AT395971B - Verfahren zur herstellung von fablosen bisphenolen - Google Patents
Verfahren zur herstellung von fablosen bisphenolen Download PDFInfo
- Publication number
- AT395971B AT395971B AT0096286A AT96286A AT395971B AT 395971 B AT395971 B AT 395971B AT 0096286 A AT0096286 A AT 0096286A AT 96286 A AT96286 A AT 96286A AT 395971 B AT395971 B AT 395971B
- Authority
- AT
- Austria
- Prior art keywords
- phenol
- acid
- compound
- water
- condensation
- Prior art date
Links
- 229930185605 Bisphenol Natural products 0.000 title claims description 13
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title description 2
- 238000000034 method Methods 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 22
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 13
- 239000002904 solvent Substances 0.000 claims description 13
- 238000009833 condensation Methods 0.000 claims description 9
- 230000005494 condensation Effects 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- 235000011149 sulphuric acid Nutrition 0.000 claims description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- YNMDOZLVAPMCBD-UHFFFAOYSA-L zinc;2,4-dioxo-1h-pyrimidine-6-carboxylate Chemical compound [Zn+2].[O-]C(=O)C1=CC(=O)NC(=O)N1.[O-]C(=O)C1=CC(=O)NC(=O)N1 YNMDOZLVAPMCBD-UHFFFAOYSA-L 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229940046253 zinc orotate Drugs 0.000 claims description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 3
- -1 dihydroxymethyl lauramide Chemical compound 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 208000001840 Dandruff Diseases 0.000 claims description 2
- 238000010521 absorption reaction Methods 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- 239000002453 shampoo Substances 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 6
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 claims 2
- 229930006000 Sucrose Natural products 0.000 claims 2
- 239000005720 sucrose Substances 0.000 claims 2
- 102000016938 Catalase Human genes 0.000 claims 1
- 108010053835 Catalase Proteins 0.000 claims 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 1
- HLFSDGLLUJUHTE-SNVBAGLBSA-N Levamisole Chemical compound C1([C@H]2CN3CCSC3=N2)=CC=CC=C1 HLFSDGLLUJUHTE-SNVBAGLBSA-N 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims 1
- 206010042496 Sunburn Diseases 0.000 claims 1
- 239000000443 aerosol Substances 0.000 claims 1
- 230000001476 alcoholic effect Effects 0.000 claims 1
- 150000005215 alkyl ethers Chemical class 0.000 claims 1
- 239000000921 anthelmintic agent Substances 0.000 claims 1
- 229940121363 anti-inflammatory agent Drugs 0.000 claims 1
- 239000002260 anti-inflammatory agent Substances 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 229940116335 lauramide Drugs 0.000 claims 1
- ILRSCQWREDREME-UHFFFAOYSA-N lauric acid amide propyl betaine Natural products CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 claims 1
- 229960001614 levamisole Drugs 0.000 claims 1
- 210000004185 liver Anatomy 0.000 claims 1
- 239000006210 lotion Substances 0.000 claims 1
- JRRBJSPQEVZLPI-UHFFFAOYSA-N piperazin-1-ium;hydroxide Chemical compound O.C1CNCCN1 JRRBJSPQEVZLPI-UHFFFAOYSA-N 0.000 claims 1
- 229960003641 piperazine hydrate Drugs 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 claims 1
- 230000017423 tissue regeneration Effects 0.000 claims 1
- 230000029663 wound healing Effects 0.000 claims 1
- 239000003357 wound healing promoting agent Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 13
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical class CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- 150000002989 phenols Chemical class 0.000 description 8
