounds |
| CA1162540A (en) * | 1980-12-24 | 1984-02-21 | Ikutaro Saji | Imidazolylpropanol compounds and their acid addition salts, and production and use thereof |
| GR78218B (OSRAM) * | 1981-07-02 | 1984-09-26 | Ciba Geigy Ag | |
| US4435399A (en) * | 1981-07-18 | 1984-03-06 | Pfizer Inc. | 2-Aryl-1-(imidazol-1-yl)-8-(4-piperazin-1-ylphenoxy) octan-2-ol antifungal agents |
| DE3145857A1 (de) * | 1981-11-19 | 1983-05-26 | Bayer Ag, 5090 Leverkusen | Alkylcyloalkyl-triazolylmethyl-ketone und verfahreen zu ihrer herstellung |
| DE3202601A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Substituierte 1 -hydroxyalkyl-azolyl-derivate, verfahren zu ihrer herstellung sowie ihrer verwendung als fungizide und pflanzenwachstumsregulatoren |
| DE3202604A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Ether-derivate von substituierten 1-hydroxyalkyl-azolen, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und pflanzenwachstumsregulatoren |
| DE3202613A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Antimykotische mittel |
| US4940481A (en) * | 1982-03-04 | 1990-07-10 | Ciba-Geigy Corporation | Microbicidal and growth regulating compositions |
| GB8504093D0 (en) * | 1985-02-18 | 1985-03-20 | Ici Plc | Alkene alkyne/cycloalkylene derivatives |
| US5236953A (en) * | 1982-04-14 | 1993-08-17 | Imperial Chemical Industries Plc | Alkene, alkyne or cycloalkylene derivatives |
| DE3377912D1 (en) * | 1982-06-14 | 1988-10-13 | Ici Plc | Triazole compounds |
| DE3229274A1 (de) * | 1982-08-05 | 1984-02-09 | Bayer Ag, 5090 Leverkusen | Substituierte azolylvinyl-ketone und -carbinole |
| DE3232647A1 (de) * | 1982-09-02 | 1984-03-08 | Bayer Ag, 5090 Leverkusen | Substituierte tert.-butanol-derivate, verfahren zu ihrer herstellung und diese enthaltende antimykotische mittel |
| DE3237400A1 (de) * | 1982-10-08 | 1984-04-12 | Bayer Ag, 5090 Leverkusen | Substituierte 1-hydroxyethyl-triazolyl-derivate |
| US4505919A (en) * | 1982-10-09 | 1985-03-19 | Pfizer Inc. | Antifungal S-arylmethyl- and S-heterocyclylmethyl ethers of 2-aryl-3-mercapto-1-(1H-1,2,4-triazol-1-yl) propan-2-ols |
| DE3381012D1 (de) * | 1983-01-10 | 1990-02-01 | Ciba Geigy Ag | Fluorazolyl-propanol-derivate als mikrobizide und wuchsregulierende mittel. |
| EP0117100B1 (en) * | 1983-02-16 | 1986-12-10 | Pfizer Limited | Triazole antifungal agents |
| DE3307217A1 (de) * | 1983-03-02 | 1984-09-06 | Bayer Ag, 5090 Leverkusen | Substituierte 1,3-diazolyl-2-propanole, verfahren zu ihrer herstellung und ihre verwendung als antimykotische mittel |
| DE3311702A1 (de) * | 1983-03-30 | 1984-10-04 | Bayer Ag, 5090 Leverkusen | Fungizide mittel, verfahren zu ihrer herstellung und deren verwendung |
| DE3315524A1 (de) * | 1983-04-29 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von oxiranen |
| DE3315619A1 (de) * | 1983-04-29 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von oxiranen |
| DE3315510A1 (de) * | 1983-04-29 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von oxiranen |
| DE3315681A1 (de) * | 1983-04-29 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von oxiranen |
| DE3315808A1 (de) * | 1983-04-30 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Antivirale mittel |
| GB2143815B (en) * | 1983-05-19 | 1988-01-20 | Ciba Geigy Ag | Process for the preparation of micro biocidal 1-triazolylethyl ether derivatives |
| DE3321158A1 (de) * | 1983-06-11 | 1984-12-13 | Bayer Ag, 5090 Leverkusen | Azolylmethyl-thienyl-carbinol-derivate |
| DE3333412A1 (de) * | 1983-09-16 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| US5198231A (en) * | 1983-09-16 | 1993-03-30 | Bayer Aktiengesellschaft | Fungicidal agents |
| US5250560A (en) * | 1983-09-16 | 1993-10-05 | Bayer Aktiengesellschaft | Fungicidal agents |
| DE3333411A1 (de) * | 1983-09-16 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| DE3334779A1 (de) * | 1983-09-26 | 1985-04-11 | Bayer Ag, 5090 Leverkusen | Hydroxyethyl-azol-derivate |
| DE3342692A1 (de) * | 1983-11-25 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von ss-hydroxyethyl-(1,2,4-triazol)-derivaten |
| DE3401714A1 (de) * | 1984-01-19 | 1985-07-25 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Neuartige azole mit enoletherstruktur, ihre herstellung und verwendung |
| GB8406000D0 (en) * | 1984-03-07 | 1984-04-11 | Ici Plc | Olefine derivatives |
| CN1008735B (zh) * | 1984-11-02 | 1990-07-11 | 拜尔公司 | 以取代的氮杂茂基甲基-环丙基-甲醇衍生物为活性成分的组合物 |
| EP0181529B1 (de) * | 1984-11-02 | 1991-03-27 | Bayer Ag | Optisch aktives 2-(4-Chlorphenoxymethyl)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)-2-butanol, ein Verfahren zu dessen Herstellung und dessen Verwendung als Antimykotikum |
| DE3508909A1 (de) * | 1985-03-13 | 1986-09-18 | Bayer Ag, 5090 Leverkusen | Piperazinylmethyl-1,2,4-triazolylmethyl-carbinole |
| US4863505A (en) * | 1985-09-12 | 1989-09-05 | Kureha Kagaku Kogyo Kabushiki Kaisha | Novel derivative of azole, and agricultural and horticultural composition containing the same as an active incredient |
| DE3537817A1 (de) * | 1985-10-24 | 1987-04-30 | Bayer Ag | Verfahren zur herstellung von oxiranen |
| DE3540525A1 (de) * | 1985-11-15 | 1987-05-27 | Bayer Ag | Mittel zur regulierung des pflanzenwachstums |
| GB8603951D0 (en) * | 1986-02-18 | 1986-03-26 | Ici Plc | Heterocyclic compounds |
| EP0254797B1 (de) * | 1986-03-06 | 1990-07-04 | Bayer Ag | 2-Hydroxyethyl-azol-Derivate |
| DE3702301A1 (de) * | 1986-03-06 | 1987-09-10 | Bayer Ag | 2-hydroxyethyl-azol-derivate |
| US4952232A (en) * | 1987-04-29 | 1990-08-28 | E. I. Du Pont De Nemours And Company | Antifungal carbinols |
| DE3621494A1 (de) * | 1986-06-27 | 1988-01-07 | Bayer Ag | Verwendung von 1-aryl-3-hydroxy-3-alkyl-4-(1,2,4-triazol-1-yl) -butan-derivaten als mikrobizide fuer den materialschutz |
| DE3627673A1 (de) * | 1986-08-14 | 1988-02-25 | Bayer Ag | Verfahren zur herstellung optisch aktiver 2-hydroxyethyl-azol-derivate |
| JPH0625140B2 (ja) * | 1986-11-10 | 1994-04-06 | 呉羽化学工業株式会社 | 新規アゾール誘導体、その製造方法及び該誘導体の農園芸用薬剤 |
| US5239089A (en) * | 1986-11-10 | 1993-08-24 | Kureha Kagaku Kogyo Kabushiki Kaisha | Oxirane derivatives useful for making fungicidal azole compounds |
| DE3700923A1 (de) * | 1987-01-15 | 1988-07-28 | Bayer Ag | Fungizide wirkstoffkombination |
| DE3703082A1 (de) * | 1987-02-03 | 1988-08-11 | Bayer Ag | Verfahren zur herstellung optisch aktiver 2-hydroxyethyl-azol-derivate |
| DE3716558A1 (de) * | 1987-05-18 | 1988-12-01 | Bayer Ag | Hydroxyalkyl-azolyl-derivate |
| DE3716559A1 (de) * | 1987-05-18 | 1988-12-01 | Bayer Ag | Hydroxyalkyl-triazolyl-derivate |
| DE3716560A1 (de) * | 1987-05-18 | 1988-12-01 | Bayer Ag | Hydroxyalkyl-triazolyl-derivate |
| DE3812967A1 (de) * | 1987-06-24 | 1989-01-05 | Bayer Ag | Azolylmethyl-cyclopropyl-derivate |
| DE3720998A1 (de) * | 1987-06-25 | 1989-01-05 | Bayer Ag | Verwendung von 1-(4-chlorphenyl)-4,4-dimethyl-3- (1,2,4-triazol-1-yl-methyl)-pentan-3-ol zur bekaempfung von pseudocercosporella herpotrichoides |
| DE3813129A1 (de) * | 1987-07-01 | 1989-01-12 | Bayer Ag | Hydroxyethyl-azolyl-derivate |
| DE3722133A1 (de) * | 1987-07-04 | 1989-01-12 | Bayer Ag | Azolyl-tetrahydropyran-derivate |
| DE3813874A1 (de) * | 1987-07-10 | 1989-01-19 | Bayer Ag | Hydroxyalkyl-azolyl-derivate |
| DE3724645A1 (de) * | 1987-07-25 | 1989-02-02 | Basf Ag | Hydroxyethyl-azol-derivate und ihre verwendung als fungizide |
| DE3732385A1 (de) * | 1987-09-25 | 1989-04-06 | Bayer Ag | Hydroxyalkylcyclopropyl1-1,2,4-triazolyl- oder -imidazolyl-derivate und ihre verwendung als antimykotische mittel |
| DE3733754A1 (de) * | 1987-10-06 | 1989-04-20 | Bayer Ag | Verfahren zur herstellung von 1-(4-chlorphenyl)-3-(1,2,4-triazol-1-yl-methyl)-4,4-dimethyl-pentan-3-ol |
| DE3736651C2 (de) * | 1987-10-29 | 1995-11-23 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE3804981A1 (de) * | 1988-02-18 | 1989-08-31 | Bayer Ag | Substituierte triazole |
| US5266586A (en) * | 1988-02-18 | 1993-11-30 | Bayer Aktiengesellschaft | Fungicidal substituted triazoles |
| US5187178A (en) * | 1988-02-18 | 1993-02-16 | Bayer Aktiengesellschaft | Fungicidal substituted triazoles |
| DE3809069A1 (de) * | 1988-03-18 | 1989-09-28 | Basf Ag | Azolylmethylallylalkohole und diese enthaltende fungizide |
| DE3813253A1 (de) * | 1988-04-20 | 1989-11-02 | Bayer Ag | Substituierte triazolylmethylcarbinole |
| DE3823174A1 (de) * | 1988-07-08 | 1990-01-11 | Bayer Ag | Optisch aktive (1,3-oxathian-2-yl)-oxirane, ihre herstellung und verwendung als zwischenprodukte, sowie verfahren zur herstellung von optisch aktiven 2-hydroxyethyl-1,2,4-triazol-derivaten |
| DE3824434A1 (de) * | 1988-07-19 | 1990-01-25 | Bayer Ag, 51373 Leverkusen | Substituierte 1-aryl-3-cycloalkyl-4-(1,2,4-triazol-1-yl)-but-1-in-3-ole, verfahren sowie substituierte 2-arylethinyl-2-cycloalkyl-oxirane und cycloalkyl-arylethinylketone als zwischenprodukte zu ihrer herstellung, und ihre verwendung in fungiziden mitteln |
| DE3824435A1 (de) * | 1988-07-19 | 1990-01-25 | Bayer Ag, 51373 Leverkusen | Substituierte 2,2-dihalogencyclopropyl-hydroxyethyl-1,2,4-triazole, verfahren sowie 2,2-dihalogencyclopropyl-oxirane, cyclopropylketone und halogenmethyl-cyclpropyl-ketone als zwischenprodukte zu ihrer herstellung, und ihre verwendung in fungiziden mitteln |
| US4962163A (en) * | 1989-01-17 | 1990-10-09 | The Dow Chemical Company | Vinyl ester resins containing mesogenic/rigid rodlike moieties |
| US5164464A (en) * | 1989-01-17 | 1992-11-17 | The Dow Chemical Company | Vinyl ester resins containing mesogenic/rigid rodlike moieties |
| US5024785A (en) * | 1989-01-17 | 1991-06-18 | The Dow Chemical Company | Liquid crystal/rigid rodlike polymer modified epoxy/vinyl ester resins |
| DE3905316A1 (de) * | 1989-02-21 | 1990-08-23 | Bayer Ag | Cyclopropyl-hydroxyethyl-azolyl-derivate |
| DE3906556A1 (de) * | 1989-03-02 | 1990-09-06 | Desowag Materialschutz Gmbh | Mittel oder konzentrat zum konservieren von holz oder holzwerkstoffen |
| DE3906771A1 (de) * | 1989-03-03 | 1990-09-06 | Basf Ag | 1-hydroxi-1,2,4-triazolverbindungen und diese enthaltende fungizide |
| DE3910921C1 (OSRAM) | 1989-04-05 | 1990-05-17 | Bayer Ag, 5090 Leverkusen, De | |
| DE3910922C1 (OSRAM) * | 1989-04-05 | 1990-05-17 | Bayer Ag, 5090 Leverkusen, De | |
| DE3921163A1 (de) * | 1989-06-28 | 1991-01-10 | Bayer Ag | Hydroxy-keto-azole |
| DE3934714A1 (de) * | 1989-10-18 | 1991-04-25 | Bayer Ag | Fungizide wirkstoffkombinationen |
| DE4001115A1 (de) * | 1990-01-17 | 1991-07-18 | Bayer Ag | Fungizide wirkstoffkombinationen |
| FR2662911B1 (fr) * | 1990-06-12 | 1996-12-13 | Rhone Poulenc Agrochimie | Procede pour proteger les produits de multiplication des vegetaux et les vegetaux en resultant au moyen d'un triazolyl cyclopentanol. |
| DE4018927A1 (de) * | 1990-06-13 | 1991-12-19 | Bayer Ag | Azolyl-propanol-derivate |
| US5230892A (en) * | 1990-08-24 | 1993-07-27 | Bayer Aktiengesellschaft | Solid formulations |
| FR2668893A1 (fr) * | 1990-11-13 | 1992-05-15 | Rhone Poulenc Agrochimie | Procede pour proteger les produits de multiplication des vegetaux a l'aide de triazolyl ou imidazolyl methyl allyl alcool et composes nouveaux pour mettre en óoeuvre le procede. |
| DK0487451T3 (da) * | 1990-11-16 | 1996-05-06 | Ciba Geigy Ag | Mikrobicide midler |
| DE4113158A1 (de) * | 1991-04-23 | 1992-10-29 | Bayer Ag | Mikrobizide wirkstoffkombinationen |
| DE4131205A1 (de) * | 1991-09-19 | 1993-03-25 | Bayer Ag | Wasserbasierte, loesungsmittel- und emulgatorfreie mikrobizide wirkstoffkombination |
| DE59206041D1 (de) * | 1991-12-19 | 1996-05-23 | Ciba Geigy Ag | Mikrobizide |
| DK0556157T3 (da) * | 1992-02-13 | 1998-08-10 | Novartis Ag | Fungicide blandinger på basis af triazol-fungicider og et 4,6-dimethyl-N-phenyl-2-pyrimidinamin. |
| FR2690441A1 (fr) * | 1992-04-08 | 1993-10-29 | Rhone Poulenc Agrochimie | Nouveaux dérivés triazole et imidazole fongicides. |
| FR2694161B1 (fr) * | 1992-07-31 | 1995-06-09 | Shell Int Research | Compositions fongicides comprenant un derive de 1-hydroxyethyl azole et un alkoxylate d'un alcool aliphatique. |
| DE4300452A1 (de) * | 1993-01-11 | 1994-07-14 | Bayer Ag | Mittel zur Hemmung des Pflanzenwachstums |
| DE4304172A1 (de) | 1993-02-12 | 1994-08-25 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| EP0613890A1 (en) * | 1993-02-28 | 1994-09-07 | Nihon Nohyaku Co., Ltd. | Novel triazole compound, process for preparing the same and antifungal agent containing the same |
| CA2171754A1 (en) * | 1993-09-16 | 1995-03-23 | Michael Lindemann | Butenol-triazolyl derivatives, their manufacture and use as microbicides |
| ES2085812T3 (es) * | 1993-09-24 | 1996-06-01 | Basf Ag | Mezclas fungicidas. |
| DE4412332A1 (de) * | 1994-04-11 | 1995-10-12 | Bayer Ag | Silyloxy-cyclopropyl-azolyl-Derivate |
| TW286264B (OSRAM) | 1994-05-20 | 1996-09-21 | Ciba Geigy Ag | |
| DE4426753A1 (de) * | 1994-07-28 | 1996-02-01 | Bayer Ag | Mittel zur Bekämpfung von Pflanzenschädlingen |
| US5591726A (en) * | 1994-09-26 | 1997-01-07 | American Cyanamid Company | Heterocyclylalkyl diarylboron ester and thioester fungicidal agents |
| DE19505938A1 (de) * | 1995-02-21 | 1996-08-22 | Bayer Ag | Verfahren zur Herstellung von 1-(4-Chlorphenyl)-4,4-dimethyl-pentan-3-on |
| DE19617282A1 (de) * | 1996-04-30 | 1997-11-06 | Bayer Ag | Triazolyl-mercaptide |
| DE19617461A1 (de) * | 1996-05-02 | 1997-11-06 | Bayer Ag | Acylmercapto-triazolyl-Derivate |
| DE19619544A1 (de) | 1996-05-15 | 1997-11-20 | Bayer Ag | Triazolyl-Disulfide |
| DE19620408A1 (de) * | 1996-05-21 | 1997-11-27 | Bayer Ag | Mercapto-imidazolyl-Derivate |
| DE19620407A1 (de) * | 1996-05-21 | 1997-11-27 | Bayer Ag | Thiocyano-triazolyl-Derivate |
| DE19620590A1 (de) * | 1996-05-22 | 1997-11-27 | Bayer Ag | Sulfonyl-mercapto-triazolyl-Derivate |
| US6297236B1 (en) | 1998-04-06 | 2001-10-02 | Bayer Aktiengesellschaft | Fungicide active substance combinations |
| DE19716257A1 (de) | 1997-04-18 | 1998-10-22 | Bayer Ag | Fungizide Wirkstoffkombination |
| AU751267B2 (en) | 1997-06-30 | 2002-08-08 | Monsanto Technology Llc | Microparticles containing agricultural active ingredients |
| DE19829113A1 (de) | 1998-06-10 | 1999-12-16 | Bayer Ag | Mittel zur Bekämpfung von Pflanzenschädlingen |
| ES2252948T3 (es) | 1998-06-10 | 2006-05-16 | Bayer Cropscience Ag | Agentes para la lucha contra las pestes de las plantas. |
| HK1039034B (zh) * | 1998-06-17 | 2005-07-22 | 拜尔公司 | 防治植物害蟲的組合物 |
| DE19834028A1 (de) | 1998-07-28 | 2000-02-03 | Wolman Gmbh Dr | Verfahren zur Behandlung von Holz gegen den Befall durch holzschädigende Pilze |
| ES2151847B1 (es) * | 1998-10-07 | 2001-08-16 | Rodriguez Juan Carlos Caubin | Util para orinar las mujeres. |
| AU2164101A (en) | 1999-12-13 | 2001-06-25 | Bayer Aktiengesellschaft | Fungicidal combinations of active substances |
| DE10019758A1 (de) | 2000-04-20 | 2001-10-25 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10103832A1 (de) * | 2000-05-11 | 2001-11-15 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10049804A1 (de) * | 2000-10-09 | 2002-04-18 | Bayer Ag | Wirkstoffkombinationen mit fungiziden und akariziden Eigenschaften |
| DE10059605A1 (de) | 2000-12-01 | 2002-06-06 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| CZ304590B6 (cs) * | 2001-04-12 | 2014-07-23 | Basf Se | Kombinace aktivních látek zlepšující růst kořenů |
| DE10141618A1 (de) * | 2001-08-24 | 2003-03-06 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| JP2005527568A (ja) * | 2002-04-05 | 2005-09-15 | ビーエーエスエフ アクチェンゲゼルシャフト | ベンズアミドキシム誘導体とアゾールに基づく殺真菌性混合物 |
| DE10228104A1 (de) * | 2002-06-24 | 2004-01-15 | Bayer Cropscience Ag | Fungizide Wirkstoffkombination |
| EP1611789B1 (de) * | 2002-07-10 | 2007-10-17 | Basf Aktiengesellschaft | Fungizide Mischungen auf Basis von Dithianon |
| DK1531675T3 (da) * | 2002-08-19 | 2007-07-30 | Basf Ag | Midler, som indeholder carboxylsyre, og deres anvendelse i plantedyrkning |
| ATE404058T1 (de) | 2002-11-12 | 2008-08-15 | Basf Se | Verfahren zur ertragssteigerung bei glyphosate resistenten leguminosen |
| DE10333373A1 (de) * | 2003-07-23 | 2005-02-10 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10335183A1 (de) * | 2003-07-30 | 2005-02-24 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| DE10341945A1 (de) * | 2003-09-11 | 2005-04-21 | Bayer Cropscience Ag | Verwendung von fungiziden Mitteln zur Beizung von Saatgut |
| RS20060219A (en) * | 2003-10-01 | 2008-08-07 | Basf Aktiengesellschaft, | Fungicidal mixtures |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349503A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| EP1563731A1 (en) | 2004-02-12 | 2005-08-17 | Bayer CropScience S.A. | Fungicidal composition comprising a pyridylethylbenzamide derivative and a compound capable of inhibiting the ergosterol biosynthesis |
| BRPI0509124A (pt) | 2004-04-30 | 2007-08-28 | Basf Ag | misturas fungicidas, agentes, processo para combater fungos nocivos, semente, e, uso de um composto |
| DE102004049761A1 (de) | 2004-10-12 | 2006-04-13 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| DE102005015677A1 (de) * | 2005-04-06 | 2006-10-12 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102005015850A1 (de) | 2005-04-07 | 2006-10-12 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| ATE484194T1 (de) | 2005-06-09 | 2010-10-15 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| WO2007009775A2 (en) | 2005-07-21 | 2007-01-25 | Syngenta Participations Ag | Fungicidal compositions comprising tebuconazole |
| DE102005035300A1 (de) * | 2005-07-28 | 2007-02-01 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| CN101262765B (zh) | 2005-09-09 | 2012-01-18 | 巴斯夫欧洲公司 | 三唑基杀真菌混合物 |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| JP2009544609A (ja) * | 2006-07-18 | 2009-12-17 | アストラゼネカ・アクチエボラーグ | 置換2−アセチルアミノ−アルコキシフェニルの製造方法 |
| EP2489266A3 (en) | 2006-09-18 | 2012-10-24 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| US7772156B2 (en) * | 2006-11-01 | 2010-08-10 | Buckman Laboratories International, Inc. | Microbicidal compositions including a cyanodithiocarbimate and a second microbicide, and methods of using the same |
| BRPI0719724A2 (pt) | 2006-12-07 | 2014-02-18 | Basf Se | Composição, uso da composição, kit, uso de um kit, uso de composto, e, método para proteger uma planta contra fungos nocivos |
| WO2008071714A1 (en) | 2006-12-15 | 2008-06-19 | Rohm And Haas Company | Mixtures comprising 1-methylcyclopropene |
| EP2679095A1 (en) | 2007-02-06 | 2014-01-01 | Basf Se | Pesticidal mixtures |
| EP2392662A3 (en) | 2007-04-23 | 2012-03-14 | Basf Se | Plant productivity enhancement by combining chemical agents with transgenic modifications |
| DK2196089T3 (da) | 2007-04-25 | 2011-06-06 | Syngenta Participations Ag | Fungicidsammensætninger |
| EP2000028A1 (de) * | 2007-06-06 | 2008-12-10 | Bayer CropScience Aktiengesellschaft | Fungizide Wirkstoffkombinationen |
| EP2205082B1 (en) | 2007-09-26 | 2012-04-04 | Basf Se | Ternary fungicidal compositions comprising boscalid and chlorothalonil |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| GB0823002D0 (en) * | 2008-12-17 | 2009-01-28 | Syngenta Participations Ag | Isoxazoles derivatives with plant growth regulating properties |
| EP2100506A2 (en) | 2009-01-23 | 2009-09-16 | Bayer CropScience AG | Uses of fluopyram |
| AU2009342807B2 (en) | 2009-03-25 | 2015-04-02 | Bayer Cropscience Aktiengesellschaft | Synergistic combinations of active ingredients |
| US20120088664A1 (en) | 2009-06-18 | 2012-04-12 | Basf Se | Antifungal 1,2,4-triazolyl derivatives having a 5-sulfur subtituent |
| BR112012000245A8 (pt) | 2009-07-08 | 2016-06-21 | Bayer Cropscience Ag | Derivados de fenil (oxi/tio) alcanol. |
| JP5792164B2 (ja) * | 2009-07-08 | 2015-10-07 | バイエル・インテレクチュアル・プロパティ・ゲゼルシャフト・ミット・ベシュレンクテル・ハフツングBayer Intellectual Property GmbH | 置換フェニル(オキシ/チオ)アルカノール誘導体 |
| JP5642786B2 (ja) | 2009-07-16 | 2014-12-17 | バイエル・クロップサイエンス・アーゲーBayer Cropscience Ag | フェニルトリアゾール類を含む相乗的活性化合物組み合わせ |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| WO2011076724A2 (en) * | 2009-12-23 | 2011-06-30 | Bayer Cropscience Ag | Pesticidal compound mixtures |
| WO2011140620A1 (pt) * | 2010-05-12 | 2011-11-17 | Empresa Brasileira De Pesquisa Agropecuária - Embrapa | Processo de produção, uso e composição fungicida compreendendo compostos obtidos a partir do líquido da casca da castanha de caju |
| AU2011295083A1 (en) | 2010-08-26 | 2013-03-21 | Bayer Intellectual Property Gmbh | 5-iodo-triazole derivatives |
| BRPI1003373A2 (pt) | 2010-09-29 | 2013-01-29 | Fmc Quimica Do Brasil Ltda | combinaÇÕes sinÉrgicas de triazàis, estrobirulinas e benzimidazàis, usos, formulaÇÕes, processos de produÇço e aplicaÇÕes utilizando a mesma |
| EP2646418B1 (de) | 2010-11-30 | 2017-10-04 | Bayer Intellectual Property GmbH | Pyrimidin-derivate und ihre verwendung als schädlingsbekämpfungsmittel |
| AU2011347752A1 (en) | 2010-12-20 | 2013-07-11 | Basf Se | Pesticidal active mixtures comprising pyrazole compounds |
| RU2013133873A (ru) | 2010-12-21 | 2015-01-27 | БАЙЕР КРОПСАЙЕНС ЭлПи | ШЕРОХОВАТЫЕ МУТАНТЫ Bacillus И СПОСОБЫ ИХ ПРИМЕНЕНИЯ ДЛЯ УСКОРЕНИЯ РОСТА РАСТЕНИЙ, УЛУЧШЕНИЯ ЗДОРОВЬЯ РАСТЕНИЙ И БОРЬБЫ С БОЛЕЗНЯМИ И ВРЕДИТЕЛЯМИ |
| EP2481284A3 (en) | 2011-01-27 | 2012-10-17 | Basf Se | Pesticidal mixtures |
| ES2660555T3 (es) | 2011-03-23 | 2018-03-22 | Basf Se | Composiciones que contienen compuestos iónicos, poliméricos que comprenden grupos imidazolio |
| AR085588A1 (es) | 2011-04-13 | 2013-10-09 | Bayer Cropscience Ag | Combinaciones de compuestos activos |
| AR085587A1 (es) | 2011-04-13 | 2013-10-09 | Bayer Cropscience Ag | Combinaciones de compuestos activos |
| US20140200136A1 (en) | 2011-09-02 | 2014-07-17 | Basf Se | Agricultural mixtures comprising arylquinazolinone compounds |
| EP2755485A1 (en) | 2011-09-12 | 2014-07-23 | Bayer Cropscience LP | Methods of enhancing health and/or promoting growth of a plant and/or of improving fruit ripening |
| CN104039146A (zh) * | 2011-11-25 | 2014-09-10 | 拜耳知识产权有限责任公司 | 2-碘代咪唑衍生物 |
| BR122019015109B1 (pt) | 2012-06-20 | 2020-04-07 | Basf Se | mistura pesticida, composição, composição agrícola, métodos para o combate ou controle das pragas de invertebrados, para a proteção dos vegetais em crescimento ou dos materias de propagação vegetal, para a proteção de material de propagação vegetal e uso de uma mistura pesticida |
| WO2014056780A1 (en) | 2012-10-12 | 2014-04-17 | Basf Se | A method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| US10759767B2 (en) | 2012-12-20 | 2020-09-01 | BASF Agro B.V. | Compositions comprising a triazole compound |
| EP2746257A1 (en) | 2012-12-21 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2746258A1 (en) | 2012-12-21 | 2014-06-25 | Basf Se | Substituted [1,2,4]triazole and imidazole compounds |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| EP2837287A1 (en) | 2013-08-15 | 2015-02-18 | Bayer CropScience AG | Use of prothioconazole for increasing root growth of Brassicaceae |
| WO2015032692A1 (de) | 2013-09-03 | 2015-03-12 | Bayer Cropscience Ag | Verwendung fungizider wirkstoffe zur kontrolle von chalara fraxinea an eschenbäumen |
| EP3046915A1 (en) | 2013-09-16 | 2016-07-27 | Basf Se | Fungicidal pyrimidine compounds |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| JP2017538860A (ja) | 2014-10-24 | 2017-12-28 | ビーエーエスエフ ソシエタス・ヨーロピアBasf Se | 固体粒子の表面荷電を改変するための、非両性の四級化可能な水溶性ポリマー |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
| AU2016287098A1 (en) | 2015-07-02 | 2018-01-25 | BASF Agro B.V. | Pesticidal compositions comprising a triazole compound |
| WO2017072013A1 (en) | 2015-10-27 | 2017-05-04 | Bayer Cropscience Aktiengesellschaft | Composition comprising a safener, a fungicide and metalaxyl |
| US20190218187A1 (en) | 2016-09-29 | 2019-07-18 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazolylmethyl derivatives |
| PH12023550202A1 (en) | 2020-07-30 | 2024-06-24 | Pi Industries Ltd | Composition of metominostrobin, tebuconazole and propineb |
Family Cites Families (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3188324A (en) * | 1958-11-19 | 1965-06-08 | Sinclair Research Inc | Neopentyl-substituted epoxy alcohols and chlorides |
| DE1568414A1 (de) * | 1965-09-23 | 1970-04-02 | Dow Chemical Co | Verfahren zur Herstellung von Epoxyden aus Sulfoniumsalzen |
| DE1595582A1 (de) * | 1966-01-07 | 1970-04-30 | Hoechst Ag | Verfahren zur Herstellung von Polyaethern |
| US3410810A (en) * | 1966-05-03 | 1968-11-12 | Goodrich Co B F | Polymers of cyanoalkyl epoxy ethers |
| US3930835A (en) * | 1970-08-06 | 1976-01-06 | The Dow Chemical Company | Pesticidal compositions and methods employing substituted oxirane compounds |
| DE2354444A1 (de) * | 1973-10-31 | 1975-05-07 | Merck Patent Gmbh | Biphenylylaether und verfahren zu ihrer herstellung |
| US4000131A (en) * | 1974-05-10 | 1976-12-28 | Hoffmann-La Roche Inc. | Process for preparing epoxide-cyclohexyl compound and resultant compound |
| DE2423987C2 (de) * | 1974-05-17 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von Azolyläthern, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2431407C2 (de) * | 1974-06-29 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | 1,2,4-Triazol-1-yl-alkanone und -alkanole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| EG11779A (en) * | 1974-11-19 | 1978-06-30 | Janssen Pharmaceutica Nv | Process for preparing of 1-(b-aryl-b-(r-oxy)-ethyl)imidazoles |
| US4085209A (en) * | 1975-02-05 | 1978-04-18 | Rohm And Haas Company | Preparation and safening effect of 1-substituted imidazole metal salt complexes |
| CH614201A5 (en) * | 1975-04-11 | 1979-11-15 | Hoffmann La Roche | Process for the preparation of epoxides |
| FI761174A7 (OSRAM) * | 1975-05-05 | 1976-11-06 | Erba Carlo Spa | |
| US4079143A (en) * | 1975-08-26 | 1978-03-14 | Imperial Chemical Industries Limited | Fungicidal 1H-1,2,4-triazoles |
| IE44186B1 (en) * | 1975-12-03 | 1981-09-09 | Ici Ltd | 1,2,4-triazolyl alkanols and their use as pesticides |
| DE2623129C3 (de) * | 1976-05-22 | 1980-04-10 | Nordmark-Werke Gmbh, 2000 Hamburg | U-Diphenyl-3-(imidazol-l-yl) -propan-2-ole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| FR2370432A1 (fr) * | 1976-11-16 | 1978-06-09 | Ici Ltd | Procede pour influencer la croissance des vegetaux par l'action de certains composes 1,2,4-triazoliques |
| US4123542A (en) * | 1977-01-19 | 1978-10-31 | Syntex (U.S.A.) Inc. | Derivatives of N-alkyl imidazoles |
| US4366165A (en) * | 1977-05-19 | 1982-12-28 | Rohm And Haas Company | 1 and 4-Arylcyanoalkyl-1,2,4-triazoles and fungicidal use |
| DE2736122A1 (de) * | 1977-08-11 | 1979-02-22 | Basf Ag | Fungizide |
| US4246274A (en) * | 1978-05-10 | 1981-01-20 | Bayer Aktiengesellschaft | Antimycotic hydroxypropyl-imidazoles |
| DE2851086A1 (de) * | 1978-11-25 | 1980-06-04 | Bayer Ag | Hydroxypropyl-triazole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2908378A1 (de) * | 1979-03-03 | 1980-09-11 | Hoechst Ag | Derivate des 1,2,4-triazols |
| US4551469A (en) * | 1979-03-07 | 1985-11-05 | Imperial Chemical Industries Plc | Antifungal triazole ethanol derivatives |
| US4654332A (en) * | 1979-03-07 | 1987-03-31 | Imperial Chemical Industries Plc | Heterocyclic compounds |
| DE2920374A1 (de) * | 1979-05-19 | 1980-11-20 | Bayer Ag | Fungizide mittel, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| US4414210A (en) * | 1979-10-02 | 1983-11-08 | Rohm And Haas Company | 2-Hydroxyarylethyltriazole fungicides |
| EP0158741A3 (en) * | 1980-11-19 | 1986-02-12 | Imperial Chemical Industries Plc | Intermediates for fungicidal triazole and imidazole compounds |
| US4398942A (en) * | 1980-12-22 | 1983-08-16 | Rohm And Haas Company | Herbicidally-active phenylacetonitriles |
| CA1162540A (en) * | 1980-12-24 | 1984-02-21 | Ikutaro Saji | Imidazolylpropanol compounds and their acid addition salts, and production and use thereof |
| DE3102588A1 (de) * | 1981-01-27 | 1982-08-12 | Bayer Ag, 5090 Leverkusen | Mittel zur hemmung des pflanzenwachstums |
| EP0061835B1 (en) * | 1981-03-18 | 1989-02-01 | Imperial Chemical Industries Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and fungicidal compositions containing them |
| DE3111238A1 (de) * | 1981-03-21 | 1982-10-07 | Bayer Ag, 5090 Leverkusen | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
| EP0078594B1 (en) * | 1981-08-19 | 1987-01-14 | Imperial Chemical Industries Plc | Triazole derivatives, processes for preparing them, compositions containing them and processes for combating fungi and regulating plant growth |
| GB2130322B (en) * | 1982-09-17 | 1987-04-08 | Nissin Kogyo Kk | Vehicle load dependent braking |
| DE3237400A1 (de) * | 1982-10-08 | 1984-04-12 | Bayer Ag, 5090 Leverkusen | Substituierte 1-hydroxyethyl-triazolyl-derivate |
-
1981
- 1981-04-13 AU AU69456/81A patent/AU542623B2/en not_active Expired
- 1981-05-02 AT AT82108279T patent/ATE25522T1/de not_active IP Right Cessation
- 1981-05-02 AT AT81103322T patent/ATE8391T1/de active
- 1981-05-02 EP EP83101614A patent/EP0087148B1/de not_active Expired
- 1981-05-02 EP EP82108279A patent/EP0072580B1/de not_active Expired
- 1981-05-02 DE DE8181103322T patent/DE3164696D1/de not_active Expired
- 1981-05-02 EP EP81103322A patent/EP0040345B1/de not_active Expired
- 1981-05-02 AT AT83101614T patent/ATE18666T1/de not_active IP Right Cessation
- 1981-05-06 PT PT72979A patent/PT72979B/pt unknown
- 1981-05-11 PH PH25615A patent/PH17636A/en unknown
- 1981-05-12 EG EG259/81A patent/EG14836A/xx active
- 1981-05-13 NZ NZ197083A patent/NZ197083A/en unknown
- 1981-05-13 IL IL75521A patent/IL75521A/xx not_active IP Right Cessation
- 1981-05-13 IL IL75519A patent/IL75519A/xx not_active IP Right Cessation
- 1981-05-13 FI FI811472A patent/FI73421C/fi not_active IP Right Cessation
- 1981-05-13 DK DK213081A patent/DK158152C/da not_active IP Right Cessation
- 1981-05-13 FI FI861230A patent/FI861230A7/fi not_active Application Discontinuation
- 1981-05-13 IL IL62863A patent/IL62863A/xx not_active IP Right Cessation
- 1981-05-13 NZ NZ207096A patent/NZ207096A/en unknown
- 1981-05-13 DD DD81244788A patent/DD205602A5/de not_active IP Right Cessation
- 1981-05-13 DD DD81229911A patent/DD158847A5/de not_active IP Right Cessation
- 1981-05-13 NZ NZ207097A patent/NZ207097A/xx unknown
- 1981-05-13 NZ NZ209126A patent/NZ209126A/en unknown
- 1981-05-14 ES ES502234A patent/ES502234A0/es active Granted
- 1981-05-14 TR TR22042A patent/TR22042A/xx unknown
- 1981-05-14 GR GR64959A patent/GR78229B/el unknown
- 1981-05-14 TR TR2532/84A patent/TR22396A/xx unknown
- 1981-05-14 TR TR2530/84A patent/TR22691A/xx unknown
- 1981-05-14 TR TR2531/84A patent/TR22400A/xx unknown
- 1981-05-15 OA OA57402A patent/OA06809A/xx unknown
- 1981-05-15 HU HU842227A patent/HU191671B/hu not_active IP Right Cessation
- 1981-05-15 AR AR285338A patent/AR227310A1/es active
- 1981-05-15 IE IE1093/81A patent/IE52450B1/en not_active IP Right Cessation
- 1981-05-15 HU HU842226A patent/HU191148B/hu not_active IP Right Cessation
- 1981-05-15 IE IE958/86A patent/IE52452B1/en unknown
- 1981-05-15 IE IE957/86A patent/IE52451B1/en unknown
- 1981-05-15 BR BRPI8103049-5A patent/BR8103049A/pt not_active IP Right Cessation
- 1981-05-15 HU HU811362A patent/HU188092B/hu unknown
- 1981-05-15 CA CA000617114A patent/CA1341164C/en not_active Expired - Lifetime
-
1982
- 1982-05-11 AR AR289367A patent/AR229527A1/es active
- 1982-11-09 PH PH28114A patent/PH25843A/en unknown
-
1983
- 1983-05-31 PH PH28986A patent/PH25782A/en unknown
- 1983-06-06 US US06/499,679 patent/US4532341A/en not_active Expired - Lifetime
- 1983-11-08 US US06/549,867 patent/US4897107A/en not_active Expired - Lifetime
-
1984
- 1984-06-18 US US06/621,968 patent/US4723984A/en not_active Expired - Lifetime
- 1984-12-04 AU AU36292/84A patent/AU556515B2/en not_active Ceased
- 1984-12-04 AU AU36293/84A patent/AU560022B2/en not_active Ceased
-
1985
- 1985-01-28 US US06/695,610 patent/US4626595A/en not_active Expired - Lifetime
- 1985-02-06 DK DK54285A patent/DK54285A/da not_active Application Discontinuation
- 1985-02-06 DK DK54385A patent/DK54385A/da not_active Application Discontinuation
- 1985-02-06 DK DK054185A patent/DK163507C/da not_active IP Right Cessation
- 1985-05-08 US US06/732,193 patent/US4871390A/en not_active Expired - Fee Related
- 1985-05-08 US US06/732,191 patent/US4911746A/en not_active Expired - Fee Related
- 1985-05-08 US US06/732,194 patent/US4789672A/en not_active Expired - Fee Related
- 1985-06-14 IL IL75520A patent/IL75520A0/xx not_active IP Right Cessation
- 1985-06-14 IL IL75519A patent/IL75519A0/xx unknown
- 1985-06-14 IL IL75521A patent/IL75521A0/xx unknown
-
1986
- 1986-03-21 FI FI861206A patent/FI75817C/fi not_active IP Right Cessation
-
1987
- 1987-06-05 US US07/058,479 patent/US4904298A/en not_active Expired - Lifetime
-
1989
- 1989-11-22 JP JP1302308A patent/JPH02167270A/ja active Granted
- 1989-11-22 JP JP1302307A patent/JPH02167273A/ja active Granted
-
1997
- 1997-07-24 NL NL971022C patent/NL971022I2/nl unknown
-
2005
- 2005-08-15 CA CA000377689A patent/CA1341521C/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1341164C (en) | 1-hydroxyethyl-azole derivatives, a process for their preparation and their use as plant growth regulators and fungicides | |
| US4990677A (en) | Fungicidal and plant growth-regulating azolylmethyl-cyclopropyl derivatives | |
| US4734126A (en) | Fungicidal and plant growth-regulating novel substituted 1-hydroxyalkyl-azolyl derivatives | |
| US5141553A (en) | Ether derivatives of substituted 1-hydroxyalkyl-azoles as fungicides and plant growth regulators | |
| US4960453A (en) | Hydroxyalkyl-azolyl derivatives as fungicides and plant growth regulators | |
| IE49397B1 (en) | 1-vinyltriazole derivatives,processes for their preparation and their use as growth regulators and fungicides | |
| US4729783A (en) | Halogenated triazolylvinyl keto and carbinol compounds and plant growth regulant and fungicidal compositions | |
| CA1185608A (en) | Azolyl-alkenones and -ols, a process for their preparation, and their use as plant-growth regulators and fungicides | |
| US4507141A (en) | Triazolylalkyl-thioether plant growth regulators and fungicides | |
| IE51123B1 (en) | Substituted triazolylmethyl-tert.-butyl-carbinols,a process for their preparation and their use as plant protection agents and as intermediate products | |
| US4515617A (en) | Benzyl-pyrimidinylalkyl-ethers as plant growth regulators and fungicides, and corresponding pyrimidinylcarbinols | |
| US4530715A (en) | Cycloalkyl (α-triazolyl-β-hydroxy)-ketones as fungicides and plant growth regulators | |
| US4888048A (en) | Fungicidal and plant growth-regulating azolyl-tetrahydropyran derivatives | |
| US4954162A (en) | Azolymethyl-cyclopropyl carbinol derivatives | |
| US4988383A (en) | Fungicidal and plant growth-regulating cyclopropyl-hydroxyethyl-azolyl-derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |
Effective date: 20180102 |