AT228634B - - Google Patents
Info
- Publication number
- AT228634B AT228634B AT223362A AT223362A AT228634B AT 228634 B AT228634 B AT 228634B AT 223362 A AT223362 A AT 223362A AT 223362 A AT223362 A AT 223362A AT 228634 B AT228634 B AT 228634B
- Authority
- AT
- Austria
- Prior art keywords
- parts
- naphthol
- weight
- volume
- acetylamino
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- -1 amino compound Chemical class 0.000 description 17
- 238000000354 decomposition reaction Methods 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000000155 melt Substances 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- ZXYNGLRGFYLTQZ-UHFFFAOYSA-M [Zn]Cl Chemical compound [Zn]Cl ZXYNGLRGFYLTQZ-UHFFFAOYSA-M 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000000843 powder Substances 0.000 description 5
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical class C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- KVHHMYZBFBSVDI-UHFFFAOYSA-N 8-aminonaphthalen-2-ol Chemical compound C1=C(O)C=C2C(N)=CC=CC2=C1 KVHHMYZBFBSVDI-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 150000008049 diazo compounds Chemical class 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- XIBFUTJVGBRXPJ-UHFFFAOYSA-N N-(7-hydroxynaphthalen-1-yl)-N'-methylacetohydrazide Chemical compound CNN(C(C)=O)C1=CC=CC2=CC=C(C=C12)O XIBFUTJVGBRXPJ-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- YFCXTPKUVYRXFI-UHFFFAOYSA-M 4-(diethylamino)benzenediazonium;chloride Chemical compound [Cl-].CCN(CC)C1=CC=C([N+]#N)C=C1 YFCXTPKUVYRXFI-UHFFFAOYSA-M 0.000 description 1
- NZVGQLAXTXOAET-UHFFFAOYSA-N 4-benzamido-2,5-diethoxybenzenediazonium;chloride Chemical compound [Cl-].CCOC1=CC([N+]#N)=C(OCC)C=C1NC(=O)C1=CC=CC=C1 NZVGQLAXTXOAET-UHFFFAOYSA-N 0.000 description 1
- ZRLNQIBIJSPPGC-UHFFFAOYSA-N CN(C1=CC=CC2=CC=C(C=C12)O)C(CN1CCNCC1)=O Chemical compound CN(C1=CC=CC2=CC=C(C=C12)O)C(CN1CCNCC1)=O ZRLNQIBIJSPPGC-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- HODGFPGKJHODAT-UHFFFAOYSA-N Cl.N1(CCCCC1)N(C1=CC=CC2=CC=C(C=C12)O)C(C)=O Chemical compound Cl.N1(CCCCC1)N(C1=CC=CC2=CC=C(C=C12)O)C(C)=O HODGFPGKJHODAT-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- ICGLOTCMOYCOTB-UHFFFAOYSA-N [Cl].[Zn] Chemical compound [Cl].[Zn] ICGLOTCMOYCOTB-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Landscapes
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE228634T | 1961-03-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT228634B true AT228634B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1963-07-25 |
Family
ID=29593975
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT223362A AT228634B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1961-03-18 | 1962-03-19 |
Country Status (1)
| Country | Link |
|---|---|
| AT (1) | AT228634B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
-
1962
- 1962-03-19 AT AT223362A patent/AT228634B/de active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2118798A1 (de) | Gegen den schädlichen Einfluß des UV-Lichtes geschütztes organisches Produkt und UV-Absorber | |
| AT228634B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE832396C (de) | Lichtempfindliche Schichten fuer die Diazotypie | |
| DE1226879B (de) | Lichtempfindliches Kopiermaterial mit einseitig diazotiertem p-Phenylendiamin-Derivat als licht-empfindliche Substanz | |
| DE2142947A1 (de) | Monoazofarbstoffe und deren Verwendung | |
| DE1169293B (de) | Zweikomponenten-Diazotypiematerial | |
| DE1163675B (de) | Zweikomponenten-Diazotypielichtpausmaterial | |
| DE918634C (de) | Verfahren zur Herstellung ueberfaerbeechter Faerbungen auf Acetylcellulose sowie linearen Polyamiden oder Polyurethanen | |
| DE2933990C2 (de) | 2-Sulfamoyl-5-sulfamido-1-naphthole | |
| DE831804C (de) | Lichtempfindliche Schichten fuer die Diazotypie | |
| DE2500071A1 (de) | Azofarbstoffe fuer den transferdruck | |
| DE2262794A1 (de) | Styrylfarbstoffe und verfahren zu ihrer herstellung | |
| DE1134588B (de) | Diazotypiematerial, insbesondere fuer die Trockenentwicklung | |
| DE1224611B (de) | Lichtempfindliches Kopiermaterial fuer die Diazotypie mit 2, 5-Dialkoxy-4-tert.-aminobenzol-diazoniumsalzen | |
| AT262059B (de) | Verwendung von quartären Salzen aus der Reihe der 2,3 Oxynaphthoesäureamide für die Diazotypie | |
| DE1161135B (de) | Photographisches Material fuer das Silberfarbbleichverfahren | |
| AT233378B (de) | Zweikomponenten-Diazotypielichtpausmaterial | |
| DE692648C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE878997C (de) | Verfahren zur Herstellung von stickstoffhaltigen Farbstoffen | |
| DE682540C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| AT228633B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE730590C (de) | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen | |
| AT219411B (de) | Photographisches Ein- oder Mehrschichtenmaterial | |
| DE1911491C3 (de) | Lichtempfindliche Diazoniumsalze, Verfahren zu ihrer Herstellung und sie enthaltendes Diazotypie-Kopiermaterial | |
| DE741465C (de) | Verfahren zur Herstellung von kupferhaltigen Disazofarbstoffen |