- KFZXVMNBUMVKLN-UHFFFAOYSA-N 4-chloro-5-methyl-2-propan-2-ylphenol Chemical compound CC(C)C1=CC(Cl)=C(C)C=C1O KFZXVMNBUMVKLN-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 5
- 239000008267 milk Substances 0.000 description 5
- 210000004080 milk Anatomy 0.000 description 5
- 235000013336 milk Nutrition 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 229930182555 Penicillin Natural products 0.000 description 4
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- HNOOXWDWUSLXOB-UHFFFAOYSA-N biclotymol Chemical compound CC(C)C1=CC(Cl)=C(C)C(CC=2C(=C(C(C)C)C=C(Cl)C=2C)O)=C1O HNOOXWDWUSLXOB-UHFFFAOYSA-N 0.000 description 4
- 229960004093 biclotymol Drugs 0.000 description 4
- FQUNFJULCYSSOP-UHFFFAOYSA-N bisoctrizole Chemical compound N1=C2C=CC=CC2=NN1C1=CC(C(C)(C)CC(C)(C)C)=CC(CC=2C(=C(C=C(C=2)C(C)(C)CC(C)(C)C)N2N=C3C=CC=CC3=N2)O)=C1O FQUNFJULCYSSOP-UHFFFAOYSA-N 0.000 description 4
- 210000000481 breast Anatomy 0.000 description 4
- 229940049954 penicillin Drugs 0.000 description 4
- 241000894006 Bacteria Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- JSOXHHYKGWBWGR-UHFFFAOYSA-N 4-chloro-3-methyl-2-propan-2-ylphenol Chemical compound CC(C)C1=C(C)C(Cl)=CC=C1O JSOXHHYKGWBWGR-UHFFFAOYSA-N 0.000 description 2
- QPDXBKHZJRUURK-UHFFFAOYSA-N 4-chloro-3-methyl-5-propan-2-ylphenol Chemical compound CC(C)C1=CC(O)=CC(C)=C1Cl QPDXBKHZJRUURK-UHFFFAOYSA-N 0.000 description 2
- 208000002874 Acne Vulgaris Diseases 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ULGZDMOVFRHVEP-RWJQBGPGSA-N Erythromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 ULGZDMOVFRHVEP-RWJQBGPGSA-N 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 206010000496 acne Diseases 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 230000001760 anti-analgesic effect Effects 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 229940031956 chlorothymol Drugs 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 230000000855 fungicidal effect Effects 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 2
- 229960004068 hexachlorophene Drugs 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 208000031295 Animal disease Diseases 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000304886 Bacilli Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical class CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 241000194017 Streptococcus Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000008278 cosmetic cream Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000000551 dentifrice Substances 0.000 description 1
- 239000002781 deodorant agent Substances 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229960003276 erythromycin Drugs 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000005075 mammary gland Anatomy 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- HFHZKZSRXITVMK-UHFFFAOYSA-N oxyphenbutazone Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=C(O)C=C1 HFHZKZSRXITVMK-UHFFFAOYSA-N 0.000 description 1
- 229960000649 oxyphenbutazone Drugs 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229930002330 retinoic acid Natural products 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 229960001727 tretinoin Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/115—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms using acetals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cosmetics (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8505681A FR2580275B1 (fr) | 1985-04-16 | 1985-04-16 | Perfectionnement a la preparation et applications de bisphenols substitues |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA96286A ATA96286A (de) | 1992-09-15 |
| AT395971B true AT395971B (de) | 1993-04-26 |
Family
ID=9318260
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0096286A AT395971B (de) | 1985-04-16 | 1986-04-14 | Verfahren zur herstellung von fablosen bisphenolen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4683345A (show.php) |
| AT (1) | AT395971B (show.php) |
| DE (1) | DE3634989C2 (show.php) |
| DK (1) | DK174186A (show.php) |
| FR (1) | FR2580275B1 (show.php) |
| GB (1) | GB2174090B (show.php) |
| IN (1) | IN164817B (show.php) |
| ZA (1) | ZA862795B (show.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2004103333A1 (de) * | 2003-05-24 | 2004-12-02 | Juvena (International) Ag | Gewebekulturmedien als bestandteil von kosmetika |
| JP7615920B2 (ja) * | 2021-06-30 | 2025-01-17 | 三菱ケミカル株式会社 | ビスフェノールの製造方法並びにポリカーボネート樹脂の製造方法 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0090787A1 (en) * | 1982-03-29 | 1983-10-05 | Monsanto Company | A process for making bis (hydroxyphenyl)-methanes |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1977627A (en) * | 1932-01-21 | 1934-10-23 | Ici Ltd | Process of producing diphenylolpropane |
| US2334408A (en) * | 1941-07-26 | 1943-11-16 | Burton T Bush Inc | Process for making chlorinated phenol-aldehyde condensation products |
| GB557097A (en) * | 1941-08-07 | 1943-11-04 | Burton T Bush Inc | Process for making dihydroxy halogenated diphenyl methanes |
| GB572368A (en) * | 1943-10-13 | 1945-10-04 | Kurt Israel Jacobsohn | Improved antiseptic preparations |
| GB669797A (en) * | 1949-08-27 | 1952-04-09 | Dow Chemical Co | 2, 2-alkylidene-bis(6-alkyl-4-chlorophenols) |
| GB718335A (en) * | 1951-10-16 | 1954-11-10 | Givaudan Et Co L | Improved process of preparing bis-(3,5,6-trichloro-2-hydroxyphenyl) methane |
| GB722590A (en) * | 1951-12-29 | 1955-01-26 | Geigy Ag J R | Improvements relating to diphenyl methane derivatives |
| GB893162A (en) * | 1957-05-02 | 1962-04-04 | William Pearson Ltd | Improvements in or relating to antioxidants |
| FR4620M (show.php) * | 1965-03-24 | 1966-11-28 | ||
| US3485797A (en) * | 1966-03-14 | 1969-12-23 | Ashland Oil Inc | Phenolic resins containing benzylic ether linkages and unsubstituted para positions |
| US3426081A (en) * | 1966-07-18 | 1969-02-04 | Richardson Co | Process for preparing bis(3,5,6-trichloro-2-hydroxyphenyl) methane |
| GB1201545A (en) * | 1967-06-08 | 1970-08-05 | Edwin Bernard Michaels | Method for preparing hexachlorophene |
| GB1208325A (en) * | 1968-04-22 | 1970-10-14 | Bdh Chemicals Ltd | Improvements in or relating to the production of dichlorophen |
| US3674879A (en) * | 1968-04-24 | 1972-07-04 | Armour Ind Chem Co | Process for preparing chloro-substituted bis(hydroxyphenyl)methanes |
| US3723540A (en) * | 1969-11-26 | 1973-03-27 | E Michaels | Preparation of hexachlorophene |
| BE765323A (fr) * | 1970-05-01 | 1971-08-30 | Tenneco Chem | Condensation de phenols chlores en bis-(phenols chlores) |
| DE2260138A1 (de) * | 1972-12-08 | 1974-06-12 | Hoechst Ag | Stoffwechselwirksame bisphenolalkanderivate |
| DE2418975A1 (de) * | 1974-04-19 | 1975-10-30 | Bayer Ag | Verfahren zur herstellung von dihydroxydiphenylalkanen |
| AU4101678A (en) * | 1977-11-08 | 1980-05-01 | Ici Australia Ltd | Process for killing parasites |
| US4535191A (en) * | 1982-12-06 | 1985-08-13 | General Electric Company | Dihydric phenols |
-
1985
- 1985-04-16 FR FR8505681A patent/FR2580275B1/fr not_active Expired
-
1986
