AT395592B - Verfahren zur herstellung von wasserloeslichen sulfonierten polymeren - Google Patents
Verfahren zur herstellung von wasserloeslichen sulfonierten polymeren Download PDFInfo
- Publication number
- AT395592B AT395592B AT0324386A AT324386A AT395592B AT 395592 B AT395592 B AT 395592B AT 0324386 A AT0324386 A AT 0324386A AT 324386 A AT324386 A AT 324386A AT 395592 B AT395592 B AT 395592B
- Authority
- AT
- Austria
- Prior art keywords
- zero
- polymer
- water
- general formula
- hydrogen
- Prior art date
Links
- 229920000642 polymer Polymers 0.000 title claims description 70
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000000376 reactant Substances 0.000 claims description 39
- 125000003368 amide group Chemical group 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 29
- 239000000126 substance Substances 0.000 claims description 27
- 239000002904 solvent Substances 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 22
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 11
- 125000002947 alkylene group Chemical group 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 9
- 229920002554 vinyl polymer Polymers 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 150000001340 alkali metals Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 6
- 239000003125 aqueous solvent Substances 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000004122 cyclic group Chemical group 0.000 claims description 6
- 229910052700 potassium Inorganic materials 0.000 claims description 6
- 239000011591 potassium Substances 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- 150000003512 tertiary amines Chemical class 0.000 claims description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 5
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 239000007762 w/o emulsion Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 230000035484 reaction time Effects 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 16
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 10
- 238000007056 transamidation reaction Methods 0.000 description 10
- 229920003169 water-soluble polymer Polymers 0.000 description 9
- 125000000524 functional group Chemical group 0.000 description 7
- 150000003839 salts Chemical group 0.000 description 7
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 6
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 6
- 239000000178 monomer Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- -1 amino-substituted compound Chemical class 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 125000001749 primary amide group Chemical group 0.000 description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 229920006163 vinyl copolymer Polymers 0.000 description 2
- VUFUSMKBSFOKNR-UHFFFAOYSA-N 1-azaniumyl-2-hydroxypropane-1-sulfonate Chemical compound CC(O)C(N)S(O)(=O)=O VUFUSMKBSFOKNR-UHFFFAOYSA-N 0.000 description 1
- XRMDCWJNPDVAFI-UHFFFAOYSA-N 2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)[N+]1=O XRMDCWJNPDVAFI-UHFFFAOYSA-N 0.000 description 1
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 description 1
- LPNSCOVIJFIXTJ-UHFFFAOYSA-N 2-methylidenebutanamide Chemical compound CCC(=C)C(N)=O LPNSCOVIJFIXTJ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 101150000595 CLMP gene Proteins 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 101100382322 Drosophila melanogaster Acam gene Proteins 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- GWFFSJRRFHRKJX-UHFFFAOYSA-N [Na].C(=C)S(=O)(=O)C=C Chemical compound [Na].C(=C)S(=O)(=O)C=C GWFFSJRRFHRKJX-UHFFFAOYSA-N 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000000701 coagulant Substances 0.000 description 1
- 239000004148 curcumin Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000008394 flocculating agent Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000008235 industrial water Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 150000003511 tertiary amides Chemical class 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/34—Introducing sulfur atoms or sulfur-containing groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2800/00—Copolymer characterised by the proportions of the comonomers expressed
- C08F2800/10—Copolymer characterised by the proportions of the comonomers expressed as molar percentages
Landscapes
- Chemical & Material Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Separation Of Suspended Particles By Flocculating Agents (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US79645185A | 1985-11-08 | 1985-11-08 | |
| BR8606292A BR8606292A (pt) | 1985-11-08 | 1986-12-19 | Processo para sintetizar polimeros sulfonados soluveis em agua |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA324386A ATA324386A (de) | 1992-06-15 |
| AT395592B true AT395592B (de) | 1993-01-25 |
Family
ID=25664154
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0324386A AT395592B (de) | 1985-11-08 | 1986-12-05 | Verfahren zur herstellung von wasserloeslichen sulfonierten polymeren |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS62115002A (show.php) |
| AT (1) | AT395592B (show.php) |
| AU (2) | AU589195B2 (show.php) |
| BE (1) | BE905996A (show.php) |
| BR (1) | BR8606292A (show.php) |
| CA (1) | CA1240444A (show.php) |
| CH (1) | CH677234A5 (show.php) |
| DE (1) | DE3616583A1 (show.php) |
| FR (1) | FR2589864B1 (show.php) |
| GB (1) | GB2182666B (show.php) |
| NL (1) | NL191240C (show.php) |
| SE (1) | SE466260B (show.php) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4731419A (en) * | 1986-02-24 | 1988-03-15 | Nalco Chemical Company | Alkoxylated/cationically modified amide-containing polymers |
| JPH01167308A (ja) * | 1987-11-24 | 1989-07-03 | Nalco Chem Co | 高分子量アクリルアミド含有ポリソープ・ラテックス重合体のスルフォエチル化方法 |
| FR2870246B1 (fr) * | 2004-05-14 | 2008-09-12 | Univ Paris 13 | Copolymeres hydrosolubles, preparation et utilisations |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3418397A1 (de) * | 1983-06-01 | 1984-12-06 | Sanyo Chemical Industries Ltd., Kyoto | Wasserloesliche copolymerisate, die fuer die verbesserte oelgewinnung geeignet sind |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1266224A (show.php) * | 1969-04-02 | 1972-03-08 | ||
| US3692673A (en) * | 1971-02-12 | 1972-09-19 | Lubrizol Corp | Water-soluble sulfonate polymers as flocculants |
| US3709815A (en) * | 1971-07-01 | 1973-01-09 | Calgon Corp | Boiler water treatment |
| US4103742A (en) * | 1975-12-24 | 1978-08-01 | Phillips Petroleum Company | Method for acidizing subterranean formations |
| US4342653A (en) * | 1979-02-15 | 1982-08-03 | American Cyanamid Company | Process for the flocculation of suspended solids |
| DE2931897A1 (de) * | 1979-08-06 | 1981-02-26 | Cassella Ag | Wasserloesliches copolymerisat und seine herstellung |
| DE3027236C2 (de) * | 1980-07-18 | 1985-08-01 | Chemische Fabrik Stockhausen GmbH, 4150 Krefeld | Terpolymere aus 2-Acrylamido-2-methyl-propansulfonsäure, Acrylamid und Acrylsäure in Form ihrer Salze, Verfahren zur Herstellung dieser Terpolymeren und Verwendung zur Verhinderung von Inkrustationen in wäßrigen Systemen |
| US4471097A (en) * | 1982-01-11 | 1984-09-11 | Klaus Uhl | Water soluble copolymers containing vinyl imidazole as drilling fluid additives |
| CA1225793A (en) * | 1983-03-11 | 1987-08-18 | Union Carbide Corporation | High molecular weight water-soluble polymers and flocculation method using same |
| US4545902A (en) * | 1984-09-17 | 1985-10-08 | Nalco Chemical Company | Flocculants for bauxite (red mud) |
| NZ214078A (en) * | 1984-11-10 | 1988-08-30 | Int Computers Ltd | Keyboard subset powered by standby source during mains failure |
| US4652623A (en) * | 1984-11-23 | 1987-03-24 | Calgon Corporation | Polymers for use as filtration control aids in drilling muds |
-
1986
- 1986-05-16 DE DE19863616583 patent/DE3616583A1/de active Granted
- 1986-05-20 FR FR8607129A patent/FR2589864B1/fr not_active Expired - Lifetime
- 1986-06-10 JP JP61132894A patent/JPS62115002A/ja active Granted
- 1986-07-08 AU AU59841/86A patent/AU589195B2/en not_active Ceased
- 1986-10-14 NL NL8602576A patent/NL191240C/xx not_active IP Right Cessation
- 1986-11-10 GB GB8626810A patent/GB2182666B/en not_active Expired
- 1986-11-10 CA CA000522526A patent/CA1240444A/en not_active Expired
- 1986-12-02 CH CH4807/86A patent/CH677234A5/de not_active IP Right Cessation
- 1986-12-05 AT AT0324386A patent/AT395592B/de not_active IP Right Cessation
- 1986-12-18 SE SE8605441A patent/SE466260B/sv unknown
- 1986-12-19 BE BE0/217569A patent/BE905996A/fr not_active IP Right Cessation
- 1986-12-19 BR BR8606292A patent/BR8606292A/pt not_active IP Right Cessation
-
1989
- 1989-06-27 AU AU37094/89A patent/AU625537B2/en not_active Ceased
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3418397A1 (de) * | 1983-06-01 | 1984-12-06 | Sanyo Chemical Industries Ltd., Kyoto | Wasserloesliche copolymerisate, die fuer die verbesserte oelgewinnung geeignet sind |
Also Published As
| Publication number | Publication date |
|---|---|
| NL191240C (nl) | 1995-04-03 |
| AU5984186A (en) | 1987-05-14 |
| SE466260B (sv) | 1992-01-20 |
| DE3616583C2 (show.php) | 1989-07-20 |
| AU625537B2 (en) | 1992-07-16 |
| ATA324386A (de) | 1992-06-15 |
| JPH0344562B2 (show.php) | 1991-07-08 |
| GB8626810D0 (en) | 1986-12-10 |
| GB2182666B (en) | 1990-06-13 |
| CA1240444A (en) | 1988-08-09 |
| AU589195B2 (en) | 1989-10-05 |
| AU3709489A (en) | 1989-11-02 |
| SE8605441D0 (sv) | 1986-12-18 |
| FR2589864A1 (fr) | 1987-05-15 |
| CH677234A5 (show.php) | 1991-04-30 |
| JPS62115002A (ja) | 1987-05-26 |
| BR8606292A (pt) | 1988-07-05 |
| SE8605441L (sv) | 1988-06-19 |
| FR2589864B1 (fr) | 1992-10-09 |
| NL8602576A (nl) | 1987-06-01 |
| GB2182666A (en) | 1987-05-20 |
| DE3616583A1 (de) | 1987-05-21 |
| NL191240B (nl) | 1994-11-01 |
| BE905996A (fr) | 1987-06-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3785476T2 (de) | Verfahren zur herstellung von carboxylatgruppen enthaltenden modifizierten acrylamidpolymeren und polymere daraus. | |
| US4703092A (en) | Process of making N-(2-hydroxy-3-sulfopropyl)amide containing polymers | |
| DE69127758T2 (de) | Markierte Polymere und Synthese durch Nach-Polymerisation-Transamidierung | |
| DE2040270C2 (de) | Verfahren zur Herstellung eines Polyolefin-substituierten Amins | |
| EP0238729B1 (en) | Alkoxylated/cationically modified amide-containing polymers and process for producing the polymers | |
| DE2502914A1 (de) | Funktionelle ionische zusammensetzungen und ihre verwendung | |
| EP0566974A1 (de) | Reinigung von fluorierten Carbonsäuren | |
| DE2835876A1 (de) | Kationisches polymeres ausflockungsmittel | |
| DE3887714T3 (de) | Herstellung von Polycarbonat. | |
| DE2736408A1 (de) | Verfahren zur herstellung von sulfobetainen | |
| DE69302841T2 (de) | Seitenkettenchlorierung von 2-Chlor-Methylpyridin | |
| DE1495538C3 (de) | Verfahren zur Herstellung eines löslichen Diphenylätherpolymerisats | |
| DE10150190A1 (de) | Verfahren zur Verringerung oder zur vollständigen Einstellung von Wasserzuflüssen bei einer unterirdischen Formation, und vernetzbare Copolymere zu dessen Durchführung | |
| DE3382747T2 (de) | Oxydiertes Produkt von Mannichkondensaten. | |
| AT395592B (de) | Verfahren zur herstellung von wasserloeslichen sulfonierten polymeren | |
| EP0186029A2 (de) | Verfahren zum Trennen von Öl-in-Wasser-Emulsionen | |
| DE3390062C2 (show.php) | ||
| DE4322854C2 (de) | Verfahren für die Synthese von oligomeren und polymeren Vinylaminen | |
| DE69518027T2 (de) | Verfahren zur Herstellung von Acrylamid | |
| DE1595544C3 (de) | Verfahren zur Herstellung von stabilen, wasserlöslichen kationischen Carbamoyl-Gruppen tragenden Polymerisaten | |
| DE69421488T2 (de) | Verfahren zur Darstellung von Polycarbonaten | |
| DE69208288T2 (de) | Korrosioninhibierung in stark sauren Umgebungen | |
| DE69204412T2 (de) | Dithiocarbamat-gruppen enthaltende Polymere. | |
| DE952981C (de) | Verfahren zur Herstellung von oberflaechenaktiven polyoxalkylierten N-(tert.-Alkyl)-aminen | |
| DE2615831A1 (de) | Verfahren zur aminierung von alpha, beta -ungesaettigten amid-polymeren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |