SK287019B6 - Spôsob prípravy kyseliny 1-(aminometyl)cyklohexyloctovej a medziprodukt pri jej príprave - Google Patents
Spôsob prípravy kyseliny 1-(aminometyl)cyklohexyloctovej a medziprodukt pri jej príprave Download PDFInfo
- Publication number
- SK287019B6 SK287019B6 SK937-2001A SK9372001A SK287019B6 SK 287019 B6 SK287019 B6 SK 287019B6 SK 9372001 A SK9372001 A SK 9372001A SK 287019 B6 SK287019 B6 SK 287019B6
- Authority
- SK
- Slovakia
- Prior art keywords
- formula
- acid
- nitromethyl
- compound
- benzyl
- Prior art date
Links
- UGJMXCAKCUNAIE-UHFFFAOYSA-N Gabapentin Chemical compound OC(=O)CC1(CN)CCCCC1 UGJMXCAKCUNAIE-UHFFFAOYSA-N 0.000 title claims abstract description 40
- 238000000034 method Methods 0.000 title claims abstract description 30
- 150000001875 compounds Chemical class 0.000 title claims description 17
- 230000015572 biosynthetic process Effects 0.000 title abstract description 8
- 238000003786 synthesis reaction Methods 0.000 title abstract description 6
- KTVHUWOVEOQHPU-UHFFFAOYSA-N 2-[1-(nitromethyl)cyclohexyl]acetic acid Chemical class OC(=O)CC1(C[N+]([O-])=O)CCCCC1 KTVHUWOVEOQHPU-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 6
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 239000001257 hydrogen Substances 0.000 claims abstract description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 19
- 239000003054 catalyst Substances 0.000 claims description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- -1 benzyl halide Chemical class 0.000 claims description 8
- 125000005907 alkyl ester group Chemical group 0.000 claims description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 238000005984 hydrogenation reaction Methods 0.000 claims description 5
- UKYISVNNIPKTNG-UHFFFAOYSA-N 2-cyclohexylideneacetic acid Chemical compound OC(=O)C=C1CCCCC1 UKYISVNNIPKTNG-UHFFFAOYSA-N 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 4
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 claims description 4
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- JCCOEMBKLSKROY-UHFFFAOYSA-N benzyl 2-[1-(nitromethyl)cyclohexyl]acetate Chemical compound C=1C=CC=CC=1COC(=O)CC1(C[N+](=O)[O-])CCCCC1 JCCOEMBKLSKROY-UHFFFAOYSA-N 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 230000001131 transforming effect Effects 0.000 claims 4
- 150000003839 salts Chemical class 0.000 claims 3
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- 229960002870 gabapentin Drugs 0.000 abstract description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- XBUDZAQEMFGLEU-UHFFFAOYSA-N 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydron;chloride Chemical class Cl.OC(=O)CC1(CN)CCCCC1 XBUDZAQEMFGLEU-UHFFFAOYSA-N 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 238000005342 ion exchange Methods 0.000 description 4
- 150000003951 lactams Chemical class 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- RMUUHUOCTVAKGE-SOFGYWHQSA-N (Z)-2-(1-cyanocyclohexyl)but-2-enedioic acid Chemical class C(#N)C1(CCCCC1)/C(=C/C(=O)O)/C(=O)O RMUUHUOCTVAKGE-SOFGYWHQSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- JAWPQJDOQPSNIQ-UHFFFAOYSA-N 2-Azaspiro[4.5]decan-3-one Chemical class C1NC(=O)CC21CCCCC2 JAWPQJDOQPSNIQ-UHFFFAOYSA-N 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000006845 Michael addition reaction Methods 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- FNIATMYXUPOJRW-UHFFFAOYSA-N cyclohexylidene Chemical group [C]1CCCCC1 FNIATMYXUPOJRW-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 239000000383 hazardous chemical Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- PYFQWDMBAIDELB-UHFFFAOYSA-N methyl 2-[1-(nitromethyl)cyclohexyl]acetate Chemical compound COC(=O)CC1(C[N+]([O-])=O)CCCCC1 PYFQWDMBAIDELB-UHFFFAOYSA-N 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 150000002940 palladium Chemical class 0.000 description 1
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/50—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
- C07C205/51—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/04—Formation of amino groups in compounds containing carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU9803034A HU225502B1 (en) | 1998-12-29 | 1998-12-29 | Process for producing 1-(amino-metyl)-cyclohexene-acetic-acid and intermediates |
| PCT/HU1999/000102 WO2000039074A1 (en) | 1998-12-29 | 1999-12-23 | Process for the synthesis of 1-(aminomethyl)cyclohexyl-acetic acid |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SK9372001A3 SK9372001A3 (en) | 2002-01-07 |
| SK287019B6 true SK287019B6 (sk) | 2009-09-07 |
Family
ID=89997614
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK937-2001A SK287019B6 (sk) | 1998-12-29 | 1999-12-23 | Spôsob prípravy kyseliny 1-(aminometyl)cyklohexyloctovej a medziprodukt pri jej príprave |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US6765114B1 (ru) |
| JP (1) | JP2002533431A (ru) |
| CN (1) | CN1221525C (ru) |
| AT (1) | ATE250569T1 (ru) |
| AU (1) | AU1996300A (ru) |
| BG (1) | BG65056B1 (ru) |
| CA (1) | CA2349826C (ru) |
| CZ (1) | CZ301922B6 (ru) |
| DE (1) | DE69911646T2 (ru) |
| DK (1) | DK1140793T3 (ru) |
| EA (1) | EA003555B1 (ru) |
| EE (1) | EE04587B1 (ru) |
| ES (1) | ES2207979T3 (ru) |
| HU (1) | HU225502B1 (ru) |
| PL (1) | PL196854B1 (ru) |
| SK (1) | SK287019B6 (ru) |
| UA (1) | UA73108C2 (ru) |
| WO (1) | WO2000039074A1 (ru) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL153441A0 (en) * | 2000-06-16 | 2003-07-06 | Teva Pharma | Stable gabapentin having ph within a controlled range |
| CA2660769C (en) * | 2006-06-30 | 2013-12-03 | Zach System S.P.A. | Process for preparing gabapentin |
| US20110190393A1 (en) * | 2008-06-03 | 2011-08-04 | Generics (Uk) Limited | Novel and efficient method for the synthesis of an amino acid |
| CN104974037B (zh) * | 2014-04-13 | 2019-04-30 | 江苏康缘药业股份有限公司 | 一种含羧基多羰基姜黄素衍生物及其制备方法和应用 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3253039A (en) * | 1962-02-05 | 1966-05-24 | Engelhard Ind Inc | Catalytic hydrogenation of organic nitrocompounds |
| US3594419A (en) * | 1968-04-15 | 1971-07-20 | Gulf Research Development Co | Process for converting nitroparaffins to amines |
| US3766271A (en) * | 1971-03-04 | 1973-10-16 | Texaco Inc | Homogeneous catalysts useful in the reduction of nitroparaffins to amines |
| DE2460891C2 (de) * | 1974-12-21 | 1982-09-23 | Gödecke AG, 1000 Berlin | 1-Aminomethyl-1-cycloalkanessigsäuren und deren Ester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel |
| US4894476A (en) * | 1988-05-02 | 1990-01-16 | Warner-Lambert Company | Gabapentin monohydrate and a process for producing the same |
| DE3928183A1 (de) * | 1989-08-25 | 1991-02-28 | Goedecke Ag | Lactamfreie cyclische aminosaeuren |
| DE3928182A1 (de) * | 1989-08-25 | 1991-02-28 | Goedecke Ag | Verfahren zur herstellung von gabapentin |
| FI905584A (fi) | 1989-11-16 | 1991-05-17 | Lonza Ag | Foerfarande foer framstaellning av 1-(aminometyl)cyklohexanaettikssyra. |
| CA2303244C (en) * | 1997-10-27 | 2005-12-06 | Warner-Lambert Company | Cyclic amino acids and derivatives thereof useful as pharmaceutical agents |
-
1998
- 1998-12-29 HU HU9803034A patent/HU225502B1/hu not_active IP Right Cessation
-
1999
- 1999-12-23 EE EEP200100295A patent/EE04587B1/xx not_active IP Right Cessation
- 1999-12-23 JP JP2000590987A patent/JP2002533431A/ja active Pending
- 1999-12-23 AT AT99963652T patent/ATE250569T1/de not_active IP Right Cessation
- 1999-12-23 DE DE69911646T patent/DE69911646T2/de not_active Expired - Lifetime
- 1999-12-23 WO PCT/HU1999/000102 patent/WO2000039074A1/en active IP Right Grant
- 1999-12-23 CA CA002349826A patent/CA2349826C/en not_active Expired - Fee Related
- 1999-12-23 SK SK937-2001A patent/SK287019B6/sk not_active IP Right Cessation
- 1999-12-23 EA EA200100723A patent/EA003555B1/ru not_active IP Right Cessation
- 1999-12-23 ES ES99963652T patent/ES2207979T3/es not_active Expired - Lifetime
- 1999-12-23 UA UA2001075268A patent/UA73108C2/uk unknown
- 1999-12-23 PL PL348461A patent/PL196854B1/pl not_active IP Right Cessation
- 1999-12-23 AU AU19963/00A patent/AU1996300A/en not_active Abandoned
- 1999-12-23 US US09/856,517 patent/US6765114B1/en not_active Expired - Fee Related
- 1999-12-23 DK DK99963652T patent/DK1140793T3/da active
- 1999-12-23 CZ CZ20012070A patent/CZ301922B6/cs not_active IP Right Cessation
- 1999-12-23 CN CNB998129593A patent/CN1221525C/zh not_active Expired - Fee Related
-
2001
- 2001-05-07 BG BG105491A patent/BG65056B1/bg unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PL196854B1 (pl) | 2008-02-29 |
| EA003555B1 (ru) | 2003-06-26 |
| CN1221525C (zh) | 2005-10-05 |
| CZ20012070A3 (cs) | 2001-09-12 |
| DE69911646D1 (de) | 2003-10-30 |
| BG105491A (en) | 2001-12-29 |
| WO2000039074A1 (en) | 2000-07-06 |
| BG65056B1 (bg) | 2007-01-31 |
| CA2349826C (en) | 2009-05-12 |
| US6765114B1 (en) | 2004-07-20 |
| HUP9803034A2 (hu) | 2001-02-28 |
| JP2002533431A (ja) | 2002-10-08 |
| CN1325378A (zh) | 2001-12-05 |
| CZ301922B6 (cs) | 2010-07-28 |
| UA73108C2 (en) | 2005-06-15 |
| AU1996300A (en) | 2000-07-31 |
| HU9803034D0 (en) | 1999-02-01 |
| DE69911646T2 (de) | 2004-07-08 |
| ATE250569T1 (de) | 2003-10-15 |
| SK9372001A3 (en) | 2002-01-07 |
| DK1140793T3 (da) | 2004-02-02 |
| PL348461A1 (en) | 2002-05-20 |
| EE04587B1 (et) | 2006-02-15 |
| CA2349826A1 (en) | 2000-07-06 |
| ES2207979T3 (es) | 2004-06-01 |
| HU225502B1 (en) | 2007-01-29 |
| EA200100723A1 (ru) | 2001-12-24 |
| EE200100295A (et) | 2002-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0432504B1 (de) | Verfahren zur Herstellung von 1-(Aminomethyl)cyclohexanessigsäure | |
| SK287019B6 (sk) | Spôsob prípravy kyseliny 1-(aminometyl)cyklohexyloctovej a medziprodukt pri jej príprave | |
| EP1527042B1 (de) | Verfahren zur herstellung von aminoalkoxybenzylaminen und aminoalkoxybenzonitrilen als zwischenprodukte | |
| EP0678502A1 (de) | Verfahren zur Herstellung von Glykoloylaniliden | |
| US20050148792A1 (en) | Process for the preparation of gabapentin | |
| SK282297B6 (sk) | Spôsob výroby N-substituovaných glycínových kyselín alebo glycínových esterov a jeho použitie na syntézu indiga | |
| EP1599446B1 (en) | An improved process for the preparation of gabalactam | |
| EP1140793B1 (en) | Process for the synthesis of 1-(aminomethyl)cyclohexyl-acetic acid | |
| EP0902011B1 (en) | Gamma-oxo-homophenylalanine derivatives and process for producing homophenylalanine derivatives by reducing the same | |
| SK280401B6 (sk) | Spôsob výroby nitrilov kyseliny aminopropiónovej | |
| EP0570817B1 (de) | Verfahren zur Herstellung von 5-Chloroxindol | |
| DE60308170T2 (de) | Verfahren zur herstellung von chinolinderivaten | |
| EP1694630B1 (de) | Verfahren zur herstellung von chiralen oder enantiomerenangereicherten beta-aminosaeuren, -aldehyden, - ketonen und gamma-aminoalkoholen | |
| EP1651590B1 (en) | Process for the preparation of an imine intermediate | |
| HU191927B (en) | Process for production of amino-cis-2,6-lupeditin | |
| FR2497797A1 (fr) | Procede de preparation de l'amino-4 butyramide | |
| DE10328888A1 (de) | Verbessertes Verfahren zur Herstellung von 1,2-disubstituierten Hexahydropyridazin-3-carbonsäuren und deren Estern | |
| JP2006076934A (ja) | シクロアルキルアルキルアミン化合物の製造方法 | |
| JPH09157231A (ja) | ２−アミノベンジルアルコール類の製造方法 | |
| HU202478B (en) | Process for producing cis- and trans-2-(aminomethyl)-cycloalkanols | |
| CS209400B1 (en) | Method of preparation of 5,6,7,8-tetrahydrodibenz/c,e/azocine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed due to non-payment of maintenance fees |
Effective date: 20101223 |