AT124034B - Elektrische Leuchtröhre. - Google Patents
Elektrische Leuchtröhre.Info
- Publication number
- AT124034B AT124034B AT124034DA AT124034B AT 124034 B AT124034 B AT 124034B AT 124034D A AT124034D A AT 124034DA AT 124034 B AT124034 B AT 124034B
- Authority
- AT
- Austria
- Prior art keywords
- transition points
- temperature
- fluorescent tube
- vapors
- main pipe
- Prior art date
Links
- 230000007704 transition Effects 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 239000007789 gas Substances 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 3
- 229910052756 noble gas Inorganic materials 0.000 claims description 3
- 150000002835 noble gases Chemical class 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 150000002739 metals Chemical class 0.000 claims description 2
- 238000004804 winding Methods 0.000 claims description 2
- 230000001681 protective effect Effects 0.000 claims 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 238000010304 firing Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/52—Cooling arrangements; Heating arrangements; Means for circulating gas or vapour within the discharge space
- H01J61/523—Heating or cooling particular parts of the lamp
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE518948T | 1930-01-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT124034B true AT124034B (de) | 1931-08-10 |
Family
ID=34085408
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT124034D AT124034B (de) | 1930-01-12 | 1930-10-06 | Elektrische Leuchtröhre. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US1930132A (mber) |
| AT (1) | AT124034B (mber) |
| CH (1) | CH148905A (mber) |
| DE (1) | DE518948C (mber) |
| FR (1) | FR703530A (mber) |
| GB (1) | GB363092A (mber) |
| NL (1) | NL33743C (mber) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1198452B (de) * | 1957-05-07 | 1965-08-12 | Philips Nv | Niederdruckquecksilberdampfentladungslampe |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2621296A (en) * | 1944-09-02 | 1952-12-09 | Robert W Thompson | Ion source |
| US3482141A (en) * | 1967-12-07 | 1969-12-02 | Henry Greber | Gas discharge lamp with a movable baffle adjacent one electrode |
| US3531687A (en) * | 1968-10-17 | 1970-09-29 | Henry Greber | Gas discharge tube with a movable baffle between the electrodes |
| US4278910A (en) * | 1979-08-06 | 1981-07-14 | Gte Products Corporation | High pressure arc discharge lamp having concave shaped outer jacket |
| US4508993A (en) * | 1981-11-25 | 1985-04-02 | General Electric Company | Fluorescent lamp without ballast |
| US7619350B2 (en) * | 2006-08-29 | 2009-11-17 | Osram Sylvania Inc. | Arc discharge vessel having arc centering structure and lamp containing same |
-
0
- NL NL33743D patent/NL33743C/xx active
-
1930
- 1930-01-12 DE DE1930518948D patent/DE518948C/de not_active Expired
- 1930-10-06 AT AT124034D patent/AT124034B/de active
- 1930-10-07 CH CH148905D patent/CH148905A/de unknown
- 1930-10-09 FR FR703530D patent/FR703530A/fr not_active Expired
- 1930-11-17 GB GB34541/30A patent/GB363092A/en not_active Expired
- 1930-12-16 US US502741A patent/US1930132A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1198452B (de) * | 1957-05-07 | 1965-08-12 | Philips Nv | Niederdruckquecksilberdampfentladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| NL33743C (mber) | |
| CH148905A (de) | 1931-08-15 |
| US1930132A (en) | 1933-10-10 |
| GB363092A (en) | 1931-12-17 |
| FR703530A (fr) | 1931-05-01 |
| DE518948C (de) | 1931-02-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT124034B (de) | Elektrische Leuchtröhre. | |
| DE69007314T2 (de) | Schaltanordnung. | |
| DE1918466A1 (de) | Elektrischer Widerstand fuer das Zuenden von Gasen oder Brennoelen | |
| DE657884C (de) | Elektrischer Heizkoerper, insbesondere fuer Koch-, Brat- und Backzwecke | |
| DE652752C (de) | Mit Metalldampf gefuellte elektrische Entladungsroehre | |
| DE709101C (de) | Hochhitzebestaendiges keramisches Schutzrohr fuer stabfoermige Heizleiter | |
| AT87132B (de) | Vorrichtung zur Erzeugung hoher Temperaturen, insbesondere bei elektrisch geheizten Öfen. | |
| AT112116B (de) | Rohrförmiger elektrischer Ofen zum Glühen von Drähten, Stangen, Rohren und ähnlich geformtem Material. | |
| DE741289C (de) | Elektrischer Gluehheizkoerper | |
| DE597916C (de) | Elektrische Leuchtroehre mit festen Metall- oder Oxydelektroden und einer Fuellung aus kondensierbaren Metalldaempfen oder aus einem Gemisch solcher Daempfe und die Entladung einleitenden Gasen | |
| AT159296B (de) | Elektrische Heizeinrichtung. | |
| AT139286B (de) | Doppelwandige elektrische Leuchtröhre. | |
| DE540969C (de) | Eisenloser Induktionsofen mit gasdichtem Heizraum | |
| AT150986B (de) | Elektrisch beheizter Ofen. | |
| AT142507B (de) | Hochspannungssicherung. | |
| DE633186C (de) | Direkt geheizte Gluehkathode fuer gasgefuellte Entladungsgefaesse | |
| AT157558B (de) | Heizelement für Hochtemperaturöfen. | |
| AT137801B (de) | Elektrische Entladungsröhre. | |
| DE499454C (de) | Anordnung an elektrischen Hochspannungs-Lichtbogenoefen | |
| DE673106C (de) | Elektrischer Induktions- und Widerstandsofen zur Erzielung hoher Temperaturen mit betriebsmaessig fluessigen Metallen als Heizwiderstaenden | |
| DE683436C (de) | Insbesondere zum Aussenden von Lichtstrahlen dienende elektrische Entladungsroehre mit einer Fuellung aus Gas und Dampf von verhaeltnismaessig schwerfluechtigem Metall | |
| AT257766B (de) | Induktor für elektrische Induktionserwärmung | |
| CH352188A (de) | Zünder | |
| DE620826C (de) | Elektrisch beheizter Ofen | |
| DE584353C (de) | Verfahren zur Ausheizung von elektrischen Entladungsroehren |