CA1100498A - Selected process for producing monohalogenated derivatives of 7-hydroxy-coumarin - Google Patents
Selected process for producing monohalogenated derivatives of 7-hydroxy-coumarinInfo
- Publication number
- CA1100498A CA1100498A CA315,435A CA315435A CA1100498A CA 1100498 A CA1100498 A CA 1100498A CA 315435 A CA315435 A CA 315435A CA 1100498 A CA1100498 A CA 1100498A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- acid
- compound
- methyl
- beta
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- ORHBXUUXSCNDEV-UHFFFAOYSA-N umbelliferone Chemical class C1=CC(=O)OC2=CC(O)=CC=C21 ORHBXUUXSCNDEV-UHFFFAOYSA-N 0.000 title claims abstract description 4
- 238000000034 method Methods 0.000 title claims description 43
- -1 alkenyl radical Chemical class 0.000 claims abstract description 29
- 125000005843 halogen group Chemical group 0.000 claims abstract description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims description 34
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical group [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 8
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 claims description 8
- 125000003282 alkyl amino group Chemical group 0.000 claims description 7
- 239000000460 chlorine Chemical group 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 150000007522 mineralic acids Chemical class 0.000 claims description 6
- 150000007524 organic acids Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052801 chlorine Chemical group 0.000 claims description 5
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 claims description 5
- 229920000137 polyphosphoric acid Polymers 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 4
- 125000004122 cyclic group Chemical group 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 125000004494 ethyl ester group Chemical group 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 150000003254 radicals Chemical group 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 claims 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 150000002431 hydrogen Chemical group 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 abstract description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 2
- 230000000304 vasodilatating effect Effects 0.000 abstract description 2
- 150000005840 aryl radicals Chemical group 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 230000004907 flux Effects 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 206010002091 Anaesthesia Diseases 0.000 description 4
- 238000001949 anaesthesia Methods 0.000 description 4
- 230000037005 anaesthesia Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 229960005003 carbocromen Drugs 0.000 description 3
- KLOIYEQEVSIOOO-UHFFFAOYSA-N carbocromen Chemical compound CC1=C(CCN(CC)CC)C(=O)OC2=CC(OCC(=O)OCC)=CC=C21 KLOIYEQEVSIOOO-UHFFFAOYSA-N 0.000 description 3
- 230000000747 cardiac effect Effects 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 210000004351 coronary vessel Anatomy 0.000 description 3
- 210000001105 femoral artery Anatomy 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WQKHERPPDYPMNX-UHFFFAOYSA-N 6-chloro-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(Cl)=CC=C21 WQKHERPPDYPMNX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 210000000709 aorta Anatomy 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- 230000017531 blood circulation Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- OJYGBLRPYBAHRT-IPQSZEQASA-N chloralose Chemical compound O1[C@H](C(Cl)(Cl)Cl)O[C@@H]2[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]21 OJYGBLRPYBAHRT-IPQSZEQASA-N 0.000 description 2
- 229950009941 chloralose Drugs 0.000 description 2
- 210000003748 coronary sinus Anatomy 0.000 description 2
