SU831077A3 - Способ получени 1,2-дигидрохино-ли-2-OHOB или иХ СОлЕй (ЕгО ВАРиАН-Ты) - Google Patents
Способ получени 1,2-дигидрохино-ли-2-OHOB или иХ СОлЕй (ЕгО ВАРиАН-Ты) Download PDFInfo
- Publication number
- SU831077A3 SU831077A3 SU792782353A SU2782353A SU831077A3 SU 831077 A3 SU831077 A3 SU 831077A3 SU 792782353 A SU792782353 A SU 792782353A SU 2782353 A SU2782353 A SU 2782353A SU 831077 A3 SU831077 A3 SU 831077A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- dihydroquinoline
- piperazin
- oxo
- methyl
- propoxy
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title abstract description 4
- 238000000034 method Methods 0.000 title description 8
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical class C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 title description 6
- -1 4-substituted-piperazin-1-yl Chemical group 0.000 abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 5
- 239000001257 hydrogen Substances 0.000 abstract description 5
- 125000000217 alkyl group Chemical group 0.000 abstract description 3
- 150000002431 hydrogen Chemical group 0.000 abstract description 3
- 229910052736 halogen Inorganic materials 0.000 abstract description 2
- 150000002367 halogens Chemical group 0.000 abstract description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract 1
- 230000003266 anti-allergic effect Effects 0.000 abstract 1
- 230000003276 anti-hypertensive effect Effects 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 22
- 239000002585 base Substances 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000000155 melt Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- GQMHYGCWUDYARM-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]-4-(3-chloropropyl)piperazine Chemical compound C1CN(CCCCl)CCN1CC1=CC=C(Cl)C=C1 GQMHYGCWUDYARM-UHFFFAOYSA-N 0.000 description 4
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 4
- 150000004885 piperazines Chemical class 0.000 description 4
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 description 3
- MYEVEFULPUKTSZ-UHFFFAOYSA-N 7-hydroxy-4-methyl-1H-quinolin-2-one Chemical compound OC1=CC=C2C(C)=CC(=O)NC2=C1 MYEVEFULPUKTSZ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 2
- MLWJMEZPVTZSKE-UHFFFAOYSA-N 6-hydroxy-4-methyl-1h-quinolin-2-one Chemical compound C1=C(O)C=C2C(C)=CC(=O)NC2=C1 MLWJMEZPVTZSKE-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- NDQKGEFMUGSRNS-UHFFFAOYSA-N 1-(3-chlorophenyl)-4-(3-chloropropyl)piperazine Chemical compound C1CN(CCCCl)CCN1C1=CC=CC(Cl)=C1 NDQKGEFMUGSRNS-UHFFFAOYSA-N 0.000 description 1
- OIMXWBXBBASKAL-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(4-fluorophenyl)methyl]piperazine Chemical compound C1=CC(F)=CC=C1CN1CCN(CCCCl)CC1 OIMXWBXBBASKAL-UHFFFAOYSA-N 0.000 description 1
- DFBLBPFSFUPYJN-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(4-methoxyphenyl)methyl]piperazine Chemical compound C1=CC(OC)=CC=C1CN1CCN(CCCCl)CC1 DFBLBPFSFUPYJN-UHFFFAOYSA-N 0.000 description 1
- XOSNEZPIANDZMR-UHFFFAOYSA-N 1-benzyl-4-(3-chloropropyl)piperazine Chemical compound C1CN(CCCCl)CCN1CC1=CC=CC=C1 XOSNEZPIANDZMR-UHFFFAOYSA-N 0.000 description 1
- HMNZROFMBSUMAB-UHFFFAOYSA-N 1-ethoxybutan-1-ol Chemical compound CCCC(O)OCC HMNZROFMBSUMAB-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000006487 butyl benzyl group Chemical group 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 229940126545 compound 53 Drugs 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- SIGPWCVHTYIKME-UHFFFAOYSA-N hexamethanol Chemical compound OC.OC.OC.OC.OC.OC SIGPWCVHTYIKME-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- 150000002691 malonic acids Chemical class 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- FDBYIYFVSAHJLY-UHFFFAOYSA-N resmetirom Chemical compound N1C(=O)C(C(C)C)=CC(OC=2C(=CC(=CC=2Cl)N2C(NC(=O)C(C#N)=N2)=O)Cl)=N1 FDBYIYFVSAHJLY-UHFFFAOYSA-N 0.000 description 1
- 150000003870 salicylic acids Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 150000003444 succinic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pulmonology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Immunology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782827566 DE2827566A1 (de) | 1978-06-23 | 1978-06-23 | 1,2-dihydro-chinolin-2-on-derivate und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU831077A3 true SU831077A3 (ru) | 1981-05-15 |
Family
ID=6042551
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU792782353A SU831077A3 (ru) | 1978-06-23 | 1979-06-22 | Способ получени 1,2-дигидрохино-ли-2-OHOB или иХ СОлЕй (ЕгО ВАРиАН-Ты) |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4234585A (enExample) |
| EP (1) | EP0006506B1 (enExample) |
| JP (1) | JPS552693A (enExample) |
| AT (1) | ATE224T1 (enExample) |
| CA (1) | CA1122218A (enExample) |
| CS (2) | CS207798B2 (enExample) |
| DE (2) | DE2827566A1 (enExample) |
| ES (1) | ES481729A1 (enExample) |
| HU (1) | HU177959B (enExample) |
| IL (1) | IL57577A (enExample) |
| PL (1) | PL115260B1 (enExample) |
| SU (1) | SU831077A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4410822A1 (de) * | 1994-03-24 | 1995-09-28 | Schering Ag | Neue Piperidin-Derivate |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS54130587A (en) * | 1978-03-30 | 1979-10-09 | Otsuka Pharmaceut Co Ltd | Carbostyryl derivative |
| JPS55162774A (en) * | 1979-06-06 | 1980-12-18 | Otsuka Pharmaceut Co Ltd | Carbostyril derivative |
| DE3034237A1 (de) * | 1979-09-18 | 1981-04-16 | Otsuka Pharmaceutical Co. Ltd., Tokyo | Carbostyrilderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende, antihistaminisch wirkende mittel |
| PH17194A (en) * | 1980-03-06 | 1984-06-19 | Otsuka Pharma Co Ltd | Novel carbostyril derivatives,and pharmaceutical composition containing the same |
| DE3033112A1 (de) * | 1980-09-03 | 1982-04-01 | Hochtemperatur-Reaktorbau GmbH, 5000 Köln | Atomkernreaktor |
| JPS57130210A (en) * | 1981-02-06 | 1982-08-12 | Kinseishiya Kk | Power switch noise remover for audio appliance |
| US4442111A (en) * | 1981-07-25 | 1984-04-10 | Dr. Karl Thomae Gesellschaft Mit Beschrankter Haftung | Antithrombotic sulfimino and sulfoximino indolinones-2 |
| DE3225169A1 (de) * | 1982-07-06 | 1984-01-12 | Basf Ag, 6700 Ludwigshafen | Chinolinderivate, verfahren zu ihrer herstellung, diese enthaltende mikrobizide und ihre verwendung zur bekaempfung von pilzen |
| DE3434271A1 (de) * | 1984-09-19 | 1986-03-20 | Beiersdorf Ag, 2000 Hamburg | Substituierte 3,4-dihydro-chinolin-2(1h)-one verfahren zu ihrer herstellung und ihre verwendung sowie diese verbindungen enthaltende zubereitungen |
| DE3442570A1 (de) * | 1984-11-22 | 1986-05-22 | Hoechst Ag, 6230 Frankfurt | Neue substituierte phenylpiperazinderivate, verfahren zu deren herstellung und die verwendung substituierter phenylpiperazinderivate als aggressionshemmer fuer tiere |
| GB8502267D0 (en) * | 1985-01-30 | 1985-02-27 | Pfizer Ltd | Quinolone inotropic agents |
| JPS63119467A (ja) * | 1987-10-21 | 1988-05-24 | Otsuka Pharmaceut Co Ltd | カルボスチリル誘導体 |
| JP2608788B2 (ja) * | 1988-10-31 | 1997-05-14 | 大塚製薬 株式会社 | 精神分裂病治療剤 |
| US5006528A (en) * | 1988-10-31 | 1991-04-09 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives |
| US5457099A (en) * | 1992-07-02 | 1995-10-10 | Sawai Pharmaceutical Co., Ltd. | Carbostyril derivatives and antiallergic agent |
| CA2180190A1 (en) * | 1995-07-10 | 1997-01-11 | Kazumi Ogata | Benzylpiperazine derivatives |
| GB0203778D0 (en) * | 2002-02-18 | 2002-04-03 | Glaxo Group Ltd | Compounds |
| CN100497325C (zh) * | 2004-04-21 | 2009-06-10 | 齐鲁制药有限公司 | 哌嗪衍生物及其在制备喹啉酮衍生物中的用途 |
| TWI320783B (en) | 2005-04-14 | 2010-02-21 | Otsuka Pharma Co Ltd | Heterocyclic compound |
| CN101538252B (zh) * | 2008-03-20 | 2011-04-20 | 成都康弘药业集团股份有限公司 | 阿立哌唑的制备方法及其中间体 |
| NZ603076A (en) * | 2010-08-24 | 2014-12-24 | Otsuka Pharma Co Ltd | Suspension and cake composition containing carbostyril derivative and silicone oil and/or silicone oil derivative |
| EP2847193B1 (en) * | 2012-05-09 | 2019-08-07 | Sunovion Pharmaceuticals Inc. | Heteroaryl compounds and methods of use thereof |
| CN109180577B (zh) * | 2018-10-15 | 2021-11-16 | 迪嘉药业集团有限公司 | 一种阿立哌唑的制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH523899A (de) * | 1968-07-05 | 1972-06-15 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von Derivaten des 2-Oxo-1,2-dihydro-chinolins |
| JPS48103590A (enExample) * | 1972-04-13 | 1973-12-25 | ||
| DE2337461A1 (de) * | 1973-07-24 | 1975-02-06 | Boehringer Mannheim Gmbh | Neue indolderivate und verfahren zu deren herstellung |
| GB1501149A (en) * | 1975-07-11 | 1978-02-15 | Nisshin Flour Milling Co | Isocarbostyril derivatives |
| JPS54130587A (en) * | 1978-03-30 | 1979-10-09 | Otsuka Pharmaceut Co Ltd | Carbostyryl derivative |
| JPS55124766A (en) * | 1979-03-20 | 1980-09-26 | Otsuka Pharmaceut Co Ltd | Antihistaminic |
-
1978
- 1978-06-23 DE DE19782827566 patent/DE2827566A1/de not_active Withdrawn
-
1979
- 1979-06-04 US US06/045,472 patent/US4234585A/en not_active Expired - Lifetime
- 1979-06-08 DE DE7979101827T patent/DE2960820D1/de not_active Expired
- 1979-06-08 AT AT79101827T patent/ATE224T1/de not_active IP Right Cessation
- 1979-06-08 EP EP79101827A patent/EP0006506B1/de not_active Expired
- 1979-06-13 CA CA000329712A patent/CA1122218A/en not_active Expired
- 1979-06-17 IL IL57577A patent/IL57577A/xx unknown
- 1979-06-18 PL PL1979216409A patent/PL115260B1/pl unknown
- 1979-06-20 ES ES481729A patent/ES481729A1/es not_active Expired
- 1979-06-21 CS CS794286A patent/CS207798B2/cs unknown
- 1979-06-21 CS CS798953A patent/CS207799B2/cs unknown
- 1979-06-22 JP JP7823079A patent/JPS552693A/ja active Granted
- 1979-06-22 HU HU79BO1793A patent/HU177959B/hu not_active IP Right Cessation
- 1979-06-22 SU SU792782353A patent/SU831077A3/ru active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4410822A1 (de) * | 1994-03-24 | 1995-09-28 | Schering Ag | Neue Piperidin-Derivate |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0006506A1 (de) | 1980-01-09 |
| CS207798B2 (en) | 1981-08-31 |
| DE2960820D1 (en) | 1981-12-03 |
| US4234585A (en) | 1980-11-18 |
| CS207799B2 (en) | 1981-08-31 |
| CA1122218A (en) | 1982-04-20 |
| IL57577A0 (en) | 1979-10-31 |
| DE2827566A1 (de) | 1980-01-10 |
| ES481729A1 (es) | 1980-03-01 |
| HU177959B (en) | 1982-02-28 |
| ATE224T1 (de) | 1981-10-15 |
| PL216409A1 (enExample) | 1980-03-24 |
| JPS552693A (en) | 1980-01-10 |
| JPS6331465B2 (enExample) | 1988-06-23 |
| PL115260B1 (en) | 1981-03-31 |
| IL57577A (en) | 1982-03-31 |
| EP0006506B1 (de) | 1981-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU831077A3 (ru) | Способ получени 1,2-дигидрохино-ли-2-OHOB или иХ СОлЕй (ЕгО ВАРиАН-Ты) | |
| DE60217147T2 (de) | Lactamderivate zur verwendung als humane 11cby rezeptorantagonisten | |
| EP0385237B1 (en) | 2-(1-piperazinyl)-4-phenylcycloalkanopyridine derivatives, processes for the production thereof, and pharmaceutical composition containing the same | |
| US4590273A (en) | Isoquinoline compounds | |
| SE447255B (sv) | Karbostyrilderivat och forfarande for framstellning derav | |
| CS227024B2 (en) | Method of preparing new pyrimidinones | |
| US4999355A (en) | Isoindolinone derivatives, processes for preparing them and medicines containing them | |
| CS226405B2 (en) | Method of preparing piperidinepropoxyquinoline and piperidinepropoxycoumarin | |
| Verdecia et al. | Synthesis of methyl 4-aryl-6-methyl-4, 7-dihydro-1 H-pyrazolo-[3, 4-b] pyridine-5-carboxylates from methyl 4-aryl-6-methyl-2-oxo-1, 2, 3, 4-tetrahydropyridine-5-carboxylates | |
| JPH0477B2 (enExample) | ||
| HU196995B (en) | Process for producing tetrahydroquinoline derivatives and pharmaceuticals comprising same | |
| EP0093521B1 (en) | Quinoline derivatives | |
| CA1203801A (en) | Piperazine derivatives, their production and pharmaceutical compositions containing them | |
| PL96534B1 (pl) | Sposob wytwarzania nowych dwubenzo/b,f/tiepin | |
| US4560692A (en) | 4-Piperidino-2-phenylquinolines | |
| CA1208643A (en) | 1,5-diphenyl-pyrazolin-3-one compounds, process and intermediates for preparation thereof and pharmaceutical compositions containing them | |
| PL94634B1 (pl) | Sposob wytwarzania nowych arylopiperazynowych pochodnych adeniny | |
| CS248720B2 (en) | Production method of quinolines | |
| CA1209994A (en) | 2-piperazinyl-quinazoline derivatives, their production and pharmaceutical compositions containing them | |
| CA1175428A (en) | Process for preparing imidazo /1,2-a/ quinoline derivatives | |
| US3926994A (en) | Heterocyclic compounds | |
| US5089497A (en) | Substituted piperazines as central nervous system agents | |
| EP0268273A2 (en) | Process for the preparation of 2-substituted-1,4-dihydro-pyridines | |
| GB2166136A (en) | Furo-(3,4-c)-pyridine derivatives | |
| EP0364091B1 (en) | Antipsychotic 4-(4-(3-benzisothiazolyl)-1-piperazinyl)butyl bridged bicyclic imides |