AP680A - Herbicidal compositions of 4-benzoylisoxazole or 2-cyano-1,3-dione herbcides and antidotes therefor - Google Patents
Herbicidal compositions of 4-benzoylisoxazole or 2-cyano-1,3-dione herbcides and antidotes therefor Download PDFInfo
- Publication number
- AP680A AP680A APAP/P/1997/001023A AP9701023A AP680A AP 680 A AP680 A AP 680A AP 9701023 A AP9701023 A AP 9701023A AP 680 A AP680 A AP 680A
- Authority
- AP
- ARIPO
- Prior art keywords
- oxazolidine
- alkyl
- optionally substituted
- halogen
- carbon atoms
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims abstract description 102
- 239000000203 mixture Substances 0.000 title claims abstract description 41
- FGGUUGIYSOGQED-UHFFFAOYSA-N 1,2-oxazol-4-yl(phenyl)methanone Chemical group C=1C=CC=CC=1C(=O)C=1C=NOC=1 FGGUUGIYSOGQED-UHFFFAOYSA-N 0.000 title claims abstract description 27
- 239000000729 antidote Substances 0.000 title claims description 73
- 229940075522 antidotes Drugs 0.000 title description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 87
- 239000004009 herbicide Substances 0.000 claims abstract description 79
- 230000006378 damage Effects 0.000 claims abstract description 22
- 238000000034 method Methods 0.000 claims abstract description 22
- 208000027418 Wounds and injury Diseases 0.000 claims abstract description 17
- 208000014674 injury Diseases 0.000 claims abstract description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 81
- -1 benzothiazolvl Chemical class 0.000 claims description 62
- 125000005843 halogen group Chemical group 0.000 claims description 60
- 125000004432 carbon atom Chemical group C* 0.000 claims description 57
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 39
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 claims description 35
- 229910052736 halogen Inorganic materials 0.000 claims description 30
- 150000002367 halogens Chemical class 0.000 claims description 30
- 125000003342 alkenyl group Chemical group 0.000 claims description 26
- 239000002689 soil Substances 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 23
- 125000003545 alkoxy group Chemical group 0.000 claims description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 22
- 125000001188 haloalkyl group Chemical group 0.000 claims description 21
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- 125000000304 alkynyl group Chemical group 0.000 claims description 17
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 125000002541 furyl group Chemical group 0.000 claims description 11
- 125000001544 thienyl group Chemical group 0.000 claims description 11
- WCGGWVOVFQNRRS-UHFFFAOYSA-N dichloroacetamide Chemical compound NC(=O)C(Cl)Cl WCGGWVOVFQNRRS-UHFFFAOYSA-N 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 8
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 8
- ICJSJAJWTWPSBD-UHFFFAOYSA-N cloquintocet Chemical compound C1=CN=C2C(OCC(=O)O)=CC=C(Cl)C2=C1 ICJSJAJWTWPSBD-UHFFFAOYSA-N 0.000 claims description 8
- 125000004076 pyridyl group Chemical group 0.000 claims description 8
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical compound C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 claims description 7
- 125000000262 haloalkenyl group Chemical group 0.000 claims description 7
- CSVFWMMPUJDVKH-UHFFFAOYSA-N 1,1-dichloropropan-2-one Chemical compound CC(=O)C(Cl)Cl CSVFWMMPUJDVKH-UHFFFAOYSA-N 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 231100001184 nonphytotoxic Toxicity 0.000 claims description 5
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- 125000001041 indolyl group Chemical group 0.000 claims description 4
- 125000005956 isoquinolyl group Chemical group 0.000 claims description 4
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 4
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 claims description 4
- LJDZFAPLPVPTBD-UHFFFAOYSA-N nitroformic acid Chemical class OC(=O)[N+]([O-])=O LJDZFAPLPVPTBD-UHFFFAOYSA-N 0.000 claims description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 4
- 125000005936 piperidyl group Chemical group 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 4
- 125000000335 thiazolyl group Chemical group 0.000 claims description 4
- GZEVGNINWVUGFO-UHFFFAOYSA-N 2-chloro-n-[1-(2,4,6-trimethylphenyl)ethenyl]acetamide Chemical compound CC1=CC(C)=C(C(=C)NC(=O)CCl)C(C)=C1 GZEVGNINWVUGFO-UHFFFAOYSA-N 0.000 claims description 3
- YNQSILKYZQZHFJ-UHFFFAOYSA-N R-29148 Chemical compound CC1CN(C(=O)C(Cl)Cl)C(C)(C)O1 YNQSILKYZQZHFJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000006383 alkylpyridyl group Chemical group 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 3
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- QRAOZQGIUIDZQZ-UHFFFAOYSA-N 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzoxazine Chemical compound C=1C=C2N(C)CCOC2=CC=1B1OC(C)(C)C(C)(C)O1 QRAOZQGIUIDZQZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims description 2
- 125000005277 alkyl imino group Chemical group 0.000 claims description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 claims 14
- 125000001841 imino group Chemical group [H]N=* 0.000 claims 9
- BIXDGFXKRPNCKF-UHFFFAOYSA-N 2,2-dichloro-1-(2,2-dimethyl-5-thiophen-2-yl-1,3-oxazolidin-3-yl)ethanone Chemical compound C1N(C(=O)C(Cl)Cl)C(C)(C)OC1C1=CC=CS1 BIXDGFXKRPNCKF-UHFFFAOYSA-N 0.000 claims 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims 6
- KWGQOJWITMQEOT-UHFFFAOYSA-N 2-benzhydryloxyacetic acid Chemical compound C=1C=CC=CC=1C(OCC(=O)O)C1=CC=CC=C1 KWGQOJWITMQEOT-UHFFFAOYSA-N 0.000 claims 4
- FOMHMPJALXOZGZ-UHFFFAOYSA-N 2,2-dichloro-1-(2,2-dimethyl-1,3-oxazolidin-3-yl)ethanone Chemical compound CC1(C)OCCN1C(=O)C(Cl)Cl FOMHMPJALXOZGZ-UHFFFAOYSA-N 0.000 claims 3
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims 3
- 125000004193 piperazinyl group Chemical group 0.000 claims 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims 3
- UUGRNKOTUALLDR-UHFFFAOYSA-N 1-(1-azaspiro[4.4]nonan-1-yl)-2,2-dichloroethanone Chemical compound ClC(Cl)C(=O)N1CCCC11CCCC1 UUGRNKOTUALLDR-UHFFFAOYSA-N 0.000 claims 2
- MCNOFYBITGAAGM-UHFFFAOYSA-N 2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone Chemical compound C1N(C(=O)C(Cl)Cl)C(C)(C)OC1C1=CC=CO1 MCNOFYBITGAAGM-UHFFFAOYSA-N 0.000 claims 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims 2
- 150000008064 anhydrides Chemical class 0.000 claims 2
- 125000004692 haloalkylcarbonyl group Chemical group 0.000 claims 2
- 125000000160 oxazolidinyl group Chemical group 0.000 claims 2
- 125000002071 phenylalkoxy group Chemical group 0.000 claims 2
- 125000004928 piperidonyl group Chemical group 0.000 claims 2
- 125000003226 pyrazolyl group Chemical group 0.000 claims 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims 2
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 claims 2
- WFVUIONFJOAYPK-SDNWHVSQSA-N (z)-n-(1,3-dioxolan-2-ylmethoxy)benzenecarboximidoyl cyanide Chemical compound C=1C=CC=CC=1C(/C#N)=N/OCC1OCCO1 WFVUIONFJOAYPK-SDNWHVSQSA-N 0.000 claims 1
- SXSNYZPSATVORJ-UHFFFAOYSA-N 2,2-dichloro-1-(2,2-dimethyl-5-phenyl-1,3-oxazolidin-3-yl)ethanone Chemical compound C1N(C(=O)C(Cl)Cl)C(C)(C)OC1C1=CC=CC=C1 SXSNYZPSATVORJ-UHFFFAOYSA-N 0.000 claims 1
- NRFQZTCQAYEXEE-UHFFFAOYSA-N Fenclorim Chemical compound ClC1=CC(Cl)=NC(C=2C=CC=CC=2)=N1 NRFQZTCQAYEXEE-UHFFFAOYSA-N 0.000 claims 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 150000005130 benzoxazines Chemical class 0.000 claims 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims 1
- 125000005052 dihydropyrazolyl group Chemical group N1(NCC=C1)* 0.000 claims 1
- VLXDSXLUNPBBOT-UHFFFAOYSA-N n-(2-chloro-1-phenylethylidene)hydroxylamine Chemical compound ON=C(CCl)C1=CC=CC=C1 VLXDSXLUNPBBOT-UHFFFAOYSA-N 0.000 claims 1
- 229920001281 polyalkylene Polymers 0.000 claims 1
- 230000002605 anti-dotal effect Effects 0.000 abstract description 6
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 abstract description 5
- 235000002017 Zea mays subsp mays Nutrition 0.000 abstract description 5
- 235000005822 corn Nutrition 0.000 abstract description 5
- 230000000694 effects Effects 0.000 abstract description 5
- 231100000674 Phytotoxicity Toxicity 0.000 abstract description 4
- 244000038559 crop plants Species 0.000 abstract description 4
- 239000004480 active ingredient Substances 0.000 abstract description 2
- 241000209149 Zea Species 0.000 abstract 2
- 241000196324 Embryophyta Species 0.000 description 29
- 238000011282 treatment Methods 0.000 description 8
- 240000008042 Zea mays Species 0.000 description 5
- 239000002671 adjuvant Substances 0.000 description 5
- 230000002411 adverse Effects 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 241000894007 species Species 0.000 description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 5
- 230000009286 beneficial effect Effects 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 238000010899 nucleation Methods 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000006978 adaptation Effects 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 239000003815 herbicide antidote Substances 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 229910052717 sulfur Chemical group 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- IJVLVRYLIMQVDD-UHFFFAOYSA-N 1,3-thiazole-2-carboxylic acid Chemical class OC(=O)C1=NC=CS1 IJVLVRYLIMQVDD-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 235000007244 Zea mays Nutrition 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000001276 controlling effect Effects 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 208000037824 growth disorder Diseases 0.000 description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000000885 phytotoxic effect Effects 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- CAAMSDWKXXPUJR-UHFFFAOYSA-N 3,5-dihydro-4H-imidazol-4-one Chemical class O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 description 1
- BPPVUXSMLBXYGG-UHFFFAOYSA-N 4-[3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoyl]-2-methyl-1h-pyrazol-3-one Chemical group CC1=C(C(=O)C=2C(N(C)NC=2)=O)C=CC(S(C)(=O)=O)=C1C1=NOCC1 BPPVUXSMLBXYGG-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- 206010001557 Albinism Diseases 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000007218 Ipomoea hederacea Species 0.000 description 1
- YJLYANLCNIKXMG-UHFFFAOYSA-N N-Methyldioctylamine Chemical compound CCCCCCCCN(C)CCCCCCCC YJLYANLCNIKXMG-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- 235000017016 Setaria faberi Nutrition 0.000 description 1
- 241000820191 Setaria magna Species 0.000 description 1
- 235000015505 Sorghum bicolor subsp. bicolor Nutrition 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 240000000359 Triticum dicoccon Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 229910021386 carbon form Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 239000004491 dispersible concentrate Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 208000006278 hypochromic anemia Diseases 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002680 magnesium Chemical class 0.000 description 1
- 230000036244 malformation Effects 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 125000005358 mercaptoalkyl group Chemical group 0.000 description 1
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical class [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- ZCYXXKJEDCHMGH-UHFFFAOYSA-N nonane Chemical compound CCCC[CH]CCCC ZCYXXKJEDCHMGH-UHFFFAOYSA-N 0.000 description 1
- BKIMMITUMNQMOS-UHFFFAOYSA-N normal nonane Natural products CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- 150000003109 potassium Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000004040 pyrrolidinones Chemical class 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 230000007226 seed germination Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229940124547 specific antidotes Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/42—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing within the same carbon skeleton a carboxylic group or a thio analogue, or a derivative thereof, and a carbon atom having only two bonds to hetero atoms with at the most one bond to halogen, e.g. keto-carboxylic acids
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/80—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,2
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/370,070 US5627131A (en) | 1995-01-09 | 1995-01-09 | Herbicidal compositions of 4-benzoylisoxazole and antidotes therefor |
| PCT/GB1996/000014 WO1996021357A1 (en) | 1995-01-09 | 1996-01-05 | Herbicidal compositions of 4-benzoylisoxazole or 2-cyano-1,3-dione herbicides and antidotes therefor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AP9701023A0 AP9701023A0 (en) | 1997-07-31 |
| AP680A true AP680A (en) | 1998-09-30 |
Family
ID=23458096
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| APAP/P/1997/001023A AP680A (en) | 1995-01-09 | 1996-01-05 | Herbicidal compositions of 4-benzoylisoxazole or 2-cyano-1,3-dione herbcides and antidotes therefor |
Country Status (28)
| Country | Link |
|---|---|
| US (1) | US5627131A (ro) |
| EP (1) | EP0802732B1 (ro) |
| JP (2) | JP3851348B2 (ro) |
| KR (1) | KR100408797B1 (ro) |
| CN (1) | CN1079641C (ro) |
| AP (1) | AP680A (ro) |
| AT (1) | ATE191829T1 (ro) |
| AU (1) | AU702142B2 (ro) |
| BG (1) | BG63654B1 (ro) |
| BR (1) | BR9606891A (ro) |
| CA (1) | CA2209937C (ro) |
| CZ (1) | CZ292510B6 (ro) |
| DE (1) | DE69607827T2 (ro) |
| DK (1) | DK0802732T3 (ro) |
| EA (1) | EA000062B1 (ro) |
| ES (1) | ES2147360T3 (ro) |
| GR (1) | GR3033303T3 (ro) |
| HU (1) | HU218492B (ro) |
| NZ (1) | NZ297874A (ro) |
| PL (1) | PL186083B1 (ro) |
| PT (1) | PT802732E (ro) |
| RO (1) | RO116151B1 (ro) |
| SI (1) | SI0802732T1 (ro) |
| SK (1) | SK283551B6 (ro) |
| TR (1) | TR199700607T1 (ro) |
| UA (1) | UA49819C2 (ro) |
| WO (1) | WO1996021357A1 (ro) |
| ZA (1) | ZA9667B (ro) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5795846A (en) * | 1994-08-01 | 1998-08-18 | Rhone-Poulenc Agriculture Limited | Herbicidal compositions |
| AU697591B2 (en) * | 1994-08-01 | 1998-10-08 | Rhone-Poulenc Agriculture Limited | New herbicidal compositions |
| US5627131A (en) * | 1995-01-09 | 1997-05-06 | Zeneca Limited | Herbicidal compositions of 4-benzoylisoxazole and antidotes therefor |
| US6297198B1 (en) | 1996-05-14 | 2001-10-02 | Syngenta Participations Ag | Isoxazole derivatives and their use as herbicides |
| US20030041357A1 (en) * | 1996-11-07 | 2003-02-27 | Zeneca Limited | Herbicide resistant plants |
| ATE207296T1 (de) * | 1997-06-10 | 2001-11-15 | Aventis Cropscience Sa | Neue herbizide mischungen |
| EP1005467A1 (en) * | 1997-08-20 | 2000-06-07 | Novartis AG | Benzothiophene derivatives as herbicides |
| US5863865A (en) * | 1997-10-28 | 1999-01-26 | Zeneca Limited | Herbicidal 4-benzoylisoxazoles derivatives |
| US5905057A (en) * | 1997-11-06 | 1999-05-18 | Rhone-Poulenc Agrochimie | Herbicidal 4-benzoylisoxazole-3-carboxylate liquid compositions comprising N-alkylpyrrolidinone stabilizer |
| DE19827855A1 (de) * | 1998-06-23 | 1999-12-30 | Hoechst Schering Agrevo Gmbh | Kombinationen aus Herbiziden und Safenern |
| AU4997999A (en) | 1998-07-16 | 2000-02-07 | Dow Corning Corporation | Compositions and methods for protecting cultivated plants from herbicidal injury |
| DE19853827A1 (de) | 1998-11-21 | 2000-05-25 | Aventis Cropscience Gmbh | Kombinationen aus Herbiziden und Safenern |
| HRP20020207B1 (en) * | 1999-09-08 | 2011-06-30 | Aventis Cropscience Uk Limited | New herbicidal compositions |
| CN1288665A (zh) * | 1999-09-16 | 2001-03-28 | 诺瓦提斯公司 | 除草组合物 |
| DE19950943A1 (de) * | 1999-10-22 | 2001-05-17 | Aventis Cropscience Gmbh | Synergistische herbizide Mittel enthaltend Herbizide aus der Gruppe der Hemmstoffe der Hydroxyphenylpyruvat-Dioxygenase |
| DE10106420A1 (de) * | 2001-02-12 | 2002-08-14 | Bayer Ag | Selektive Herbizide auf Basis von substituierten Arylketonen und Safenern |
| EP1753735A1 (en) * | 2004-04-20 | 2007-02-21 | Transtech Pharma, Inc. | Substituted thiazole and pyrimidine derivatives as melanocortin receptor modulators |
| WO2010025142A1 (en) * | 2008-08-29 | 2010-03-04 | Transtech Pharma, Inc. | Substituted aminothiazole derivatives, pharmaceutical compositions, and methods of use |
| AR091901A1 (es) | 2012-07-25 | 2015-03-11 | Amvac Chemical Corp | Composiciones herbicidas dispersables y metodos de uso de las mismas |
| US10743535B2 (en) | 2017-08-18 | 2020-08-18 | H&K Solutions Llc | Insecticide for flight-capable pests |
| CN108935460B (zh) * | 2018-07-10 | 2020-03-17 | 东北农业大学 | 用于玉米生长的区域防治有害杂草的除草组合物及其用途 |
| CN113480489A (zh) * | 2021-08-19 | 2021-10-08 | 贵州大学 | 异噁唑联苯类化合物及其制备方法和应用 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0418175A2 (en) * | 1989-09-11 | 1991-03-20 | Rhone Poulenc Agriculture Ltd. | Isoxazoles herbicides |
| EP0446631A2 (en) * | 1990-03-12 | 1991-09-18 | International Business Machines Corporation | Method and system for locating the amount field on a document |
| EP0625505A2 (en) * | 1993-05-18 | 1994-11-23 | Rhone Poulenc Agriculture Ltd. | 2-Cyano-1,3-dione derivatives and their use as herbicides |
| WO1996021357A1 (en) * | 1995-01-09 | 1996-07-18 | Zeneca Limited | Herbicidal compositions of 4-benzoylisoxazole or 2-cyano-1,3-dione herbicides and antidotes therefor |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4021224A (en) * | 1971-12-09 | 1977-05-03 | Stauffer Chemical Company | Herbicide compositions |
| US4021229A (en) * | 1972-09-05 | 1977-05-03 | Stauffer Chemical Company | Sulfonamide herbicide antidote compositions and method of use |
| US4230874A (en) * | 1976-09-13 | 1980-10-28 | Stauffer Chemical Company | N-(Benzenesulfonyl) carbamates-herbicidal antidotes |
| US4276078A (en) * | 1978-08-04 | 1981-06-30 | Stauffer Chemical Company | Herbicide compositions |
| US4938796A (en) * | 1987-07-06 | 1990-07-03 | Ici Americas Inc. | Herbicidal compositions of acylated 1,3-dicarbonyl herbicides and antidotes therefor |
| US5201933A (en) * | 1988-08-01 | 1993-04-13 | Monsanto Company | Safening herbicidal benzoic acid derivatives |
| GB9025469D0 (en) * | 1990-11-22 | 1991-01-09 | Rhone Poulenc Agriculture | New compositions of matter |
| WO1992010095A1 (en) * | 1990-12-12 | 1992-06-25 | Zeneca Inc. | Antidoting herbicidal 3-isoxazolidinone compounds |
| GB9101659D0 (en) * | 1991-01-25 | 1991-03-06 | Rhone Poulenc Agriculture | Compositions of matter |
| GB9101660D0 (en) * | 1991-01-25 | 1991-03-06 | Rhone Poulenc Agriculture | New compositions of matter |
| GB9116834D0 (en) * | 1991-08-05 | 1991-09-18 | Rhone Poulenc Agriculture | Compositions of new matter |
| IL102674A (en) * | 1991-08-05 | 1996-11-14 | Rhone Poulenc Agriculture | 4-Benzoyl isoxazole derivatives process for their preparation and herbicidal compositions containing them |
| GB9215551D0 (en) * | 1992-07-22 | 1992-09-02 | Rhone Poulenc Agriculture | New compositions of matter |
| GB9302049D0 (en) * | 1993-02-03 | 1993-03-24 | Rhone Poulenc Agriculture | Compositions of new matter |
| GB9302072D0 (en) * | 1993-02-03 | 1993-03-24 | Rhone Poulenc Agriculture | New compositions of matter |
| US5552367A (en) * | 1994-11-18 | 1996-09-03 | Rhone-Poulenc Agriculture Ltd. | Synergistic herbicidal compositions comprising 4-benzoylisoxazole and dinitroaniline herbicides |
-
1995
- 1995-01-09 US US08/370,070 patent/US5627131A/en not_active Expired - Lifetime
-
1996
- 1996-01-05 AU AU43129/96A patent/AU702142B2/en not_active Expired
- 1996-01-05 AP APAP/P/1997/001023A patent/AP680A/en active
- 1996-01-05 SK SK909-97A patent/SK283551B6/sk not_active IP Right Cessation
- 1996-01-05 NZ NZ297874A patent/NZ297874A/en not_active IP Right Cessation
- 1996-01-05 BR BR9606891A patent/BR9606891A/pt not_active IP Right Cessation
- 1996-01-05 DK DK96900040T patent/DK0802732T3/da active
- 1996-01-05 PT PT96900040T patent/PT802732E/pt unknown
- 1996-01-05 AT AT96900040T patent/ATE191829T1/de active
- 1996-01-05 TR TR97/00607T patent/TR199700607T1/xx unknown
- 1996-01-05 SI SI9630165T patent/SI0802732T1/xx unknown
- 1996-01-05 ES ES96900040T patent/ES2147360T3/es not_active Expired - Lifetime
- 1996-01-05 EP EP96900040A patent/EP0802732B1/en not_active Expired - Lifetime
- 1996-01-05 JP JP52150196A patent/JP3851348B2/ja not_active Expired - Lifetime
- 1996-01-05 HU HU9800117A patent/HU218492B/hu unknown
- 1996-01-05 KR KR1019970704560A patent/KR100408797B1/ko not_active Expired - Lifetime
- 1996-01-05 EA EA199700077A patent/EA000062B1/ru not_active IP Right Cessation
- 1996-01-05 RO RO97-01252A patent/RO116151B1/ro unknown
- 1996-01-05 CZ CZ19972068A patent/CZ292510B6/cs not_active IP Right Cessation
- 1996-01-05 PL PL96321266A patent/PL186083B1/pl unknown
- 1996-01-05 CA CA002209937A patent/CA2209937C/en not_active Expired - Lifetime
- 1996-01-05 CN CN96191386A patent/CN1079641C/zh not_active Expired - Lifetime
- 1996-01-05 WO PCT/GB1996/000014 patent/WO1996021357A1/en not_active Ceased
- 1996-01-05 DE DE69607827T patent/DE69607827T2/de not_active Expired - Lifetime
- 1996-01-05 UA UA97084157A patent/UA49819C2/uk unknown
- 1996-01-05 ZA ZA9667A patent/ZA9667B/xx unknown
-
1997
- 1997-06-17 BG BG101635A patent/BG63654B1/bg unknown
-
2000
- 2000-04-24 GR GR20000400986T patent/GR3033303T3/el unknown
-
2006
- 2006-05-10 JP JP2006132016A patent/JP2006241169A/ja not_active Withdrawn
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0418175A2 (en) * | 1989-09-11 | 1991-03-20 | Rhone Poulenc Agriculture Ltd. | Isoxazoles herbicides |
| EP0446631A2 (en) * | 1990-03-12 | 1991-09-18 | International Business Machines Corporation | Method and system for locating the amount field on a document |
| EP0625505A2 (en) * | 1993-05-18 | 1994-11-23 | Rhone Poulenc Agriculture Ltd. | 2-Cyano-1,3-dione derivatives and their use as herbicides |
| WO1996021357A1 (en) * | 1995-01-09 | 1996-07-18 | Zeneca Limited | Herbicidal compositions of 4-benzoylisoxazole or 2-cyano-1,3-dione herbicides and antidotes therefor |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AP680A (en) | Herbicidal compositions of 4-benzoylisoxazole or 2-cyano-1,3-dione herbcides and antidotes therefor | |
| US4938796A (en) | Herbicidal compositions of acylated 1,3-dicarbonyl herbicides and antidotes therefor | |
| AU744797B2 (en) | Herbicidal compositions of tetrazolinone herbicides and antidotes therefor | |
| JPS5944284B2 (ja) | 除草剤 | |
| RO111678B1 (ro) | Derivati de 4-benzoilizoxazol, procedee pentru prepararea acestora, compozitii erbicide si metoda pentru combaterea buruienilor | |
| JP2008523150A (ja) | トウモロコシの収穫量を増加する方法 | |
| US4414020A (en) | Composition and process for promoting the growth of crop plants | |
| US6248693B1 (en) | Herbicidal compositions of tetrazolinone herbicides and antidotes therefor | |
| MXPA97005131A (en) | Herbicidal compositions of 4-benzoylosoxazol oherbicides 2-ciano-1,3-diona and its antido | |
| CA1039076A (en) | Herbicidal compounds | |
| HK1028523A (en) | Herbicidal compositions of tetrazolinone herbicides and antidotes therefor |