CA1099268A - Aminoalkyl-furanylalkyl-urea derivatives - Google Patents
Aminoalkyl-furanylalkyl-urea derivativesInfo
- Publication number
- CA1099268A CA1099268A CA283,694A CA283694A CA1099268A CA 1099268 A CA1099268 A CA 1099268A CA 283694 A CA283694 A CA 283694A CA 1099268 A CA1099268 A CA 1099268A
- Authority
- CA
- Canada
- Prior art keywords
- methyl
- furanyl
- thio
- formula
- dimethylamino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 117
- 239000001257 hydrogen Substances 0.000 claims abstract description 46
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 46
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 32
- 150000003839 salts Chemical class 0.000 claims abstract description 30
- 238000004519 manufacturing process Methods 0.000 claims abstract description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 20
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 14
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 12
- 150000001204 N-oxides Chemical class 0.000 claims abstract description 10
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 10
- 150000004677 hydrates Chemical class 0.000 claims abstract description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 10
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 10
- 101100244083 Arabidopsis thaliana PKL gene Proteins 0.000 claims abstract description 9
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 8
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 7
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 7
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 6
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims abstract description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 6
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 3
- 125000003118 aryl group Chemical group 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 114
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 114
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 75
- 238000000034 method Methods 0.000 claims description 60
- 230000008569 process Effects 0.000 claims description 52
- -1 alkali metal cyanates Chemical class 0.000 claims description 34
- 150000001412 amines Chemical class 0.000 claims description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 29
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 26
- 239000000047 product Substances 0.000 claims description 25
- 150000002431 hydrogen Chemical class 0.000 claims description 24
- 238000002360 preparation method Methods 0.000 claims description 21
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 19
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 14
- 239000005864 Sulphur Substances 0.000 claims description 14
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 14
- 150000003141 primary amines Chemical class 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 238000006683 Mannich reaction Methods 0.000 claims description 9
- 150000002540 isothiocyanates Chemical class 0.000 claims description 9
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims description 8
- JFGCGQJHMUYGLU-UHFFFAOYSA-N 2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethanamine Chemical compound CN(C)CC1=CC=C(CSCCN)O1 JFGCGQJHMUYGLU-UHFFFAOYSA-N 0.000 claims description 8
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims description 8
- 150000004702 methyl esters Chemical class 0.000 claims description 8
- 150000003335 secondary amines Chemical class 0.000 claims description 8
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 claims description 6
- 229930040373 Paraformaldehyde Natural products 0.000 claims description 6
- 239000012948 isocyanate Substances 0.000 claims description 6
- 150000002513 isocyanates Chemical class 0.000 claims description 6
- 229920002866 paraformaldehyde Polymers 0.000 claims description 6
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 238000010511 deprotection reaction Methods 0.000 claims description 5
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000005544 phthalimido group Chemical group 0.000 claims description 5
- 150000003573 thiols Chemical class 0.000 claims description 5
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 229910001385 heavy metal Inorganic materials 0.000 claims description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 4
- YQFHPXZGXNYYLD-UHFFFAOYSA-N n-methyl-1-methylsulfanyl-2-nitroethenamine Chemical compound CNC(SC)=C[N+]([O-])=O YQFHPXZGXNYYLD-UHFFFAOYSA-N 0.000 claims description 4
- 150000003567 thiocyanates Chemical class 0.000 claims description 4
- NXGHEDHQXXXTTP-UHFFFAOYSA-N 1,1-bis(methylsulfanyl)-2-nitroethene Chemical compound CSC(SC)=C[N+]([O-])=O NXGHEDHQXXXTTP-UHFFFAOYSA-N 0.000 claims description 3
- VFIAOIVGTFADLM-UHFFFAOYSA-N 1-(furan-2-yl)-n,n-dimethylmethanamine Chemical compound CN(C)CC1=CC=CO1 VFIAOIVGTFADLM-UHFFFAOYSA-N 0.000 claims description 3
- JZCXCGRGVDXRDQ-UHFFFAOYSA-N 2-[[1-(methylamino)-2-nitroethenyl]amino]ethanethiol Chemical compound [O-][N+](=O)C=C(NC)NCCS JZCXCGRGVDXRDQ-UHFFFAOYSA-N 0.000 claims description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 3
- BQRQOLQFLNSWNV-UHFFFAOYSA-N [5-[(dimethylamino)methyl]furan-2-yl]methanol Chemical compound CN(C)CC1=CC=C(CO)O1 BQRQOLQFLNSWNV-UHFFFAOYSA-N 0.000 claims description 3
- JRQYKULIUYUIQS-UHFFFAOYSA-N 2-[[5-(methylaminomethyl)furan-2-yl]methylsulfanyl]ethanamine Chemical compound CNCC1=CC=C(CSCCN)O1 JRQYKULIUYUIQS-UHFFFAOYSA-N 0.000 claims description 2
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 claims description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 2
- KNJULNRXTDFNQG-UHFFFAOYSA-N methylsulfonyliminocarbamodithioic acid Chemical compound CS(=O)(=O)N=NC(S)=S KNJULNRXTDFNQG-UHFFFAOYSA-N 0.000 claims description 2
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 2
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 20
- VMXUWOKSQNHOCA-UHFFFAOYSA-N N1'-[2-[[5-[(dimethylamino)methyl]-2-furanyl]methylthio]ethyl]-N1-methyl-2-nitroethene-1,1-diamine Chemical compound [O-][N+](=O)C=C(NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-UHFFFAOYSA-N 0.000 claims 9
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 claims 6
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 3
- IGIBOJUUDQAOPQ-UHFFFAOYSA-N 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-methyl-3-methylsulfonylguanidine Chemical compound CS(=O)(=O)NC(=NC)NCCSCC1=CC=C(CN(C)C)O1 IGIBOJUUDQAOPQ-UHFFFAOYSA-N 0.000 claims 2
- CIENVMPNYRBSAW-UHFFFAOYSA-N 1-cyano-2-methyl-3-[2-[[5-(methylaminomethyl)furan-2-yl]methylsulfanyl]ethyl]guanidine Chemical compound CNCC1=CC=C(CSCCNC(NC#N)=NC)O1 CIENVMPNYRBSAW-UHFFFAOYSA-N 0.000 claims 2
- CWBHHMFRECVXSM-UHFFFAOYSA-N 1-cyano-3-[4-[5-[(dimethylamino)methyl]furan-2-yl]butyl]-2-methylguanidine Chemical compound N#CNC(=NC)NCCCCC1=CC=C(CN(C)C)O1 CWBHHMFRECVXSM-UHFFFAOYSA-N 0.000 claims 2
- UZTWDZASHGUVHZ-UHFFFAOYSA-N 1-n'-[4-[5-[(dimethylamino)methyl]furan-2-yl]butyl]-1-n-methyl-2-nitroethene-1,1-diamine Chemical compound [O-][N+](=O)C=C(NC)NCCCCC1=CC=C(CN(C)C)O1 UZTWDZASHGUVHZ-UHFFFAOYSA-N 0.000 claims 2
- SKFSGGYLFMBUNI-UHFFFAOYSA-N 2-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-nitroguanidine Chemical compound CN(C)CC1=CC=C(CSCCNC(=N)N[N+]([O-])=O)O1 SKFSGGYLFMBUNI-UHFFFAOYSA-N 0.000 claims 2
- 101000989653 Homo sapiens Membrane frizzled-related protein Proteins 0.000 claims 2
- 102100029357 Membrane frizzled-related protein Human genes 0.000 claims 2
- WZLBVRXZNDXPPW-UHFFFAOYSA-N desmethylranitidine Chemical compound CNCC1=CC=C(CSCCNC(NC)=C[N+]([O-])=O)O1 WZLBVRXZNDXPPW-UHFFFAOYSA-N 0.000 claims 2
- GGWBHVILAJZWKJ-UHFFFAOYSA-N dimethyl-[[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methyl]azanium;chloride Chemical compound Cl.[O-][N+](=O)C=C(NC)NCCSCC1=CC=C(CN(C)C)O1 GGWBHVILAJZWKJ-UHFFFAOYSA-N 0.000 claims 2
- GYBROSSBMDGGNP-UHFFFAOYSA-N 1-(benzenesulfonyl)-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-2-methylguanidine Chemical compound C=1C=CC=CC=1S(=O)(=O)NC(=NC)NCCSCC1=CC=C(CN(C)C)O1 GYBROSSBMDGGNP-UHFFFAOYSA-N 0.000 claims 1
- ZLRGSFJJCMPBHF-UHFFFAOYSA-N 1-n'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-n-(2-methoxyethyl)-2-nitroethene-1,1-diamine Chemical compound COCCNC(=C[N+]([O-])=O)NCCSCC1=CC=C(CN(C)C)O1 ZLRGSFJJCMPBHF-UHFFFAOYSA-N 0.000 claims 1
- RDXBMEMCHHCIIZ-UHFFFAOYSA-N 1-n'-[5-[5-[(dimethylamino)methyl]furan-2-yl]pentyl]-1-n-methyl-2-nitroethene-1,1-diamine Chemical compound [O-][N+](=O)C=C(NC)NCCCCCC1=CC=C(CN(C)C)O1 RDXBMEMCHHCIIZ-UHFFFAOYSA-N 0.000 claims 1
- QWPCWVKOWZSMMU-UHFFFAOYSA-N 4-[5-[(dimethylamino)methyl]furan-2-yl]butan-1-amine Chemical compound CN(C)CC1=CC=C(CCCCN)O1 QWPCWVKOWZSMMU-UHFFFAOYSA-N 0.000 claims 1
- CUVJBOZXHSRMQC-UHFFFAOYSA-N 5-(4-aminobutyl)-N,N,4-trimethylfuran-2-amine Chemical compound CN(C1=CC(=C(O1)CCCCN)C)C CUVJBOZXHSRMQC-UHFFFAOYSA-N 0.000 claims 1
- FLZZNZJENFNFOJ-UHFFFAOYSA-N methyl n'-nitrocarbamimidothioate Chemical compound CSC(N)=N[N+]([O-])=O FLZZNZJENFNFOJ-UHFFFAOYSA-N 0.000 claims 1
- 239000000543 intermediate Substances 0.000 abstract description 7
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 abstract description 3
- 230000000694 effects Effects 0.000 abstract description 2
- 125000005842 heteroatom Chemical group 0.000 abstract description 2
- 239000003485 histamine H2 receptor antagonist Substances 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 103
- 239000000243 solution Substances 0.000 description 79
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 73
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 70
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 56
- 125000005289 uranyl group Chemical group 0.000 description 55
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 45
- 239000003921 oil Substances 0.000 description 40
- 238000004458 analytical method Methods 0.000 description 36
- 239000002904 solvent Substances 0.000 description 35
- 239000000203 mixture Substances 0.000 description 32
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- 239000000377 silicon dioxide Substances 0.000 description 28
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 20
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 20
- 239000007787 solid Substances 0.000 description 19
- 101150041968 CDC13 gene Proteins 0.000 description 18
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 14
- 238000004440 column chromatography Methods 0.000 description 14
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 13
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 12
- 239000004480 active ingredient Substances 0.000 description 12
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 12
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 12
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 12
- 210000002784 stomach Anatomy 0.000 description 11
- 229910021529 ammonia Inorganic materials 0.000 description 10
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- CHJJGSNFBQVOTG-UHFFFAOYSA-N methylguanidine Chemical compound CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- 230000009858 acid secretion Effects 0.000 description 7
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 229960001340 histamine Drugs 0.000 description 7
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 7
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 7
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 239000003610 charcoal Substances 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 6
- 125000002541 furyl group Chemical group 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 239000002674 ointment Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 230000028327 secretion Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 5
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 description 4
- 241001440269 Cutina Species 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 102000003710 Histamine H2 Receptors Human genes 0.000 description 4
- 108090000050 Histamine H2 Receptors Proteins 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 230000002496 gastric effect Effects 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 3
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 3
- 241001024304 Mino Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 229960004977 anhydrous lactose Drugs 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 229940097265 cysteamine hydrochloride Drugs 0.000 description 3
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 229910001961 silver nitrate Inorganic materials 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 3
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical class [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 3
- KGLPWQKSKUVKMJ-UHFFFAOYSA-N 2,3-dihydrophthalazine-1,4-dione Chemical class C1=CC=C2C(=O)NNC(=O)C2=C1 KGLPWQKSKUVKMJ-UHFFFAOYSA-N 0.000 description 2
- ZFFTZDQKIXPDAF-UHFFFAOYSA-N 2-Furanmethanethiol Chemical compound SCC1=CC=CO1 ZFFTZDQKIXPDAF-UHFFFAOYSA-N 0.000 description 2
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 2
- VHTUKWXCIFHXKN-UHFFFAOYSA-N 3-(furan-2-yl)propanenitrile Chemical compound N#CCCC1=CC=CO1 VHTUKWXCIFHXKN-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical class C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 230000000172 allergic effect Effects 0.000 description 2
- 239000000739 antihistaminic agent Substances 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229960002242 chlorocresol Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical compound NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 description 2
- 239000011928 denatured alcohol Substances 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 2
- 210000004211 gastric acid Anatomy 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229960004592 isopropanol Drugs 0.000 description 2
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 2
- 229940011051 isopropyl acetate Drugs 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 150000002688 maleic acid derivatives Chemical class 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 2
- 229960000582 mepyramine Drugs 0.000 description 2
- 229960003151 mercaptamine Drugs 0.000 description 2
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- SYJXFKPQNSDJLI-HKEUSBCWSA-N neamine Chemical compound N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](N)C[C@@H]1N SYJXFKPQNSDJLI-HKEUSBCWSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 150000003891 oxalate salts Chemical class 0.000 description 2
- 230000010412 perfusion Effects 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000008279 sol Substances 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- KSQZVAWGIAAZHJ-CQSZACIVSA-N (2r)-1-methyl-2-pentyl-3,4-dihydro-2h-quinoline Chemical compound C1=CC=C2N(C)[C@H](CCCCC)CCC2=C1 KSQZVAWGIAAZHJ-CQSZACIVSA-N 0.000 description 1
- SWGZHHCRMZDRSN-BTJKTKAUSA-N (Z)-but-2-enedioic acid 1-phenoxypropan-2-ylhydrazine Chemical compound OC(=O)\C=C/C(O)=O.NNC(C)COC1=CC=CC=C1 SWGZHHCRMZDRSN-BTJKTKAUSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- PKFBXDJVTHWICY-UHFFFAOYSA-N 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-methylthiourea Chemical compound CN(C)CC1=CC=C(O1)CSCCN(C(=S)N)C PKFBXDJVTHWICY-UHFFFAOYSA-N 0.000 description 1
- ALJILIAEAQBJPP-UHFFFAOYSA-N 1-[5-(ethylsulfanylmethyl)furan-2-yl]-n,n-dimethylmethanamine Chemical compound CCSCC1=CC=C(CN(C)C)O1 ALJILIAEAQBJPP-UHFFFAOYSA-N 0.000 description 1
- SIPUVDMTGKCNOP-UHFFFAOYSA-N 1-cyano-3-prop-2-enylthiourea Chemical compound C=CCNC(=S)NC#N SIPUVDMTGKCNOP-UHFFFAOYSA-N 0.000 description 1
- HTSAVXAFEVUJQE-UHFFFAOYSA-N 1-isothiocyanato-2-methoxyethane Chemical compound COCCN=C=S HTSAVXAFEVUJQE-UHFFFAOYSA-N 0.000 description 1
- GZFMPEKGONDQFE-UHFFFAOYSA-N 1-methyl-3-(2-sulfanylethyl)urea Chemical compound CNC(=O)NCCS GZFMPEKGONDQFE-UHFFFAOYSA-N 0.000 description 1
- PIACIHLDRSUEBO-UHFFFAOYSA-N 1-methyl-3-[2-[[5-[(4-methylpiperazin-1-yl)methyl]furan-2-yl]methylsulfanyl]ethyl]thiourea Chemical compound O1C(CSCCNC(=S)NC)=CC=C1CN1CCN(C)CC1 PIACIHLDRSUEBO-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- XNPSFFSMEXSPKL-UHFFFAOYSA-N 2-(2-methoxyethyl)guanidine Chemical compound COCCN=C(N)N XNPSFFSMEXSPKL-UHFFFAOYSA-N 0.000 description 1
- UHOPWFKONJYLCF-UHFFFAOYSA-N 2-(2-sulfanylethyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCS)C(=O)C2=C1 UHOPWFKONJYLCF-UHFFFAOYSA-N 0.000 description 1
- VKJCJJYNVIYVQR-UHFFFAOYSA-N 2-(3-bromopropyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCBr)C(=O)C2=C1 VKJCJJYNVIYVQR-UHFFFAOYSA-N 0.000 description 1
- GANBJDIOIDQSGI-UHFFFAOYSA-N 2-(chloromethyl)furan Chemical compound ClCC1=CC=CO1 GANBJDIOIDQSGI-UHFFFAOYSA-N 0.000 description 1
- SLIYSEJITIBKRF-UHFFFAOYSA-N 2-[2-[2-(furan-2-yl)ethylsulfanyl]ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCSCCC1=CC=CO1 SLIYSEJITIBKRF-UHFFFAOYSA-N 0.000 description 1
- AENRMVMZLHJHAH-UHFFFAOYSA-N 2-[2-[[5-[(4-methylpiperazin-1-yl)methyl]furan-2-yl]methylsulfanyl]ethyl]isoindole-1,3-dione Chemical compound C1CN(C)CCN1CC(O1)=CC=C1CSCCN1C(=O)C2=CC=CC=C2C1=O AENRMVMZLHJHAH-UHFFFAOYSA-N 0.000 description 1
- IFUSSZFGSFTQHD-UHFFFAOYSA-N 2-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]ethanamine Chemical compound CN(C)CC1=CC=C(COCCN)O1 IFUSSZFGSFTQHD-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- ONRREFWJTRBDRA-UHFFFAOYSA-N 2-chloroethanamine;hydron;chloride Chemical compound [Cl-].[NH3+]CCCl ONRREFWJTRBDRA-UHFFFAOYSA-N 0.000 description 1
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 1
- HOCPDSKONPQIQM-UHFFFAOYSA-N 4-(2-bromoethyl)isoindole-1,3-dione Chemical compound BrCCC1=CC=CC2=C1C(=O)NC2=O HOCPDSKONPQIQM-UHFFFAOYSA-N 0.000 description 1
- VWKFHCOVGJWSQV-UHFFFAOYSA-N 5-[5-[(dimethylamino)methyl]furan-2-yl]pentan-1-amine Chemical compound CN(C)CC1=CC=C(CCCCCN)O1 VWKFHCOVGJWSQV-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- 238000006824 Eschweiler-Clarke methylation reaction Methods 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- WJYIASZWHGOTOU-UHFFFAOYSA-N Heptylamine Chemical compound CCCCCCCN WJYIASZWHGOTOU-UHFFFAOYSA-N 0.000 description 1
- 102000000543 Histamine Receptors Human genes 0.000 description 1
- 108010002059 Histamine Receptors Proteins 0.000 description 1
- 241000243251 Hydra Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- FPBPLBWLMYGIQR-UHFFFAOYSA-N Metiamide Chemical compound CNC(=S)NCCSCC=1N=CNC=1C FPBPLBWLMYGIQR-UHFFFAOYSA-N 0.000 description 1
- KQJQICVXLJTWQD-UHFFFAOYSA-N N-Methylthiourea Chemical compound CNC(N)=S KQJQICVXLJTWQD-UHFFFAOYSA-N 0.000 description 1
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 206010041899 Stab wound Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- UCTLHLZWKJIXJI-LXIBVNSESA-N [(3s,8r,9s,10r,13s,14s)-17-chloro-16-formyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1h-cyclopenta[a]phenanthren-3-yl] acetate Chemical compound C([C@@H]12)C[C@]3(C)C(Cl)=C(C=O)C[C@H]3[C@@H]1CC=C1[C@]2(C)CC[C@H](OC(=O)C)C1 UCTLHLZWKJIXJI-LXIBVNSESA-N 0.000 description 1
- KFWROBGTNRQCEF-UHFFFAOYSA-N [5-(dimethylamino)furan-2-yl]methanol Chemical compound CN(C)C1=CC=C(CO)O1 KFWROBGTNRQCEF-UHFFFAOYSA-N 0.000 description 1
- DBHUDSKDNDYJNR-UHFFFAOYSA-N [5-[4-(dimethylamino)butyl]furan-2-yl]methyl acetate Chemical compound CN(C)CCCCC1=CC=C(COC(C)=O)O1 DBHUDSKDNDYJNR-UHFFFAOYSA-N 0.000 description 1
- UDUMWDDMSHXGGQ-UHFFFAOYSA-N [amino(methylsulfanyl)methylidene]-methylazanium;iodide Chemical compound I.CSC(N)=NC UDUMWDDMSHXGGQ-UHFFFAOYSA-N 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000091 aluminium hydride Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- WIRUZQNBHNAMAB-UHFFFAOYSA-N benzene;cyclohexane Chemical compound C1CCCCC1.C1=CC=CC=C1 WIRUZQNBHNAMAB-UHFFFAOYSA-N 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 1
- 210000002808 connective tissue Anatomy 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- XMYLSWOTJKUSHE-UHFFFAOYSA-N cyanamide;lead Chemical compound [Pb].NC#N XMYLSWOTJKUSHE-UHFFFAOYSA-N 0.000 description 1
- 150000001913 cyanates Chemical class 0.000 description 1
- 230000003226 decolorizating effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 230000006203 ethylation Effects 0.000 description 1
- 238000006200 ethylation reaction Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 230000027119 gastric acid secretion Effects 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000007031 hydroxymethylation reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- XGEGHDBEHXKFPX-NJFSPNSNSA-N methylurea Chemical compound [14CH3]NC(N)=O XGEGHDBEHXKFPX-NJFSPNSNSA-N 0.000 description 1
- 229950003251 metiamide Drugs 0.000 description 1
- 239000013081 microcrystal Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- RPMXALUWKZHYOV-UHFFFAOYSA-N nitroethene Chemical group [O-][N+](=O)C=C RPMXALUWKZHYOV-UHFFFAOYSA-N 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Substances ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- POSZUTFLHGNLHX-KSBRXOFISA-N tris maleate Chemical compound OCC(N)(CO)CO.OCC(N)(CO)CO.OC(=O)\C=C/C(O)=O POSZUTFLHGNLHX-KSBRXOFISA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
- C07D275/03—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/335—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin
- A61K31/34—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having five-membered rings with one oxygen as the only ring hetero atom, e.g. isosorbide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/64—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB32465/76 | 1976-08-04 | ||
| GB32465/76A GB1565966A (en) | 1976-08-04 | 1976-08-04 | Aminoalkyl furan derivatives |
| GB50685/76 | 1976-12-06 | ||
| GB5068576 | 1976-12-06 | ||
| GB2018777 | 1977-05-13 | ||
| GB20187/77 | 1977-05-13 | ||
| GB28187/78A GB1565967A (en) | 1976-08-04 | 1977-07-22 | Aminoalkyl furan derivatives |
| KR7701808A KR810000355B1 (ko) | 1977-05-13 | 1977-08-04 | 아미노 알킬푸란 유도체의 제조방법 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1099268A true CA1099268A (en) | 1981-04-14 |
Family
ID=27516213
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA283,694A Expired CA1099268A (en) | 1976-08-04 | 1977-07-29 | Aminoalkyl-furanylalkyl-urea derivatives |
Country Status (10)
| Country | Link |
|---|---|
| US (3) | US4128658A (cg-RX-API-DMAC10.html) |
| JP (3) | JPS5840956B2 (cg-RX-API-DMAC10.html) |
| AU (1) | AU515628B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE857388A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1099268A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2734070C2 (cg-RX-API-DMAC10.html) |
| FR (3) | FR2360587B1 (cg-RX-API-DMAC10.html) |
| GB (2) | GB1565966A (cg-RX-API-DMAC10.html) |
| LU (1) | LU77911A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL178320C (cg-RX-API-DMAC10.html) |
Families Citing this family (169)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5021429A (en) * | 1977-05-17 | 1991-06-04 | Allen & Hansburys Limited | Pharmacologically active aminoalkylphenyl compounds and their use |
| GB1601459A (en) * | 1977-05-17 | 1981-10-28 | Allen & Hanburys Ltd | Aminoalkyl thiophene derivatives |
| JPS5444660A (en) * | 1977-08-29 | 1979-04-09 | Yamanouchi Pharmaceut Co Ltd | Heterocyclic compound and its preparation |
| DK452578A (da) * | 1977-10-11 | 1979-04-12 | Glaxo Group Ltd | Fremgangsmaade til fremstilling af furanderivater |
| US4233302A (en) * | 1977-12-23 | 1980-11-11 | Glaxo Group Limited | Amine derivatives and pharmaceutical compositions containing them |
| IN151188B (cg-RX-API-DMAC10.html) * | 1978-02-13 | 1983-03-05 | Smith Kline French Lab | |
| US4539207A (en) * | 1978-02-13 | 1985-09-03 | Smith Kline & French Laboratories Limited | Pyrimidine compounds |
| AR228941A1 (es) * | 1978-04-26 | 1983-05-13 | Glaxo Group Ltd | Procedimiento para preparar nuevos derivados de 3,5-diamino-1,2,4-triazol que son activos contra receptores histaminicos |
| IL57416A (en) * | 1978-05-30 | 1983-03-31 | Smith Kline French Lab | Nitro compounds,processes for preparing them and compositions containing them |
| US4405624A (en) * | 1978-05-30 | 1983-09-20 | Smith Kline & French Laboratories Limited | Nitro-substituted dihydropyrroles and tetrahydropyridines, compositions, compounds, and medicinal use |
| US4584384A (en) * | 1978-05-30 | 1986-04-22 | Smith Kline & French Laboratories Limited | Nitro pyrroles |
| IL57415A (en) * | 1978-05-30 | 1984-08-31 | Smith Kline French Lab | Nitropyrrole compounds,process for preparing them and pharmaceutical compositions containing them |
| ZA793443B (en) * | 1978-07-26 | 1980-12-31 | Glaxo Group Ltd | Heterocyclic derivatives |
| US4200760A (en) * | 1978-09-26 | 1980-04-29 | Bristol-Myers Company | Imidazolylalkylthioalkylamino-ethylene derivatives |
| US4203909A (en) * | 1978-09-26 | 1980-05-20 | Bristol-Myers Company | Furan compounds |
| FR2446829A1 (fr) * | 1978-11-16 | 1980-08-14 | Glaxo Group Ltd | Derives de polymethylene disubstitues en alpha, omega, procede pour leur preparation et compositions pharmaceutiques les contenant |
| US4282363A (en) * | 1978-11-24 | 1981-08-04 | Bristol-Myers Company | 1-Nitro-2-(2-alkynylamino)-2-[(2-pyridylmethylthio)-ethylamino]ethylene derivatives |
| DK89480A (da) * | 1979-03-02 | 1980-09-03 | Glaxo Group Ltd | R fremgangsmaade til fremstilling af heterocycliske forbindelse |
| ZA801151B (en) * | 1979-03-02 | 1981-02-25 | Glaxo Group Ltd | Heterocyclic derivatives |
| JPS55120571A (en) * | 1979-03-02 | 1980-09-17 | Glaxo Group Ltd | Heterocyclic derivative |
| US4220654A (en) * | 1979-06-04 | 1980-09-02 | Merck & Co., Inc. | Cyclic imidazole cyanoguanidines |
| US4293557A (en) * | 1979-07-03 | 1981-10-06 | Teikoku Hormone Mfg. Co., Ltd. | Antiulcer phenoxypropylamine derivatives |
| JPS5610175A (en) * | 1979-07-06 | 1981-02-02 | Fujisawa Pharmaceut Co Ltd | Preparation of imidazole derivative |
| GB2063874B (en) * | 1979-10-22 | 1983-09-28 | Glaxo Group Ltd | Triazole derivatives processes for the preparation thereof and pharmaceutical compositions containing them |
| GB2063253B (en) * | 1979-10-22 | 1983-09-14 | Glaxo Group Ltd | Triazole derivatives processes for their production and pharmaceutical compositions containing them |
| US4238487A (en) * | 1979-10-31 | 1980-12-09 | Merck & Co., Inc. | Aminoalkyl benzofuran derivatives |
| JPS5681578A (en) * | 1979-12-07 | 1981-07-03 | Shionogi & Co Ltd | Novel thioalkyl amide derivative |
| US4431802A (en) * | 1979-12-10 | 1984-02-14 | G. D. Searle & Co. | N-Heterocyclyl-N-cyano-N-(heterocyclythioalkyl)-guanidines |
| US4239908A (en) * | 1979-12-10 | 1980-12-16 | G.D. Searle & Co. | N-aralkenyl-N'-cyano-N"-(heterocyclylthioalkyl)-guanidines |
| PT72320B (en) * | 1980-01-08 | 1982-07-23 | Glaxo Group Ltd | Process for preparation of a furan derivative |
| CA1181084A (en) * | 1980-01-08 | 1985-01-15 | Glaxo Group Limited | Process for the preparation of a furan derivative |
| CA1171096A (en) * | 1980-01-08 | 1984-07-17 | Glaxo Group Limited | Process for the preparation of a furan derivative |
| YU53681A (en) * | 1980-03-08 | 1983-12-31 | Smith Kline French Lab | Process for obtaining 5-dimethylamino-methyl-2-furane methanol |
| CA1155842A (en) * | 1980-03-29 | 1983-10-25 | Thomas H. Brown | Compounds |
| US4491586A (en) * | 1980-06-05 | 1985-01-01 | Glaxo Group Limited | Amine derivatives |
| US4394508A (en) * | 1980-06-07 | 1983-07-19 | Bristol-Myers Company | Chemical compounds |
| IL63968A (en) * | 1980-10-01 | 1985-10-31 | Glaxo Group Ltd | Form 2 ranitidine hydrochloride,its preparation and pharmaceutical compositions containing it |
| US4607107A (en) * | 1980-10-01 | 1986-08-19 | Smith Kline & French Laboratories Ltd. | (4-aminoalkyl-2-pyridyl alkyl)guanidines |
| AT407956B (de) * | 1980-10-01 | 2001-07-25 | Glaxo Group Ltd | Verfahren zur herstellung eines arzneimittels |
| US4904792A (en) * | 1980-10-02 | 1990-02-27 | Eli Lilly And Company | N-thiazolymethylthioalkyl-N'-alkylamidines and related compounds |
| US4760075A (en) * | 1980-10-02 | 1988-07-26 | Eli Lilly And Company | N-thiazolylmethylthioalkyl-N-alkyl-amidines and related compounds |
| US4490533A (en) * | 1980-12-22 | 1984-12-25 | Merck & Co., Inc. | Aminoalkyl pyridine derivatives |
| EP0055625B1 (en) * | 1980-12-30 | 1985-05-02 | Glaxo Group Limited | Process for the preparation of a furan derivative |
| JPS57134476A (en) * | 1980-12-30 | 1982-08-19 | Glaxo Group Ltd | Manufacture of furan derivatives |
| DK558181A (da) * | 1981-01-30 | 1982-07-31 | Smithkline Corp | Fremgangsmaade til fremstilling af 3,5-diamino-1,2,4-triazoler |
| EP0057981A3 (en) | 1981-02-09 | 1982-08-25 | Beecham Group Plc | Aromatic compounds, processes for their preparation and their use |
| AR226777A1 (es) * | 1981-02-20 | 1982-08-13 | Glaxo Group Ltd | Un procedimiento para la preparacion de ranitidina |
| DE3108753A1 (de) * | 1981-03-07 | 1982-09-16 | Degussa Ag, 6000 Frankfurt | Neue substituierte alkyl-phenylsulfonylguanidine miteinem heterocyclischen rest |
| FR2501691A1 (fr) * | 1981-03-11 | 1982-09-17 | Sanofi Sa | Thioalkylamides, procede de preparation et compositions pharmaceutiques en contenant |
| US4381395A (en) * | 1981-04-03 | 1983-04-26 | Sk & F Lab Co. | Process for preparing an imidazole derivative |
| AR229878A1 (es) * | 1981-05-07 | 1983-12-30 | Glaxo Group Ltd | Procedimiento para preparar ranitidina |
| US4390701A (en) * | 1981-05-18 | 1983-06-28 | Bristol-Myers Company | 1-Amino-2-[3-(3-piperidinomethylphenoxy)propylamino]cyclobutene-3,4-dione |
| US5171860A (en) * | 1981-06-15 | 1992-12-15 | Merck & Co., Inc. | Diamino isothiazole-1-oxides and 1,1 dioxides as gastric secretion inhibitors |
| BE894285A (fr) * | 1981-09-04 | 1983-03-02 | Glaxo Group Ltd | Composition pharmaceutique contenant un medicament anti-inflammatoire et de la ranitidine ou un sel de ce compose |
| ES507180A0 (es) * | 1981-11-16 | 1982-08-16 | Pharmedical Sa Lab | Procedimiento de preparacion de amino alcosi furanos o tio- fenos. |
| US4525477A (en) * | 1981-12-02 | 1985-06-25 | Smith Kline & French Laboratories Limited | 2-Thiazolyl, isothiazolyl, oxazolyl and isoxazolyl alkylamino-3-nitro-heterocyclic compounds |
| GR77847B (cg-RX-API-DMAC10.html) * | 1981-12-14 | 1984-09-25 | American Home Prod | |
| WO1983002113A1 (fr) * | 1981-12-17 | 1983-06-23 | Yuki, Hiroshi | Derives de propenylamine et medicaments les contenant |
| US4411899A (en) * | 1981-12-21 | 1983-10-25 | Merck & Co., Inc. | Substituted derivatives of amino alkane diols as gastric secretion inhibitors |
| DE3213509A1 (de) * | 1982-04-10 | 1983-10-20 | Basf Ag, 6700 Ludwigshafen | N-substituierte imidazol-derivate, ihre herstellung, diese enthaltende arzneimittel und ihre verwendung |
| PT76557B (en) * | 1982-04-16 | 1986-01-21 | Inke Sa | Process for preparing furan derivatives and addition salts thereof and of pharmaceutical compositions containing the same |
| ATE21901T1 (de) * | 1982-07-30 | 1986-09-15 | Smith Kline French Lab | Aminopyrimidinone und ihre herstellung. |
| US4590192A (en) * | 1982-10-01 | 1986-05-20 | Beecham Group P.L.C. | Benzisothiazoles, their pharmaceutical compositions, and method of use |
| EP0105732A3 (en) * | 1982-10-01 | 1985-09-04 | Beecham Group Plc | Histamine h2 receptor antagonists of the benzisothiazole amino and benzthiadiazine amino series |
| JPS5988458A (ja) * | 1982-11-12 | 1984-05-22 | Toyama Chem Co Ltd | アミン誘導体およびその塩 |
| US4458077A (en) * | 1982-11-22 | 1984-07-03 | American Home Products Corporation | Heterocyclic anti-ulcer agents |
| YU42819B (en) * | 1982-11-22 | 1988-12-31 | Lek Tovarna Farmacevtskih | Process for preparing n-/2-///5-(dimethyl-amino)-methyl-2-furanyl/methyl/thio/ethyl-n'-methyl-2-nitro-1,1-ethene diamine |
| DE3343884A1 (de) * | 1982-12-08 | 1984-06-14 | Degussa Ag, 6000 Frankfurt | Neue ethendiamin- und guanidin-derivate |
| NL8303965A (nl) * | 1982-12-08 | 1984-07-02 | Degussa | Nieuwe etheendiamine- en guanidine-derivaten; werkwijze voor het bereiden daarvan; geneesmiddelen die ze bevatten; werkwijze voor het bereiden van dergelijke geneesmiddelen; toepassing van de verbindingen voor het bereiden van geneesmiddelen en in de geneeskunde. |
| US4565815A (en) * | 1982-12-30 | 1986-01-21 | Biomeasure, Inc. | Pyrazolo[1,5-a]-1,3,5-triazines |
| US4814335A (en) * | 1982-12-30 | 1989-03-21 | Biomeasure, Incorporated | Antiviral compounds |
| US4495193A (en) * | 1982-12-30 | 1985-01-22 | Biomeasure, Inc. | Imidazole compounds which reduce gastric acid secretion |
| US4665172A (en) * | 1983-01-28 | 1987-05-12 | Ube Industries, Ltd. | Process for producing heterocyclic compound having nitromethylene group as the side chain group |
| US4558044A (en) * | 1983-02-19 | 1985-12-10 | Beecham Group P.L.C. | 1,2,4-Benzothiadiazines |
| DE3306102C1 (de) * | 1983-02-22 | 1984-08-02 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | Pyridin-Pyrimidinon-Derivate,Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| DK169255B1 (da) * | 1983-02-22 | 1994-09-26 | American Home Prod | Analogifremgangsmåde til fremstilling af thieno-isothiazol-1,1-dioxid-derivater og farmaceutisk acceptable salte heraf |
| US4772622A (en) * | 1983-03-25 | 1988-09-20 | Merck & Co., Inc. | 3,5-diamino-1,2,4-oxidiazoles as gastric secretion inhibitors |
| ES521588A0 (es) * | 1983-03-30 | 1984-08-16 | Ferrer Int | Procedimiento de obtencion de nuevas n-ciano-formamidinas. |
| GB8313217D0 (en) * | 1983-05-13 | 1983-06-22 | Glaxo Group Ltd | Pharmaceutical compositions |
| US4567191A (en) * | 1983-06-07 | 1986-01-28 | Merck & Co., Inc. | Amino-phenyl-thiadiazoledioxides as gastric secretion inhibitors |
| US4539416A (en) * | 1983-06-10 | 1985-09-03 | The Dow Chemical Company | Processes for making thioalkyl carboxamides and amines |
| AT389873B (de) * | 1983-07-15 | 1990-02-12 | Richter Gedeon Vegyeszet | Verfahren zur herstellung des 1-(2-(5-/ |
| JPS6067474A (ja) * | 1983-09-24 | 1985-04-17 | Wakamoto Pharmaceut Co Ltd | 新規な1,3,4−チアジアゾ−ル誘導体及びそれを有効成分とする抗潰瘍剤 |
| BG39661A1 (en) * | 1984-04-13 | 1986-08-29 | Ivanova | Antiulcer means |
| HU198196B (en) * | 1984-05-02 | 1989-08-28 | Gyogyszerkutato Intezet | Process for production of basic tioether and its salts |
| IT1196133B (it) * | 1984-06-06 | 1988-11-10 | Ausonia Farma Srl | Derivati furanici con attivita' antiulcera |
| DE3546858C2 (de) * | 1984-06-15 | 1995-04-20 | Glaxo Group Ltd | Verfahren zur Herstellung von Ranitidin |
| GB8415254D0 (en) | 1984-06-15 | 1984-07-18 | Glaxo Group Ltd | Amine derivatives |
| GB8423804D0 (en) * | 1984-09-20 | 1984-10-24 | Glaxo Group Ltd | Chemical process |
| IT1178026B (it) * | 1984-10-05 | 1987-09-03 | Medosan Ind Biochimi | Derivati del 2-amino-tiazolo |
| FR2571723B1 (fr) * | 1984-10-12 | 1988-08-26 | Lipha | Derives de thieno et furo-(2,3-c) pyrroles, procedes de preparation et medicaments les contenant |
| AR245716A1 (es) * | 1986-03-28 | 1994-02-28 | Janus Farma Srl | Procedimiento para la sintesis de niperotidina que tiene actividad terapeutica anti-ulcera. |
| US4814341A (en) * | 1986-08-26 | 1989-03-21 | Reiter Lawrence A | 2-guanidino-4-(2-furyl) thiazoles as antiulcer agents |
| JPH0725745B2 (ja) * | 1986-11-11 | 1995-03-22 | 株式会社日本触媒 | アミン化合物の製造方法 |
| GB8629781D0 (en) * | 1986-12-12 | 1987-01-21 | Glaxo Group Ltd | Pharmaceutical compositions |
| DE3784698D1 (de) * | 1987-04-06 | 1993-04-15 | Heumann Pharma Gmbh & Co | Verfahren zur herstellung von nitroethenderivaten. |
| GB2209163B (en) * | 1987-08-28 | 1991-04-24 | Toyama Chemical Co Ltd | Amine derivative and its salt, process for producing the same, and anti-ulcer agent containing the same |
| JPH01131172A (ja) * | 1987-08-28 | 1989-05-24 | Toyama Chem Co Ltd | アミン誘導体およびその塩、それらの製造法、並びにそれらを含有する抗潰瘍剤 |
| SE8704436D0 (sv) * | 1987-11-13 | 1987-11-13 | Pm Konsult Handelsbolag | Anvendning av antisekretoriska substanser for nya indikationer |
| JPH01138013U (cg-RX-API-DMAC10.html) * | 1988-03-16 | 1989-09-21 | ||
| IL90245A (en) * | 1988-05-11 | 1994-04-12 | Glaxo Group Ltd | Resin adsorbate comprising ranitidine together with a synthetic cation exchange resin, its preparation and pharmaceutical compositions containing it |
| US4880636A (en) * | 1988-05-13 | 1989-11-14 | Franz Robert M | Film coated tablet of ranitidine HCl |
| CH679582A5 (cg-RX-API-DMAC10.html) * | 1988-07-18 | 1992-03-13 | Glaxo Group Ltd | |
| CA1327748C (en) * | 1988-09-20 | 1994-03-15 | Christopher William Quirk | Pharmaceutical composition containing ranitidine and alginic acid |
| GB8904182D0 (en) * | 1989-02-23 | 1989-04-05 | Glaxo Canada | Pharmaceutical compositions |
| ES2012285A6 (es) * | 1989-03-09 | 1990-03-01 | Vinas Lab | Procedimiento para la obtencion de derivados furanicos. |
| JPH0730064B2 (ja) * | 1989-08-17 | 1995-04-05 | 協和醗酵工業株式会社 | フラン誘導体 |
| GB9004328D0 (en) * | 1990-02-27 | 1990-04-25 | Glaxo Group Ltd | Chemical compounds |
| GB9009437D0 (en) * | 1990-04-26 | 1990-06-20 | Glaxo Group Ltd | Chemical compounds |
| HU210849B (en) * | 1990-11-09 | 1995-08-28 | Richter Gedeon Vegyeszet | Process for preparing furil derivatives |
| US5169864A (en) * | 1991-11-15 | 1992-12-08 | Baxter International Inc. | Unbuffered premixed ranitidine formulation |
| US5294433A (en) * | 1992-04-15 | 1994-03-15 | The Procter & Gamble Company | Use of H-2 antagonists for treatment of gingivitis |
| KR950701312A (ko) * | 1992-05-12 | 1995-03-23 | 이베 사치아키 | 신규 4급 암모늄염 및 약제로서 그의 사용 |
| JPH0649615U (ja) * | 1992-12-14 | 1994-07-08 | 日本建鐵株式会社 | ドライシールカーテンウォールの排水構造 |
| WO1995010274A1 (en) * | 1993-10-14 | 1995-04-20 | F.H. Faulding & Co. Limited | Aqueous pharmaceutical composition |
| DE4341310A1 (de) * | 1993-12-03 | 1995-06-08 | Hexal Pharma Gmbh | Tablette oder Kapsel mit einem Gehalt an stabilem Ranitidinhydrochlorid Form 1 |
| US5407687A (en) * | 1994-02-22 | 1995-04-18 | Glaxo Inc. | Ranitidine solid dosage form |
| EP0754182A1 (en) | 1994-04-08 | 1997-01-22 | Brantford Chemicals Inc. | Form 1 ranitidine hydrochloride with increased density |
| CA2120874E (en) * | 1994-04-08 | 2002-01-08 | Keshava Murthy | Form of form 1 ranitidine |
| IN181698B (cg-RX-API-DMAC10.html) * | 1994-05-13 | 1998-09-05 | Ranbaxy Lab Ltd | |
| NZ272054A (en) * | 1994-05-13 | 1996-05-28 | Ranbaxy Lab Ltd | Process for producing form 1 ranitidine hydrochloride |
| IN181699B (cg-RX-API-DMAC10.html) * | 1994-05-13 | 1998-09-05 | Ranbaxy Lab Ltd | |
| ES2119268T3 (es) * | 1994-06-24 | 1998-10-01 | Ranbaxy Lab Ltd | Procedimiento para fabricar ranitidina base de calidad farmaceutica. |
| DE69504156T2 (de) | 1994-06-24 | 1998-12-24 | Ranbaxy Laboratories, Ltd., New Delhi | Verfahren zur Herstellung von Ranitidinhydrochlorid in der Kristallform 1 |
| US5538737A (en) * | 1994-11-30 | 1996-07-23 | Applied Analytical Industries, Inc. | Oral compositions of H2 -antagonists |
| US5672724A (en) * | 1994-12-08 | 1997-09-30 | Hoechst Marion Roussel, Inc. | Processes for preparing ranitidine |
| AU4288796A (en) * | 1994-12-08 | 1996-06-26 | Hoechst Marion Roussel, Inc. | Novel processes for preparing ranitidine |
| US5663381A (en) * | 1995-04-21 | 1997-09-02 | Hexal Pharmaceuticals, Inc. | Process for preparing form 1 ranitidine hydrochloride |
| US5686588A (en) * | 1995-08-16 | 1997-11-11 | Yoo; Seo Hong | Amine acid salt compounds and process for the production thereof |
| EP0861075A1 (en) * | 1995-11-13 | 1998-09-02 | Albany Medical College | Analgesic compounds and uses thereof |
| WO1997035853A1 (en) * | 1996-03-25 | 1997-10-02 | Hoechst Marion Roussel, Inc. | Process for the preparation of form 1 ranitidine hydrochloride |
| RU2131264C1 (ru) * | 1996-06-04 | 1999-06-10 | Московское производственное химико-фармацевтическое объединение им.Н.А.Семашко | Противоязвенное средство в виде таблеток и способ его получения |
| EP1047683A1 (en) * | 1998-01-16 | 2000-11-02 | Centaur Pharmaceuticals, Inc. | Thioether furan nitrone compounds |
| AU4055699A (en) * | 1998-06-17 | 2000-01-05 | Russinsky Limited | Ranitidine adduct |
| YU52598A (sh) * | 1998-11-19 | 2001-05-28 | D.D. Zdravlje- sektor za istraživanje i razvoj | POSTUPAK ZA sintezu N-[2[[[5=[(DIALKILAMINO)METIL]-2= FURANIL]METIL]TIO]ETIL]-N'-ALKIL-2-NITRO 1,1 ALKENDIAMINA I NJIHOVIH HIDROHLORIDA |
| US6316020B1 (en) | 1999-08-26 | 2001-11-13 | Robert R. Whittle | Pharmaceutical formulations |
| US6262085B1 (en) | 1999-08-26 | 2001-07-17 | Robert R. Whittle | Alkoxy substituted Benzimidazole compounds, pharmaceutical preparations containing the same, and methods of using the same |
| US6312712B1 (en) | 1999-08-26 | 2001-11-06 | Robert R. Whittle | Method of improving bioavailability |
| US6268385B1 (en) | 1999-08-26 | 2001-07-31 | Robert R. Whittle | Dry blend pharmaceutical formulations |
| US6312723B1 (en) | 1999-08-26 | 2001-11-06 | Robert R. Whittle | Pharmaceutical unit dosage form |
| US6369087B1 (en) | 1999-08-26 | 2002-04-09 | Robert R. Whittle | Alkoxy substituted benzimidazole compounds, pharmaceutical preparations containing the same, and methods of using the same |
| US6326384B1 (en) | 1999-08-26 | 2001-12-04 | Robert R. Whittle | Dry blend pharmaceutical unit dosage form |
| US6262086B1 (en) | 1999-08-26 | 2001-07-17 | Robert R. Whittle | Pharmaceutical unit dosage form |
| US6780880B1 (en) | 1999-08-26 | 2004-08-24 | Robert R. Whittle | FT-Raman spectroscopic measurement |
| DE10300325A1 (de) * | 2003-01-09 | 2004-07-22 | Hexal Ag | Granulat mit öliger Substanz, Herstellungsverfahren und Tablette |
| US7632521B2 (en) * | 2003-07-15 | 2009-12-15 | Eurand, Inc. | Controlled release potassium chloride tablets |
| EP1579862A1 (en) | 2004-03-25 | 2005-09-28 | Boehringer Ingelheim Vetmedica Gmbh | Use of PDE III inhibitors for the reduction of heart size in mammals suffering from heart failure |
| US8980894B2 (en) | 2004-03-25 | 2015-03-17 | Boehringer Ingelheim Vetmedica Gmbh | Use of PDE III inhibitors for the treatment of asymptomatic (occult) heart failure |
| US20060087051A1 (en) * | 2004-10-27 | 2006-04-27 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20060088587A1 (en) * | 2004-10-27 | 2006-04-27 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20060088586A1 (en) * | 2004-10-27 | 2006-04-27 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US8383159B2 (en) * | 2004-10-27 | 2013-02-26 | Mcneil-Ppc, Inc. | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20060088593A1 (en) * | 2004-10-27 | 2006-04-27 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20070281022A1 (en) * | 2004-10-27 | 2007-12-06 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| US20070190133A1 (en) * | 2004-10-27 | 2007-08-16 | Bunick Frank J | Dosage forms having a microreliefed surface and methods and apparatus for their production |
| WO2006071659A1 (en) * | 2004-12-29 | 2006-07-06 | Trustees Of Boston University | Delivery of h2 antagonists |
| CA2500676A1 (en) * | 2005-03-11 | 2006-09-11 | Apotex Pharmachem Inc. | Preparation of acid addition salts of amine bases by solid phase-gas phase reactions |
| EP1920785A1 (en) | 2006-11-07 | 2008-05-14 | Boehringer Ingelheim Vetmedica Gmbh | Liquid preparation comprising a complex of pimobendan and cyclodextrin |
| EP2572713B1 (en) | 2011-09-22 | 2014-08-13 | King Saud University | Extracts and isolated flavonoids from Euphorbia cuneata useful as anti-ulcer agents |
| ES2924478T3 (es) | 2012-03-15 | 2022-10-07 | Boehringer Ingelheim Vetmedica Gmbh | Formulación de comprimidos farmacéuticos para el sector médico veterinario, método de producción y uso de los mismos |
| HUE054186T2 (hu) | 2013-07-19 | 2021-08-30 | Boehringer Ingelheim Vetmedica Gmbh | Éterezett ciklodextrin-származékokat tartalmazó, tartósított, folyékony, vizes gyógyászati készítmény |
| WO2015082389A1 (en) | 2013-12-04 | 2015-06-11 | Boehringer Ingelheim Vetmedica Gmbh | Improved pharmaceutical compositions of pimobendan |
| US9457011B2 (en) | 2014-02-25 | 2016-10-04 | Muslim D. Shahid | Compositions and methods for the treatment of acid-related gastrointestinal disorders containing a dithiolane compound and a gastric acid secretion inhibitor |
| EP2929884A1 (en) | 2014-04-11 | 2015-10-14 | Sanovel Ilac Sanayi ve Ticaret A.S. | Pharmaceutical combinations of dabigatran and h2-receptor antagonists |
| EP2942058A1 (en) | 2014-05-09 | 2015-11-11 | Sanovel Ilac Sanayi ve Ticaret A.S. | Pharmaceutical combinations of rivaroxaban and H2-receptor antagonists |
| US10537570B2 (en) | 2016-04-06 | 2020-01-21 | Boehringer Ingelheim Vetmedica Gmbh | Use of pimobendan for the reduction of heart size and/or the delay of onset of clinical symptoms in patients with asymptomatic heart failure due to mitral valve disease |
| CN108864001A (zh) * | 2018-06-30 | 2018-11-23 | 郑州明泽医药科技有限公司 | 一种合成雷尼替丁的新方法 |
| EP4196793A1 (en) | 2020-08-11 | 2023-06-21 | Université de Strasbourg | H2 blockers targeting liver macrophages for the prevention and treatment of liver disease and cancer |
| CN114605360B (zh) * | 2022-03-09 | 2023-05-05 | 河北海力恒远新材料股份有限公司 | 一种2-[[[5-(二甲氨基)甲基-2-呋喃基]甲基]硫代]乙胺的制备方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2989546A (en) * | 1961-06-20 | Synthesis of furans | ||
| US3097206A (en) * | 1962-03-19 | 1963-07-09 | Smith Kline French Lab | Aminomethylthienyl and furyl alcohol derivatives |
| US3433807A (en) * | 1963-09-26 | 1969-03-18 | Merck & Co Inc | Aminopropoxymethylfurans and intermediates therefor |
| US3393209A (en) * | 1965-10-04 | 1968-07-16 | Dow Chemical Co | Furfuryl and tetrahydrofurfuryl phenyl ureas |
| GB1307539A (en) | 1970-06-25 | 1973-02-21 | Smith Kline French Lab | Thiourea derivatives |
| GB1338169A (en) | 1971-03-09 | 1973-11-21 | Smith Kline French Lab | Ureas thioureas and guanidines |
| GB1397436A (en) | 1972-09-05 | 1975-06-11 | Smith Kline French Lab | Heterocyclic n-cyanoguinidines |
| US4000164A (en) * | 1973-04-02 | 1976-12-28 | Richardson-Merrell Inc. | Hypolipidemic agents |
| US4110351A (en) * | 1973-04-02 | 1978-08-29 | Richardson-Merrell Inc. | Hypolipidemic agents RO- or RS- substituted furoic acids, esters and salts |
| GB1421792A (en) | 1973-05-17 | 1976-01-21 | Smith Kline French Lab | Heterocyclic substituted-1, 1-diamino-ethylene derivatives methods for their preparation and compositions containing them |
| DK452578A (da) * | 1977-10-11 | 1979-04-12 | Glaxo Group Ltd | Fremgangsmaade til fremstilling af furanderivater |
-
1976
- 1976-08-04 GB GB32465/76A patent/GB1565966A/en not_active Expired
-
1977
- 1977-07-22 GB GB28187/78A patent/GB1565967A/en not_active Expired
- 1977-07-25 US US05/818,762 patent/US4128658A/en not_active Expired - Lifetime
- 1977-07-28 DE DE2734070A patent/DE2734070C2/de not_active Expired
- 1977-07-29 CA CA283,694A patent/CA1099268A/en not_active Expired
- 1977-08-01 AU AU27519/77A patent/AU515628B2/en not_active Expired
- 1977-08-02 BE BE179834A patent/BE857388A/xx not_active IP Right Cessation
- 1977-08-03 NL NLAANVRAGE7708601,A patent/NL178320C/xx not_active IP Right Cessation
- 1977-08-03 LU LU77911A patent/LU77911A1/xx unknown
- 1977-08-04 FR FR7724021A patent/FR2360587B1/fr not_active Expired
- 1977-08-04 JP JP52093722A patent/JPS5840956B2/ja not_active Expired
-
1978
- 1978-05-12 FR FR7814250A patent/FR2384765B1/fr not_active Expired
- 1978-05-12 FR FR7814251A patent/FR2384753B1/fr not_active Expired
- 1978-10-13 US US05/951,025 patent/US4279819A/en not_active Expired - Lifetime
- 1978-10-13 US US05/951,026 patent/US4255440A/en not_active Expired - Lifetime
-
1980
- 1980-03-21 JP JP3601580A patent/JPS55153761A/ja active Pending
- 1980-03-21 JP JP3601680A patent/JPS55153779A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5318557A (en) | 1978-02-20 |
| FR2384765B1 (fr) | 1982-09-10 |
| FR2384765A1 (fr) | 1978-10-20 |
| DE2734070C2 (de) | 1983-12-29 |
| FR2384753B1 (fr) | 1981-06-12 |
| FR2384753A1 (fr) | 1978-10-20 |
| US4279819A (en) | 1981-07-21 |
| JPS55153779A (en) | 1980-11-29 |
| JPS6132315B2 (cg-RX-API-DMAC10.html) | 1986-07-25 |
| NL178320C (nl) | 1986-03-03 |
| JPS55153761A (en) | 1980-11-29 |
| JPS5840956B2 (ja) | 1983-09-08 |
| US4128658A (en) | 1978-12-05 |
| FR2360587B1 (fr) | 1981-07-17 |
| DE2734070A1 (de) | 1978-02-09 |
| AU515628B2 (en) | 1981-04-16 |
| BE857388A (fr) | 1978-02-02 |
| GB1565966A (en) | 1980-04-23 |
| LU77911A1 (fr) | 1979-05-23 |
| NL7708601A (nl) | 1978-02-07 |
| GB1565967A (en) | 1980-04-23 |
| US4255440A (en) | 1981-03-10 |
| AU2751977A (en) | 1979-02-08 |
| FR2360587A1 (fr) | 1978-03-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1099268A (en) | Aminoalkyl-furanylalkyl-urea derivatives | |
| EP0002930B1 (en) | Amine derivatives, their preparation and pharmaceutical compositions containing them | |
| GB1601459A (en) | Aminoalkyl thiophene derivatives | |
| DE3340967A1 (de) | Neue aminderivate, salze derselben, verfahren zur herstellung derselben sowie anti-ulcusmittel mit einem gehalt derselben | |
| US4288443A (en) | Substituted furan compounds and pharmaceutical compositions containing them | |
| EP0028483A1 (en) | 1,2,4-Triazole derivatives, processes for the preparation thereof and pharmaceutical compositions containing them | |
| US4169855A (en) | N'-derivatives of n-(2-mercapto-ethyl)-2-nitro-1,1-ethenediamine | |
| EP0029303B1 (en) | 1,2,4-triazole derivatives, processes for their production and pharmaceutical compositions containing them | |
| CA1069904A (en) | Pharmacologically active sulfoxide derivatives | |
| EP0029306B1 (en) | Aminoalkyl compounds, their production and pharmaceutical compositions containing them | |
| GB1575904A (en) | Phenyl piperazines | |
| EP0049049A1 (en) | 5-Amino-tetrazole derivatives, processes for their preparation and pharmaceutical compositions containing them | |
| US4016154A (en) | Novel derivative of N-(3,4,5-trimethoxy cinnamoyl) piperazine, its acid addition salts, its process of preparation and its therapeutic application | |
| AT390952B (de) | Verfahren zur herstellung von neuen furan- oder thiophenderivaten | |
| IE45456B1 (en) | Aminoalkyl furan derivatives | |
| GB2104071A (en) | Furan derivatives | |
| US4491586A (en) | Amine derivatives | |
| GB2085871A (en) | New 3-substituted-2-propenimidamides and method of manufacturing the same | |
| KR810000355B1 (ko) | 아미노 알킬푸란 유도체의 제조방법 | |
| KR810000356B1 (ko) | 아미노 알킬푸란 유도체의 제조방법 | |
| CA1070316A (en) | Pharmacologically active bis imidazolyl guanidines | |
| DK149812B (da) | Analogifremgangsmaade til fremstilling af aminoalkylfuranderivater | |
| JPS6058236B2 (ja) | 新規なアミノアルキルフラン誘導体、それらの製造法およびそれらを含有する医薬組成物 | |
| CH651560A5 (en) | Aminoalkylfuran derivatives, and drugs containing these compounds | |
| HU185001B (en) | Process for preparing pharmaceutically active amino-alkyl-furane derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |