SU188296A1 - - Google Patents
Info
- Publication number
- SU188296A1 SU188296A1 SU929760A SU929760A SU188296A1 SU 188296 A1 SU188296 A1 SU 188296A1 SU 929760 A SU929760 A SU 929760A SU 929760 A SU929760 A SU 929760A SU 188296 A1 SU188296 A1 SU 188296A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- antistatic layer
- film
- substrate
- layer
- order
- Prior art date
Links
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 5
- 239000000758 substrate Substances 0.000 claims description 5
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- IBZDRCSTEHAQEC-UHFFFAOYSA-N 2-(methylamino)ethanesulfonic acid (Z)-octadec-9-enoic acid Chemical compound CNCCS(=O)(=O)O.C(CCCCCCCC=C/CCCCCCCC)(=O)O IBZDRCSTEHAQEC-UHFFFAOYSA-N 0.000 claims description 3
- 150000002170 ethers Chemical class 0.000 claims description 3
- 238000010521 absorption reaction Methods 0.000 claims description 2
- 239000003792 electrolyte Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 239000001103 potassium chloride Substances 0.000 claims description 2
- 235000011164 potassium chloride Nutrition 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 239000001913 cellulose Substances 0.000 claims 1
- 229920002678 cellulose Polymers 0.000 claims 1
- 235000011187 glycerol Nutrition 0.000 claims 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 3
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU188296A1 true SU188296A1 (pm) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2127767C3 (de) | Fotopolymerisierbares Aufzeichnungs material und Verfahren zu dessen Her Stellung | |
| DE1447610A1 (de) | Photographisches Entwicklungsverfahren und hierzu geeignetes photographisches Material | |
| DE2335465A1 (de) | Verfahren zur herstellung hydrophiler haftschichten auf massbestaendigem polyesterfilm | |
| DE1447916A1 (de) | Feuchtigkeitsfeste Flachdruckplatten | |
| DE2119093A1 (de) | Photographisches Arbeitsblatt oder -band für die Verarbeitung belichteter photographischer Aufzeichnungsmaterialien | |
| DE1797518C3 (de) | Lichtempfindliche Flachdruckplatte und Verfahren zu ihrer Herstellung. Ausscheidung aus: 1447920 | |
| SU188296A1 (pm) | ||
| DE1015682B (de) | Lichtunempfindliche Bildempfangsschicht fuer das Silbersalz-Diffusionsverfahren | |
| DE2336379A1 (de) | Strahlungsempfindliches aufzeichnungsmaterial | |
| DE2249869A1 (de) | Verfahren zur verminderung der tendenz von folien sich durch auftragen schrumpfbarer schichten zu woelben oder zu kruemmen | |
| SU432734A3 (ru) | Способ дубления гидрофильных коллоидов | |
| US3067033A (en) | Production of transfer images by the silver salt diffusion process | |
| CN1029803C (zh) | 带有抗卷曲层的感光材料片基的生产方法 | |
| US2923623A (en) | Photographic process and product | |
| DE1597540A1 (de) | Verwendung von Oniumhalogeniden als Silberhalogenidkomplexbildner zum Stabilisieren photographischer Silberhalogenidbilder | |
| DE2322873B2 (de) | Photographisches aufzeichnungsmaterial sowie verfahren zur herstellung photographischer bilder | |
| DE2105488A1 (de) | Verfahren zur Herstellung photographischer Bilder | |
| US3787214A (en) | Process for undercoating a support of photographic material | |
| DE1283676B (de) | Bildempfangsmaterial zum Empfang von nicht gehaerteten Bildteilen einer Silberhalogenidemulsionsschicht | |
| DE1547702C (de) | Verfahren zum Trocknen der hydrophilen wasserhaltigen Kolloid Schichten eines pho tographischen Aufzeichnungsmaterial | |
| DE2807346A1 (de) | Photographisches aufzeichnungsmaterial fuer die herstellung von vesicularbildern | |
| DE1547882C3 (de) | Photographisches Silberhalogeniddiffusionsverfahren | |
| SU937496A1 (ru) | Липка лента | |
| SU362271A1 (ru) | Подложка для кинофотоматериалов | |
| NO118102B (pm) |