CA1068271A - N-aryl-n-(1-l-4-piperidinyl)-arylacetamides - Google Patents
N-aryl-n-(1-l-4-piperidinyl)-arylacetamidesInfo
- Publication number
- CA1068271A CA1068271A CA261,551A CA261551A CA1068271A CA 1068271 A CA1068271 A CA 1068271A CA 261551 A CA261551 A CA 261551A CA 1068271 A CA1068271 A CA 1068271A
- Authority
- CA
- Canada
- Prior art keywords
- parts
- group
- piperidinyl
- formula
- appropriate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 claims abstract description 33
- 239000000203 mixture Substances 0.000 claims description 55
- 150000001875 compounds Chemical class 0.000 claims description 52
- -1 di-substituted phenyl Chemical group 0.000 claims description 47
- 150000003839 salts Chemical class 0.000 claims description 38
- 239000002253 acid Substances 0.000 claims description 37
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 36
- 125000000217 alkyl group Chemical group 0.000 claims description 26
- 239000000047 product Substances 0.000 claims description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 16
- 125000006239 protecting group Chemical group 0.000 claims description 13
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 11
- 239000007858 starting material Substances 0.000 claims description 11
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- PZXDYQVSAFZTBI-UHFFFAOYSA-N n-(4-chlorophenyl)-2-phenyl-n-piperidin-4-ylacetamide Chemical compound C1=CC(Cl)=CC=C1N(C(=O)CC=1C=CC=CC=1)C1CCNCC1 PZXDYQVSAFZTBI-UHFFFAOYSA-N 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 claims description 5
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 238000005904 alkaline hydrolysis reaction Methods 0.000 claims description 4
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 150000001299 aldehydes Chemical class 0.000 claims description 2
- IUKQLMGVFMDQDP-UHFFFAOYSA-N azane;piperidine Chemical group N.C1CCNCC1 IUKQLMGVFMDQDP-UHFFFAOYSA-N 0.000 claims description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 claims description 2
- 238000006894 reductive elimination reaction Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 4
- 239000000126 substance Substances 0.000 claims 4
- ORAWRMFWMOWNSJ-UHFFFAOYSA-N 2-(3-chlorophenyl)-N-(1-cyclohexylpiperidin-4-yl)-N-phenylacetamide Chemical compound ClC=1C=C(C=CC1)CC(=O)N(C1=CC=CC=C1)C1CCN(CC1)C1CCCCC1 ORAWRMFWMOWNSJ-UHFFFAOYSA-N 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 2
- XHOJAWVAWFHGHL-UHFFFAOYSA-N lorcainide Chemical compound C1CN(C(C)C)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=CC=C1 XHOJAWVAWFHGHL-UHFFFAOYSA-N 0.000 claims 2
- OKUKTFTVDGOSEF-UHFFFAOYSA-N n-(4-chlorophenyl)-n-(1-ethylpiperidin-4-yl)-2-phenylacetamide Chemical compound C1CN(CC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=CC=C1 OKUKTFTVDGOSEF-UHFFFAOYSA-N 0.000 claims 2
- PYPMKORNJLTHGP-UHFFFAOYSA-N 2-(3-chlorophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=CC(Cl)=C1 PYPMKORNJLTHGP-UHFFFAOYSA-N 0.000 claims 1
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 claims 1
- 238000007126 N-alkylation reaction Methods 0.000 claims 1
- 239000012467 final product Substances 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 239000003416 antiarrhythmic agent Substances 0.000 abstract description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 100
- 239000000243 solution Substances 0.000 description 62
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 50
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 47
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 46
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 46
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 46
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 45
- 239000002585 base Substances 0.000 description 34
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 33
- 239000011541 reaction mixture Substances 0.000 description 33
- 239000000706 filtrate Substances 0.000 description 24
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- 238000010992 reflux Methods 0.000 description 21
- 239000000284 extract Substances 0.000 description 19
- 229960004592 isopropanol Drugs 0.000 description 19
- 238000003756 stirring Methods 0.000 description 19
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 229960001701 chloroform Drugs 0.000 description 18
- 239000007787 solid Substances 0.000 description 18
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 16
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 15
- 239000012458 free base Substances 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 15
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 13
- 239000000543 intermediate Substances 0.000 description 13
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 13
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 239000003480 eluent Substances 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 229960000443 hydrochloric acid Drugs 0.000 description 9
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 9
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 7
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 238000004440 column chromatography Methods 0.000 description 6
- 230000000875 corresponding effect Effects 0.000 description 6
- 230000008030 elimination Effects 0.000 description 6
- 238000003379 elimination reaction Methods 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 229960001866 silicon dioxide Drugs 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 5
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical class OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 5
- 238000005903 acid hydrolysis reaction Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 5
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 5
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 5
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 238000010934 O-alkylation reaction Methods 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 235000011118 potassium hydroxide Nutrition 0.000 description 4
- 229940093932 potassium hydroxide Drugs 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 206010015856 Extrasystoles Diseases 0.000 description 3
- 208000000418 Premature Cardiac Complexes Diseases 0.000 description 3
- 150000001335 aliphatic alkanes Chemical class 0.000 description 3
- 230000003288 anthiarrhythmic effect Effects 0.000 description 3
- 239000011260 aqueous acid Substances 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 150000004982 aromatic amines Chemical class 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 125000003386 piperidinyl group Chemical group 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 3
- 229930192474 thiophene Natural products 0.000 description 3
- KNSLGPATJQAECH-UHFFFAOYSA-N 2-phenylacetamide;hydrochloride Chemical compound Cl.NC(=O)CC1=CC=CC=C1 KNSLGPATJQAECH-UHFFFAOYSA-N 0.000 description 2
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 2
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 2
- 150000001266 acyl halides Chemical class 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- LIKFZBWZGQWAMR-UHFFFAOYSA-N ethyl 4-(pyridin-2-ylamino)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=CC=CC=N1 LIKFZBWZGQWAMR-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- JLLCBWRGOGXRBX-UHFFFAOYSA-N n-(4-chlorophenyl)-1-propan-2-ylpiperidin-4-amine Chemical compound C1CN(C(C)C)CCC1NC1=CC=C(Cl)C=C1 JLLCBWRGOGXRBX-UHFFFAOYSA-N 0.000 description 2
- HQPSCRCCYZGOIV-UHFFFAOYSA-N n-piperidin-4-ylpyrimidin-2-amine Chemical compound C1CNCCC1NC1=NC=CC=N1 HQPSCRCCYZGOIV-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical group 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 238000010606 normalization Methods 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 2
- 230000033764 rhythmic process Effects 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- WTOYUGZUPNQZHG-UHFFFAOYSA-N (4-anilino-1-benzylpiperidin-4-yl)methanol Chemical compound C1CC(CO)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 WTOYUGZUPNQZHG-UHFFFAOYSA-N 0.000 description 1
- OJUNHCSAANMXKJ-ONEGZZNKSA-N (E)-4-oxo-4-thiophen-2-yloxybut-2-enoic acid Chemical compound C1=CSC(=C1)OC(=O)/C=C/C(=O)O OJUNHCSAANMXKJ-ONEGZZNKSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OOPATDCMAHMTSE-UHFFFAOYSA-N 1-benzyl-4-(ethoxymethyl)-n-phenylpiperidin-4-amine Chemical compound C1CC(COCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 OOPATDCMAHMTSE-UHFFFAOYSA-N 0.000 description 1
- YPTJBIYNKWHSRB-UHFFFAOYSA-N 1-benzyl-n-(4-fluorophenyl)-4-(methoxymethyl)piperidin-4-amine Chemical compound C1CC(COC)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 YPTJBIYNKWHSRB-UHFFFAOYSA-N 0.000 description 1
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- JFLUVKCJIMSNJM-UHFFFAOYSA-N 2-(1-chlorocyclohexa-2,4-dien-1-yl)-n-(4-chlorophenyl)-n-piperidin-4-ylacetamide;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1N(C(=O)CC1(Cl)C=CC=CC1)C1CCNCC1 JFLUVKCJIMSNJM-UHFFFAOYSA-N 0.000 description 1
- CJJURHKDGQSBLE-UHFFFAOYSA-N 2-(3,4-dichlorophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=C(Cl)C(Cl)=C1 CJJURHKDGQSBLE-UHFFFAOYSA-N 0.000 description 1
- BGGKEDDFKBVTDK-UHFFFAOYSA-N 2-(3-methylphenyl)acetyl chloride Chemical compound CC1=CC=CC(CC(Cl)=O)=C1 BGGKEDDFKBVTDK-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- UUPZTFTUZUQRQT-UHFFFAOYSA-N 2-thiophen-2-ylacetamide Chemical compound NC(=O)CC1=CC=CS1 UUPZTFTUZUQRQT-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- MKBOBWSGAIPQGV-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenyl-1-propan-2-ylpiperidin-4-amine Chemical compound C=1C=CC=CC=1NC1(COC)CCN(C(C)C)CC1 MKBOBWSGAIPQGV-UHFFFAOYSA-N 0.000 description 1
- PUFOFCNHIWPPNN-UHFFFAOYSA-N 4-anilino-1-benzylpiperidine-4-carboxamide Chemical compound C1CC(C(=O)N)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 PUFOFCNHIWPPNN-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- IZTJJKZPDBUODZ-UHFFFAOYSA-N C(C(=O)O)(=O)O.N1(CCCCC1)C(=O)O Chemical compound C(C(=O)O)(=O)O.N1(CCCCC1)C(=O)O IZTJJKZPDBUODZ-UHFFFAOYSA-N 0.000 description 1
- CJGQPNZLGWXNHM-UHFFFAOYSA-N Cl.NC(=O)CC1=C(C=CC=C1)C1=CC=CC=C1 Chemical compound Cl.NC(=O)CC1=C(C=CC=C1)C1=CC=CC=C1 CJGQPNZLGWXNHM-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 101100011511 Mus musculus Elovl6 gene Proteins 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-L Oxalate Chemical compound [O-]C(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-L 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical group C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 208000036366 Sensation of pressure Diseases 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 1
- AXJDEHNQPMZKOS-UHFFFAOYSA-N acetylazanium;chloride Chemical compound [Cl-].CC([NH3+])=O AXJDEHNQPMZKOS-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 150000001412 amines Chemical group 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 230000006793 arrhythmia Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000000332 continued effect Effects 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- RMEDXOLNCUSCGS-UHFFFAOYSA-N droperidol Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CC=C(N2C(NC3=CC=CC=C32)=O)CC1 RMEDXOLNCUSCGS-UHFFFAOYSA-N 0.000 description 1
- 229960000394 droperidol Drugs 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- YWPZNKNNUDFQFZ-UHFFFAOYSA-N ethyl 4-(pyrimidin-2-ylamino)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1NC1=NC=CC=N1 YWPZNKNNUDFQFZ-UHFFFAOYSA-N 0.000 description 1
- CPDREELMVQAIKC-UHFFFAOYSA-N ethyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 CPDREELMVQAIKC-UHFFFAOYSA-N 0.000 description 1
- LUBGFMZTGFXIIN-UHFFFAOYSA-N ethyl 4-oxopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)CC1 LUBGFMZTGFXIIN-UHFFFAOYSA-N 0.000 description 1
- MULIJFXPCXLEPU-UHFFFAOYSA-N ethyl 4-pyridin-2-yliminopiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1=NC1=CC=CC=N1 MULIJFXPCXLEPU-UHFFFAOYSA-N 0.000 description 1
- BRJBQXWFFZKEJD-UHFFFAOYSA-N ethyl 4-pyrimidin-2-yliminopiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1=NC1=NC=CC=N1 BRJBQXWFFZKEJD-UHFFFAOYSA-N 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- NPNNCHCGYDKUTA-UHFFFAOYSA-N methyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 NPNNCHCGYDKUTA-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- CFCQMLAMFCRMIO-UHFFFAOYSA-N n,2-bis(4-chlorophenyl)-n-(1-propylpiperidin-4-yl)acetamide Chemical compound C1CN(CCC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=C(Cl)C=C1 CFCQMLAMFCRMIO-UHFFFAOYSA-N 0.000 description 1
- XFXULBACFFSBLW-UHFFFAOYSA-N n,2-bis(4-chlorophenyl)-n-piperidin-4-ylacetamide Chemical compound C1=CC(Cl)=CC=C1CC(=O)N(C=1C=CC(Cl)=CC=1)C1CCNCC1 XFXULBACFFSBLW-UHFFFAOYSA-N 0.000 description 1
- ZJQSDRIXGUWYDM-UHFFFAOYSA-N n-(1-cyclopentylpiperidin-4-yl)-2-(3-methylphenyl)-n-pyridin-3-ylacetamide;oxalic acid Chemical compound OC(=O)C(O)=O.CC1=CC=CC(CC(=O)N(C2CCN(CC2)C2CCCC2)C=2C=NC=CC=2)=C1 ZJQSDRIXGUWYDM-UHFFFAOYSA-N 0.000 description 1
- JZMJTOMXVMWFES-UHFFFAOYSA-N n-(1-cyclopentylpiperidin-4-yl)pyrimidin-2-amine Chemical compound C1CCCC1N1CCC(NC=2N=CC=CN=2)CC1 JZMJTOMXVMWFES-UHFFFAOYSA-N 0.000 description 1
- CVTBGLRLBNLKPS-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-1-methylpiperidin-4-amine Chemical compound C1CN(C)CCC1NC1=C(C)C=CC=C1C CVTBGLRLBNLKPS-UHFFFAOYSA-N 0.000 description 1
- NYKYCCXAHBGMOF-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-2-phenyl-n-piperidin-4-ylacetamide Chemical compound CC1=CC=CC(C)=C1N(C(=O)CC=1C=CC=CC=1)C1CCNCC1 NYKYCCXAHBGMOF-UHFFFAOYSA-N 0.000 description 1
- VUIZXNOFBJYZET-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-2-phenyl-n-piperidin-4-ylacetamide;hydrobromide Chemical compound Br.CC1=CC=CC(C)=C1N(C(=O)CC=1C=CC=CC=1)C1CCNCC1 VUIZXNOFBJYZET-UHFFFAOYSA-N 0.000 description 1
- YBORSQLTSFNGCR-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-n-(1-propylpiperidin-4-yl)-2-thiophen-2-ylacetamide;dihydrochloride Chemical compound Cl.Cl.C1CN(CCC)CCC1N(C=1C(=CC=CC=1C)C)C(=O)CC1=CC=CS1 YBORSQLTSFNGCR-UHFFFAOYSA-N 0.000 description 1
- GGZSZUZDQOCVBK-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-n-piperidin-4-yl-2-thiophen-2-ylacetamide Chemical compound CC1=CC=CC(C)=C1N(C(=O)CC=1SC=CC=1)C1CCNCC1 GGZSZUZDQOCVBK-UHFFFAOYSA-N 0.000 description 1
- GCVDVSQZZZAYHM-UHFFFAOYSA-N n-(2,6-dimethylphenyl)piperidin-4-amine Chemical compound CC1=CC=CC(C)=C1NC1CCNCC1 GCVDVSQZZZAYHM-UHFFFAOYSA-N 0.000 description 1
- XDBCXBKGHRTYJO-UHFFFAOYSA-N n-(2,6-dimethylphenyl)piperidin-4-amine;dihydrobromide Chemical compound Br.Br.CC1=CC=CC(C)=C1NC1CCNCC1 XDBCXBKGHRTYJO-UHFFFAOYSA-N 0.000 description 1
- IBHRJZFTQGPXPD-UHFFFAOYSA-N n-(2-chlorophenyl)-2-phenyl-n-piperidin-4-ylacetamide Chemical compound ClC1=CC=CC=C1N(C(=O)CC=1C=CC=CC=1)C1CCNCC1 IBHRJZFTQGPXPD-UHFFFAOYSA-N 0.000 description 1
- IDXQVTXVVVODGJ-UHFFFAOYSA-N n-(4-chlorophenyl)-1-prop-2-enylpiperidin-4-amine Chemical compound C1=CC(Cl)=CC=C1NC1CCN(CC=C)CC1 IDXQVTXVVVODGJ-UHFFFAOYSA-N 0.000 description 1
- PZCLNWWBKSADDQ-UHFFFAOYSA-N n-(4-chlorophenyl)-2-(3-methoxyphenyl)-n-piperidin-4-ylacetamide Chemical compound COC1=CC=CC(CC(=O)N(C2CCNCC2)C=2C=CC(Cl)=CC=2)=C1 PZCLNWWBKSADDQ-UHFFFAOYSA-N 0.000 description 1
- BGOHVARCGIKWKF-UHFFFAOYSA-N n-(4-chlorophenyl)-2-phenyl-n-piperidin-4-ylacetamide;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1N(C(=O)CC=1C=CC=CC=1)C1CCNCC1 BGOHVARCGIKWKF-UHFFFAOYSA-N 0.000 description 1
- RPYGYLFPBYZJTO-UHFFFAOYSA-N n-(4-chlorophenyl)-n-(1-ethylpiperidin-4-yl)-2-(3-methylphenyl)acetamide Chemical compound C1CN(CC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=CC(C)=C1 RPYGYLFPBYZJTO-UHFFFAOYSA-N 0.000 description 1
- KTJCTQMCOFGIPC-UHFFFAOYSA-N n-(4-chlorophenyl)-n-(1-ethylpiperidin-4-yl)-2-phenylacetamide;hydrochloride Chemical compound Cl.C1CN(CC)CCC1N(C=1C=CC(Cl)=CC=1)C(=O)CC1=CC=CC=C1 KTJCTQMCOFGIPC-UHFFFAOYSA-N 0.000 description 1
- GZFOECASLPBAMA-UHFFFAOYSA-N n-(4-chlorophenyl)-n-piperidin-4-yl-2-thiophen-2-ylacetamide;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1N(C(=O)CC=1SC=CC=1)C1CCNCC1 GZFOECASLPBAMA-UHFFFAOYSA-N 0.000 description 1
- KCOHNRMFXQLTCW-UHFFFAOYSA-N n-(4-chlorophenyl)piperidin-4-amine Chemical compound C1=CC(Cl)=CC=C1NC1CCNCC1 KCOHNRMFXQLTCW-UHFFFAOYSA-N 0.000 description 1
- YLAIUOADIPJFOS-UHFFFAOYSA-N n-chloro-2-phenylacetamide Chemical compound ClNC(=O)CC1=CC=CC=C1 YLAIUOADIPJFOS-UHFFFAOYSA-N 0.000 description 1
- SBSLCPHONZWKIE-UHFFFAOYSA-N n-piperidin-4-ylpyridin-2-amine Chemical compound C1CNCCC1NC1=CC=CC=N1 SBSLCPHONZWKIE-UHFFFAOYSA-N 0.000 description 1
- UUXXGTMOTIUHPW-UHFFFAOYSA-N n-piperidin-4-ylpyridin-3-amine Chemical compound C1CNCCC1NC1=CC=CN=C1 UUXXGTMOTIUHPW-UHFFFAOYSA-N 0.000 description 1
- BGEYIUJJXHLUPW-UHFFFAOYSA-N n-piperidin-4-ylpyrimidin-2-amine;dihydrochloride Chemical compound Cl.Cl.C1CNCCC1NC1=NC=CC=N1 BGEYIUJJXHLUPW-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical compound NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- XBXHCBLBYQEYTI-UHFFFAOYSA-N piperidin-4-ylmethanol Chemical compound OCC1CCNCC1 XBXHCBLBYQEYTI-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229960003975 potassium Drugs 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000002633 protecting effect Effects 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 229940116269 uric acid Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/06—Antiarrhythmics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
- C07D211/66—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4 having a hetero atom as the second substituent in position 4
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US61513175A | 1975-09-23 | 1975-09-23 | |
| US71375676A | 1976-08-12 | 1976-08-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1068271A true CA1068271A (en) | 1979-12-18 |
Family
ID=27087421
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA261,551A Expired CA1068271A (en) | 1975-09-23 | 1976-09-20 | N-aryl-n-(1-l-4-piperidinyl)-arylacetamides |
Country Status (29)
| Country | Link |
|---|---|
| JP (1) | JPS6016417B2 (enExample) |
| AT (1) | AT363935B (enExample) |
| AU (1) | AU510029B2 (enExample) |
| BG (1) | BG27543A3 (enExample) |
| CA (1) | CA1068271A (enExample) |
| CH (1) | CH628623A5 (enExample) |
| CS (1) | CS222663B2 (enExample) |
| DE (1) | DE2642856A1 (enExample) |
| DK (1) | DK150478C (enExample) |
| ES (1) | ES451768A1 (enExample) |
| FI (1) | FI61482C (enExample) |
| FR (1) | FR2325377A1 (enExample) |
| GB (1) | GB1539473A (enExample) |
| GR (1) | GR58469B (enExample) |
| HU (1) | HU172964B (enExample) |
| IE (1) | IE43802B1 (enExample) |
| IL (1) | IL50522A (enExample) |
| IT (1) | IT1073893B (enExample) |
| LU (1) | LU75837A1 (enExample) |
| NL (1) | NL187267C (enExample) |
| NO (1) | NO147672C (enExample) |
| NZ (1) | NZ181972A (enExample) |
| PH (1) | PH12497A (enExample) |
| PL (2) | PL117323B1 (enExample) |
| PT (1) | PT65631B (enExample) |
| RO (1) | RO70079A (enExample) |
| SE (1) | SE427839B (enExample) |
| SU (1) | SU747424A3 (enExample) |
| YU (1) | YU39973B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA765684B (en) * | 1975-09-23 | 1978-04-26 | Janssen Pharmaceutica Nv | Novel n-aryl-n-(1-l-4-piperidinyl)-arylacetamides |
| JPS62260786A (ja) * | 1986-05-08 | 1987-11-13 | 株式会社ヘキトク | 燻瓦の製造ラインにおける焼成工程後の表面仕上げ装置 |
| JO2769B1 (en) | 2005-10-26 | 2014-03-15 | جانسين فارماسوتيكا ان. في | Rapid decomposition of physiologically antagonistic agents of the 2-dopamine receptor |
| JO2642B1 (en) | 2006-12-08 | 2012-06-17 | جانسين فارماسوتيكا ان. في | Dopamine 2 receptor antagonists are rapidly hydrolyzed |
| JO2849B1 (en) | 2007-02-13 | 2015-03-15 | جانسين فارماسوتيكا ان. في | Dopamine 2 receptor antagonists are rapidly hydrolyzed |
| CN101663299A (zh) | 2007-04-23 | 2010-03-03 | 詹森药业有限公司 | 作为快速解离性多巴胺2受体拮抗剂的噻(二)唑类化合物 |
| KR20100016498A (ko) * | 2007-04-23 | 2010-02-12 | 얀센 파마슈티카 엔.브이. | 속해리성 도파민 2 수용체 길항제로서의 피리딘 유도체 |
| PL2148873T3 (pl) | 2007-04-23 | 2013-01-31 | Janssen Pharmaceutica Nv | Pochodne 4-alkoksypirydazynowe jako szybko dysocjujący antagoniści receptora dopaminowego 2 |
| EP2310374B1 (en) | 2008-07-03 | 2012-10-31 | Janssen Pharmaceutica N.V. | Substituted 6- (1-piperazinyl) -pyridazines as 5-ht6 receptor antagonists |
| KR101609218B1 (ko) | 2008-07-31 | 2016-04-05 | 얀센 파마슈티카 엔.브이. | 속해리성 도파민 2 수용체 길항제로서의 피페라진-1-일-트리플루오로메틸-치환된-피리딘 |
| CN118496638B (zh) * | 2024-07-22 | 2024-11-22 | 海安浩驰科技有限公司 | 一种抗紫外车窗膜及其制备方法 |
-
1976
- 1976-09-06 NO NO763054A patent/NO147672C/no unknown
- 1976-09-08 NZ NZ181972A patent/NZ181972A/xx unknown
- 1976-09-16 FR FR7627870A patent/FR2325377A1/fr active Granted
- 1976-09-17 AU AU17878/76A patent/AU510029B2/en not_active Expired
- 1976-09-20 CA CA261,551A patent/CA1068271A/en not_active Expired
- 1976-09-20 RO RO7687590A patent/RO70079A/ro unknown
- 1976-09-20 LU LU75837A patent/LU75837A1/xx unknown
- 1976-09-21 GB GB39099/76A patent/GB1539473A/en not_active Expired
- 1976-09-21 CH CH1194876A patent/CH628623A5/de not_active IP Right Cessation
- 1976-09-21 JP JP51112527A patent/JPS6016417B2/ja not_active Expired
- 1976-09-21 GR GR51742A patent/GR58469B/el unknown
- 1976-09-21 IT IT51370/76A patent/IT1073893B/it active
- 1976-09-21 IL IL50522A patent/IL50522A/xx unknown
- 1976-09-22 SE SE7610501A patent/SE427839B/xx not_active IP Right Cessation
- 1976-09-22 IE IE2095/76A patent/IE43802B1/en unknown
- 1976-09-22 AT AT0702976A patent/AT363935B/de not_active IP Right Cessation
- 1976-09-22 NL NLAANVRAGE7610513,A patent/NL187267C/xx not_active IP Right Cessation
- 1976-09-22 PL PL1976216213A patent/PL117323B1/pl unknown
- 1976-09-22 ES ES451768A patent/ES451768A1/es not_active Expired
- 1976-09-22 FI FI762698A patent/FI61482C/fi not_active IP Right Cessation
- 1976-09-22 HU HU76JA00000767A patent/HU172964B/hu not_active IP Right Cessation
- 1976-09-22 CS CS766139A patent/CS222663B2/cs unknown
- 1976-09-22 PT PT65631A patent/PT65631B/pt unknown
- 1976-09-22 PL PL19257876A patent/PL192578A1/xx not_active IP Right Cessation
- 1976-09-22 DK DK427876A patent/DK150478C/da active
- 1976-09-22 PH PH18928A patent/PH12497A/en unknown
- 1976-09-22 YU YU2336/76A patent/YU39973B/xx unknown
- 1976-09-23 BG BG034265A patent/BG27543A3/xx unknown
- 1976-09-23 DE DE19762642856 patent/DE2642856A1/de active Granted
- 1976-09-23 SU SU762405548A patent/SU747424A3/ru active
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1080232A (en) | N-(4-piperidinyl)-n-phenylamides and carbamates | |
| US4126689A (en) | N-aryl-n-(1-alkyl-4-piperidinyl)-arylacetamides | |
| CA2033497C (en) | 3-aminopiperidine derivatives and related nitrogen containing heterocycles | |
| CA1068271A (en) | N-aryl-n-(1-l-4-piperidinyl)-arylacetamides | |
| US4179569A (en) | N-(4-piperidinyl)-N-phenylamides | |
| CA2067834A1 (en) | Dialkylenepiperidino compounds and their enantiomers, process for preparing them and pharmaceutical compositions containing them | |
| US5039803A (en) | Process for preparing aryl-substituted piperidines | |
| EP0034415A1 (en) | 1-(Cyclohexyl or cyclohexenyl)-4-aryl-4-piperidinecarboxylic acid derivatives | |
| CA1246564A (en) | 1-(AMINOALKYL) -.alpha., .alpha.-DIARYL PYRROLIDINE-, PIPERIDINE- AND HOMOPIPERIDINE- ACETAMIDES AND ACETONITRILES | |
| JPS5916875A (ja) | 新規アリ−ルピペリジン誘導体の製造方法 | |
| US2727895A (en) | Alpha-alkylated, 4-benzyl pyridines and certain substitution derivatives | |
| DE60309251T2 (de) | Verfahren zur Herstellung von Donepezil | |
| US3850935A (en) | Process for producing piperidine derivatives by degrading quaternary piperidinium salts | |
| US4197304A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| US4151286A (en) | N-aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| US3158609A (en) | Diphenylmethyl-1-aminopiperidine hydrazones and congeners | |
| US4755599A (en) | 3-phenyl-2-propeneamine derivatives, their preparation and composition containing them | |
| CA1105464A (en) | (4,5-dihydro-5-oxo-1h-tetrazol-1-yl)ethyl-4-¬(1-oxo- propyl)phenylamino|-4-piperidine carboxylate compounds | |
| JPS60202859A (ja) | 3―アミノアゼチジン化合物及びその製造方法 | |
| EP0360275A2 (en) | Imidazole antiarrhythmics | |
| US4197303A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| US4198411A (en) | N-aryl-N-(1-L-4-piperidinyl)-arylaceytamides | |
| US4208418A (en) | N-Aryl-N-(1-alkyl-4-piperidinyl)arylacetamides | |
| US3217008A (en) | 4-alkoxycarbonyl-1-amino-4-phenyl-piperidines, derivatives thereof and intermediates thereto | |
| US4122180A (en) | Isoquinolines and anti-depressants containing them |