BG61323B2 - Производни на пиперидина,тяхното получаване и използването им като лекарства - Google Patents
Производни на пиперидина,тяхното получаване и използването им като лекарства Download PDFInfo
- Publication number
- BG61323B2 BG61323B2 BG098345A BG9834593A BG61323B2 BG 61323 B2 BG61323 B2 BG 61323B2 BG 098345 A BG098345 A BG 098345A BG 9834593 A BG9834593 A BG 9834593A BG 61323 B2 BG61323 B2 BG 61323B2
- Authority
- BG
- Bulgaria
- Prior art keywords
- hydrochloride
- solution
- paroxetine
- crystalline
- paroxetine hydrochloride
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 13
- 239000003814 drug Substances 0.000 title claims abstract description 5
- 150000003053 piperidines Chemical class 0.000 title 1
- AHOUBRCZNHFOSL-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine Chemical compound C1=CC(F)=CC=C1C1C(COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-UHFFFAOYSA-N 0.000 claims abstract description 51
- 229960005183 paroxetine hydrochloride Drugs 0.000 claims abstract description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 45
- AHOUBRCZNHFOSL-YOEHRIQHSA-N (+)-Casbol Chemical compound C1=CC(F)=CC=C1[C@H]1[C@H](COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-YOEHRIQHSA-N 0.000 claims description 44
- 229960002296 paroxetine Drugs 0.000 claims description 36
- 238000000034 method Methods 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 16
- 239000012458 free base Substances 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 9
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 230000006196 deacetylation Effects 0.000 claims description 4
- 238000003381 deacetylation reaction Methods 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 229940124597 therapeutic agent Drugs 0.000 abstract description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 43
- 239000000243 solution Substances 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- 238000002425 crystallisation Methods 0.000 description 8
- 230000008025 crystallization Effects 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 7
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- MWUISCCBFHLWLY-UHFFFAOYSA-N 1,2-dimethylpiperidine Chemical compound CC1CCCCN1C MWUISCCBFHLWLY-UHFFFAOYSA-N 0.000 description 4
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PQLFROTZSIMBKR-UHFFFAOYSA-N ethenyl carbonochloridate Chemical compound ClC(=O)OC=C PQLFROTZSIMBKR-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- QDUXDCXILAPLAG-UHFFFAOYSA-N hydron;1-methylpiperidine;chloride Chemical compound Cl.CN1CCCCC1 QDUXDCXILAPLAG-UHFFFAOYSA-N 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- -1 nitro, acetylamino, methylsulfonyl Chemical group 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 208000020401 Depressive disease Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- RQBJOWKBGCDPOS-RVXRQPKJSA-N acetic acid;(3s,4r)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine Chemical class CC(O)=O.C1=CC(F)=CC=C1[C@H]1[C@H](COC=2C=C3OCOC3=CC=2)CNCC1 RQBJOWKBGCDPOS-RVXRQPKJSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940005513 antidepressants Drugs 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- QOPVNWQGBQYBBP-UHFFFAOYSA-N chloroethyl chloroformate Chemical compound CC(Cl)OC(Cl)=O QOPVNWQGBQYBBP-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229910052925 anhydrite Inorganic materials 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000010583 slow cooling Methods 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 125000004950 trifluoroalkyl group Chemical group 0.000 description 1
- 239000003021 water soluble solvent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/26—Psychostimulants, e.g. nicotine, cocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Psychiatry (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Pain & Pain Management (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB858526408A GB8526408D0 (en) | 1985-10-25 | 1985-10-25 | Chemical process |
| GB858526407A GB8526407D0 (en) | 1985-10-25 | 1985-10-25 | Compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BG61323B2 true BG61323B2 (bg) | 1997-05-30 |
Family
ID=26289934
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BG098345A BG61323B2 (bg) | 1985-10-25 | 1993-12-29 | Производни на пиперидина,тяхното получаване и използването им като лекарства |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4721723A (no) |
| EP (1) | EP0223403B1 (no) |
| JP (1) | JPH0647587B2 (no) |
| AU (1) | AU593295B2 (no) |
| BG (1) | BG61323B2 (no) |
| CA (1) | CA1287060C (no) |
| CY (1) | CY1743A (no) |
| CZ (1) | CZ391091A3 (no) |
| DE (1) | DE3688827T2 (no) |
| DK (1) | DK171694B1 (no) |
| ES (1) | ES2058061T3 (no) |
| FI (1) | FI87785C (no) |
| HK (1) | HK125993A (no) |
| IE (1) | IE59901B1 (no) |
| NO (1) | NO171453C (no) |
| NZ (1) | NZ218047A (no) |
| PT (1) | PT83608B (no) |
| SK (1) | SK391091A3 (no) |
Families Citing this family (153)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE66332B1 (en) * | 1986-11-03 | 1995-12-27 | Novo Nordisk As | Piperidine compounds and their preparation and use |
| DK231088D0 (da) * | 1988-04-28 | 1988-04-28 | Ferrosan As | Piperidinforbindelser, deres fremstilling og anvendelse |
| DK58291D0 (da) * | 1991-04-02 | 1991-04-02 | Novo Nordisk As | Krystalinsk stof og dets fremstilling |
| GB9209687D0 (en) * | 1992-05-06 | 1992-06-17 | Smithkline Beecham Plc | Novel process |
| US5258517A (en) * | 1992-08-06 | 1993-11-02 | Sepracor, Inc. | Method of preparing optically pure precursors of paroxetine |
| US5276042A (en) * | 1993-04-16 | 1994-01-04 | Crenshaw Roger T | Treatment of premature ejaculation |
| EP0639568A1 (en) * | 1993-08-19 | 1995-02-22 | Novo Nordisk A/S | Piperidine compounds, their preparation and use in the treatment of neurodegenerative disorders |
| US20020086053A1 (en) * | 1993-12-15 | 2002-07-04 | Smithkline Beecham Plc | Formulations, tablets of paroxetine and process to prepare them |
| GB9325644D0 (en) * | 1993-12-15 | 1994-02-16 | Smithkline Beecham Plc | Novel formulation |
| ES2102295B1 (es) * | 1994-03-18 | 1998-04-01 | Ferrer Int | Nuevos compuestos derivados de la n-benzoilmetil-piperidina. |
| SK283608B6 (sk) * | 1995-02-06 | 2003-10-07 | Smithkline Beecham Plc | Bezvodý hydrochlorid paroxetínu, spôsob jeho výroby a použitie |
| ES2149726B1 (es) * | 1995-02-06 | 2001-06-16 | Smithkline Beecham Plc | Nuevos compuestos de paroxetina. |
| GB9502297D0 (en) | 1995-02-06 | 1995-03-29 | Smithkline Beecham Plc | Novel compound |
| GB2297550B (en) * | 1995-02-06 | 1997-04-09 | Smithkline Beecham Plc | Paroxetine hydrochloride anhydrate substantially free of bound organic solvent |
| US5856493A (en) * | 1995-02-06 | 1999-01-05 | Smithkline Beecham Corporation | Process for making novel form of paroxeting hydrochloride anhydrate |
| US6548084B2 (en) * | 1995-07-20 | 2003-04-15 | Smithkline Beecham Plc | Controlled release compositions |
| GB9605828D0 (en) * | 1996-03-20 | 1996-05-22 | Smithkline Beecham Plc | Treatment method |
| CA2206592A1 (en) * | 1996-05-30 | 1997-11-30 | Shu-Zhong Wang | Method of producing amorphous paroxetine hydrochloride |
| JP3882224B2 (ja) * | 1996-05-31 | 2007-02-14 | 旭硝子株式会社 | パロキセチンの製造方法 |
| US5965555A (en) * | 1996-06-07 | 1999-10-12 | Hoechst Aktiengesellschaft | Xanthine compounds having terminally animated alkynol side chains |
| EP1384720A1 (en) * | 1996-06-13 | 2004-01-28 | SUMIKA FINE CHEMICALS Co., Ltd. | Process for drying paroxetine hydrochloride |
| HU221921B1 (hu) * | 1996-07-08 | 2003-02-28 | Richter Gedeon Vegyészeti Gyár Rt. | N-benzil-piperidin- és tetrahidropiridinszármazékok és eljárás azok előállítására |
| WO1998002556A2 (en) * | 1996-07-15 | 1998-01-22 | Smithkline Beecham Plc | Screening for and use of an esterase for a stereospecific resolution |
| US5672612A (en) * | 1996-09-09 | 1997-09-30 | Pentech Pharmaceuticals, Inc. | Amorphous paroxetine composition |
| US6638948B1 (en) | 1996-09-09 | 2003-10-28 | Pentech Pharmaceuticals, Inc. | Amorphous paroxetine composition |
| CA2193939C (en) * | 1996-12-24 | 2002-02-12 | K.S. Keshava Murthy | Useful form of anhydrous paroxetine hydrochloride |
| EP1078925A1 (en) * | 1997-06-10 | 2001-02-28 | Synthon B.V. | 4-Phenylpiperidine compounds |
| US5955475A (en) * | 1997-06-30 | 1999-09-21 | Endo Pharmaceuticals Inc. | Process for manufacturing paroxetine solid dispersions |
| GB9726907D0 (en) * | 1997-12-19 | 1998-02-18 | Smithkline Beecham Plc | Novel compounds |
| KR20010040711A (ko) * | 1998-02-06 | 2001-05-15 | 피터 기딩스 | 파록세틴의 염 |
| AP2000001907A0 (en) * | 1998-03-16 | 2000-09-30 | Smithkline Beecham Plc | Crystalline form of paroxetine. |
| US6699882B2 (en) | 1998-03-24 | 2004-03-02 | Smithkline Beecham P.L.C. | Paroxetine compositions |
| AU2003200534B2 (en) * | 1998-03-24 | 2004-12-02 | Smithkline Beecham Plc | Paroxetine compositions |
| GB9806312D0 (en) * | 1998-03-24 | 1998-05-20 | Smithkline Beecham Plc | Novel formulations |
| GB9808894D0 (en) * | 1998-04-25 | 1998-06-24 | Smithkline Beecham Plc | Novel compound |
| GB9808896D0 (en) * | 1998-04-25 | 1998-06-24 | Smithkline Beecham Plc | Novel compound |
| GB9812941D0 (en) * | 1998-06-16 | 1998-08-12 | Smithkline Beecham Plc | Method of treatment |
| US6300343B1 (en) | 1998-06-16 | 2001-10-09 | Smithkline Beecham Corporation | Method of treatment |
| GB9814316D0 (en) * | 1998-07-02 | 1998-09-02 | Smithkline Beecham Plc | Novel compounds |
| CH689805A8 (fr) * | 1998-07-02 | 2000-02-29 | Smithkline Beecham Plc | Méthanesulfonate de paroxétine, procédé pour sa préparation et compositions pharmaceutiques le contenant. |
| ES2138937B1 (es) | 1998-07-07 | 2000-10-01 | Medichem Sa | Polimorfo de maleato de paroxetina y formulaciones farmaceuticas que lo contienen. |
| PT1100796E (pt) * | 1998-08-07 | 2003-09-30 | Smithkline Beecham Plc | Processo para a preparacao de um cloridrato de paroxetina na forma anidra nao cristalina |
| EP1102764A1 (en) * | 1998-08-08 | 2001-05-30 | Smithkline Beecham Plc | Paroxetine salts |
| GB9824298D0 (en) * | 1998-11-05 | 1998-12-30 | Smithkline Beecham Plc | Novel process |
| GB9826176D0 (en) * | 1998-11-28 | 1999-01-20 | Smithkline Beecham Plc | Novel process |
| GB9826175D0 (en) * | 1998-11-28 | 1999-01-20 | Smithkline Beecham Plc | Novel process |
| GB9826178D0 (en) * | 1998-11-30 | 1999-01-20 | Smithkline Beecham Plc | Novel process |
| GB9826180D0 (en) * | 1998-11-30 | 1999-01-20 | Smithkline Beecham Plc | Novel process |
| GB9826171D0 (en) * | 1998-11-30 | 1999-01-20 | Smithkline Beecham Plc | Novel compounds |
| GB9826242D0 (en) * | 1998-11-30 | 1999-01-20 | Smithkline Beecham Plc | Novel process |
| WO2000032594A1 (en) * | 1998-11-30 | 2000-06-08 | Smithkline Beecham Plc | Mixed paroxetine propan-2-ol solvates |
| GB9827387D0 (en) * | 1998-12-11 | 1999-02-03 | Smithkline Beecham Plc | Novel process |
| GB9828780D0 (en) * | 1998-12-29 | 1999-02-17 | Smithkline Beecham Plc | Novel process |
| GB9828779D0 (en) * | 1998-12-29 | 1999-02-17 | Smithkline Beecham Plc | Novel process |
| GB9828781D0 (en) * | 1998-12-29 | 1999-02-17 | Smithkline Beecham Plc | Novel process |
| GB9828767D0 (en) * | 1998-12-29 | 1999-02-17 | Smithkline Beecham Plc | Novel process |
| EP1161241B1 (de) * | 1999-03-12 | 2005-12-07 | Aesica Pharmaceuticals Ltd. | Stabile pharmazeutische anwendungsform für paroxetin-anhydrat |
| FR2791345B1 (fr) * | 1999-03-26 | 2001-05-04 | Adir | Nouveaux derives du benzo[3,4]cyclobuta[1,2-c]pyrrole, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| US6245782B1 (en) | 1999-05-17 | 2001-06-12 | Heartdrug Research L.L.C. | Methods of inhibiting platelet activation with selective serotonin reuptake inhibitors |
| GB9914583D0 (en) * | 1999-06-22 | 1999-08-25 | Smithkline Beecham Plc | Novel process |
| GB9914585D0 (en) * | 1999-06-22 | 1999-08-25 | Smithkline Beecham Plc | Novel process |
| ATE248165T1 (de) | 1999-07-01 | 2003-09-15 | Italfarmaco Spa | Komplexe von paroxetin mit cyclodextrin oder cyclodextrin derivaten |
| GB9916187D0 (en) * | 1999-07-09 | 1999-09-08 | Smithkline Beecham Plc | Novel process |
| GB9919052D0 (en) * | 1999-08-12 | 1999-10-13 | Smithkline Beecham Plc | Novel compound composition and process |
| GB9923446D0 (en) * | 1999-10-04 | 1999-12-08 | Smithkline Beecham Plc | Novel process |
| US6503927B1 (en) | 1999-10-28 | 2003-01-07 | Pentech Pharmaceuticals, Inc. | Amorphous paroxetine composition |
| GB0003232D0 (en) * | 2000-02-11 | 2000-04-05 | Smithkline Beecham Plc | Novel composition |
| HU226912B1 (en) * | 2000-04-07 | 2010-03-01 | Richter Gedeon Nyrt | New paroxetin salt and medicament containing it |
| AU5702201A (en) * | 2000-04-13 | 2001-10-30 | Mayo Foundation | Abeta<sub>42</sub> lowering agents |
| US6660298B1 (en) * | 2000-07-27 | 2003-12-09 | Pentech Pharmaceuticals, Inc. | Paroxetine tablets and capsules |
| US20030109577A1 (en) * | 2000-10-27 | 2003-06-12 | Ken Liljegren | Pharmaceutical composition containing citalopram |
| DE20100529U1 (de) * | 2001-01-11 | 2001-05-10 | Synthon Bv | Pharmazeutische Tablette umfassend Paroxetinmesylat |
| US6610326B2 (en) | 2001-02-16 | 2003-08-26 | Andrx Corporation | Divalproex sodium tablets |
| US6720003B2 (en) * | 2001-02-16 | 2004-04-13 | Andrx Corporation | Serotonin reuptake inhibitor formulations |
| NL1017421C2 (nl) | 2001-02-21 | 2002-01-15 | Synthon Bv | Werkwijze voor het vervaardigen van paroxetine. |
| US6645946B1 (en) | 2001-03-27 | 2003-11-11 | Pro-Pharmaceuticals, Inc. | Delivery of a therapeutic agent in a formulation for reduced toxicity |
| CA2457382A1 (en) * | 2001-06-13 | 2002-12-19 | Teva Pharmaceutical Industries Ltd. | Process for the preparation of paroxetine substantially free of alkoxy impurities |
| IL159280A0 (en) * | 2001-06-14 | 2004-06-01 | Teva Pharma | A process for preparing paroxetine hcl which limits formation of pink colored compounds |
| EA006213B1 (ru) * | 2001-07-31 | 2005-10-27 | Х. Лундбекк А/С | Кристаллическая композиция, содержащая эсциталопрам |
| CA2456233A1 (en) * | 2001-08-02 | 2003-03-13 | Spurcourt Limited | Paroxetine isethionate salt, process of preparation and use in the treatment of depression |
| JP2005501066A (ja) * | 2001-08-09 | 2005-01-13 | スミスクライン ビーチャム パブリック リミテッド カンパニー | パロキセチンおよび医薬上許容されるグリチルリチン酸塩を含む組成物 |
| PT1440067E (pt) * | 2001-10-22 | 2005-02-28 | Synthon Bv | Derivados n-formilo de paroxetina |
| AU2002360775B9 (en) * | 2001-12-28 | 2008-07-24 | Teva Pharmaceutical Industries Ltd. | A stable pharmaceutical formulation of paroxetine hydrochloride and a process for preparation thereof |
| IL163666A0 (en) | 2002-02-22 | 2005-12-18 | New River Pharmaceuticals Inc | Active agent delivery systems and methods for protecting and administering active agents |
| AU2002259114A1 (en) * | 2002-02-22 | 2003-09-09 | Teva Pharmaceutical Industries Ltd. | Preparation of paroxetine involving novel intermediates |
| US6956121B2 (en) | 2002-03-01 | 2005-10-18 | Teva Pharmaceutical Industries Ltd. | Preparation of paroxetine involving novel intermediates |
| UA77536C2 (en) * | 2002-07-03 | 2006-12-15 | Lundbeck & Co As H | Secondary aminoaniline piperidines as mch1 antagonists and their use |
| US7407955B2 (en) | 2002-08-21 | 2008-08-05 | Boehringer Ingelheim Pharma Gmbh & Co., Kg | 8-[3-amino-piperidin-1-yl]-xanthines, the preparation thereof and their use as pharmaceutical compositions |
| JP4394004B2 (ja) * | 2002-09-19 | 2010-01-06 | 住友化学株式会社 | 結晶析出方法 |
| US20060041138A1 (en) * | 2002-09-19 | 2006-02-23 | Shigeya Yamazaki | Process for producing paroxetine hydrochloride hydrate |
| US20040220153A1 (en) * | 2002-09-24 | 2004-11-04 | Jost-Price Edward Roydon | Methods and reagents for the treatment of diseases and disorders associated with increased levels of proinflammatory cytokines |
| WO2004071431A2 (en) * | 2003-02-05 | 2004-08-26 | Myriad Genetics, Inc. | Method and composition for treating neurodegenerative disorders |
| DE602004004453T2 (de) * | 2003-03-12 | 2007-11-08 | Teva Pharmaceutical Industries Ltd. | Stabile pharmazeutische zusammensetzungen mit desloratadin |
| US20060135547A1 (en) * | 2003-03-12 | 2006-06-22 | Toth Zoltan G | Stable pharmaceutical compositions of desloratadine and processes for preparation of polymorphic forms of desloratadine |
| AU2004311577A1 (en) * | 2003-07-11 | 2005-07-21 | Myriad Genetics, Inc. | Pharmaceutical methods, dosing regimes and dosage forms for the treatment of Alzheimer's disease |
| EP1691811B1 (en) | 2003-12-11 | 2014-07-23 | Sunovion Pharmaceuticals Inc. | Combination of a sedative and a neurotransmitter modulator, and methods for improving sleep quality and treating depression |
| US20050154020A1 (en) * | 2004-01-14 | 2005-07-14 | Synaptic Pharmaceutical Corporation | 4-Aryl piperidines |
| US7501426B2 (en) | 2004-02-18 | 2009-03-10 | Boehringer Ingelheim International Gmbh | 8-[3-amino-piperidin-1-yl]-xanthines, their preparation and their use as pharmaceutical compositions |
| WO2006001877A2 (en) * | 2004-04-13 | 2006-01-05 | Myriad Genetics, Inc. | Combination treatment for neurodegenerative disorders comprising r-flurbiprofen |
| EP1737473A4 (en) * | 2004-04-19 | 2009-08-26 | Noven Therapeutics Llc | COMBINATIONS OF LITHIUM AND USES THEREOF |
| US20050252144A1 (en) * | 2004-04-29 | 2005-11-17 | Macdonald Robert A | Veneers for walls, retaining walls and the like |
| US20050266082A1 (en) * | 2004-05-26 | 2005-12-01 | Patel Satishkumar A | Preparation of stable paroxetine HC1 ER tablets using a melt granulation process |
| WO2006020852A2 (en) * | 2004-08-11 | 2006-02-23 | Myriad Genetics, Inc. | Pharmaceutical composition and method for treating neurodegenerative disorders |
| BRPI0514303A (pt) * | 2004-08-11 | 2008-06-10 | Myriad Genetics Inc | composição farmacêutica e método para tratar distúrbios neurodegenerativos |
| WO2006020850A2 (en) * | 2004-08-11 | 2006-02-23 | Myriad Genetics, Inc. | Pharmaceutical composition and method for treating neurodegenerative disorders |
| EP1778183B1 (en) * | 2004-08-18 | 2018-06-27 | Synthon B.V. | Liquid paroxetine compositions |
| EP1791531A1 (en) * | 2004-08-20 | 2007-06-06 | Alpharma, Inc. | Paroxetine formulations |
| KR100672184B1 (ko) * | 2004-09-21 | 2007-01-19 | 주식회사종근당 | 파록세틴의 콜린산 또는 콜린산 유도체 염 |
| DE102004054054A1 (de) | 2004-11-05 | 2006-05-11 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Verfahren zur Herstellung chiraler 8-(3-Amino-piperidin-1-yl)-xanthine |
| DE102004056398A1 (de) * | 2004-11-23 | 2006-05-24 | Bayer Materialscience Ag | Hydrolysestabile, hydrophobe, lösemittelfreie Polyole |
| US20060216345A1 (en) * | 2005-03-24 | 2006-09-28 | Sun Pharmaceutical Industries Limited | Oral pharmaceutical composition including paroxetine |
| ATE407933T1 (de) * | 2005-05-26 | 2008-09-15 | Apotecnia S A | Verfahren zur herstellung von paroxetin hydrochlorid hemihydrat |
| US20070015832A1 (en) * | 2005-07-14 | 2007-01-18 | Myriad Genetics, Incorporated | Methods of treating overactive bladder and urinary incontinence |
| CA2615063A1 (en) * | 2005-07-22 | 2007-02-01 | Myriad Genetics, Inc. | High drug load formulations and dosage forms |
| DE102005035891A1 (de) * | 2005-07-30 | 2007-02-08 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | 8-(3-Amino-piperidin-1-yl)-xanthine, deren Herstellung und deren Verwendung als Arzneimittel |
| KR100591142B1 (ko) * | 2005-11-04 | 2006-06-20 | 지엘팜텍 주식회사 | 파록세틴을 활성물질로 함유하는 장용성 서방형 정제 |
| WO2007054978A2 (en) * | 2005-11-10 | 2007-05-18 | Jubilant Organosys Limited | Process for preparing paroxetine hydrochloride hemihydrate |
| AU2006315684A1 (en) * | 2005-11-14 | 2007-05-24 | Auspex Pharmaceuticals, Inc. | Substituted phenylpiperidines with serotoninergic activity and enhanced therapeutic properties |
| NO347644B1 (no) | 2006-05-04 | 2024-02-12 | Boehringer Ingelheim Int | Polymorfer |
| PE20080251A1 (es) | 2006-05-04 | 2008-04-25 | Boehringer Ingelheim Int | Usos de inhibidores de dpp iv |
| EP1852108A1 (en) | 2006-05-04 | 2007-11-07 | Boehringer Ingelheim Pharma GmbH & Co.KG | DPP IV inhibitor formulations |
| US20080033045A1 (en) * | 2006-07-07 | 2008-02-07 | Myriad Genetics, Incorporated | Treatment of psychiatric disorders |
| WO2008012623A1 (en) * | 2006-07-25 | 2008-01-31 | Pfizer Products Inc. | Benzimidazolyl compounds as potentiators of mglur2 subtype of glutamate receptor |
| US20080033050A1 (en) | 2006-08-04 | 2008-02-07 | Richards Patricia Allison Tewe | Method of treating thermoregulatory disfunction with paroxetine |
| DK2118074T3 (en) | 2007-02-01 | 2014-03-10 | Resverlogix Corp | Compounds for the prevention and treatment of cardiovascular diseases |
| US20080300258A1 (en) * | 2007-05-30 | 2008-12-04 | Souza Fabio Eduardo Silva | Anhydrous ciprofloxacin hydrochloride |
| US9138430B2 (en) * | 2007-12-27 | 2015-09-22 | Mylan Specialty L.P. | Formulation and method for the release of paroxetine in the large intestine |
| AR071175A1 (es) | 2008-04-03 | 2010-06-02 | Boehringer Ingelheim Int | Composicion farmaceutica que comprende un inhibidor de la dipeptidil-peptidasa-4 (dpp4) y un farmaco acompanante |
| DE102009030506A1 (de) * | 2008-06-30 | 2009-12-31 | Borgwarner Inc., Auburn Hills | Reibungsmaterialien |
| KR20200118243A (ko) | 2008-08-06 | 2020-10-14 | 베링거 인겔하임 인터내셔날 게엠베하 | 메트포르민 요법이 부적합한 환자에서의 당뇨병 치료 |
| UY32030A (es) | 2008-08-06 | 2010-03-26 | Boehringer Ingelheim Int | "tratamiento para diabetes en pacientes inapropiados para terapia con metformina" |
| MX2011002558A (es) | 2008-09-10 | 2011-04-26 | Boehringer Ingelheim Int | Terapia de combinacion para el tratamiento de diabetes y estados relacionados. |
| US20200155558A1 (en) | 2018-11-20 | 2020-05-21 | Boehringer Ingelheim International Gmbh | Treatment for diabetes in patients with insufficient glycemic control despite therapy with an oral antidiabetic drug |
| US8865729B2 (en) | 2008-12-23 | 2014-10-21 | Boehringer Ingelheim International Gmbh | Salt forms of a xanthine compound |
| TW201036975A (en) | 2009-01-07 | 2010-10-16 | Boehringer Ingelheim Int | Treatment for diabetes in patients with inadequate glycemic control despite metformin therapy |
| CA2992231C (en) | 2009-03-18 | 2022-03-29 | Resverlogix Corp. | Phenyl-quinazolin-4(3h)-one and phenyl-pyrido[2,3-d]pyrimidin-4(3h)-one derivatives and compositions thereof useful as anti-inflammatory agents |
| JP2010260826A (ja) * | 2009-05-08 | 2010-11-18 | Sumitomo Chemical Co Ltd | パロキセチン塩酸塩半水和物の製造方法 |
| AU2010323068B2 (en) | 2009-11-27 | 2015-09-03 | Boehringer Ingelheim International Gmbh | Treatment of genotyped diabetic patients with DPP-IV inhibitors such as linagliptin |
| WO2011138421A1 (en) | 2010-05-05 | 2011-11-10 | Boehringer Ingelheim International Gmbh | Combination therapy |
| JP5700367B2 (ja) * | 2010-05-06 | 2015-04-15 | 高田製薬株式会社 | パロキセチン含有フイルムコ−テイング経口製剤 |
| KR20190050871A (ko) | 2010-06-24 | 2019-05-13 | 베링거 인겔하임 인터내셔날 게엠베하 | 당뇨병 요법 |
| AR083878A1 (es) | 2010-11-15 | 2013-03-27 | Boehringer Ingelheim Int | Terapia antidiabetica vasoprotectora y cardioprotectora, linagliptina, metodo de tratamiento |
| EP2685966A1 (en) | 2011-03-17 | 2014-01-22 | Lupin Limited | Controlled release pharmaceutical compositions of selective serotonin reuptake inhibitor |
| GB201108345D0 (en) * | 2011-05-18 | 2011-06-29 | Aesica Pharmaceuticals Ltd | Process |
| KR101985384B1 (ko) | 2011-07-15 | 2019-06-03 | 베링거 인겔하임 인터내셔날 게엠베하 | 치환된 퀴나졸린, 이의 제조 및 약제학적 조성물에서의 이의 용도 |
| CN102285973B (zh) * | 2011-09-20 | 2013-03-06 | 海南美大制药有限公司 | 一种盐酸帕罗西汀化合物及其制法 |
| US9555001B2 (en) | 2012-03-07 | 2017-01-31 | Boehringer Ingelheim International Gmbh | Pharmaceutical composition and uses thereof |
| EP2849755A1 (en) | 2012-05-14 | 2015-03-25 | Boehringer Ingelheim International GmbH | A xanthine derivative as dpp -4 inhibitor for use in the treatment of podocytes related disorders and/or nephrotic syndrome |
| WO2013174767A1 (en) | 2012-05-24 | 2013-11-28 | Boehringer Ingelheim International Gmbh | A xanthine derivative as dpp -4 inhibitor for use in modifying food intake and regulating food preference |
| AU2013204159B2 (en) * | 2013-03-15 | 2015-05-07 | Bionomics Limited | A Crystalline Form of an Anxiolytic Compound |
| WO2015128453A1 (en) | 2014-02-28 | 2015-09-03 | Boehringer Ingelheim International Gmbh | Medical use of a dpp-4 inhibitor |
| CN104447714A (zh) * | 2014-11-18 | 2015-03-25 | 成都医路康医学技术服务有限公司 | 一种盐酸帕罗西汀的生产工艺 |
| US10155000B2 (en) | 2016-06-10 | 2018-12-18 | Boehringer Ingelheim International Gmbh | Medical use of pharmaceutical combination or composition |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1422263A (en) * | 1973-01-30 | 1976-01-21 | Ferrosan As | 4-phenyl-piperidine compounds |
| EP0190496A3 (en) * | 1984-12-13 | 1987-05-27 | Beecham Group Plc | Piperidine derivatives having a gastro-intestinal activity |
-
1986
- 1986-10-14 DE DE86307919T patent/DE3688827T2/de not_active Expired - Lifetime
- 1986-10-14 ES ES86307919T patent/ES2058061T3/es not_active Expired - Lifetime
- 1986-10-14 EP EP86307919A patent/EP0223403B1/en not_active Expired - Lifetime
- 1986-10-23 NZ NZ218047A patent/NZ218047A/xx unknown
- 1986-10-23 PT PT83608A patent/PT83608B/pt unknown
- 1986-10-23 DK DK508786A patent/DK171694B1/da not_active IP Right Cessation
- 1986-10-23 IE IE280286A patent/IE59901B1/en not_active IP Right Cessation
- 1986-10-23 CA CA000521223A patent/CA1287060C/en not_active Expired - Lifetime
- 1986-10-23 NO NO864237A patent/NO171453C/no unknown
- 1986-10-23 US US06/922,530 patent/US4721723A/en not_active Expired - Lifetime
- 1986-10-23 AU AU64332/86A patent/AU593295B2/en not_active Expired
- 1986-10-24 FI FI864320A patent/FI87785C/fi not_active IP Right Cessation
- 1986-10-24 JP JP61253499A patent/JPH0647587B2/ja not_active Expired - Lifetime
-
1991
- 1991-12-19 SK SK3910-91A patent/SK391091A3/sk unknown
- 1991-12-19 CZ CS913910A patent/CZ391091A3/cs unknown
-
1993
- 1993-11-11 HK HK1259/93A patent/HK125993A/xx not_active IP Right Cessation
- 1993-12-29 BG BG098345A patent/BG61323B2/bg unknown
-
1995
- 1995-02-17 CY CY174395A patent/CY1743A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CY1743A (en) | 1995-02-17 |
| FI864320A (fi) | 1987-04-26 |
| NZ218047A (en) | 1989-03-29 |
| NO171453B (no) | 1992-12-07 |
| CA1287060C (en) | 1991-07-30 |
| FI87785C (fi) | 1993-02-25 |
| IE59901B1 (en) | 1994-04-20 |
| NO864237D0 (no) | 1986-10-23 |
| NO171453C (no) | 1993-03-17 |
| EP0223403B1 (en) | 1993-08-04 |
| DK171694B1 (da) | 1997-03-17 |
| PT83608A (en) | 1986-11-01 |
| SK391091A3 (en) | 2000-10-09 |
| AU593295B2 (en) | 1990-02-08 |
| DK508786A (da) | 1987-04-26 |
| FI87785B (fi) | 1992-11-13 |
| DK508786D0 (da) | 1986-10-23 |
| PT83608B (pt) | 1989-05-31 |
| EP0223403A2 (en) | 1987-05-27 |
| DE3688827D1 (de) | 1993-09-09 |
| CZ391091A3 (en) | 1994-01-19 |
| DE3688827T2 (de) | 1994-03-31 |
| HK125993A (en) | 1993-11-19 |
| FI864320A0 (fi) | 1986-10-24 |
| EP0223403A3 (en) | 1989-09-06 |
| JPS62129280A (ja) | 1987-06-11 |
| IE862802L (en) | 1987-04-25 |
| AU6433286A (en) | 1987-04-30 |
| ES2058061T3 (es) | 1994-11-01 |
| NO864237L (no) | 1987-04-27 |
| US4721723A (en) | 1988-01-26 |
| JPH0647587B2 (ja) | 1994-06-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BG61323B2 (bg) | Производни на пиперидина,тяхното получаване и използването им като лекарства | |
| EP0994872B1 (en) | 4-phenylpiperidine compounds | |
| US5354760A (en) | Crystalline Tiagabine monohydrate, its preparation and use | |
| JP2005350459A (ja) | フェキソフェナジンの多形体およびその製造方法 | |
| KR20030081458A (ko) | 비-수화 펙소페나딘 염화수소의 제조방법 및 이 방법에의하여 얻어지는 신규 결정 형태 | |
| WO2002053135A1 (en) | Amlodipine free base | |
| CA2164296C (en) | Heterocyclic chemistry | |
| WO2002102777A2 (en) | NOVEL CRYSTALLINE FORMS OF 4-[4-[4-(HYDROXYDIPHENYLMETHYL)-1-PIPERINDINYL]-1-HYDROXYBUTYL]-α, α-DIMETHYLBENZENE ACETIC ACID AND ITS HYDROCHLORIDE | |
| AU2001278094A1 (en) | Novel crystalline forms of 4-[4-[4-(hydroxydiphenylmethyl)-1-piperindinyl]-1-hydroxybutyl]-alpha, alpha-dimethylbenzene acetic acid and its hydrochloride | |
| US7335380B2 (en) | Amlodipine free base | |
| WO2005023769A1 (en) | Process for the preparation of amlodipine salts | |
| EP2072510A1 (en) | Crystalline form of azelastine | |
| DK175352B1 (da) | Fremgangsmåde til fremstilling af 4-phenylpiperidinderivater | |
| BE1014922A3 (nl) | Amlodipine als vrije base. | |
| BG104973A (bg) | Пароксетин 10-камфорсулфонат за лечение на cns заболявания | |
| EP1102764A1 (en) | Paroxetine salts | |
| GB2385268A (en) | Amlodipine free base | |
| WO1983004022A1 (fr) | Nouvelles phenyloxoalcoyle piperidines, leurs procedes d'obtention et les compositions pharmaceutiques en renfermant | |
| SI21121A (sl) | Prosta baza amlodipina |