SU423299A3 - Способ получения производных тетрлгидробензодиазепинонл - Google Patents
Способ получения производных тетрлгидробензодиазепинонлInfo
- Publication number
- SU423299A3 SU423299A3 SU701666624A SU1666624A SU423299A3 SU 423299 A3 SU423299 A3 SU 423299A3 SU 701666624 A SU701666624 A SU 701666624A SU 1666624 A SU1666624 A SU 1666624A SU 423299 A3 SU423299 A3 SU 423299A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- phenyl
- derivatives
- tetrlhydrobenzodiazepinonl
- obtaining
- mixture
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- -1 hydroxy- Chemical class 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000004981 cycloalkylmethyl group Chemical group 0.000 description 1
- WJYHCYBNUJVCEH-UHFFFAOYSA-N cyclohexane;ethoxyethane Chemical compound CCOCC.C1CCCCC1 WJYHCYBNUJVCEH-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000005360 mashing Methods 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/12—1,5-Benzodiazepines; Hydrogenated 1,5-benzodiazepines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691929656 DE1929656A1 (de) | 1969-06-11 | 1969-06-11 | Neue Tetrahydro-benzodiazepinone |
| DE19702006600 DE2006600A1 (en) | 1970-02-13 | 1970-02-13 | Tetrahydro-1,5-benzodiazepine-4-ones |
| DE19702019627 DE2019627A1 (de) | 1969-06-11 | 1970-04-23 | Neue Tetrahydrobenzodiazepinone |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU423299A3 true SU423299A3 (ru) | 1974-04-05 |
Family
ID=27181978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU701666624A SU423299A3 (ru) | 1969-06-11 | 1970-06-05 | Способ получения производных тетрлгидробензодиазепинонл |
Country Status (16)
| Country | Link |
|---|---|
| JP (3) | JPS5031158B1 (https=) |
| AT (2) | AT303746B (https=) |
| BE (1) | BE751834A (https=) |
| BG (4) | BG17602A3 (https=) |
| CA (1) | CA967154A (https=) |
| CH (1) | CH549582A (https=) |
| ES (4) | ES380557A1 (https=) |
| FR (1) | FR2052950B1 (https=) |
| GB (1) | GB1317475A (https=) |
| IE (1) | IE35727B1 (https=) |
| IL (1) | IL34689A (https=) |
| NL (1) | NL7008404A (https=) |
| NO (1) | NO129524B (https=) |
| RO (4) | RO58640A (https=) |
| SE (1) | SE381873B (https=) |
| SU (1) | SU423299A3 (https=) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN110183397B (zh) * | 2019-06-24 | 2022-08-23 | 陕西师范大学 | 二氯二茂锆催化制备1,5-苯并噻嗪类化合物的方法 |
| CN110256365B (zh) * | 2019-06-24 | 2022-06-07 | 陕西师范大学 | 二氯二茂钛催化制备苯二氮卓衍生物的方法 |
-
1970
- 1970-04-10 BG BG014913A patent/BG17602A3/xx unknown
- 1970-06-05 SU SU701666624A patent/SU423299A3/ru active
- 1970-06-05 RO RO69783A patent/RO58640A/ro unknown
- 1970-06-05 RO RO69784A patent/RO58641A/ro unknown
- 1970-06-05 RO RO69785A patent/RO58887A/ro unknown
- 1970-06-05 CA CA084,760A patent/CA967154A/en not_active Expired
- 1970-06-05 RO RO63562A patent/RO58405A/ro unknown
- 1970-06-09 ES ES380557A patent/ES380557A1/es not_active Expired
- 1970-06-09 CH CH863170A patent/CH549582A/xx not_active IP Right Cessation
- 1970-06-09 IL IL34689A patent/IL34689A/en unknown
- 1970-06-10 BG BG017289A patent/BG17974A3/xx unknown
- 1970-06-10 NL NL7008404A patent/NL7008404A/xx unknown
- 1970-06-10 AT AT00409/72A patent/AT303746B/de not_active IP Right Cessation
- 1970-06-10 NO NO02256/70A patent/NO129524B/no unknown
- 1970-06-10 GB GB2819770A patent/GB1317475A/en not_active Expired
- 1970-06-10 AT AT522570A patent/AT303737B/de not_active IP Right Cessation
- 1970-06-10 BG BG017287A patent/BG17973A3/xx unknown
- 1970-06-10 IE IE753/70A patent/IE35727B1/xx unknown
- 1970-06-11 BE BE751834D patent/BE751834A/xx unknown
- 1970-06-11 SE SE7008152A patent/SE381873B/xx unknown
- 1970-06-11 FR FR7021448A patent/FR2052950B1/fr not_active Expired
-
1971
- 1971-01-11 ES ES387136A patent/ES387136A1/es not_active Expired
- 1971-01-11 ES ES71387137A patent/ES387137A1/es not_active Expired
- 1971-01-11 ES ES387138A patent/ES387138A1/es not_active Expired
- 1971-04-07 BG BG017288A patent/BG17603A3/xx unknown
- 1971-10-01 JP JP46077048A patent/JPS5031158B1/ja active Pending
- 1971-10-01 JP JP46077046A patent/JPS49192B1/ja active Pending
- 1971-10-01 JP JP46077047A patent/JPS5013273B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IE35727B1 (en) | 1976-05-12 |
| BG17603A3 (bg) | 1973-11-10 |
| CH549582A (de) | 1974-05-31 |
| JPS5013273B1 (https=) | 1975-05-19 |
| RO58640A (https=) | 1975-10-15 |
| BE751834A (fr) | 1970-12-11 |
| RO58887A (https=) | 1975-10-15 |
| SE381873B (sv) | 1975-12-22 |
| NO129524B (https=) | 1974-04-22 |
| IL34689A0 (en) | 1970-08-19 |
| ES387136A1 (es) | 1974-01-01 |
| JPS49192B1 (https=) | 1974-01-05 |
| RO58405A (https=) | 1975-11-15 |
| IL34689A (en) | 1973-03-30 |
| ES387137A1 (es) | 1974-01-01 |
| ES387138A1 (es) | 1973-05-01 |
| FR2052950A1 (https=) | 1971-04-16 |
| BG17602A3 (bg) | 1973-11-10 |
| IE35727L (en) | 1970-12-11 |
| CA967154A (en) | 1975-05-06 |
| JPS5031158B1 (https=) | 1975-10-07 |
| BG17974A3 (bg) | 1974-03-05 |
| RO58641A (https=) | 1975-09-15 |
| NL7008404A (https=) | 1970-12-15 |
| FR2052950B1 (https=) | 1974-08-30 |
| BG17973A3 (bg) | 1974-03-05 |
| GB1317475A (en) | 1973-05-16 |
| AT303737B (de) | 1972-12-11 |
| ES380557A1 (es) | 1973-04-01 |
| AT303746B (de) | 1972-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU474145A3 (ru) | Способ получени производных имидазолина | |
| SU685151A3 (ru) | Способ получени карбонилзамещенных 1-сульфонилбензимидазолов | |
| SU721003A3 (ru) | Способ получени производных тиазолинил или тиазинилбензимидазола | |
| US2920080A (en) | Process of preparing tryptamine | |
| RU2388753C2 (ru) | Способ получения промежуточного продукта, участвующего в синтезе ирбесартана | |
| SU556727A3 (ru) | Способ получени производных 1,2,4--триазола | |
| SU423299A3 (ru) | Способ получения производных тетрлгидробензодиазепинонл | |
| SU818484A3 (ru) | Способ получени 4а, 9 -транс-гЕКСАгидРО - -КАРбОлиНА | |
| US3978085A (en) | Process for benz[f]-2,5-oxazocines | |
| SU493974A3 (ru) | Способ получени производных тиазоло (5,4-д) пиримидина | |
| JP2527319B2 (ja) | 7―ブロモ―β―カルボリン誘導体の製造方法 | |
| US4704472A (en) | Preparation of an enantiomer of a substituted fluorenyloxyacetic acid | |
| SU499806A3 (ru) | Способ получени производных пиперазина | |
| US3058992A (en) | Intermediates for the preparation of | |
| SU677653A3 (ru) | Способ получени 2-бензоил-3аминопиридинов или их солей | |
| US3215739A (en) | Method of producing dibenzo (a, d) cyclohepta (1, 4) dienes | |
| SU493965A3 (ru) | Способ получени д-2-замещенных-6-алкил8-замещенных эрголинов | |
| SU501670A3 (ru) | Способ получени производных циклопентено-хинолона | |
| SU449485A3 (ru) | Способ получени -замещенных сложных эфиров 1,2,3,6-тетрагидро-4пиридилметилкарбоновой кислоты | |
| SU497764A3 (ru) | Способ получени производных норборнана | |
| SU1480771A3 (ru) | Способ получени 9-амино-5,6,6 @ ,7-тетрагидро-4Н-бензо @ , @ тиазоло @ 4,5- @ хинолинов или их кислотно-аддитивных солей в виде рацемата, энантиомеров или смеси энантиомеров | |
| RU2043993C1 (ru) | Способ получения гексагидрата тринатрийфосфоноформиата | |
| US5142091A (en) | α, β-unsaturated ketones and ketoxime derivatives | |
| SU528870A3 (ru) | Способ получени производных 2-имидазолидинона или их солей | |
| SU437284A1 (ru) | Способ получени производных индено-пиридина |