- 229960000956 coumarin Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000009434 installation Methods 0.000 description 2
- 210000004731 jugular vein Anatomy 0.000 description 2
- HQCYVSPJIOJEGA-UHFFFAOYSA-N methoxycoumarin Chemical compound C1=CC=C2OC(=O)C(OC)=CC2=C1 HQCYVSPJIOJEGA-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000001356 surgical procedure Methods 0.000 description 2
- 230000002861 ventricular Effects 0.000 description 2
- JQVAPEJNIZULEK-UHFFFAOYSA-N 4-chlorobenzene-1,3-diol Chemical compound OC1=CC=C(Cl)C(O)=C1 JQVAPEJNIZULEK-UHFFFAOYSA-N 0.000 description 1
- CJIJXIFQYOPWTF-UHFFFAOYSA-N 7-hydroxycoumarin Natural products O1C(=O)C=CC2=CC(O)=CC=C21 CJIJXIFQYOPWTF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- 241000219498 Alnus glutinosa Species 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241001432959 Chernes Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- OWIHWZAVHVREEJ-UHFFFAOYSA-N chromen-2-one;hydrochloride Chemical compound Cl.C1=CC=C2OC(=O)C=CC2=C1 OWIHWZAVHVREEJ-UHFFFAOYSA-N 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 210000003191 femoral vein Anatomy 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- BFWFOFBNNPVJFZ-UHFFFAOYSA-N n-ethylethanamine;propan-2-one Chemical compound CC(C)=O.CCNCC BFWFOFBNNPVJFZ-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- AWLILQARPMWUHA-UHFFFAOYSA-M thiopental sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC([S-])=NC1=O AWLILQARPMWUHA-UHFFFAOYSA-M 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/06—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2
- C07D311/08—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring
- C07D311/16—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring substituted in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT29765/77A IT1088554B (it) | 1977-11-17 | 1977-11-17 | Procedimento sellettivo per la preparazione di derivati della 7-indrossi cumarina |
| IT29765A/77 | 1977-11-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1100498A true CA1100498A (en) | 1981-05-05 |
Family
ID=11228398
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA315,435A Expired CA1100498A (en) | 1977-11-17 | 1978-10-31 | Selected process for producing monohalogenated derivatives of 7-hydroxy-coumarin |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4296039A (enExample) |
| JP (2) | JPS5479282A (enExample) |
| AT (1) | AT371815B (enExample) |
| BE (1) | BE871315A (enExample) |
| CA (1) | CA1100498A (enExample) |
| CH (1) | CH635334A5 (enExample) |
| DE (1) | DE2846083A1 (enExample) |
| ES (2) | ES474445A1 (enExample) |
| FI (1) | FI783470A7 (enExample) |
| FR (2) | FR2412541A1 (enExample) |
| GB (1) | GB2008109B (enExample) |
| GR (1) | GR66562B (enExample) |
| IT (1) | IT1088554B (enExample) |
| NL (1) | NL7810946A (enExample) |
| PT (1) | PT68788A (enExample) |
| YU (1) | YU40537B (enExample) |
| ZA (1) | ZA785739B (enExample) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1088554B (it) * | 1977-11-17 | 1985-06-10 | F I D I A Spa | Procedimento sellettivo per la preparazione di derivati della 7-indrossi cumarina |
| IT1100069B (it) * | 1978-11-06 | 1985-09-28 | Fidia Spa | Procedimento selettivo per la preparazione di derivati della 7-idrossicumarina |
| IT1212882B (it) * | 1983-07-29 | 1989-11-30 | Della Valle Francesco | Derivati basici della cumarina |
| IT1212907B (it) * | 1983-12-21 | 1989-11-30 | Romeo Aurelio | Preparazione di fenoli alogenati |
| US4788298A (en) * | 1985-01-22 | 1988-11-29 | Eastman Kodak Company | Process for the preparation of coumarin compounds |
| US4647666A (en) * | 1985-04-01 | 1987-03-03 | Iowa State University Research Foundation, Inc. | Heterocyclic synthesis via thallation and subsequent palladium-promoted olefination |
| US4650881A (en) * | 1985-04-01 | 1987-03-17 | Iowa State University Research Foundation, Inc. | Synthesis of isocoumarins via thallation-olefination of arenes |
| US4882412A (en) * | 1987-11-30 | 1989-11-21 | Eastman Kodak Company | Polyester polymer containing the residue of the UV absorbing benzopyran compound and shaped articles produced therefrom |
| US5356929A (en) * | 1989-01-23 | 1994-10-18 | Lehigh University | Reduced and quaternized psoralens as photo-activated therapeutics |
| WO1990008529A2 (en) * | 1989-01-23 | 1990-08-09 | Lehigh University | 7-alkoxycoumarins, dihydropsoralens, and benzodipyranones as photo-activated therapeutic agents and inhibitors of epidermal growth factor |
| US6251644B1 (en) | 1990-04-16 | 2001-06-26 | Baxter International, Inc. | Method for inactivating non-enveloped viral contaminants with a photosensitizer by increasing viral permeability to the photosensitizer |
| US5516629A (en) | 1990-04-16 | 1996-05-14 | Cryopharm Corporation | Photoinactivation of viral and bacterial blood contaminants using halogenated coumarins |
| US5444042A (en) * | 1990-12-28 | 1995-08-22 | Cortex Pharmaceuticals | Method of treatment of neurodegeneration with calpain inhibitors |
| IT1247476B (it) * | 1991-06-14 | 1994-12-17 | Fidia Spa | Derivati della cumarina. |
| IT1265665B1 (it) * | 1993-06-21 | 1996-11-22 | Fidia Spa | Composizioni farmaceutiche comprendenti 8-cloro-3-(beta- dietilaminoetil)-4-metil-7-etossicarbonilmetossi cumarina base e |
| CA2250919C (en) * | 1996-03-29 | 2008-05-13 | Therakos, Inc. | Photopheresis treatment of leukocytes |
| AU714882B2 (en) | 1996-04-09 | 2000-01-13 | Therakos, Inc. | Method for removal of psoralens from biological fluids |
| US6265421B1 (en) | 1997-06-25 | 2001-07-24 | Orion Corporation | Phospholamban inhibitors and a method for increasing coronary flow |
| CN1230212C (zh) * | 1997-07-10 | 2005-12-07 | 特拉科斯有限公司 | 肠和膀胱炎症紊乱的治疗 |
| US6627233B1 (en) * | 1997-09-18 | 2003-09-30 | Wm. Wrigley Jr. Company | Chewing gum containing physiological cooling agents |
| US6538022B1 (en) | 1997-09-24 | 2003-03-25 | Orion Corporation | Compounds for deactivating phospholamban function on Ca-ATPase (phopholamban inhibitors) |
| US5968959A (en) * | 1997-12-12 | 1999-10-19 | Orion Corporation | Method for the prevention and treatment of stunned myocardium |
| DE69913533T2 (de) * | 1998-07-16 | 2004-11-11 | Gentest Corp., Woburn | Reagentien für cyp2d fluoreszenztest |
| US6219584B1 (en) | 1999-07-09 | 2001-04-17 | Therakos, Inc. | Method and system for determining an effective amount of light energy to delivery to fluids having targets for the light energy |
| US6495366B1 (en) * | 1999-09-03 | 2002-12-17 | Therakos, Inc. | Uninterrupted flow pump apparatus and method |
| US8722422B2 (en) | 1999-09-03 | 2014-05-13 | Therakos, Inc. | Uninterrupted flow pump apparatus and method |
| US6207404B1 (en) | 1999-09-30 | 2001-03-27 | Gentest Corporation | Coumarin-based CYP3A fluorescent assay reagents |
| US6793643B1 (en) | 2000-04-21 | 2004-09-21 | Therakos, Inc. | Low extracorporeal volume treatment system |
| ES2362998T3 (es) | 2002-08-19 | 2011-07-18 | Pfizer Inc. | Terapia de combinación para enfermedades hiperproliferativas. |
| US20050054586A1 (en) * | 2003-06-30 | 2005-03-10 | Bartels Stephen P. | Treatment of ophthalmic disorders |
| US20050037063A1 (en) * | 2003-07-21 | 2005-02-17 | Bolton Anthony E. | Combined therapies |
| US7741317B2 (en) | 2005-10-21 | 2010-06-22 | Bristol-Myers Squibb Company | LXR modulators |
| US7888376B2 (en) | 2005-11-23 | 2011-02-15 | Bristol-Myers Squibb Company | Heterocyclic CETP inhibitors |
| ES2382009T3 (es) | 2006-12-01 | 2012-06-04 | Bristol-Myers Squibb Company | Derivados de N-((3-bencil)-2,2-(bis-fenil-)-propan-1-amina como inhibidores de CETP para el tratamiento de aterosclerosis y enfermedades cardiovasculares |
| US20100029017A1 (en) * | 2008-07-29 | 2010-02-04 | Becton, Dickinson And Company | Mono-chlorinated hydroxycoumarin conjugates |
| US8431416B2 (en) * | 2009-04-01 | 2013-04-30 | Becton, Dickinson And Company | Reactive heterocycle-substituted 7-hydroxycoumarins and their conjugates |
| BR112015026513A2 (pt) | 2013-04-17 | 2017-07-25 | Pfizer | derivados de n-piperidin-3-ilbenzamida para tratar as doenças cardiovasculares |
| WO2016055901A1 (en) | 2014-10-08 | 2016-04-14 | Pfizer Inc. | Substituted amide compounds |
| CA3125765A1 (en) | 2019-01-18 | 2020-07-23 | Astrazeneca Ab | Pcsk9 inhibitors and methods of use thereof |
| EP4230196A1 (en) | 2022-02-21 | 2023-08-23 | Som Innovation Biotech, S.A. | Compounds for use in the treatment of dystrophinopathies |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1210883B (de) * | 1961-11-09 | 1966-02-17 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von Derivaten des 7-Oxycumarins |
| FR2361M (fr) * | 1961-08-12 | 1964-02-24 | Cassella Farbwerke Mainkur Ag | Médicament coronaro-dilatateur renfermant un dérivé de la 7-hydroxy-coumarine. |
| US3259635A (en) * | 1962-07-26 | 1966-07-05 | Cassella Farbwerke Mainkur Ag | 7-hydroxy coumarin derivative |
| GB1044608A (en) * | 1964-07-17 | 1966-10-05 | Cassella Farbwerke Mainkur Ag | Substituted 3-(ª‰-hydroxyalkyl)-4-alkyl-coumarins and process for their production |
| AT276377B (de) * | 1967-05-06 | 1969-11-25 | Troponwerke Dinklage & Co | Verfahren zur Herstellung neuer basischer Cumarinderivate und ihrer Salze |
| GB1146792A (en) * | 1967-06-20 | 1969-03-26 | Cassella Farbwerke Mainkur Ag | 7-hydroxy-coumarin derivatives and process for their production |
| US3515721A (en) * | 1967-06-26 | 1970-06-02 | Cassella Farbwerke Mainkur Ag | 3-tertiary-aminoethyl-4-methyl or phenyl-7-ethoxycarbonylmethoxy - halo or mononitro coumarins and congeners |
| DE2108185A1 (en) * | 1971-02-20 | 1972-09-07 | Troponwerke Dinklage & Co, 5000 Köln-Mülheim | N-(3-aminoalkyl-2-oxo-2h-1-benzopyran-7-yl) ureas - as coronary vasodilators |
| DE2039867A1 (de) * | 1970-08-11 | 1972-02-17 | Troponwerke Dinklage & Co | Pharmakologisch wirksame Coumarin-Drivate und Verfahren zu ihrer Darstellung |
| PL74614B1 (enExample) * | 1971-07-19 | 1974-12-31 | ||
| US3923836A (en) * | 1973-07-18 | 1975-12-02 | Smithkline Corp | Chroman and chromene compounds |
| DE2543945A1 (de) * | 1975-10-02 | 1977-04-21 | Troponwerke Gmbh & Co Kg | 2-benzopyranonderivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2530405A1 (de) * | 1975-07-08 | 1977-01-27 | Troponwerke Dinklage & Co | 2-benzopyranonderivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| IT1088554B (it) * | 1977-11-17 | 1985-06-10 | F I D I A Spa | Procedimento sellettivo per la preparazione di derivati della 7-indrossi cumarina |
-
1977
- 1977-11-17 IT IT29765/77A patent/IT1088554B/it active
-
1978
- 1978-10-11 ZA ZA00785739A patent/ZA785739B/xx unknown
- 1978-10-17 BE BE191161A patent/BE871315A/xx not_active IP Right Cessation
- 1978-10-23 ES ES474445A patent/ES474445A1/es not_active Expired
- 1978-10-23 DE DE19782846083 patent/DE2846083A1/de active Granted
- 1978-10-26 FR FR7830524A patent/FR2412541A1/fr active Granted
- 1978-10-31 CA CA315,435A patent/CA1100498A/en not_active Expired
- 1978-11-01 CH CH1123678A patent/CH635334A5/fr not_active IP Right Cessation
- 1978-11-03 NL NL7810946A patent/NL7810946A/xx active Search and Examination
- 1978-11-08 GB GB7843690A patent/GB2008109B/en not_active Expired
- 1978-11-09 YU YU2614/78A patent/YU40537B/xx unknown
- 1978-11-14 FI FI783470A patent/FI783470A7/fi not_active Application Discontinuation
- 1978-11-15 PT PT68788A patent/PT68788A/pt unknown
- 1978-11-16 JP JP14214478A patent/JPS5479282A/ja active Pending
- 1978-11-17 AT AT0822078A patent/AT371815B/de not_active IP Right Cessation
- 1978-11-17 GR GR57668A patent/GR66562B/el unknown
-
1979
- 1979-02-09 FR FR7903385A patent/FR2412542A1/fr active Granted
- 1979-05-09 ES ES480376A patent/ES480376A1/es not_active Expired
-
1980
- 1980-01-15 US US06/112,223 patent/US4296039A/en not_active Expired - Lifetime
-
1982
- 1982-02-01 US US06/344,521 patent/US4452811A/en not_active Expired - Lifetime
-
1985
- 1985-04-24 JP JP60089880A patent/JPS60243081A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| PT68788A (en) | 1978-12-01 |
| US4452811A (en) | 1984-06-05 |
| FI783470A7 (fi) | 1979-05-18 |
| FR2412541B1 (enExample) | 1982-09-10 |
| US4296039A (en) | 1981-10-20 |
| ATA822078A (de) | 1982-12-15 |
| ES480376A1 (es) | 1980-04-01 |
| AT371815B (de) | 1983-08-10 |
| DE2846083A1 (de) | 1979-05-23 |
| JPS5479282A (en) | 1979-06-25 |
| YU40537B (en) | 1986-02-28 |
| DE2846083C2 (enExample) | 1989-02-02 |
| NL7810946A (nl) | 1979-05-21 |
| GB2008109A (en) | 1979-05-31 |
| FR2412542A1 (fr) | 1979-07-20 |
| FR2412542B1 (enExample) | 1983-02-25 |
| BE871315A (fr) | 1979-02-15 |
| YU261478A (en) | 1983-01-21 |
| JPS60243081A (ja) | 1985-12-03 |
| ZA785739B (en) | 1979-09-26 |
| CH635334A5 (fr) | 1983-03-31 |
| FR2412541A1 (fr) | 1979-07-20 |
| ES474445A1 (es) | 1980-01-16 |
| JPS6310154B2 (enExample) | 1988-03-04 |
| GB2008109B (en) | 1982-08-04 |
| GR66562B (enExample) | 1981-03-27 |
| IT1088554B (it) | 1985-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1100498A (en) | Selected process for producing monohalogenated derivatives of 7-hydroxy-coumarin | |
| SU856380A3 (ru) | Способ получени производных пиридина /его варианты/ | |
| SU1160935A3 (ru) | Способ получени производных бензазепина или их кислотно-аддитивных солей с неорганическими кислотами | |
| EP0175376B1 (en) | Xanthone derivatives and process for producing the same | |
| US4363811A (en) | Anti-hypertensive chromanol derivatives | |
| US4048317A (en) | Chroman derivatives | |
| CA1119180A (en) | Derivatives of trans-3-hydroxy-4-amino-chromans | |
| US4366163A (en) | Anti-hypertensive chromanol derivatives | |
| ATE37544T1 (de) | Benzofuranderivate, verfahren zu deren herstellung und pharmazeutische zusammensetzungen welche diese enthalten. | |
| EP0248420B1 (en) | Benzopyran derivatives | |
| KR850000193B1 (ko) | 벤조피란 화합물의 제조방법 | |
| EP0198456B1 (en) | 1,7-naphthyridine derivatives and medicinal preparations containing same | |
| US4481213A (en) | 4-Haloalkylamino substituted chromanol useful as antihypertensive agent | |
| US4062870A (en) | Chroman derivatives | |
| US3515721A (en) | 3-tertiary-aminoethyl-4-methyl or phenyl-7-ethoxycarbonylmethoxy - halo or mononitro coumarins and congeners | |
| US4327099A (en) | Pyrano derivatives, a process for their preparation and their use | |
| US4556739A (en) | 3,4-Dialkoxy-2-alkylcarbonyl analino compounds | |
| CA1266470A (en) | Xanthine derivatives, processes for their production and their use as pharmaceuticals | |
| US4904667A (en) | 1H-1,2,4-thiadiazolo(3,4-b)quinazolin-5-one-2,2-dioxides, and a method for increasing the cardiac output of a mammal with them | |
| EP0176333A2 (en) | Substituted quinazolinediones | |
| JPH0131502B2 (enExample) | ||
| US4051245A (en) | Pyrazine 4-oxide derivatives and process for their preparation | |
| US4430342A (en) | N-Acyl-3-[4-(benzoylalkyl)piperazin-1-yl]-sydnonimine compound, process for prodction thereof, and use thereof | |
| US4797498A (en) | Flavonoxypropanolamines and esters of flavonoxypropanolamines as antiarrhythmic agents | |
| US4495356A (en) | 1,4-Dihydropyridine compound |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |