AT70921B - Verfahren zur Darstellung von Entwicklerfarbstoffen. - Google Patents
Verfahren zur Darstellung von Entwicklerfarbstoffen.Info
- Publication number
- AT70921B AT70921B AT70921DA AT70921B AT 70921 B AT70921 B AT 70921B AT 70921D A AT70921D A AT 70921DA AT 70921 B AT70921 B AT 70921B
- Authority
- AT
- Austria
- Prior art keywords
- sep
- sulfonic acid
- green
- preparation
- aminobenzoyl
- Prior art date
Links
- 239000000975 dye Substances 0.000 title 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- ZCGVPUAAMCMLTM-UHFFFAOYSA-N 2-amino-5-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C=C1S(O)(=O)=O ZCGVPUAAMCMLTM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 2
- 229950009041 edaravone Drugs 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- CYCGXYKRUBKWHT-UHFFFAOYSA-N 1-(2,5-dichlorophenyl)piperazine;dihydrochloride Chemical compound Cl.Cl.ClC1=CC=C(Cl)C(N2CCNCC2)=C1 CYCGXYKRUBKWHT-UHFFFAOYSA-N 0.000 description 1
- PPVRMPPLECDING-UHFFFAOYSA-N 4-[(4-aminophenyl)diazenyl]benzenesulfonic acid Chemical compound C1=CC(N)=CC=C1N=NC1=CC=C(S(O)(=O)=O)C=C1 PPVRMPPLECDING-UHFFFAOYSA-N 0.000 description 1
- YUNBHHWDQDGWHC-UHFFFAOYSA-N 6-aminonaphthalene-1-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=CC(N)=CC=C21 YUNBHHWDQDGWHC-UHFFFAOYSA-N 0.000 description 1
- QEZZCWMQXHXAFG-UHFFFAOYSA-N 8-aminonaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=CC=CC2=C1 QEZZCWMQXHXAFG-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- BFVHBHKMLIBQNN-UHFFFAOYSA-N n-(2-chlorophenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1Cl BFVHBHKMLIBQNN-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Heat Sensitive Colour Forming Recording (AREA)
Description
<Desc/Clms Page number 1> EMI1.1 EMI1.2 <Desc/Clms Page number 2> EMI2.1 <tb> <tb> Farbstoff <SEP> aus <SEP> direkte <SEP> Färbung <SEP> entwickelt <SEP> mit <tb> Methylphenylpyrazolon <tb> 1. <SEP> 4-Chloranilin-2-sulfosäure+1.2-Aminonaphtoläthyl- <tb> äther-6-sulfosäure+m-Aminobenzoyl-2.4-aminonaphtol- <SEP> grünstichig <SEP> blaustichig <tb> -T. <SEP> s. <SEP> lfosäure' <SEP> u <SEP> S'grin <tb> 2. <SEP> 4-Chloranilin-2-sulfosäure+1.2-Aminonaphtoläthyl- <tb> äther-6-sulfosäure+p-Aminobenzoyl-2.5-aminonaphtol- <SEP> grunstrung <SEP> grün <tb> -7-sulfosäure <SEP> blau <tb> 3.4.5-Dichloranilin-2-sulfosaure+1.2-Aminonaphtoläthyl- <tb> äther-6-sulfosäure+ <SEP> p-Aminobenzoyl-2.5-aminonaphtol <SEP> grünstichig <SEP> grün <tb> -7-sulfosäure <SEP> blau <tb> 4. <SEP> 2.5-Dichloranilin-4-sulfosäure <SEP> + <SEP> 1.2-Aminonaphtoläthyl- <SEP> Grünstichig <SEP> grün <tb> äther-6-sulfosäure <SEP> + <SEP> p-Aminophenyl-1.2-naphtothiazol- <SEP> blau <tb> -5-oxy-7-sulfosäure <tb> 5. <SEP> 2. <SEP> 5-Dichloranilin-4-sulfosäure <SEP> + <SEP> 1.2-Aminonaphtoläthyl- <tb> äther-6 <SEP> sulfonsäure <SEP> + <SEP> p-Aminobenzoyl-2.5-aminonaphtol- <SEP> grünstichig <SEP> grün <tb> -7-salfsäure <tb> 6. <SEP> 1-Naphtylamin-7-sulfosäure <SEP> + <SEP> 1.2-Aminonaphtoläthyl- <tb> äther-6-sulfosäure <SEP> + <SEP> m'Aminobenzoyl-m-aminobenzoyl- <SEP> grünstichig <SEP> blaustichig <tb> -2.5-aminonaphtol-7-sulfosäure <SEP> blau <SEP> grun <tb> 7. <SEP> 2-Naphtylamin-5-sulfosäure <SEP> + <SEP> 1.2-Aminonaphtoläthyl- <tb> äther-6-sulfosäure <SEP> + <SEP> m-Aminophenyl-1.2-naphtimidazol <SEP> grünstichig <SEP> grän <tb> -5-oxy-7-sulfosäure <SEP> blau <tb> 8. <SEP> 2-Naphtylamin-8-sulfosäure <SEP> + <SEP> 1.2 <SEP> - <SEP> Aminonaphtoläthyl- <SEP> grünstichig <tb> äther <SEP> + <SEP> p-Aminobenzoyl-2.5-aminonaphtol-7-sulfosäure <SEP> blau <SEP> grun <tb> 9. <SEP> 1-Naphtylamin-3.7-disulfosäure <SEP> + <SEP> 1.2-Aminonaphtol <tb> äthyläther+p'-Aminobenzoyl-m-aminobenzoyl-2.5-amino- <SEP> blaugrün <SEP> gelbstichig <tb> naphtol-7-sulfosäure <SEP> grün <tb> 10. <SEP> Aminoazobenzoldisulfosäure <SEP> + <SEP> 1.2-Aminonaphtoläthyl- <tb> äther-6-sulfosäure <SEP> + <SEP> p-Aminobenzoyl-2.5-aminonaphtol <SEP> grünstichig <SEP> grün <tb> -7-sulfosäure <SEP> blau <tb> 11. <SEP> 2.5-Dichloranilin-4-sulfosaure <SEP> + <SEP> 1.2-Aminonaphtoläthyl- <tb> äther-6-sulfosäure <SEP> + <SEP> p-Aminobenzoyl-2.8-aminonaphtol <SEP> blau <SEP> grün <tb> -6-sulfosäure <tb> EMI2.2 EMI2.3 <tb> <tb> a) <SEP> nach <SEP> dem <SEP> Diazotieren <SEP> auf <SEP> der <SEP> Faser <SEP> entwickelt <SEP> mit <SEP> : <tb> 1. <SEP> Azetessigsáureätby <SEP> lester. <SEP> blaugrün <tb> 2. <SEP> Azetessig-o-chloranilid <SEP> . <SEP> . <SEP> . <SEP> . <SEP> . <SEP> . <SEP> . <SEP> . <SEP> . <SEP> blaustichig <SEP> grün <tb> 3. <SEP> Methylphenylpyrazolon <SEP> . <SEP> . <SEP> . <SEP> . <SEP> . <SEP> . <SEP> . <SEP> . <SEP> grün <tb> 4. <SEP> Phenol. <SEP> grün <tb> 5. <SEP> Resorzin. <SEP> grün <tb> b) <SEP> auf <SEP> der <SEP> Faser <SEP> nachbehandelt <SEP> mit <tb> diazotiertem <SEP> p-Nitrani1in. <SEP> grün. <tb> EMI2.4
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE70921X | 1913-05-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT70921B true AT70921B (de) | 1916-01-10 |
Family
ID=5635625
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT70921D AT70921B (de) | 1913-05-16 | 1914-05-02 | Verfahren zur Darstellung von Entwicklerfarbstoffen. |
Country Status (1)
| Country | Link |
|---|---|
| AT (1) | AT70921B (de) |
-
1914
- 1914-05-02 AT AT70921D patent/AT70921B/de active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT70921B (de) | Verfahren zur Darstellung von Entwicklerfarbstoffen. | |
| US2384419A (en) | Azo dyestuffs | |
| DE591495C (de) | Verfahren zur Herstellung von Stilbenazofarbstoffen | |
| DE889488C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| US2050811A (en) | Primary disazo compounds | |
| AT107575B (de) | Verfahren zur Darstellung von Monoazofarbstoffen. | |
| DE697000C (de) | Verfahren zur Herstellung von o-Oxyazofarbstoffen | |
| DE582644C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| US1893557A (en) | Metal compounds of an o-hydroxyazo dyestuff | |
| DE409280C (de) | Verfahren zur Darstellung von Monoazofarbstoffen fuer Wolle | |
| DE2362996A1 (de) | Neue wasserloesliche trisazofarbstoffe | |
| DE724870C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| AT106016B (de) | Verfahren zur Darstellung von Monoazofarbstoffen. | |
| AT40668B (de) | Verfahren zur Darstellung von Trisazofarbstoffen. | |
| DE693021C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE631184C (de) | Verfahren zur Herstellung von Azofarbstoffen auf pflanzlichen Fasern | |
| CH235461A (de) | Verfahren zur Herstellung eines wasserlöslichen Monoazofarbstoffes. | |
| DE652818C (de) | Verfahren zur Herstellung von wasserunloeslichen Azofarbstoffen | |
| DE695402C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE751693C (de) | Verfahren zur Herstellung von o-Oxyazofarbstoffen | |
| AT156808B (de) | Verfahren zur Herstellung von wasserunlöslichen Azofarbstoffen. | |
| GB519326A (en) | Manufacture of disazo-dyestuffs | |
| CH214613A (de) | Verfahren zur Darstellung eines Disazofarbstoffes. | |
| CH209512A (de) | Verfahren zur Herstellung eines Disazofarbstoffes. | |
| GB455229A (en) | Manufacture of cupriferous dyestuffs |