- 1986-03-26 GB GB8607469A patent/GB2174090B/en not_active Expired
- 1986-04-14 IN IN288/CAL/86A patent/IN164817B/en unknown
- 1986-04-14 AT AT0096286A patent/AT395971B/de not_active IP Right Cessation
- 1986-04-15 ZA ZA862795A patent/ZA862795B/xx unknown
- 1986-04-16 US US06/852,409 patent/US4683345A/en not_active Expired - Lifetime
- 1986-04-16 DK DK174186A patent/DK174186A/da not_active Application Discontinuation
- 1986-10-14 DE DE3634989A patent/DE3634989C2/de not_active Expired - Fee Related
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0090787A1 (en) * | 1982-03-29 | 1983-10-05 | Monsanto Company | A process for making bis (hydroxyphenyl)-methanes |
Also Published As
| Publication number | Publication date |
|---|---|
| US4683345A (en) | 1987-07-28 |
| DK174186A (da) | 1986-10-17 |
| GB2174090A (en) | 1986-10-29 |
| GB8607469D0 (en) | 1986-04-30 |
| ZA862795B (en) | 1987-02-25 |
| ATA96286A (de) | 1992-09-15 |
| FR2580275A1 (fr) | 1986-10-17 |
| IN164817B (show.php) | 1989-06-10 |
| DE3634989C2 (de) | 1996-08-29 |
| DK174186D0 (da) | 1986-04-16 |
| GB2174090B (en) | 1989-07-05 |
| DE3634989A1 (de) | 1988-04-21 |
| FR2580275B1 (fr) | 1988-11-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2616479C2 (de) | Substituierte Fluoracylresorcine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel und Kosmetika | |
| DE2500110A1 (de) | 3-aryloxy-3-phenylpropylamine und verfahren zu ihrer herstellung | |
| DE2501443A1 (de) | Pharmazeutische mittel mit einem gehalt an mindestens einer diphenylsubstituierten verbindung | |
| DE3743374A1 (de) | Verwendung von bisguanide enthaltenden zusammensetzungen gegen eier des madenwurms | |
| DE4221740A1 (de) | Benzyliden-chinuclidinone | |
| DE69111974T2 (de) | Verwendung von Lithium zur Behandlung oder Prophylaxe von Molluscum contagiusum. | |
| DE2263126A1 (de) | Durch einen cyklus mit 5 kohlenstoffatomen substituierte phenolderivate, deren herstellung und verwendung | |
| AT395971B (de) | Verfahren zur herstellung von fablosen bisphenolen | |
| DE2019504C3 (de) | Oxim-N-acylcarbamate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Schädlingsbekämpfung | |
| EP0967980B1 (de) | Verwendung von aminothiazolen zur wund- und hautbehandlung | |
| DE3024323C2 (show.php) | ||
| DE1141051B (de) | Desinfektionsmittelgemisch | |
| DE1931466C3 (de) | Kupfer (Il)-komplexe von 6-Niederalkoxy-1-phenazinol- 5,10 - dioxiden | |
| DE2113489C3 (de) | 2-Nitro-benzofuranderivate, ein Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE2714671A1 (de) | Aromatische alpha-hydroxyamide | |
| DE2340709C2 (de) | Kombinationspräparat enthaltend 6-Chlorbenzisothiazolinon und ein 2-Nitrofurylderivat | |
| DE2553270A1 (de) | Ektoparasitizide mittel enthaltend diphenylcarbodiimide | |
| CH642043A5 (en) | Halogenated 4-hydroxydiphenylmethane derivatives | |
| DE2156967C3 (de) | N-(4-Fluorphenyl)-23-dichlormaleinimid, Verfahren zu dessen Herstellung und diese Verbindung enthaltende Schädlingsbekämpfungsmittel | |
| DE1939139C3 (de) | n-Decylester der 4-Aminobuttersäure und hautverträgliches antiseptisches Mittel, enthaltend einen n-Alkylester der 4-Aminobuttersäure | |
| DE2407289A1 (de) | 5-brom-5-nitro-2-alkyl-1,3-dioxane | |
| CH493480A (de) | Verfahren zur Herstellung von neuen O,N-Diphenyl-carbaminsäureestern | |
| AT319200B (de) | Vzh von neuen substituierten 1,1-diphenyl-2-nitropropanen und -butane | |
| DE2321198C3 (de) | Chlorderivate von Methylisopropylphenolen und diese enthaltende Arzneimittel | |
| DE1593933C3 (de) | Quarternäre Stickstoffverbindungen und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |