CA1133164A - Toughened thermoplastic polyamide matrix with micron sized dispersed soft polymer - Google Patents
Toughened thermoplastic polyamide matrix with micron sized dispersed soft polymerInfo
- Publication number
- CA1133164A CA1133164A CA253,067A CA253067A CA1133164A CA 1133164 A CA1133164 A CA 1133164A CA 253067 A CA253067 A CA 253067A CA 1133164 A CA1133164 A CA 1133164A
- Authority
- CA
- Canada
- Prior art keywords
- polymer
- carbon atoms
- percent
- taken
- class consisting
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000642 polymer Polymers 0.000 title claims abstract description 276
- 239000011159 matrix material Substances 0.000 title claims abstract description 114
- 229920006345 thermoplastic polyamide Polymers 0.000 title description 2
- 239000000203 mixture Substances 0.000 claims abstract description 217
- 239000004952 Polyamide Substances 0.000 claims abstract description 143
- 229920002647 polyamide Polymers 0.000 claims abstract description 137
- 229920005989 resin Polymers 0.000 claims abstract description 72
- 239000011347 resin Substances 0.000 claims abstract description 72
- 239000002245 particle Substances 0.000 claims abstract description 40
- 229920001169 thermoplastic Polymers 0.000 claims abstract description 21
- 239000004416 thermosoftening plastic Substances 0.000 claims abstract description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 126
- 239000000178 monomer Substances 0.000 claims description 103
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 80
- 239000005977 Ethylene Substances 0.000 claims description 80
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 69
- 229920001577 copolymer Polymers 0.000 claims description 48
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 44
- -1 vinylidene halides Chemical class 0.000 claims description 44
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 40
- 238000000034 method Methods 0.000 claims description 36
- 239000002253 acid Substances 0.000 claims description 34
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims description 32
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 29
- 238000006386 neutralization reaction Methods 0.000 claims description 29
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 24
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 claims description 24
- 150000002148 esters Chemical class 0.000 claims description 24
- 230000008569 process Effects 0.000 claims description 23
- 150000003839 salts Chemical class 0.000 claims description 23
- 229910021645 metal ion Inorganic materials 0.000 claims description 22
- 239000000155 melt Substances 0.000 claims description 21
- 229910052751 metal Inorganic materials 0.000 claims description 21
- 239000002184 metal Substances 0.000 claims description 21
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 20
- 150000008064 anhydrides Chemical class 0.000 claims description 20
- 239000001530 fumaric acid Substances 0.000 claims description 20
- XLYMOEINVGRTEX-UHFFFAOYSA-N fumaric acid monoethyl ester Natural products CCOC(=O)C=CC(O)=O XLYMOEINVGRTEX-UHFFFAOYSA-N 0.000 claims description 20
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 19
- 150000007513 acids Chemical class 0.000 claims description 18
- 150000001298 alcohols Chemical class 0.000 claims description 17
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 17
- BAPJBEWLBFYGME-UHFFFAOYSA-N acrylic acid methyl ester Natural products COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims description 16
- 150000001412 amines Chemical class 0.000 claims description 16
- 150000001735 carboxylic acids Chemical class 0.000 claims description 16
- 150000002118 epoxides Chemical class 0.000 claims description 16
- 239000011976 maleic acid Substances 0.000 claims description 15
- PRBHEGAFLDMLAL-GQCTYLIASA-N (4e)-hexa-1,4-diene Chemical compound C\C=C\CC=C PRBHEGAFLDMLAL-GQCTYLIASA-N 0.000 claims description 14
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 14
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 238000002844 melting Methods 0.000 claims description 12
- 230000008018 melting Effects 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 229920002554 vinyl polymer Polymers 0.000 claims description 12
- XLYMOEINVGRTEX-ARJAWSKDSA-N Ethyl hydrogen fumarate Chemical compound CCOC(=O)\C=C/C(O)=O XLYMOEINVGRTEX-ARJAWSKDSA-N 0.000 claims description 11
- SJYNFBVQFBRSIB-UHFFFAOYSA-N norbornadiene Chemical compound C1=CC2C=CC1C2 SJYNFBVQFBRSIB-UHFFFAOYSA-N 0.000 claims description 11
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 10
- 229920002302 Nylon 6,6 Polymers 0.000 claims description 10
- 239000007795 chemical reaction product Substances 0.000 claims description 10
- 150000001923 cyclic compounds Chemical class 0.000 claims description 10
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 10
- 229920002292 Nylon 6 Polymers 0.000 claims description 9
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 9
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 9
- 239000000470 constituent Substances 0.000 claims description 9
- 229920001567 vinyl ester resin Polymers 0.000 claims description 9
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 claims description 8
- 150000001252 acrylic acid derivatives Chemical class 0.000 claims description 8
- 150000002430 hydrocarbons Chemical group 0.000 claims description 8
- 150000002825 nitriles Chemical class 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 6
- 239000011575 calcium Substances 0.000 claims description 6
- 150000004985 diamines Chemical class 0.000 claims description 6
- 229920000570 polyether Polymers 0.000 claims description 6
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 5
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 5
- 229910052791 calcium Inorganic materials 0.000 claims description 5
- 125000005442 diisocyanate group Chemical group 0.000 claims description 5
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 5
- 239000003381 stabilizer Substances 0.000 claims description 5
- 239000003086 colorant Substances 0.000 claims description 4
- 229920002635 polyurethane Polymers 0.000 claims description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims description 3
- 150000002009 diols Chemical class 0.000 claims description 3
- 239000003365 glass fiber Substances 0.000 claims description 3
- 229910052744 lithium Inorganic materials 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 229920005604 random copolymer Polymers 0.000 claims description 3
- 238000010008 shearing Methods 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 2
- 239000012764 mineral filler Substances 0.000 claims description 2
- 229920000728 polyester Polymers 0.000 claims description 2
- 229940093470 ethylene Drugs 0.000 claims 11
- 125000000217 alkyl group Chemical group 0.000 claims 10
- 125000003118 aryl group Chemical group 0.000 claims 7
- 150000002763 monocarboxylic acids Chemical class 0.000 claims 7
- 239000000306 component Substances 0.000 claims 6
- 125000005907 alkyl ester group Chemical group 0.000 claims 4
- 229920006029 tetra-polymer Polymers 0.000 claims 4
- 239000004814 polyurethane Substances 0.000 claims 3
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 claims 2
- 230000002730 additional effect Effects 0.000 claims 2
- 125000005250 alkyl acrylate group Chemical group 0.000 claims 2
- 238000006482 condensation reaction Methods 0.000 claims 2
- 235000007686 potassium Nutrition 0.000 claims 2
- 229960003975 potassium Drugs 0.000 claims 2
- 229940095050 propylene Drugs 0.000 claims 2
- 230000002787 reinforcement Effects 0.000 claims 1
- 239000000463 material Substances 0.000 abstract description 18
- 230000009467 reduction Effects 0.000 abstract description 2
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 30
- 229920001778 nylon Polymers 0.000 description 28
- 239000004677 Nylon Substances 0.000 description 27
- 230000001464 adherent effect Effects 0.000 description 18
- 229920001971 elastomer Polymers 0.000 description 18
- 229920005601 base polymer Polymers 0.000 description 17
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 15
- 230000000694 effects Effects 0.000 description 15
- 229920000554 ionomer Polymers 0.000 description 15
- 229940063559 methacrylic acid Drugs 0.000 description 15
- 239000005060 rubber Substances 0.000 description 14
- 239000012071 phase Substances 0.000 description 13
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 12
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 12
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 11
- 238000002156 mixing Methods 0.000 description 11
- 229940117958 vinyl acetate Drugs 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- AHAREKHAZNPPMI-UHFFFAOYSA-N hexadiene group Chemical group C=CC=CCC AHAREKHAZNPPMI-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 229920001897 terpolymer Polymers 0.000 description 9
- CFVWNXQPGQOHRJ-UHFFFAOYSA-N 2-methylpropyl prop-2-enoate Chemical compound CC(C)COC(=O)C=C CFVWNXQPGQOHRJ-UHFFFAOYSA-N 0.000 description 8
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 8
- HSVFKFNNMLUVEY-UHFFFAOYSA-N sulfuryl diazide Chemical compound [N-]=[N+]=NS(=O)(=O)N=[N+]=[N-] HSVFKFNNMLUVEY-UHFFFAOYSA-N 0.000 description 8
- 239000012745 toughening agent Substances 0.000 description 8
- 150000003751 zinc Chemical class 0.000 description 8
- HUAXFEIASFYLRR-UHFFFAOYSA-N 2-benzofuran-1,3-dione;sulfuryl diazide Chemical group [N-]=[N+]=NS(=O)(=O)N=[N+]=[N-].C1=CC=C2C(=O)OC(=O)C2=C1 HUAXFEIASFYLRR-UHFFFAOYSA-N 0.000 description 7
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- 239000011701 zinc Substances 0.000 description 7
- 229910052725 zinc Inorganic materials 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 239000000654 additive Substances 0.000 description 5
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 150000001993 dienes Chemical class 0.000 description 5
- YYXLGGIKSIZHSF-UHFFFAOYSA-N ethene;furan-2,5-dione Chemical compound C=C.O=C1OC(=O)C=C1 YYXLGGIKSIZHSF-UHFFFAOYSA-N 0.000 description 5
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 229920000089 Cyclic olefin copolymer Polymers 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 244000043261 Hevea brasiliensis Species 0.000 description 4
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 4
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 4
- 239000004698 Polyethylene Substances 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Chemical compound CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 4
- WOLATMHLPFJRGC-UHFFFAOYSA-N furan-2,5-dione;styrene Chemical compound O=C1OC(=O)C=C1.C=CC1=CC=CC=C1 WOLATMHLPFJRGC-UHFFFAOYSA-N 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 4
- 230000006872 improvement Effects 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 238000004898 kneading Methods 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 229920003052 natural elastomer Polymers 0.000 description 4
- 229920001194 natural rubber Polymers 0.000 description 4
- 229920000573 polyethylene Polymers 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- RYPKRALMXUUNKS-UHFFFAOYSA-N 2-Hexene Natural products CCCC=CC RYPKRALMXUUNKS-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 3
- 229920002367 Polyisobutene Polymers 0.000 description 3
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000007334 copolymerization reaction Methods 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 239000000806 elastomer Substances 0.000 description 3
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 3
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 3
- DPUXQWOMYBMHRN-UHFFFAOYSA-N hexa-2,3-diene Chemical compound CCC=C=CC DPUXQWOMYBMHRN-UHFFFAOYSA-N 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000004816 latex Substances 0.000 description 3
- 229920000126 latex Polymers 0.000 description 3
- 238000011068 loading method Methods 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- 229940063557 methacrylate Drugs 0.000 description 3
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000005457 optimization Methods 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 229920002857 polybutadiene Polymers 0.000 description 3
- 238000010791 quenching Methods 0.000 description 3
- 238000010526 radical polymerization reaction Methods 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- 239000007790 solid phase Substances 0.000 description 3
- 229920003048 styrene butadiene rubber Polymers 0.000 description 3
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 2
- VSAWBBYYMBQKIK-UHFFFAOYSA-N 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-2,6-ditert-butylphenol Chemical compound CC1=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C1CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 VSAWBBYYMBQKIK-UHFFFAOYSA-N 0.000 description 2
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 241001441571 Hiodontidae Species 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 2
- 229920000299 Nylon 12 Polymers 0.000 description 2
- 239000005062 Polybutadiene Substances 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 229910052787 antimony Inorganic materials 0.000 description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- TZSXSWLMFPFPCL-UHFFFAOYSA-N benzoic acid;sulfuryl diazide Chemical compound [N-]=[N+]=NS(=O)(=O)N=[N+]=[N-].OC(=O)C1=CC=CC=C1 TZSXSWLMFPFPCL-UHFFFAOYSA-N 0.000 description 2
- UTOVMEACOLCUCK-PLNGDYQASA-N butyl maleate Chemical compound CCCCOC(=O)\C=C/C(O)=O UTOVMEACOLCUCK-PLNGDYQASA-N 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 229940000425 combination drug Drugs 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 2
- QHZOMAXECYYXGP-UHFFFAOYSA-N ethene;prop-2-enoic acid Chemical compound C=C.OC(=O)C=C QHZOMAXECYYXGP-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 229920000578 graft copolymer Polymers 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 125000006289 hydroxybenzyl group Chemical group 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 238000003801 milling Methods 0.000 description 2
- 239000002667 nucleating agent Substances 0.000 description 2
- HMZGPNHSPWNGEP-UHFFFAOYSA-N octadecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C(C)=C HMZGPNHSPWNGEP-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 238000010186 staining Methods 0.000 description 2
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 2
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- XLYMOEINVGRTEX-ONEGZZNKSA-N (e)-4-ethoxy-4-oxobut-2-enoic acid Chemical compound CCOC(=O)\C=C\C(O)=O XLYMOEINVGRTEX-ONEGZZNKSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- 150000005207 1,3-dihydroxybenzenes Chemical class 0.000 description 1
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 1
- PAALZGOZEUHCET-UHFFFAOYSA-N 1,4-dioxecane-5,10-dione Chemical compound O=C1CCCCC(=O)OCCO1 PAALZGOZEUHCET-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- JJRUAPNVLBABCN-UHFFFAOYSA-N 2-(ethenoxymethyl)oxirane Chemical compound C=COCC1CO1 JJRUAPNVLBABCN-UHFFFAOYSA-N 0.000 description 1
- BMFMTNROJASFBW-UHFFFAOYSA-N 2-(furan-2-ylmethylsulfinyl)acetic acid Chemical compound OC(=O)CS(=O)CC1=CC=CO1 BMFMTNROJASFBW-UHFFFAOYSA-N 0.000 description 1
- XUDBVJCTLZTSDC-UHFFFAOYSA-N 2-ethenylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C=C XUDBVJCTLZTSDC-UHFFFAOYSA-N 0.000 description 1
- WDQMWEYDKDCEHT-UHFFFAOYSA-N 2-ethylhexyl 2-methylprop-2-enoate Chemical compound CCCCC(CC)COC(=O)C(C)=C WDQMWEYDKDCEHT-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- KBIWOJBFYNSQKW-UHFFFAOYSA-N 3-ethenylphthalic acid Chemical compound OC(=O)C1=CC=CC(C=C)=C1C(O)=O KBIWOJBFYNSQKW-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- UIERETOOQGIECD-UHFFFAOYSA-N Angelic acid Natural products CC=C(C)C(O)=O UIERETOOQGIECD-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- 102100026735 Coagulation factor VIII Human genes 0.000 description 1
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 101100010303 Drosophila melanogaster PolG1 gene Proteins 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- 101000911390 Homo sapiens Coagulation factor VIII Proteins 0.000 description 1
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- IPRJXAGUEGOFGG-UHFFFAOYSA-N N-butylbenzenesulfonamide Chemical compound CCCCNS(=O)(=O)C1=CC=CC=C1 IPRJXAGUEGOFGG-UHFFFAOYSA-N 0.000 description 1
- 101000941356 Nostoc ellipsosporum Cyanovirin-N Proteins 0.000 description 1
- 229920000571 Nylon 11 Polymers 0.000 description 1
- 229920000305 Nylon 6,10 Polymers 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 101150078890 POLG gene Proteins 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 229920006311 Urethane elastomer Polymers 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- IRERQBUNZFJFGC-UHFFFAOYSA-L azure blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[S-]S[S-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] IRERQBUNZFJFGC-UHFFFAOYSA-L 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- LVKZSFMYNWRPJX-UHFFFAOYSA-N benzenearsonic acid Natural products O[As](O)(=O)C1=CC=CC=C1 LVKZSFMYNWRPJX-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 229920005549 butyl rubber Polymers 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000000975 co-precipitation Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012967 coordination catalyst Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- UCVPKAZCQPRWAY-UHFFFAOYSA-N dibenzyl benzene-1,2-dicarboxylate Chemical compound C=1C=CC=C(C(=O)OCC=2C=CC=CC=2)C=1C(=O)OCC1=CC=CC=C1 UCVPKAZCQPRWAY-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- MLCHBQKMVKNBOV-UHFFFAOYSA-M dioxido(phenyl)phosphanium Chemical compound [O-]P(=O)C1=CC=CC=C1 MLCHBQKMVKNBOV-UHFFFAOYSA-M 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 229920001198 elastomeric copolymer Polymers 0.000 description 1
- 238000000635 electron micrograph Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- BGVWGPMAGMJLBU-UHFFFAOYSA-N ethenyl naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC=C)=CC=CC2=C1 BGVWGPMAGMJLBU-UHFFFAOYSA-N 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000010433 feldspar Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000009863 impact test Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N itaconic acid Chemical class OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- WHXSMMKQMYFTQS-IGMARMGPSA-N lithium-7 atom Chemical compound [7Li] WHXSMMKQMYFTQS-IGMARMGPSA-N 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 125000005395 methacrylic acid group Chemical class 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- AFFLGGQVNFXPEV-UHFFFAOYSA-N n-decene Natural products CCCCCCCCC=C AFFLGGQVNFXPEV-UHFFFAOYSA-N 0.000 description 1
- CISXFNQXHQSOIW-UHFFFAOYSA-N naphthalene-1-carboxylic acid;sulfuryl diazide Chemical compound [N-]=[N+]=NS(=O)(=O)N=[N+]=[N-].C1=CC=C2C(C(=O)O)=CC=CC2=C1 CISXFNQXHQSOIW-UHFFFAOYSA-N 0.000 description 1
- FJXWKBZRTWEWBJ-UHFFFAOYSA-N nonanediamide Chemical compound NC(=O)CCCCCCCC(N)=O FJXWKBZRTWEWBJ-UHFFFAOYSA-N 0.000 description 1
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 1
- LYRFLYHAGKPMFH-UHFFFAOYSA-N octadecanamide Chemical class CCCCCCCCCCCCCCCCCC(N)=O LYRFLYHAGKPMFH-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920006122 polyamide resin Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920000909 polytetrahydrofuran Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 229920006012 semi-aromatic polyamide Polymers 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000009864 tensile test Methods 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000003017 thermal stabilizer Substances 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 235000013799 ultramarine blue Nutrition 0.000 description 1
- JBIQAPKSNFTACH-UHFFFAOYSA-K vanadium oxytrichloride Chemical compound Cl[V](Cl)(Cl)=O JBIQAPKSNFTACH-UHFFFAOYSA-K 0.000 description 1
- KOZCZZVUFDCZGG-UHFFFAOYSA-N vinyl benzoate Chemical compound C=COC(=O)C1=CC=CC=C1 KOZCZZVUFDCZGG-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L77/00—Compositions of polyamides obtained by reactions forming a carboxylic amide link in the main chain; Compositions of derivatives of such polymers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Artificial Filaments (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US58051375A | 1975-05-23 | 1975-05-23 | |
| US580,513 | 1975-05-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1133164A true CA1133164A (en) | 1982-10-05 |
Family
ID=24321410
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA253,067A Expired CA1133164A (en) | 1975-05-23 | 1976-05-21 | Toughened thermoplastic polyamide matrix with micron sized dispersed soft polymer |
Country Status (8)
| Country | Link |
|---|---|
| JP (2) | JPS51143061A (show.php) |
| CA (1) | CA1133164A (show.php) |
| CH (1) | CH649566A5 (show.php) |
| DE (1) | DE2622973B2 (show.php) |
| FR (1) | FR2311814A1 (show.php) |
| GB (1) | GB1552352A (show.php) |
| IT (1) | IT1061385B (show.php) |
| NL (1) | NL168540B (show.php) |
Families Citing this family (57)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2654168C2 (de) * | 1976-11-30 | 1986-02-06 | Bayer Ag, 5090 Leverkusen | Polyamidlegierungen |
| DE2713537B2 (de) * | 1977-03-26 | 1981-04-16 | Bayer Ag, 5090 Leverkusen | Polyamidlegierungen |
| DE2734693A1 (de) * | 1977-08-02 | 1979-02-15 | Bayer Ag | Hochschlagzaehe polyamidlegierungen |
| JPS5439458A (en) * | 1977-09-02 | 1979-03-26 | Hitachi Ltd | Friction material |
| JPS5493043A (en) * | 1977-12-29 | 1979-07-23 | Unitika Ltd | Resin composition and its production |
| JPS5536279A (en) * | 1978-09-08 | 1980-03-13 | Mitsubishi Chem Ind Ltd | Production of polyamide resin composition |
| US4320213A (en) * | 1978-10-30 | 1982-03-16 | Monsanto Company | High-impact polyamide molding resin compositions |
| JPS55139450A (en) * | 1979-04-18 | 1980-10-31 | Ube Ind Ltd | Impact-resistant polyamide composition |
| US4283502A (en) * | 1979-04-30 | 1981-08-11 | E. I. Du Pont De Nemours And Company | Polyamide resins |
| US4220733A (en) | 1979-05-01 | 1980-09-02 | E. I. Du Pont De Nemours And Company | Thermally stable, flame-retardant polymers |
| JPS55157650A (en) * | 1979-05-29 | 1980-12-08 | Ube Ind Ltd | Polyamide composition with high impact strength |
| JPS6059257B2 (ja) * | 1979-11-14 | 1985-12-24 | 旭化成株式会社 | ガラス繊維強化樹脂組成物 |
| GB2060649B (en) * | 1979-10-04 | 1983-07-13 | Asahi Dow Ltd | Co-grafted polymers |
| US4387184A (en) * | 1979-12-10 | 1983-06-07 | Rhone-Poulenc Industries | Heat stable polyphase polyamide compositions and preparation thereof |
| JPS56109247A (en) * | 1980-01-22 | 1981-08-29 | Du Pont | Polyamide blend |
| US4410653A (en) * | 1980-04-08 | 1983-10-18 | E. I. Du Pont De Nemours And Company | Flame-retardant polyamide blends |
| JPS578246A (en) * | 1980-06-19 | 1982-01-16 | Mitsubishi Chem Ind Ltd | Polyamide resin composition |
| JPS5778453A (en) * | 1980-11-05 | 1982-05-17 | Mitsubishi Chem Ind Ltd | Polyamide resin composition |
| GB2092600A (en) * | 1981-02-11 | 1982-08-18 | Du Pont | Mineral reinforced polyamides |
| DE3204455A1 (de) * | 1981-02-14 | 1982-09-09 | Basf Ag, 6700 Ludwigshafen | Schlagzaehe thermoplastische formmassen |
| JPS57160612A (en) * | 1981-03-30 | 1982-10-04 | Toray Ind Inc | Thermoplastic film |
| JPS57200448A (en) * | 1981-06-03 | 1982-12-08 | Mitsubishi Chem Ind Ltd | Polyamide resin composition |
| US4394459A (en) | 1981-09-18 | 1983-07-19 | E. I. Du Pont De Nemours & Co. | Fast-curing foamable composition based on ethylene terpolymers |
| US4370423A (en) | 1981-09-18 | 1983-01-25 | Bata Limited | Fast-curing foamable composition based on ethylene terpolymers |
| DE3220380A1 (de) * | 1982-05-29 | 1983-12-01 | Basf Ag, 6700 Ludwigshafen | Schlagzaehe polyamid-formmassen |
| JPS5924751A (ja) * | 1982-08-02 | 1984-02-08 | Toray Ind Inc | ポリアミド樹脂組成物 |
| JPS5927948A (ja) * | 1982-08-06 | 1984-02-14 | Toray Ind Inc | 樹脂組成物 |
| JPS59151008U (ja) * | 1983-03-28 | 1984-10-09 | 松下電器産業株式会社 | 加熱調理装置 |
| NL8302602A (nl) * | 1983-07-20 | 1985-02-18 | Stamicarbon | Slagvaste polyamide compositie. |
| DE3417476A1 (de) * | 1984-05-11 | 1985-11-14 | Bayer Ag, 5090 Leverkusen | Polyamid-formmassen mit hohen zaehigkeiten |
| EP0175161B1 (de) * | 1984-09-15 | 1990-04-04 | Hüls Aktiengesellschaft | Formmassen auf Basis von Thermoplasten |
| JPS61152782A (ja) * | 1984-12-27 | 1986-07-11 | Ube Ind Ltd | ポリアミド系接着剤組成物および積層物 |
| JPS61296079A (ja) * | 1985-06-25 | 1986-12-26 | Ube Ind Ltd | ポリアミド系接着剤組成物および積層物 |
| DE3773608D1 (de) * | 1986-09-26 | 1991-11-14 | Ube Industries | Mit fasern verstaerkte kautschukmischung, verfahren zu deren herstellung und deren verwendung. |
| DE3700330A1 (de) * | 1987-01-08 | 1988-07-21 | Basf Ag | Schlagzaehe polyamid-formmassen |
| DE3711730A1 (de) * | 1987-04-10 | 1988-10-27 | Ter Hell Plastic Gmbh | Verfahren zur herstellung von polymerlegierungen sowie derartige polymerlegierungen |
| US4987017A (en) * | 1987-06-26 | 1991-01-22 | Japan Synthetic Rubber Co., Ltd. | Thermoplastic elastomer composition and Freon gas hose made thereof |
| CH672495A5 (show.php) * | 1987-07-17 | 1989-11-30 | Inventa Ag | |
| CA1332013C (en) * | 1987-08-17 | 1994-09-13 | Yuichi Orikasa | Thermoplastic resin composition and method for preparing the same |
| DE3810519C1 (show.php) * | 1988-03-28 | 1989-10-12 | Ems-Inventa Ag, Zuerich, Ch | |
| CA1338025C (en) * | 1988-08-29 | 1996-01-30 | Andri Elia Elia | Toughened nylons characterized by low mold deposit |
| JPH0284453A (ja) * | 1988-09-20 | 1990-03-26 | Japan Synthetic Rubber Co Ltd | 熱可塑性エラストマー組成物および冷凍機用ゴム部材 |
| DE3926904A1 (de) * | 1989-08-16 | 1991-02-21 | Basf Ag | Verfahren zur herstellung von verstaerkten, zaehmodifizierten thermoplastischen formmassen |
| JPH0385104A (ja) * | 1989-08-29 | 1991-04-10 | Asahi Corp | テニスシューズ用爪先補強ゴム片 |
| DE4214383C2 (de) * | 1992-04-30 | 1996-08-14 | Inventa Ag | Koextrudiertes Mehrschicht-Polymer-Rohr |
| US5486594A (en) * | 1994-07-11 | 1996-01-23 | Shell Oil Company | Polyketone polymers as nylon toughners |
| DE4425437A1 (de) | 1994-07-19 | 1996-01-25 | Basf Ag | Glasverstärkte Polyamidformmassen für Blasform-Anwendung |
| DE19653042A1 (de) | 1996-12-19 | 1998-06-25 | Basf Ag | Flammgeschützte Formmassen |
| EP1057870A1 (fr) | 1999-06-02 | 2000-12-06 | Atofina | Compositions à base de polyoléfine et de polyamide à bas point de fusion |
| AU2001229642A1 (en) * | 2000-01-21 | 2001-07-31 | E.I. Du Pont De Nemours And Company | Impact modified polyamide composition |
| US20020004555A1 (en) * | 2000-01-21 | 2002-01-10 | Silvia Di-Benedetto | Impact modified polyamide composition |
| US6420481B2 (en) | 2000-01-21 | 2002-07-16 | E. I. Du Pont De Nemours And Comapny | Impact modified polyamide compositions |
| GB2410308B (en) † | 2004-01-20 | 2008-06-25 | Uponor Innovation Ab | Multilayer pipe |
| JP7311338B2 (ja) * | 2019-07-11 | 2023-07-19 | 旭化成株式会社 | ポリアミド樹脂組成物及び成形品の製造方法 |
| WO2021049511A1 (ja) | 2019-09-12 | 2021-03-18 | 東洋紡株式会社 | ポリアミド樹脂組成物、及びポリアミド樹脂成形品 |
| CN117043239A (zh) * | 2021-03-23 | 2023-11-10 | 东丽株式会社 | 纤维增强树脂、多孔结构体、成型构件 |
| JPWO2024157717A1 (show.php) | 2023-01-27 | 2024-08-02 |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA742299A (en) * | 1966-09-06 | H. Halliwell Ronald | Blends of polyamide resins with acid-containing methacrylate polymers | |
| NL237027A (show.php) * | 1958-08-28 | |||
| US3274289A (en) * | 1959-05-12 | 1966-09-20 | Canadian Ind | Homogeneous blends of polyamides with carboxylate copolymers containing a neutral monomer comprising butadiene-1, 3, vinyl chloride, or a mixture of butadiene-1, 3 and methyl methacrylate |
| NL302805A (show.php) * | 1962-12-31 | |||
| GB1047069A (en) * | 1963-08-21 | 1966-11-02 | Du Pont | Blends of polyamide resins with acrylic resins |
| CH441742A (de) * | 1964-01-31 | 1967-08-15 | Igo Plast Faigle & Co | Kunststoffmaterial, vorzugsweise für Lager und ähnliche Maschinenelemente, sowie Verfahren zu dessen Herstellung |
| GB1116202A (en) * | 1964-10-24 | 1968-06-06 | Ici Ltd | Improvements in or relating to the dispersion of polyolefins in non-compatible synthetic polymers and to the products obtained thereby |
| US3388186A (en) * | 1965-03-02 | 1968-06-11 | Allied Chem | Carboxy terminated graft copolymers of amino-carboxylic acids or lactams on acrylic copolymers |
| US3845163A (en) * | 1966-01-24 | 1974-10-29 | Du Pont | Blends of polyamides and ionic copolymer |
| JPS4810380B1 (show.php) * | 1967-07-27 | 1973-04-03 | ||
| GB1189029A (en) * | 1967-08-14 | 1970-04-22 | Du Pont | Oriented Polyamide Articles |
| GB1214781A (en) * | 1968-01-08 | 1970-12-02 | Monsanto Co | Thermoplastic compositions |
| FR1570562A (show.php) * | 1968-03-22 | 1969-06-13 | ||
| FR2016138A1 (show.php) * | 1968-08-16 | 1970-05-08 | Dart Ind Inc | |
| NL7003304A (show.php) * | 1969-03-11 | 1970-09-15 | ||
| GB1241361A (en) * | 1969-03-11 | 1971-08-04 | Ici Ltd | Thermoplastic polymer blends |
| US3668274A (en) * | 1970-09-10 | 1972-06-06 | Rohm & Haas | Acrylic modifiers for polycarbonamides |
| US3821171A (en) * | 1971-07-01 | 1974-06-28 | Du Pont | Continuous,solid-phase polymerization of polyamide granules |
| US3735607A (en) * | 1971-07-21 | 1973-05-29 | G Jeney | Knitting apparatus |
| US3780140A (en) * | 1971-08-06 | 1973-12-18 | Du Pont | Ethylene/carbon monoxide polymer compositions |
| DE2217527C3 (de) * | 1972-04-12 | 1980-02-14 | Basf Ag, 6700 Ludwigshafen | Aus der Schmelze geformte, ein Antistatikum enthaltende Fäden oder Fasern aus Polyamiden sowie ein Verfahren zu deren Herstellung |
| JPS497061A (show.php) * | 1972-05-08 | 1974-01-22 | ||
| IT989816B (it) * | 1972-11-14 | 1975-06-10 | Ford Motor Co | Materiale termoplastico a base di poliammide rinforzata da gomma e procedimento per la sua produzione |
| JPS5038658B2 (show.php) * | 1973-01-12 | 1975-12-11 | ||
| DE2343693C2 (de) * | 1973-08-30 | 1982-06-16 | Hoechst Ag, 6000 Frankfurt | Thermoplastische Polyamidformmassen |
| JPS51125451A (en) * | 1975-04-03 | 1976-11-01 | Asahi Chem Ind Co Ltd | Polyamide composition |
-
1976
- 1976-05-21 CA CA253,067A patent/CA1133164A/en not_active Expired
- 1976-05-21 JP JP5801576A patent/JPS51143061A/ja active Granted
- 1976-05-21 NL NL7605495A patent/NL168540B/xx not_active Application Discontinuation
- 1976-05-21 DE DE19762622973 patent/DE2622973B2/de not_active Ceased
- 1976-05-21 CH CH644376A patent/CH649566A5/de not_active IP Right Cessation
- 1976-05-21 IT IT2353376A patent/IT1061385B/it active
- 1976-05-24 GB GB2150276A patent/GB1552352A/en not_active Expired
- 1976-05-24 FR FR7615621A patent/FR2311814A1/fr active Granted
-
1983
- 1983-11-24 JP JP21966583A patent/JPS59131649A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2622973B2 (de) | 1979-09-20 |
| NL7605495A (nl) | 1976-11-25 |
| JPS51143061A (en) | 1976-12-09 |
| NL168540B (nl) | 1981-11-16 |
| JPS5544108B2 (show.php) | 1980-11-10 |
| JPS6354308B2 (show.php) | 1988-10-27 |
| GB1552352A (en) | 1979-09-12 |
| IT1061385B (it) | 1983-02-28 |
| FR2311814A1 (fr) | 1976-12-17 |
| CH649566A5 (en) | 1985-05-31 |
| JPS59131649A (ja) | 1984-07-28 |
| DE2622973A1 (de) | 1976-12-09 |
| FR2311814B1 (show.php) | 1979-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1133164A (en) | Toughened thermoplastic polyamide matrix with micron sized dispersed soft polymer | |
| US4174358A (en) | Tough thermoplastic nylon compositions | |
| DE3687303T2 (de) | Thermoplastische polymerzusammensetzung. | |
| US5387645A (en) | Polyphthalamide composition | |
| EP0734419B1 (en) | Breathable film | |
| US5506299A (en) | High impact resistant blends of thermoplastic polyamides and modified block copolymers | |
| CA1110379A (en) | Compositions containing hydrogenated block copolymers and polyamides | |
| US5883195A (en) | Thermoplastic polyamide/-polyetheramide/elastomer alloys having improved mechanical properties | |
| KR950001856B1 (ko) | 저온 내충격성 및 안료 상용성을 갖는 열가소성 성형 조성물과 그의 제조방법 | |
| CA2303937A1 (en) | Thermoplastic elastomer compositions having improved processing properties | |
| WO1995026380A1 (en) | Thermoplastic elastomers having improved surface properties | |
| CA2006097A1 (en) | Toughened compositions of polyamide and functionalized rubber block or graft copolymers | |
| AU664194B2 (en) | Blow moldable thermoplastic polyamide composition | |
| US4078014A (en) | Composition of polyamide, polyethylene ionomer copolymer | |
| EP0386110B1 (en) | Polyamide compositions having nitrile rubber and copolymer of ethylene and alpha-olefin therein | |
| US4921914A (en) | Thermoplastic rubber compositions of carboxyl ethylene polymer and blends with polyamide | |
| US4757112A (en) | Single step bulk process for high impact polyamide masterbatches, products thereof and blends with polyamides | |
| US5061757A (en) | High impact strength polyamide blends and method for preparation thereof | |
| EP0356978B1 (en) | Toughened nylons characterized by low mold deposit | |
| AU644640B2 (en) | Polyketone polymer compositions | |
| EP0032123B1 (en) | Mono-olefin polymers having methylol phenolic groups grafted thereto, a process for their production and polymer blends containing them | |
| CA1334451C (en) | Polymer composition | |
| EP0649871A2 (en) | Thermoplastic compositions containing ground vulcanized rubber and polyolefin resin | |
| EP0477027A2 (en) | Improved polyphthalamide composition | |
| EP0168170B1 (en) | Modified ionic elastomer and blend with nylon |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |