RU2298002C2 - Производные хинолина в качестве антагонистов npy - Google Patents
Производные хинолина в качестве антагонистов npy Download PDFInfo
- Publication number
- RU2298002C2 RU2298002C2 RU2004126936/04A RU2004126936A RU2298002C2 RU 2298002 C2 RU2298002 C2 RU 2298002C2 RU 2004126936/04 A RU2004126936/04 A RU 2004126936/04A RU 2004126936 A RU2004126936 A RU 2004126936A RU 2298002 C2 RU2298002 C2 RU 2298002C2
- Authority
- RU
- Russia
- Prior art keywords
- methyl
- pyrrolidin
- ylquinolin
- methylquinolin
- alkyl
- Prior art date
Links
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 title claims abstract description 9
- 239000005557 antagonist Substances 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 145
- -1 benzylcarbonyl Chemical group 0.000 claims abstract description 134
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 66
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 31
- 238000000034 method Methods 0.000 claims abstract description 28
- 238000011282 treatment Methods 0.000 claims abstract description 25
- 208000008589 Obesity Diseases 0.000 claims abstract description 20
- 235000020824 obesity Nutrition 0.000 claims abstract description 20
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 19
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 18
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 14
- 239000003814 drug Substances 0.000 claims abstract description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 14
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 14
- 208000024172 Cardiovascular disease Diseases 0.000 claims abstract description 13
- 208000001647 Renal Insufficiency Diseases 0.000 claims abstract description 13
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims abstract description 13
- 206010003246 arthritis Diseases 0.000 claims abstract description 13
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims abstract description 13
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 13
- 201000006370 kidney failure Diseases 0.000 claims abstract description 13
- 206010012601 diabetes mellitus Diseases 0.000 claims abstract description 12
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 10
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims abstract description 10
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims abstract description 9
- 125000004076 pyridyl group Chemical group 0.000 claims abstract description 9
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 8
- 125000003725 azepanyl group Chemical group 0.000 claims abstract description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 7
- 125000002541 furyl group Chemical group 0.000 claims abstract description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 7
- 125000001544 thienyl group Chemical group 0.000 claims abstract description 6
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims abstract description 5
- 125000002757 morpholinyl group Chemical group 0.000 claims abstract description 4
- 238000006243 chemical reaction Methods 0.000 claims description 153
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 45
- 150000003839 salts Chemical class 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 239000001257 hydrogen Substances 0.000 claims description 25
- 229940086609 Lipase inhibitor Drugs 0.000 claims description 20
- 150000002148 esters Chemical class 0.000 claims description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 18
- 125000001424 substituent group Chemical group 0.000 claims description 18
- AHLBNYSZXLDEJQ-FWEHEUNISA-N orlistat Chemical group CCCCCCCCCCC[C@H](OC(=O)[C@H](CC(C)C)NC=O)C[C@@H]1OC(=O)[C@H]1CCCCCC AHLBNYSZXLDEJQ-FWEHEUNISA-N 0.000 claims description 16
- 238000004519 manufacturing process Methods 0.000 claims description 15
- 229960001243 orlistat Drugs 0.000 claims description 15
- 230000002265 prevention Effects 0.000 claims description 15
- 239000000460 chlorine Substances 0.000 claims description 14
- 229910052736 halogen Inorganic materials 0.000 claims description 14
- 150000002367 halogens Chemical group 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 101710151321 Melanostatin Proteins 0.000 claims description 12
- 102400000064 Neuropeptide Y Human genes 0.000 claims description 12
- 208000030814 Eating disease Diseases 0.000 claims description 10
- 208000019454 Feeding and Eating disease Diseases 0.000 claims description 10
- 235000014632 disordered eating Nutrition 0.000 claims description 10
- 229910052740 iodine Inorganic materials 0.000 claims description 9
- CTOKVDGFJMEMLN-UHFFFAOYSA-N [1-(7-amino-2-methylquinolin-4-yl)pyrrolidin-2-yl]methanol Chemical compound C=12C=CC(N)=CC2=NC(C)=CC=1N1CCCC1CO CTOKVDGFJMEMLN-UHFFFAOYSA-N 0.000 claims description 8
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 7
- 229940079593 drug Drugs 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 claims description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- FLCRSCHUKYNXKW-UHFFFAOYSA-N 4-(3-ethoxypyrrolidin-1-yl)-2-methylquinolin-7-amine Chemical compound C1C(OCC)CCN1C1=CC(C)=NC2=CC(N)=CC=C12 FLCRSCHUKYNXKW-UHFFFAOYSA-N 0.000 claims description 5
- 239000013543 active substance Substances 0.000 claims description 5
- 201000010099 disease Diseases 0.000 claims description 5
- 102000005962 receptors Human genes 0.000 claims description 5
- 108020003175 receptors Proteins 0.000 claims description 5
- YIAYAZXGXKSBRM-UHFFFAOYSA-N 4-[(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)amino]benzonitrile Chemical compound C=12C=CC(NC=3C=CC(=CC=3)C#N)=CC2=NC(C)=CC=1N1CCCC1 YIAYAZXGXKSBRM-UHFFFAOYSA-N 0.000 claims description 4
- MVJVQMRGBDNHOW-SFHVURJKSA-N 4-[(3s)-3-ethoxypyrrolidin-1-yl]-2-methyl-n-pyridin-3-ylquinolin-7-amine Chemical compound C1[C@@H](OCC)CCN1C1=CC(C)=NC2=CC(NC=3C=NC=CC=3)=CC=C12 MVJVQMRGBDNHOW-SFHVURJKSA-N 0.000 claims description 4
- HAYLQPXSZLDLQK-KRWDZBQOSA-N 4-[(3s)-3-methoxypyrrolidin-1-yl]-2-methyl-n-pyridin-3-ylquinolin-7-amine Chemical compound C1[C@@H](OC)CCN1C1=CC(C)=NC2=CC(NC=3C=NC=CC=3)=CC=C12 HAYLQPXSZLDLQK-KRWDZBQOSA-N 0.000 claims description 4
- VDQKHTJHDWFTLL-FQEVSTJZSA-N 4-[[4-[(3s)-3-ethoxypyrrolidin-1-yl]-2-methylquinolin-7-yl]amino]benzonitrile Chemical compound C1[C@@H](OCC)CCN1C1=CC(C)=NC2=CC(NC=3C=CC(=CC=3)C#N)=CC=C12 VDQKHTJHDWFTLL-FQEVSTJZSA-N 0.000 claims description 4
- UWDNSCIPWKCXII-UHFFFAOYSA-N CC1=NC2=CC(=C(C=C2C(=C1)N1CCCC1)C)C1=C(OC=C1)C(=O)N Chemical compound CC1=NC2=CC(=C(C=C2C(=C1)N1CCCC1)C)C1=C(OC=C1)C(=O)N UWDNSCIPWKCXII-UHFFFAOYSA-N 0.000 claims description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 4
- 108050002826 Neuropeptide Y Receptor Proteins 0.000 claims description 4
- 102000012301 Neuropeptide Y receptor Human genes 0.000 claims description 4
- 239000011630 iodine Substances 0.000 claims description 4
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 4
- HUACSPMJAPGPNA-UHFFFAOYSA-N n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)methanesulfonamide Chemical compound C=12C=CC(NS(C)(=O)=O)=CC2=NC(C)=CC=1N1CCCC1 HUACSPMJAPGPNA-UHFFFAOYSA-N 0.000 claims description 4
- UPTVWHNDQOIPGI-UHFFFAOYSA-N n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)pyridine-3-carboxamide Chemical compound C=12C=CC(NC(=O)C=3C=NC=CC=3)=CC2=NC(C)=CC=1N1CCCC1 UPTVWHNDQOIPGI-UHFFFAOYSA-N 0.000 claims description 4
- PMJPHEAEMAOVPH-UHFFFAOYSA-N n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)pyridine-4-carboxamide Chemical compound C=12C=CC(NC(=O)C=3C=CN=CC=3)=CC2=NC(C)=CC=1N1CCCC1 PMJPHEAEMAOVPH-UHFFFAOYSA-N 0.000 claims description 4
- QYBCQTIWTCSCPL-HNNXBMFYSA-N n-[4-[(3s)-3-ethoxypyrrolidin-1-yl]-2-methylquinolin-7-yl]propanamide Chemical compound C1[C@@H](OCC)CCN1C1=CC(C)=NC2=CC(NC(=O)CC)=CC=C12 QYBCQTIWTCSCPL-HNNXBMFYSA-N 0.000 claims description 4
- BLIFSQROOJKZEL-UHFFFAOYSA-N 2-methyl-4-pyrrolidin-1-yl-n-(thiophen-2-ylmethyl)quinolin-7-amine Chemical compound C=12C=CC(NCC=3SC=CC=3)=CC2=NC(C)=CC=1N1CCCC1 BLIFSQROOJKZEL-UHFFFAOYSA-N 0.000 claims description 3
- APPRTOYEZDOHKS-UHFFFAOYSA-N 4-[2-(methoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-amine Chemical compound COCC1CCCN1C1=CC(C)=NC2=CC(N)=CC=C12 APPRTOYEZDOHKS-UHFFFAOYSA-N 0.000 claims description 3
- SRNUHYAZNVNSKZ-HXUWFJFHSA-N 4-[[4-[(2r)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]amino]benzonitrile Chemical compound COC[C@H]1CCCN1C1=CC(C)=NC2=CC(NC=3C=CC(=CC=3)C#N)=CC=C12 SRNUHYAZNVNSKZ-HXUWFJFHSA-N 0.000 claims description 3
- YAVPLAQEQDEVLN-IBGZPJMESA-N 4-[[4-[(2s)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]amino]benzonitrile Chemical compound C=12C=CC(NC=3C=CC(=CC=3)C#N)=CC2=NC(C)=CC=1N1CCC[C@H]1CO YAVPLAQEQDEVLN-IBGZPJMESA-N 0.000 claims description 3
- CLTYJMAMVSIRCT-UHFFFAOYSA-N 4-cyano-n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)benzamide Chemical compound C=12C=CC(NC(=O)C=3C=CC(=CC=3)C#N)=CC2=NC(C)=CC=1N1CCCC1 CLTYJMAMVSIRCT-UHFFFAOYSA-N 0.000 claims description 3
- SNFQXWHVDARKDG-UHFFFAOYSA-N CC1=NC2=CC(=CC=C2C(=C1)N1CCCC1)C1=NC=CC=C1S(=O)(=O)N Chemical compound CC1=NC2=CC(=CC=C2C(=C1)N1CCCC1)C1=NC=CC=C1S(=O)(=O)N SNFQXWHVDARKDG-UHFFFAOYSA-N 0.000 claims description 3
- 102100029549 Neuropeptide Y receptor type 5 Human genes 0.000 claims description 3
- 101710198055 Neuropeptide Y receptor type 5 Proteins 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 125000006307 alkoxy benzyl group Chemical group 0.000 claims description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- WDHFAKVAPOJMFZ-UHFFFAOYSA-N n-(2,6-dimethyl-4-pyrrolidin-1-ylquinolin-7-yl)propanamide Chemical compound C=12C=C(C)C(NC(=O)CC)=CC2=NC(C)=CC=1N1CCCC1 WDHFAKVAPOJMFZ-UHFFFAOYSA-N 0.000 claims description 3
- CGXHQPCFJBXZHQ-KRWDZBQOSA-N n-[4-[(2s)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]pyridine-3-carboxamide Chemical compound C=12C=CC(NC(=O)C=3C=NC=CC=3)=CC2=NC(C)=CC=1N1CCC[C@H]1CO CGXHQPCFJBXZHQ-KRWDZBQOSA-N 0.000 claims description 3
- DRZKMEMZVIYCJK-UHFFFAOYSA-N 4-fluoro-n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)benzamide Chemical compound C=12C=CC(NC(=O)C=3C=CC(F)=CC=3)=CC2=NC(C)=CC=1N1CCCC1 DRZKMEMZVIYCJK-UHFFFAOYSA-N 0.000 claims description 2
- 108090000189 Neuropeptides Proteins 0.000 claims description 2
- 150000003248 quinolines Chemical class 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 3
- 230000003042 antagnostic effect Effects 0.000 claims 2
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 claims 2
- 239000000126 substance Substances 0.000 abstract description 4
- 230000015572 biosynthetic process Effects 0.000 abstract description 3
- 235000013305 food Nutrition 0.000 abstract description 3
- 238000011321 prophylaxis Methods 0.000 abstract description 3
- 238000003786 synthesis reaction Methods 0.000 abstract description 3
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 abstract description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- 125000004429 atom Chemical group 0.000 abstract 1
- 208000035475 disorder Diseases 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 230000007721 medicinal effect Effects 0.000 abstract 1
- 238000001819 mass spectrum Methods 0.000 description 130
- 239000007787 solid Substances 0.000 description 110
- WUKXTJQCEGKRDX-UHFFFAOYSA-N 7-iodo-2-methyl-4-pyrrolidin-1-ylquinoline Chemical compound C=12C=CC(I)=CC2=NC(C)=CC=1N1CCCC1 WUKXTJQCEGKRDX-UHFFFAOYSA-N 0.000 description 61
- 239000000047 product Substances 0.000 description 47
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 32
- 150000001412 amines Chemical class 0.000 description 26
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 20
- 239000002904 solvent Substances 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- 239000003921 oil Substances 0.000 description 17
- 235000019198 oils Nutrition 0.000 description 17
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 16
- 239000006260 foam Substances 0.000 description 16
- 239000000463 material Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 15
- FHFZHPWRKFOURN-ZOWNYOTGSA-N 4-[(3s)-3-ethoxypyrrolidin-1-yl]-7-iodo-2-methylquinoline;hydrochloride Chemical compound Cl.C1[C@@H](OCC)CCN1C1=CC(C)=NC2=CC(I)=CC=C12 FHFZHPWRKFOURN-ZOWNYOTGSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- KROCOLWZJDTCPV-LBPRGKRZSA-N [(2s)-1-(7-iodo-2-methylquinolin-4-yl)pyrrolidin-2-yl]methanol Chemical compound C=12C=CC(I)=CC2=NC(C)=CC=1N1CCC[C@H]1CO KROCOLWZJDTCPV-LBPRGKRZSA-N 0.000 description 13
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 125000003118 aryl group Chemical group 0.000 description 12
- 239000002775 capsule Substances 0.000 description 11
- LLBYZZCOVUGZSS-UHFFFAOYSA-N 4-chloro-7-iodo-2-methylquinoline Chemical compound C1=CC(I)=CC2=NC(C)=CC(Cl)=C21 LLBYZZCOVUGZSS-UHFFFAOYSA-N 0.000 description 10
- OBPXIDLWMCPPTF-ZDUSSCGKSA-N 7-iodo-4-[(2s)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylquinoline Chemical compound COC[C@@H]1CCCN1C1=CC(C)=NC2=CC(I)=CC=C12 OBPXIDLWMCPPTF-ZDUSSCGKSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 125000001309 chloro group Chemical group Cl* 0.000 description 10
- 239000012458 free base Substances 0.000 description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 9
- URPYMXQQVHTUDU-OFGSCBOVSA-N nucleopeptide y Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 URPYMXQQVHTUDU-OFGSCBOVSA-N 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 8
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 8
- 238000009739 binding Methods 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 229920000159 gelatin Polymers 0.000 description 8
- 235000019322 gelatine Nutrition 0.000 description 8
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 7
- FUKWTMJZHKZKFA-UHFFFAOYSA-N 4-cyanobenzamide Chemical compound NC(=O)C1=CC=C(C#N)C=C1 FUKWTMJZHKZKFA-UHFFFAOYSA-N 0.000 description 7
- OBPXIDLWMCPPTF-CYBMUJFWSA-N 7-iodo-4-[(2r)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylquinoline Chemical compound COC[C@H]1CCCN1C1=CC(C)=NC2=CC(I)=CC=C12 OBPXIDLWMCPPTF-CYBMUJFWSA-N 0.000 description 7
- 239000001828 Gelatine Substances 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 230000027455 binding Effects 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- 235000019439 ethyl acetate Nutrition 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 7
- 229940080818 propionamide Drugs 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 229920002261 Corn starch Polymers 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002671 adjuvant Substances 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 125000001246 bromo group Chemical group Br* 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 229910052760 oxygen Chemical group 0.000 description 6
- 239000001301 oxygen Chemical group 0.000 description 6
- 239000000454 talc Substances 0.000 description 6
- 229910052623 talc Inorganic materials 0.000 description 6
- FESIWDMRDQUTBG-YDALLXLXSA-N 7-iodo-4-[(3s)-3-methoxypyrrolidin-1-yl]-2-methylquinoline;hydrochloride Chemical compound Cl.C1[C@@H](OC)CCN1C1=CC(C)=NC2=CC(I)=CC=C12 FESIWDMRDQUTBG-YDALLXLXSA-N 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 125000003282 alkyl amino group Chemical group 0.000 description 5
- 150000001448 anilines Chemical class 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 5
- 125000004663 dialkyl amino group Chemical group 0.000 description 5
- 239000003925 fat Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 230000037406 food intake Effects 0.000 description 5
- TVFIYRKPCACCNL-UHFFFAOYSA-N furan-2-carboxamide Chemical compound NC(=O)C1=CC=CO1 TVFIYRKPCACCNL-UHFFFAOYSA-N 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- 125000002346 iodo group Chemical group I* 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 229920005862 polyol Polymers 0.000 description 5
- 150000003077 polyols Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000012453 solvate Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 4
- LEHMFQMPEDAKCH-UHFFFAOYSA-N 4-(azepan-1-yl)-7-iodo-2-methylquinoline Chemical compound C=12C=CC(I)=CC2=NC(C)=CC=1N1CCCCCC1 LEHMFQMPEDAKCH-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 125000005129 aryl carbonyl group Chemical group 0.000 description 4
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 4
- 239000008120 corn starch Substances 0.000 description 4
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 description 4
- AIMMVWOEOZMVMS-UHFFFAOYSA-N cyclopropanecarboxamide Chemical compound NC(=O)C1CC1 AIMMVWOEOZMVMS-UHFFFAOYSA-N 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 235000012631 food intake Nutrition 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- QMUAFDDGGJKWEU-LLVKDONJSA-N (3r)-1-(7-iodo-2-methylquinolin-4-yl)pyrrolidin-3-ol Chemical compound C=12C=CC(I)=CC2=NC(C)=CC=1N1CC[C@@H](O)C1 QMUAFDDGGJKWEU-LLVKDONJSA-N 0.000 description 3
- QMUAFDDGGJKWEU-NSHDSACASA-N (3s)-1-(7-iodo-2-methylquinolin-4-yl)pyrrolidin-3-ol Chemical compound C=12C=CC(I)=CC2=NC(C)=CC=1N1CC[C@H](O)C1 QMUAFDDGGJKWEU-NSHDSACASA-N 0.000 description 3
- HGQYQQYUTRZZNU-UHFFFAOYSA-N 2-methyl-4,6-dipyrrolidin-1-ylquinolin-7-amine;hydrochloride Chemical compound Cl.C=12C=C(N3CCCC3)C(N)=CC2=NC(C)=CC=1N1CCCC1 HGQYQQYUTRZZNU-UHFFFAOYSA-N 0.000 description 3
- VNDHYTGVCGVETQ-UHFFFAOYSA-N 4-fluorobenzamide Chemical compound NC(=O)C1=CC=C(F)C=C1 VNDHYTGVCGVETQ-UHFFFAOYSA-N 0.000 description 3
- JZWCIPCKZGSCNT-UHFFFAOYSA-N 7-iodo-2,6-dimethyl-4-pyrrolidin-1-ylquinoline Chemical compound C=12C=C(C)C(I)=CC2=NC(C)=CC=1N1CCCC1 JZWCIPCKZGSCNT-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 3
- WUDASPMDEVGWRY-UHFFFAOYSA-N CC1=NC2=CC(=CC=C2C(=C1)N1CCCC1)C1(CC1)C(=O)N Chemical compound CC1=NC2=CC(=CC=C2C(=C1)N1CCCC1)C1(CC1)C(=O)N WUDASPMDEVGWRY-UHFFFAOYSA-N 0.000 description 3
- 206010020710 Hyperphagia Diseases 0.000 description 3
- 102000004882 Lipase Human genes 0.000 description 3
- 108090001060 Lipase Proteins 0.000 description 3
- 239000004367 Lipase Substances 0.000 description 3
- SIKWOTFNWURSAY-UHFFFAOYSA-N Lipstatin Natural products CCCCCCC1C(CC(CC=CCC=CCCCCC)C(=O)OC(CC(C)C)NC=O)OC1=O SIKWOTFNWURSAY-UHFFFAOYSA-N 0.000 description 3
- 101100460785 Mus musculus Npy5r gene Proteins 0.000 description 3
- 102000028582 Neuropeptide Y5 receptor Human genes 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 229940098773 bovine serum albumin Drugs 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000002299 complementary DNA Substances 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 125000004802 cyanophenyl group Chemical group 0.000 description 3
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 235000019421 lipase Nutrition 0.000 description 3
- OQMAKWGYQLJJIA-CUOOPAIESA-N lipstatin Chemical compound CCCCCC[C@H]1[C@H](C[C@H](C\C=C/C\C=C/CCCCC)OC(=O)[C@H](CC(C)C)NC=O)OC1=O OQMAKWGYQLJJIA-CUOOPAIESA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 229960003966 nicotinamide Drugs 0.000 description 3
- 235000005152 nicotinamide Nutrition 0.000 description 3
- 239000011570 nicotinamide Substances 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 3
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 3
- XIPFMBOWZXULIA-UHFFFAOYSA-N pivalamide Chemical compound CC(C)(C)C(N)=O XIPFMBOWZXULIA-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 108090000765 processed proteins & peptides Proteins 0.000 description 3
- HDOUGSFASVGDCS-UHFFFAOYSA-N pyridin-3-ylmethanamine Chemical compound NCC1=CC=CN=C1 HDOUGSFASVGDCS-UHFFFAOYSA-N 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 235000015112 vegetable and seed oil Nutrition 0.000 description 3
- 239000008158 vegetable oil Substances 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- 230000004584 weight gain Effects 0.000 description 3
- 235000019786 weight gain Nutrition 0.000 description 3
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 2
- MEQBJJUWDCYIAB-UHFFFAOYSA-N 2-chloropyridin-3-amine Chemical compound NC1=CC=CN=C1Cl MEQBJJUWDCYIAB-UHFFFAOYSA-N 0.000 description 2
- KGGHWIKBOIQEAJ-UHFFFAOYSA-N 2-fluorobenzamide Chemical compound NC(=O)C1=CC=CC=C1F KGGHWIKBOIQEAJ-UHFFFAOYSA-N 0.000 description 2
- LMNMEVBTISHSSJ-UHFFFAOYSA-N 2-methyl-4,7-dipyrrolidin-1-ylquinoline Chemical compound C=12C=CC(N3CCCC3)=CC2=NC(C)=CC=1N1CCCC1 LMNMEVBTISHSSJ-UHFFFAOYSA-N 0.000 description 2
- XUKKIDFRZSVBHZ-UHFFFAOYSA-N 2-methyl-7-nitro-4,6-dipyrrolidin-1-ylquinoline Chemical compound C=12C=C(N3CCCC3)C([N+]([O-])=O)=CC2=NC(C)=CC=1N1CCCC1 XUKKIDFRZSVBHZ-UHFFFAOYSA-N 0.000 description 2
- QVHOLYHNBWGEGC-UHFFFAOYSA-N 2-methyl-7-piperidin-1-yl-4-pyrrolidin-1-ylquinoline Chemical compound C=12C=CC(N3CCCCC3)=CC2=NC(C)=CC=1N1CCCC1 QVHOLYHNBWGEGC-UHFFFAOYSA-N 0.000 description 2
- AIWXMUSOYXMSGH-UHFFFAOYSA-N 2-methyl-n-pyridin-3-yl-4-pyrrolidin-1-ylquinolin-7-amine Chemical compound C=12C=CC(NC=3C=NC=CC=3)=CC2=NC(C)=CC=1N1CCCC1 AIWXMUSOYXMSGH-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- XIZJLRDBZDHSRJ-UHFFFAOYSA-N 4-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)morpholine Chemical compound C=12C=CC(N3CCOCC3)=CC2=NC(C)=CC=1N1CCCC1 XIZJLRDBZDHSRJ-UHFFFAOYSA-N 0.000 description 2
- QTKOJWAHLHXNIE-UHFFFAOYSA-N 4-(azepan-1-yl)-2-methyl-n-(pyridin-3-ylmethyl)quinolin-7-amine Chemical compound C=12C=CC(NCC=3C=NC=CC=3)=CC2=NC(C)=CC=1N1CCCCCC1 QTKOJWAHLHXNIE-UHFFFAOYSA-N 0.000 description 2
- CYVDEPUHIUVPJH-UHFFFAOYSA-N 4-(azepan-1-yl)-2-methyl-n-[[4-(trifluoromethyl)phenyl]methyl]quinolin-7-amine Chemical compound C=12C=CC(NCC=3C=CC(=CC=3)C(F)(F)F)=CC2=NC(C)=CC=1N1CCCCCC1 CYVDEPUHIUVPJH-UHFFFAOYSA-N 0.000 description 2
- FHFZHPWRKFOURN-BTQNPOSSSA-N 4-[(3r)-3-ethoxypyrrolidin-1-yl]-7-iodo-2-methylquinoline;hydrochloride Chemical compound Cl.C1[C@H](OCC)CCN1C1=CC(C)=NC2=CC(I)=CC=C12 FHFZHPWRKFOURN-BTQNPOSSSA-N 0.000 description 2
- JYENVUCZTRXERY-HNNXBMFYSA-N 4-[(3s)-3-(cyclopropylmethoxy)pyrrolidin-1-yl]-7-iodo-2-methylquinoline Chemical compound O([C@H]1CCN(C1)C=1C=C(N=C2C=C(I)C=CC2=1)C)CC1CC1 JYENVUCZTRXERY-HNNXBMFYSA-N 0.000 description 2
- PVXLTBBRUFAQMG-UHFFFAOYSA-N 4-[2-(ethoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-amine Chemical compound CCOCC1CCCN1C1=CC(C)=NC2=CC(N)=CC=C12 PVXLTBBRUFAQMG-UHFFFAOYSA-N 0.000 description 2
- ZZTDMOUZANJDBX-UHFFFAOYSA-N 4-[[(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)amino]methyl]benzonitrile Chemical compound C=12C=CC(NCC=3C=CC(=CC=3)C#N)=CC2=NC(C)=CC=1N1CCCC1 ZZTDMOUZANJDBX-UHFFFAOYSA-N 0.000 description 2
- SRNUHYAZNVNSKZ-FQEVSTJZSA-N 4-[[4-[(2s)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]amino]benzonitrile Chemical compound COC[C@@H]1CCCN1C1=CC(C)=NC2=CC(NC=3C=CC(=CC=3)C#N)=CC=C12 SRNUHYAZNVNSKZ-FQEVSTJZSA-N 0.000 description 2
- UFUISDJZUNLNON-UHFFFAOYSA-N 4-chloro-6-fluoro-2-methyl-7-nitroquinoline Chemical compound C1=C(F)C([N+]([O-])=O)=CC2=NC(C)=CC(Cl)=C21 UFUISDJZUNLNON-UHFFFAOYSA-N 0.000 description 2
- NZEYYJJUYIBPBY-UHFFFAOYSA-N 4-chloro-7-iodo-2,6-dimethylquinoline Chemical compound C1=C(C)C(I)=CC2=NC(C)=CC(Cl)=C21 NZEYYJJUYIBPBY-UHFFFAOYSA-N 0.000 description 2
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 2
- WHLMLJURFIZUKC-UHFFFAOYSA-N 7-(azepan-1-yl)-2-methyl-4-pyrrolidin-1-ylquinoline Chemical compound C=12C=CC(N3CCCCCC3)=CC2=NC(C)=CC=1N1CCCC1 WHLMLJURFIZUKC-UHFFFAOYSA-N 0.000 description 2
- QNQGFFZKLCQIDJ-UHFFFAOYSA-N 7-iodo-4-pyrrolidin-1-ylquinoline Chemical compound C=1C=NC2=CC(I)=CC=C2C=1N1CCCC1 QNQGFFZKLCQIDJ-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 235000019759 Maize starch Nutrition 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- FFDGPVCHZBVARC-UHFFFAOYSA-N N,N-dimethylglycine Chemical compound CN(C)CC(O)=O FFDGPVCHZBVARC-UHFFFAOYSA-N 0.000 description 2
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 241001660687 Xantho Species 0.000 description 2
- DHXNCLSKZZTTJT-HNNXBMFYSA-N [(2s)-1-[7-[(2-chloropyridin-3-yl)amino]-2-methylquinolin-4-yl]pyrrolidin-2-yl]methanol Chemical compound C=12C=CC(NC=3C(=NC=CC=3)Cl)=CC2=NC(C)=CC=1N1CCC[C@H]1CO DHXNCLSKZZTTJT-HNNXBMFYSA-N 0.000 description 2
- HVVNJUAVDAZWCB-YFKPBYRVSA-N [(2s)-pyrrolidin-2-yl]methanol Chemical compound OC[C@@H]1CCCN1 HVVNJUAVDAZWCB-YFKPBYRVSA-N 0.000 description 2
- PRDBLLIPPDOICK-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=C(C(F)(F)F)C=C1 PRDBLLIPPDOICK-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000019789 appetite Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 2
- RROBIDXNTUAHFW-UHFFFAOYSA-N benzotriazol-1-yloxy-tris(dimethylamino)phosphanium Chemical compound C1=CC=C2N(O[P+](N(C)C)(N(C)C)N(C)C)N=NC2=C1 RROBIDXNTUAHFW-UHFFFAOYSA-N 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- UQIHMYZXFGQIPJ-UHFFFAOYSA-N ethyl 3-(4-fluoro-3-nitroanilino)but-2-enoate Chemical compound CCOC(=O)C=C(C)NC1=CC=C(F)C([N+]([O-])=O)=C1 UQIHMYZXFGQIPJ-UHFFFAOYSA-N 0.000 description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- BRZYSWJRSDMWLG-CAXSIQPQSA-N geneticin Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](C(C)O)O2)N)[C@@H](N)C[C@H]1N BRZYSWJRSDMWLG-CAXSIQPQSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 230000001771 impaired effect Effects 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 210000001161 mammalian embryo Anatomy 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- FXKSVBOFWADQHA-UHFFFAOYSA-N n,2-dimethyl-n-phenyl-4-pyrrolidin-1-ylquinolin-7-amine Chemical compound C=1C=C2C(N3CCCC3)=CC(C)=NC2=CC=1N(C)C1=CC=CC=C1 FXKSVBOFWADQHA-UHFFFAOYSA-N 0.000 description 2
- FGJQAGBTWAEAIV-UHFFFAOYSA-N n-(2-methyl-4,6-dipyrrolidin-1-ylquinolin-7-yl)acetamide;hydrochloride Chemical compound Cl.C=12C=C(N3CCCC3)C(NC(=O)C)=CC2=NC(C)=CC=1N1CCCC1 FGJQAGBTWAEAIV-UHFFFAOYSA-N 0.000 description 2
- HSFVHXBGHGFUFX-UHFFFAOYSA-N n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)propanamide Chemical compound C=1C(C)=NC2=CC(NC(=O)CC)=CC=C2C=1N1CCCC1 HSFVHXBGHGFUFX-UHFFFAOYSA-N 0.000 description 2
- PTTWCRKKILBWDW-OAHLLOKOSA-N n-[4-[(2r)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]acetamide Chemical compound COC[C@H]1CCCN1C1=CC(C)=NC2=CC(NC(C)=O)=CC=C12 PTTWCRKKILBWDW-OAHLLOKOSA-N 0.000 description 2
- ZMGFCZGYDBUOQA-OAHLLOKOSA-N n-[4-[(2r)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]propanamide Chemical compound C=1C(C)=NC2=CC(NC(=O)CC)=CC=C2C=1N1CCC[C@@H]1COC ZMGFCZGYDBUOQA-OAHLLOKOSA-N 0.000 description 2
- WYYSSEHCDVOWGL-HNNXBMFYSA-N n-[4-[(2s)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]-2,2-dimethylpropanamide Chemical compound C=12C=CC(NC(=O)C(C)(C)C)=CC2=NC(C)=CC=1N1CCC[C@H]1CO WYYSSEHCDVOWGL-HNNXBMFYSA-N 0.000 description 2
- ZMGFCZGYDBUOQA-HNNXBMFYSA-N n-[4-[(2s)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]propanamide Chemical compound C=1C(C)=NC2=CC(NC(=O)CC)=CC=C2C=1N1CCC[C@H]1COC ZMGFCZGYDBUOQA-HNNXBMFYSA-N 0.000 description 2
- YNHLATJBQFXUMK-IBGZPJMESA-N n-[4-[(3s)-3-ethoxypyrrolidin-1-yl]-2-methylquinolin-7-yl]-4-fluorobenzamide Chemical compound C1[C@@H](OCC)CCN1C1=CC(C)=NC2=CC(NC(=O)C=3C=CC(F)=CC=3)=CC=C12 YNHLATJBQFXUMK-IBGZPJMESA-N 0.000 description 2
- OQYHMNKHMIFLMW-AWEZNQCLSA-N n-[4-[(3s)-3-methoxypyrrolidin-1-yl]-2-methylquinolin-7-yl]propanamide Chemical compound C=1C(C)=NC2=CC(NC(=O)CC)=CC=C2C=1N1CC[C@H](OC)C1 OQYHMNKHMIFLMW-AWEZNQCLSA-N 0.000 description 2
- 230000009871 nonspecific binding Effects 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 230000003204 osmotic effect Effects 0.000 description 2
- 125000004043 oxo group Chemical group O=* 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- TXQWFIVRZNOPCK-UHFFFAOYSA-N pyridin-4-ylmethanamine Chemical compound NCC1=CC=NC=C1 TXQWFIVRZNOPCK-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 125000001302 tertiary amino group Chemical group 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- UKLRWOHZBISUMI-UHFFFAOYSA-N (2,3-dimethylphenyl)methanamine Chemical compound CC1=CC=CC(CN)=C1C UKLRWOHZBISUMI-UHFFFAOYSA-N 0.000 description 1
- QDZZDVQGBKTLHV-UHFFFAOYSA-N (2,4-difluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1F QDZZDVQGBKTLHV-UHFFFAOYSA-N 0.000 description 1
- KDDNKZCVYQDGKE-UHFFFAOYSA-N (2-chlorophenyl)methanamine Chemical compound NCC1=CC=CC=C1Cl KDDNKZCVYQDGKE-UHFFFAOYSA-N 0.000 description 1
- PXJACNDVRNAFHD-UHFFFAOYSA-N (2-methoxyphenyl)methanamine Chemical compound COC1=CC=CC=C1CN PXJACNDVRNAFHD-UHFFFAOYSA-N 0.000 description 1
- CJAAPVQEZPAQNI-UHFFFAOYSA-N (2-methylphenyl)methanamine Chemical compound CC1=CC=CC=C1CN CJAAPVQEZPAQNI-UHFFFAOYSA-N 0.000 description 1
- CHPRFKYDQRKRRK-ZCFIWIBFSA-N (2r)-2-(methoxymethyl)pyrrolidine Chemical compound COC[C@H]1CCCN1 CHPRFKYDQRKRRK-ZCFIWIBFSA-N 0.000 description 1
- DZBHNPJZCQWUCG-UHFFFAOYSA-N (3,5-dimethylphenyl)methanamine Chemical compound CC1=CC(C)=CC(CN)=C1 DZBHNPJZCQWUCG-UHFFFAOYSA-N 0.000 description 1
- GRRIMVWABNHKBX-UHFFFAOYSA-N (3-methoxyphenyl)methanamine Chemical compound COC1=CC=CC(CN)=C1 GRRIMVWABNHKBX-UHFFFAOYSA-N 0.000 description 1
- SWZNXCABBUKIPZ-UHFFFAOYSA-N (3-methylthiophen-2-yl)methanamine Chemical compound CC=1C=CSC=1CN SWZNXCABBUKIPZ-UHFFFAOYSA-N 0.000 description 1
- JHHZLHWJQPUNKB-SCSAIBSYSA-N (3r)-pyrrolidin-3-ol Chemical compound O[C@@H]1CCNC1 JHHZLHWJQPUNKB-SCSAIBSYSA-N 0.000 description 1
- KEBOYHJEUFJZPE-LURJTMIESA-N (3s)-3-ethoxypyrrolidine Chemical compound CCO[C@H]1CCNC1 KEBOYHJEUFJZPE-LURJTMIESA-N 0.000 description 1
- BWRWNUQAQPAYCK-YFKPBYRVSA-N (3s)-3-methoxypyrrolidine Chemical compound CO[C@H]1CCNC1 BWRWNUQAQPAYCK-YFKPBYRVSA-N 0.000 description 1
- JHHZLHWJQPUNKB-BYPYZUCNSA-N (3s)-pyrrolidin-3-ol Chemical compound O[C@H]1CCNC1 JHHZLHWJQPUNKB-BYPYZUCNSA-N 0.000 description 1
- YMVFJGSXZNNUDW-UHFFFAOYSA-N (4-chlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1 YMVFJGSXZNNUDW-UHFFFAOYSA-N 0.000 description 1
- IIFVWLUQBAIPMJ-UHFFFAOYSA-N (4-fluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1 IIFVWLUQBAIPMJ-UHFFFAOYSA-N 0.000 description 1
- HMTSWYPNXFHGEP-UHFFFAOYSA-N (4-methylphenyl)methanamine Chemical compound CC1=CC=C(CN)C=C1 HMTSWYPNXFHGEP-UHFFFAOYSA-N 0.000 description 1
- PFGKKGQNFHMOBT-UHFFFAOYSA-N (6,6-difluorocyclohexa-2,4-dien-1-yl)methanamine Chemical compound NCC1C=CC=CC1(F)F PFGKKGQNFHMOBT-UHFFFAOYSA-N 0.000 description 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 1
- CHPRFKYDQRKRRK-LURJTMIESA-N (S)-2-(methoxymethyl)pyrrolidine Chemical compound COC[C@@H]1CCCN1 CHPRFKYDQRKRRK-LURJTMIESA-N 0.000 description 1
- LYAHJFZLDZDIOH-VURMDHGXSA-N (Z)-2-(2-furyl)-3-(5-nitro-2-furyl)acrylamide Chemical compound C=1C=COC=1/C(C(=O)N)=C/C1=CC=C([N+]([O-])=O)O1 LYAHJFZLDZDIOH-VURMDHGXSA-N 0.000 description 1
- 0 *C(C(N(*)*)=C1)=CC2C1=NC(*)=C[C@]2C1=CC=CC=CC=CC=CC1 Chemical compound *C(C(N(*)*)=C1)=CC2C1=NC(*)=C[C@]2C1=CC=CC=CC=CC=CC1 0.000 description 1
- IDPURXSQCKYKIJ-UHFFFAOYSA-N 1-(4-methoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1 IDPURXSQCKYKIJ-UHFFFAOYSA-N 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- XDIAMRVROCPPBK-UHFFFAOYSA-N 2,2-dimethylpropan-1-amine Chemical compound CC(C)(C)CN XDIAMRVROCPPBK-UHFFFAOYSA-N 0.000 description 1
- XJEVHMGJSYVQBQ-UHFFFAOYSA-N 2,3-dihydro-1h-inden-1-amine Chemical compound C1=CC=C2C(N)CCC2=C1 XJEVHMGJSYVQBQ-UHFFFAOYSA-N 0.000 description 1
- QNBJYUUUYZVIJP-UHFFFAOYSA-N 2,4-dichloroquinoline Chemical class C1=CC=CC2=NC(Cl)=CC(Cl)=C21 QNBJYUUUYZVIJP-UHFFFAOYSA-N 0.000 description 1
- 125000006507 2,4-difluorobenzyl group Chemical group [H]C1=C(F)C([H])=C(F)C(=C1[H])C([H])([H])* 0.000 description 1
- 125000006508 2,6-difluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C(F)=C1[H])C([H])([H])* 0.000 description 1
- RZBOMSOHMOVUES-UHFFFAOYSA-N 2-(2-chlorophenyl)ethanamine Chemical compound NCCC1=CC=CC=C1Cl RZBOMSOHMOVUES-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- OKFXPPIIANFQQR-UHFFFAOYSA-N 2-chloro-3h-thiophene-2-sulfonamide Chemical compound NS(=O)(=O)C1(Cl)CC=CS1 OKFXPPIIANFQQR-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- OFUFXTHGZWIDDB-UHFFFAOYSA-N 2-chloroquinoline Chemical class C1=CC=CC2=NC(Cl)=CC=C21 OFUFXTHGZWIDDB-UHFFFAOYSA-N 0.000 description 1
- XPFAXKWAVJEAOK-UHFFFAOYSA-N 2-fluoro-n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)benzamide Chemical compound C=12C=CC(NC(=O)C=3C(=CC=CC=3)F)=CC2=NC(C)=CC=1N1CCCC1 XPFAXKWAVJEAOK-UHFFFAOYSA-N 0.000 description 1
- KOHBEDRJXKOYHL-UHFFFAOYSA-N 2-methoxy-n-methylethanamine Chemical compound CNCCOC KOHBEDRJXKOYHL-UHFFFAOYSA-N 0.000 description 1
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- NEESHXCAWOIYTO-UHFFFAOYSA-N 2-methyl-4-pyrrolidin-1-ylquinolin-7-amine Chemical compound C=12C=CC(N)=CC2=NC(C)=CC=1N1CCCC1 NEESHXCAWOIYTO-UHFFFAOYSA-N 0.000 description 1
- YTZUOJRFZQPASL-UHFFFAOYSA-N 2-methyl-n-(naphthalen-1-ylmethyl)-4-pyrrolidin-1-ylquinolin-7-amine Chemical compound C=12C=CC(NCC=3C4=CC=CC=C4C=CC=3)=CC2=NC(C)=CC=1N1CCCC1 YTZUOJRFZQPASL-UHFFFAOYSA-N 0.000 description 1
- QFAOXICRMWQWRH-UHFFFAOYSA-N 2-methyl-n-(pyridin-3-ylmethyl)-4-pyrrolidin-1-ylquinolin-7-amine Chemical compound C=12C=CC(NCC=3C=NC=CC=3)=CC2=NC(C)=CC=1N1CCCC1 QFAOXICRMWQWRH-UHFFFAOYSA-N 0.000 description 1
- HSZSEVKBPVOBJQ-UHFFFAOYSA-N 2-methyl-n-(pyridin-4-ylmethyl)-4-pyrrolidin-1-ylquinolin-7-amine Chemical compound C=12C=CC(NCC=3C=CN=CC=3)=CC2=NC(C)=CC=1N1CCCC1 HSZSEVKBPVOBJQ-UHFFFAOYSA-N 0.000 description 1
- RLKZJLXTBNUPPU-UHFFFAOYSA-N 2-methyl-n-phenyl-4-pyrrolidin-1-ylquinolin-7-amine Chemical compound C=12C=CC(NC=3C=CC=CC=3)=CC2=NC(C)=CC=1N1CCCC1 RLKZJLXTBNUPPU-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-M 2-methylbutyrate Chemical compound CCC(C)C([O-])=O WLAMNBDJUVNPJU-UHFFFAOYSA-M 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- 125000006186 3,5-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C([H])=C1C([H])([H])[H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- KUKDIWYMSLUVLQ-UHFFFAOYSA-N 3-(cyclopropylmethoxy)pyrrolidine Chemical compound C1CC1COC1CCNC1 KUKDIWYMSLUVLQ-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- RRUDMHNAMZFNEK-UHFFFAOYSA-N 3-iodo-4-methylaniline Chemical compound CC1=CC=C(N)C=C1I RRUDMHNAMZFNEK-UHFFFAOYSA-N 0.000 description 1
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- LFIWXXXFJFOECP-UHFFFAOYSA-N 4-(aminomethyl)benzonitrile Chemical compound NCC1=CC=C(C#N)C=C1 LFIWXXXFJFOECP-UHFFFAOYSA-N 0.000 description 1
- HOVORBCIVXWZJJ-NRFANRHFSA-N 4-[(2s)-2-(cyclopropylmethoxymethyl)pyrrolidin-1-yl]-2-methyl-n-pyridin-3-ylquinolin-7-amine Chemical compound C([C@@H]1CCCN1C=1C=C(N=C2C=C(NC=3C=NC=CC=3)C=CC2=1)C)OCC1CC1 HOVORBCIVXWZJJ-NRFANRHFSA-N 0.000 description 1
- MSKMHSPXBNDAHN-BOXHHOBZSA-N 4-[(2s)-2-(cyclopropylmethoxymethyl)pyrrolidin-1-yl]-2-methyl-n-pyridin-3-ylquinolin-7-amine;hydrochloride Chemical compound Cl.C([C@@H]1CCCN1C=1C=C(N=C2C=C(NC=3C=NC=CC=3)C=CC2=1)C)OCC1CC1 MSKMHSPXBNDAHN-BOXHHOBZSA-N 0.000 description 1
- VQDZYLCFJQFVTQ-NTISSMGPSA-N 4-[(2s)-2-(cyclopropylmethoxymethyl)pyrrolidin-1-yl]-7-iodo-2-methylquinoline;hydrochloride Chemical compound Cl.C([C@@H]1CCCN1C=1C=C(N=C2C=C(I)C=CC2=1)C)OCC1CC1 VQDZYLCFJQFVTQ-NTISSMGPSA-N 0.000 description 1
- RRIFXZRZLMLPEO-IBGZPJMESA-N 4-[(2s)-2-(ethoxymethyl)pyrrolidin-1-yl]-2-methyl-n-pyridin-3-ylquinolin-7-amine Chemical compound CCOC[C@@H]1CCCN1C1=CC(C)=NC2=CC(NC=3C=NC=CC=3)=CC=C12 RRIFXZRZLMLPEO-IBGZPJMESA-N 0.000 description 1
- HPQPAGJZEUPDCL-FYZYNONXSA-N 4-[(2s)-2-(ethoxymethyl)pyrrolidin-1-yl]-2-methyl-n-pyridin-3-ylquinolin-7-amine;hydrochloride Chemical compound Cl.CCOC[C@@H]1CCCN1C1=CC(C)=NC2=CC(NC=3C=NC=CC=3)=CC=C12 HPQPAGJZEUPDCL-FYZYNONXSA-N 0.000 description 1
- ADAPEWPURVAHOO-UQKRIMTDSA-N 4-[(2s)-2-(ethoxymethyl)pyrrolidin-1-yl]-7-iodo-2-methylquinoline;hydrochloride Chemical compound Cl.CCOC[C@@H]1CCCN1C1=CC(C)=NC2=CC(I)=CC=C12 ADAPEWPURVAHOO-UQKRIMTDSA-N 0.000 description 1
- NYAUGKASVMAHQR-QHCPKHFHSA-N 4-[[4-[(2s)-2-(cyclopropylmethoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]amino]benzonitrile Chemical compound C([C@@H]1CCCN1C=1C=C(N=C2C=C(NC=3C=CC(=CC=3)C#N)C=CC2=1)C)OCC1CC1 NYAUGKASVMAHQR-QHCPKHFHSA-N 0.000 description 1
- BIBVZTBEXFQGJE-BQAIUKQQSA-N 4-[[4-[(2s)-2-(cyclopropylmethoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]amino]benzonitrile;hydrochloride Chemical compound Cl.C([C@@H]1CCCN1C=1C=C(N=C2C=C(NC=3C=CC(=CC=3)C#N)C=CC2=1)C)OCC1CC1 BIBVZTBEXFQGJE-BQAIUKQQSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 1
- JKZGHMPCBJVWEL-UHFFFAOYSA-N 4-chloro-7-iodoquinoline Chemical compound IC1=CC=C2C(Cl)=CC=NC2=C1 JKZGHMPCBJVWEL-UHFFFAOYSA-N 0.000 description 1
- GGUOCFNAWIODMF-UHFFFAOYSA-N 4-chloroacetanilide Chemical compound CC(=O)NC1=CC=C(Cl)C=C1 GGUOCFNAWIODMF-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-dimethylaminophenol Chemical compound CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
- LLIOADBCFIXIEU-UHFFFAOYSA-N 4-fluoro-3-nitroaniline Chemical compound NC1=CC=C(F)C([N+]([O-])=O)=C1 LLIOADBCFIXIEU-UHFFFAOYSA-N 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- HDHQZCHIXUUSMK-UHFFFAOYSA-N 4-hydroxy-2-quinolone Chemical class C1=CC=C2C(O)=CC(=O)NC2=C1 HDHQZCHIXUUSMK-UHFFFAOYSA-N 0.000 description 1
- HTDFYYPKIHDIDI-UHFFFAOYSA-N 4-methoxy-n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)benzamide Chemical compound C1=CC(OC)=CC=C1C(=O)NC1=CC=C(C(=CC(C)=N2)N3CCCC3)C2=C1 HTDFYYPKIHDIDI-UHFFFAOYSA-N 0.000 description 1
- GUCPYIYFQVTFSI-UHFFFAOYSA-N 4-methoxybenzamide Chemical compound COC1=CC=C(C(N)=O)C=C1 GUCPYIYFQVTFSI-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- QHZXSXZFMOBCGV-UHFFFAOYSA-N 4-methyl-n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)benzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1=CC=C(C(=CC(C)=N2)N3CCCC3)C2=C1 QHZXSXZFMOBCGV-UHFFFAOYSA-N 0.000 description 1
- RVJMYUCCSXPENF-UHFFFAOYSA-N 6-fluoro-2-methyl-7-nitro-1h-quinolin-4-one Chemical compound C1=C(F)C([N+]([O-])=O)=CC2=NC(C)=CC(O)=C21 RVJMYUCCSXPENF-UHFFFAOYSA-N 0.000 description 1
- PJEUKNUOCWNERE-UHFFFAOYSA-N 6-methyl-1h-quinolin-4-one Chemical compound N1=CC=C(O)C2=CC(C)=CC=C21 PJEUKNUOCWNERE-UHFFFAOYSA-N 0.000 description 1
- BDESDMFILMKLFD-UHFFFAOYSA-N 7-(3,4-dihydro-1h-isoquinolin-2-yl)-2-methyl-4-pyrrolidin-1-ylquinoline Chemical compound C=12C=CC(N3CC4=CC=CC=C4CC3)=CC2=NC(C)=CC=1N1CCCC1 BDESDMFILMKLFD-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- QYOVMAREBTZLBT-KTKRTIGZSA-N CCCCCCCC\C=C/CCCCCCCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO Chemical compound CCCCCCCC\C=C/CCCCCCCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO QYOVMAREBTZLBT-KTKRTIGZSA-N 0.000 description 1
- KGFBDEMDFXICTN-UHFFFAOYSA-N COCC1CCCN1c1cc(C)nc2cc(Nc3ccccc3C#N)ccc12 Chemical compound COCC1CCCN1c1cc(C)nc2cc(Nc3ccccc3C#N)ccc12 KGFBDEMDFXICTN-UHFFFAOYSA-N 0.000 description 1
- NELJGHXVFDETPQ-UHFFFAOYSA-N Cl.CCOC1CCN(C1)c1cc2ccc(I)cc2nc1C Chemical compound Cl.CCOC1CCN(C1)c1cc2ccc(I)cc2nc1C NELJGHXVFDETPQ-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 108010054576 Deoxyribonuclease EcoRI Proteins 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 102100031416 Gastric triacylglycerol lipase Human genes 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 208000031226 Hyperlipidaemia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229940127470 Lipase Inhibitors Drugs 0.000 description 1
- 239000005913 Maltodextrin Substances 0.000 description 1
- 229920002774 Maltodextrin Polymers 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- ZYVXHFWBYUDDBM-UHFFFAOYSA-N N-methylnicotinamide Chemical compound CNC(=O)C1=CC=CN=C1 ZYVXHFWBYUDDBM-UHFFFAOYSA-N 0.000 description 1
- 108070000018 Neuropeptide receptor Proteins 0.000 description 1
- 102000028517 Neuropeptide receptor Human genes 0.000 description 1
- 102000003797 Neuropeptides Human genes 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 108050006759 Pancreatic lipases Proteins 0.000 description 1
- 102000019280 Pancreatic lipases Human genes 0.000 description 1
- 108010002747 Pfu DNA polymerase Proteins 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- WQOIYWUDRYVPCT-KRWDZBQOSA-N [(2s)-1-[2-methyl-7-(pyridin-3-ylamino)quinolin-4-yl]pyrrolidin-2-yl]methanol Chemical compound C=12C=CC(NC=3C=NC=CC=3)=CC2=NC(C)=CC=1N1CCC[C@H]1CO WQOIYWUDRYVPCT-KRWDZBQOSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- DFPAKSUCGFBDDF-ZQBYOMGUSA-N [14c]-nicotinamide Chemical compound N[14C](=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-ZQBYOMGUSA-N 0.000 description 1
- ZSKQIFWUTUZAGF-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=CC=C1C(F)(F)F ZSKQIFWUTUZAGF-UHFFFAOYSA-N 0.000 description 1
- YBGJZYCWGNYUMA-UHFFFAOYSA-M [Cl-].[P+]=O Chemical compound [Cl-].[P+]=O YBGJZYCWGNYUMA-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 235000021407 appetite control Nutrition 0.000 description 1
- 230000004597 appetite gain Effects 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 230000009137 competitive binding Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 229960000913 crospovidone Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- MFNYBOWJWGPXFM-UHFFFAOYSA-N cyclobutanecarboxamide Chemical compound NC(=O)C1CCC1 MFNYBOWJWGPXFM-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 1
- MGHPNCMVUAKAIE-UHFFFAOYSA-N diphenylmethanamine Chemical compound C=1C=CC=CC=1C(N)C1=CC=CC=C1 MGHPNCMVUAKAIE-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000013604 expression vector Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229960004979 fampridine Drugs 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 108010091264 gastric triacylglycerol lipase Proteins 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- XKWCTHKJQNUFOQ-HRPSIEBRSA-N gtpl1504 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@H](CCSC)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 XKWCTHKJQNUFOQ-HRPSIEBRSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005241 heteroarylamino group Chemical group 0.000 description 1
- 125000006517 heterocyclyl carbonyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 210000003016 hypothalamus Anatomy 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- VFQXVTODMYMSMJ-UHFFFAOYSA-N isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- SANOUVWGPVYVAV-UHFFFAOYSA-N isovaleramide Chemical compound CC(C)CC(N)=O SANOUVWGPVYVAV-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229940035034 maltodextrin Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- XVAIDCNLVLTVFM-UHFFFAOYSA-N methacetin Chemical compound COC1=CC=C(NC(C)=O)C=C1 XVAIDCNLVLTVFM-UHFFFAOYSA-N 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- 125000006431 methyl cyclopropyl group Chemical group 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- WQOJQHQZUZSJJH-UHFFFAOYSA-N n,2-dimethyl-n-(pyridin-3-ylmethyl)-4-pyrrolidin-1-ylquinolin-7-amine Chemical compound C=1C=C2C(N3CCCC3)=CC(C)=NC2=CC=1N(C)CC1=CC=CN=C1 WQOJQHQZUZSJJH-UHFFFAOYSA-N 0.000 description 1
- ZBAMQLFFVBPAOX-UHFFFAOYSA-N n-(pyridin-4-ylmethyl)ethanamine Chemical compound CCNCC1=CC=NC=C1 ZBAMQLFFVBPAOX-UHFFFAOYSA-N 0.000 description 1
- HNIPNANLYHXYDE-UHFFFAOYSA-N n-[3-(trifluoromethyl)phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(C(F)(F)F)=C1 HNIPNANLYHXYDE-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- HZPJZPUYKPPBDQ-UHFFFAOYSA-N n-[4-(3-ethoxypyrrolidin-1-yl)-2-methylquinolin-7-yl]benzamide Chemical compound C1C(OCC)CCN1C1=CC(C)=NC2=CC(NC(=O)C=3C=CC=CC=3)=CC=C12 HZPJZPUYKPPBDQ-UHFFFAOYSA-N 0.000 description 1
- HLNJIEINCLRDRR-INIZCTEOSA-N n-[4-[(2s)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methylquinolin-7-yl]-2,2-dimethylpropanamide Chemical compound COC[C@@H]1CCCN1C1=CC(C)=NC2=CC(NC(=O)C(C)(C)C)=CC=C12 HLNJIEINCLRDRR-INIZCTEOSA-N 0.000 description 1
- BMENQRUXLGIDFO-FQEVSTJZSA-N n-[4-[(3s)-3-(cyclopropylmethoxy)pyrrolidin-1-yl]-2-methylquinolin-7-yl]pyridine-3-carboxamide Chemical compound O([C@H]1CCN(C1)C=1C=C(N=C2C=C(NC(=O)C=3C=NC=CC=3)C=CC2=1)C)CC1CC1 BMENQRUXLGIDFO-FQEVSTJZSA-N 0.000 description 1
- FNNZEIXCEJUHAE-INIZCTEOSA-N n-[4-[(3s)-3-ethoxypyrrolidin-1-yl]-2-methylquinolin-7-yl]-2,2-dimethylpropanamide Chemical compound C1[C@@H](OCC)CCN1C1=CC(C)=NC2=CC(NC(=O)C(C)(C)C)=CC=C12 FNNZEIXCEJUHAE-INIZCTEOSA-N 0.000 description 1
- ITJSEBQOFXNTIK-NTISSMGPSA-N n-[4-[(3s)-3-ethoxypyrrolidin-1-yl]-2-methylquinolin-7-yl]-2,2-dimethylpropanamide;hydrochloride Chemical compound Cl.C1[C@@H](OCC)CCN1C1=CC(C)=NC2=CC(NC(=O)C(C)(C)C)=CC=C12 ITJSEBQOFXNTIK-NTISSMGPSA-N 0.000 description 1
- LPOBCYLRFVUVLL-IBGZPJMESA-N n-[4-[(3s)-3-ethoxypyrrolidin-1-yl]-2-methylquinolin-7-yl]-2-pyridin-2-ylacetamide Chemical compound C1[C@@H](OCC)CCN1C1=CC(C)=NC2=CC(NC(=O)CC=3N=CC=CC=3)=CC=C12 LPOBCYLRFVUVLL-IBGZPJMESA-N 0.000 description 1
- SVHNCHIZMGPPDL-SFHVURJKSA-N n-[4-[(3s)-3-ethoxypyrrolidin-1-yl]-2-methylquinolin-7-yl]pyridine-3-carboxamide Chemical compound C1[C@@H](OCC)CCN1C1=CC(C)=NC2=CC(NC(=O)C=3C=NC=CC=3)=CC=C12 SVHNCHIZMGPPDL-SFHVURJKSA-N 0.000 description 1
- HYOOFTOWVYPEDB-KRWDZBQOSA-N n-[4-[(3s)-3-methoxypyrrolidin-1-yl]-2-methylquinolin-7-yl]pyridine-3-carboxamide Chemical compound C1[C@@H](OC)CCN1C1=CC(C)=NC2=CC(NC(=O)C=3C=NC=CC=3)=CC=C12 HYOOFTOWVYPEDB-KRWDZBQOSA-N 0.000 description 1
- DQUPUNBCKWCSGT-UHFFFAOYSA-N n-ethyl-2-methyl-n-(pyridin-4-ylmethyl)-4-pyrrolidin-1-ylquinolin-7-amine Chemical compound C=1C=C2C(N3CCCC3)=CC(C)=NC2=CC=1N(CC)CC1=CC=NC=C1 DQUPUNBCKWCSGT-UHFFFAOYSA-N 0.000 description 1
- MCSAQVGDZLPTBS-UHFFFAOYSA-N n-methyl-1-pyridin-3-ylmethanamine Chemical compound CNCC1=CC=CN=C1 MCSAQVGDZLPTBS-UHFFFAOYSA-N 0.000 description 1
- DHMIGWYUSIKSFU-UHFFFAOYSA-N n-methyl-n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)benzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)N(C)C(C=C1N=C(C)C=2)=CC=C1C=2N1CCCC1 DHMIGWYUSIKSFU-UHFFFAOYSA-N 0.000 description 1
- RGEWMROOVIYXOZ-UHFFFAOYSA-N n-methyl-n-(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)pyridine-3-carboxamide Chemical compound C=1C=C2C(N3CCCC3)=CC(C)=NC2=CC=1N(C)C(=O)C1=CC=CN=C1 RGEWMROOVIYXOZ-UHFFFAOYSA-N 0.000 description 1
- SVDVKEBISAOWJT-UHFFFAOYSA-N n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=CC=C1 SVDVKEBISAOWJT-UHFFFAOYSA-N 0.000 description 1
- JVYIBLHBCPSTKF-UHFFFAOYSA-N n-pyridin-3-ylacetamide Chemical compound CC(=O)NC1=CC=CN=C1 JVYIBLHBCPSTKF-UHFFFAOYSA-N 0.000 description 1
- 125000001326 naphthylalkyl group Chemical group 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- BPGXUIVWLQTVLZ-OFGSCBOVSA-N neuropeptide y(npy) Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(O)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 BPGXUIVWLQTVLZ-OFGSCBOVSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 210000001428 peripheral nervous system Anatomy 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 229940069328 povidone Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- NKFLEFWUYAUDJV-UHFFFAOYSA-N pyridine-3-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CN=C1 NKFLEFWUYAUDJV-UHFFFAOYSA-N 0.000 description 1
- 239000002287 radioligand Substances 0.000 description 1
- 238000003653 radioligand binding assay Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 230000009870 specific binding Effects 0.000 description 1
- 238000003153 stable transfection Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000005846 sugar alcohols Chemical class 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 230000035924 thermogenesis Effects 0.000 description 1
- FKKJJPMGAWGYPN-UHFFFAOYSA-N thiophen-2-ylmethanamine Chemical compound NCC1=CC=CS1 FKKJJPMGAWGYPN-UHFFFAOYSA-N 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000001890 transfection Methods 0.000 description 1
- 229940070710 valerate Drugs 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/14—Prodigestives, e.g. acids, enzymes, appetite stimulants, antidyspeptics, tonics, antiflatulents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/12—Drugs for disorders of the urinary system of the kidneys
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/48—Drugs for disorders of the endocrine system of the pancreatic hormones
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/42—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/42—Nitrogen atoms attached in position 4
- C07D215/46—Nitrogen atoms attached in position 4 with hydrocarbon radicals, substituted by nitrogen atoms, attached to said nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Rheumatology (AREA)
- Endocrinology (AREA)
- Obesity (AREA)
- Urology & Nephrology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Child & Adolescent Psychology (AREA)
- Pain & Pain Management (AREA)
- Cardiology (AREA)
- Emergency Medicine (AREA)
- Immunology (AREA)
- Heart & Thoracic Surgery (AREA)
- Physical Education & Sports Medicine (AREA)
- Nutrition Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Quinoline Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP02001967.5 | 2002-02-04 | ||
| EP02001967 | 2002-02-04 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU2004126936A RU2004126936A (ru) | 2005-10-10 |
| RU2298002C2 true RU2298002C2 (ru) | 2007-04-27 |
Family
ID=27635782
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU2004126936/04A RU2298002C2 (ru) | 2002-02-04 | 2003-01-27 | Производные хинолина в качестве антагонистов npy |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US6696467B2 (enExample) |
| EP (1) | EP1474145B1 (enExample) |
| JP (1) | JP4216196B2 (enExample) |
| KR (1) | KR100659428B1 (enExample) |
| CN (1) | CN100383124C (enExample) |
| AR (1) | AR038249A1 (enExample) |
| AT (1) | ATE392897T1 (enExample) |
| AU (1) | AU2003205679B2 (enExample) |
| BR (1) | BR0307441A (enExample) |
| CA (1) | CA2473181A1 (enExample) |
| DE (1) | DE60320529T2 (enExample) |
| ES (1) | ES2304498T3 (enExample) |
| MX (1) | MXPA04007502A (enExample) |
| PE (1) | PE20040120A1 (enExample) |
| PL (1) | PL372295A1 (enExample) |
| RU (1) | RU2298002C2 (enExample) |
| TW (1) | TW200400032A (enExample) |
| UY (1) | UY27646A1 (enExample) |
| WO (1) | WO2003066055A1 (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2520766C2 (ru) * | 2007-05-17 | 2014-06-27 | Хелперби Терапьютикс Лимитед | Применение соединений 4-(пирролидин-1-ил)хинолина для уничтожения клинически латентных микроорганизмов |
| RU2561132C2 (ru) * | 2009-06-29 | 2015-08-20 | Аджиос Фармасьютикалз, Инк. | Производные хинолинсульфонамидов и их применение для модулирования пкм2 активности |
| RU2620380C2 (ru) * | 2010-12-03 | 2017-05-25 | ДАУ АГРОСАЙЕНСИЗ ЭлЭлСи | Способы получения енаминов |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6900226B2 (en) * | 2000-09-06 | 2005-05-31 | Hoffman-La Roche Inc. | Neuropeptide Y antagonists |
| JP2004110367A (ja) * | 2002-09-18 | 2004-04-08 | Hitachi Ltd | 記憶装置システムの制御方法、記憶制御装置、および記憶装置システム |
| WO2005030754A1 (en) * | 2003-09-24 | 2005-04-07 | Janssen Pharmaceutica, N.V. | Indole or quinoline derivatives as non-pepticid npy y2 receptor inhibitors useful for the treatment of anxiolytic and depressive disorders and obesity |
| NZ547481A (en) | 2003-11-19 | 2009-12-24 | Array Biopharma Inc | Heterocyclic inhibitors of mek and methods of use thereof |
| US20080125403A1 (en) | 2004-04-02 | 2008-05-29 | Merck & Co., Inc. | Method of Treating Men with Metabolic and Anthropometric Disorders |
| CA2624294A1 (en) * | 2005-10-05 | 2007-04-12 | Merck Frosst Canada Ltd. | Substituted quinolines as inhibitors of leukotriene biosynthesis |
| RU2314295C2 (ru) * | 2006-03-01 | 2008-01-10 | Федеральное Государственное Образовательное Учреждение Высшего Профессионального Образования "Южный Федеральный Университет" | 2-гетарилзамещенные 1,3-трополона, способ их получения (варианты) и фармацевтическая композиция антимикробного действия |
| WO2008141077A1 (en) * | 2007-05-10 | 2008-11-20 | Janssen Pharmaceutica N.V. | Process for the preparation of tetrahydroquinolinyl, benzoxazine and benzothiazine derivatives |
| WO2010056865A1 (en) | 2008-11-14 | 2010-05-20 | Gilead Palo Alto, Inc. | Quinoline derivatives as ion channel modulators |
| CN103547566B (zh) | 2011-02-18 | 2017-05-31 | 阿萨纳生物科技有限责任公司 | 氨基茚满化合物及其治疗疼痛的用途 |
| JP2014517074A (ja) | 2011-06-24 | 2014-07-17 | アムジエン・インコーポレーテツド | Trpm8アンタゴニストおよび治療におけるそれらの使用 |
| MY157429A (en) | 2011-06-24 | 2016-06-15 | Amgen Inc | Trpm8 antagonists and their use in treatments |
| US8952009B2 (en) | 2012-08-06 | 2015-02-10 | Amgen Inc. | Chroman derivatives as TRPM8 inhibitors |
| TWI603957B (zh) | 2012-08-15 | 2017-11-01 | 阿沙納生物科學有限責任公司 | 胺基氫茚化合物用於治療膀胱過動症及間質性膀胱炎之用途 |
| EP3527569B1 (en) | 2014-02-03 | 2021-08-25 | Vitae Pharmaceuticals, LLC | Dihydropyrrolopyridine inhibitors of ror-gamma for use in treating drye eye |
| US9663515B2 (en) | 2014-11-05 | 2017-05-30 | Vitae Pharmaceuticals, Inc. | Dihydropyrrolopyridine inhibitors of ROR-gamma |
| ES2856931T3 (es) | 2015-08-05 | 2021-09-28 | Vitae Pharmaceuticals Llc | Moduladores de ROR-gamma |
| EP3868750A1 (en) * | 2015-11-20 | 2021-08-25 | Vitae Pharmaceuticals, LLC | Modulators of ror-gamma |
| TW202220968A (zh) | 2016-01-29 | 2022-06-01 | 美商維它藥物有限責任公司 | ROR-γ調節劑 |
| AU2017296392B2 (en) | 2016-07-14 | 2020-09-24 | Crinetics Pharmaceuticals, Inc. | Somatostatin modulators and uses thereof |
| TWI774767B (zh) | 2017-05-12 | 2022-08-21 | 瑞士商多蒂孔股份有限公司 | 茚烷衍生物及其在有機電子產品的用途 |
| MA49685A (fr) | 2017-07-24 | 2021-04-14 | Vitae Pharmaceuticals Llc | INHIBITEURS DE ROR gamma |
| WO2019018975A1 (en) | 2017-07-24 | 2019-01-31 | Vitae Pharmaceuticals, Inc. | INHIBITORS OF ROR GAMMA |
| EP3658560A4 (en) | 2017-07-25 | 2021-01-06 | Crinetics Pharmaceuticals, Inc. | SOMATOSTAT IN MODULATORS AND USES THEREOF |
| SG11202001310SA (en) * | 2017-08-17 | 2020-03-30 | Ikena Oncology Inc | Ahr inhibitors and uses thereof |
| MA51625B1 (fr) * | 2018-01-17 | 2022-07-29 | Crinetics Pharmaceuticals Inc | Procédé de production de modulateurs de somatostatine |
| RU2702648C1 (ru) * | 2019-07-11 | 2019-10-09 | федеральное государственное автономное образовательное учреждение высшего образования «Южный федеральный университет» | 5,7-Ди(трет-бутил)-2-(4,7-дихлор-8-метил-5-нитрохинолин-2-ил)-4-нитро-1,3-трополон, обладающий цитотоксической активностью |
| US12617767B2 (en) | 2019-07-17 | 2026-05-05 | Crinetics Pharmaceuticals, Inc. | Crystalline forms of somatostatin modulators |
| WO2022055880A1 (en) | 2020-09-09 | 2022-03-17 | Crinetics Pharmaceuticals, Inc. | Formulations of a somatostatin modulator |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4035367A (en) * | 1974-09-09 | 1977-07-12 | Sandoz, Inc. | Hydroxyalkyl-substituted-amino-quinolines |
| WO1996037474A1 (en) * | 1995-05-26 | 1996-11-28 | Warner-Lambert Company | Sulfonylquinolines as neuropeptide y1 antagonists |
| RU2161967C2 (ru) * | 1994-08-18 | 2001-01-20 | Дзе Проктер Энд Гэмбл Компани | Соединения 7-(2-имидазолиниламино) хинолина, пригодные в качестве агонистов альфа-2-адренорецептора |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1247547A (en) * | 1983-06-22 | 1988-12-28 | Paul Hadvary | Leucine derivatives |
| CA1270837A (en) | 1984-12-21 | 1990-06-26 | Hoffmann-La Roche Limited | Oxetanones |
| CA1328881C (en) | 1984-12-21 | 1994-04-26 | Pierre Barbier | Process for the manufacture of oxetanones |
| CA2035972C (en) | 1990-02-23 | 2006-07-11 | Martin Karpf | Process for the preparation of oxetanones |
| US5274143A (en) | 1991-07-23 | 1993-12-28 | Hoffmann-La Roche Inc. | Process for the preparation of (R)-3-hexyl-5,6-dihydro-4-hydroxy-6-undecyl-2H-pyran-2-one and (R)-5,6-dihydro-6-undecyl-2H-pyran-2,4(3H)-dione |
| CA2133620A1 (en) * | 1993-10-28 | 1995-04-29 | Werner Hofheinz | Aminoquinoline derivatives |
| US6004996A (en) * | 1997-02-05 | 1999-12-21 | Hoffman-La Roche Inc. | Tetrahydrolipstatin containing compositions |
| US6267952B1 (en) | 1998-01-09 | 2001-07-31 | Geltex Pharmaceuticals, Inc. | Lipase inhibiting polymers |
| BR9912980B1 (pt) | 1998-08-14 | 2013-10-22 | Composição farmacêutica administrável oralmente, tablete de mascar contendo a mesma e utilização da mesma | |
| DE69916288T2 (de) | 1998-08-14 | 2005-03-24 | F. Hoffmann-La Roche Ag | Lipasehemmer und chitosan enthaltende arzneimittel |
| US6900226B2 (en) * | 2000-09-06 | 2005-05-31 | Hoffman-La Roche Inc. | Neuropeptide Y antagonists |
| DE10064105A1 (de) * | 2000-12-21 | 2002-06-27 | Bayer Ag | Neue Substituierte Imidazotriazinone |
| KR100621287B1 (ko) * | 2001-05-21 | 2006-09-13 | 에프. 호프만-라 로슈 아게 | 신경 펩타이드 y 수용체에 대한 리간드로서의 퀴놀린유도체 |
-
2003
- 2003-01-27 JP JP2003565479A patent/JP4216196B2/ja not_active Expired - Fee Related
- 2003-01-27 ES ES03702533T patent/ES2304498T3/es not_active Expired - Lifetime
- 2003-01-27 DE DE60320529T patent/DE60320529T2/de not_active Expired - Fee Related
- 2003-01-27 CN CNB038032805A patent/CN100383124C/zh not_active Expired - Fee Related
- 2003-01-27 RU RU2004126936/04A patent/RU2298002C2/ru not_active IP Right Cessation
- 2003-01-27 AT AT03702533T patent/ATE392897T1/de not_active IP Right Cessation
- 2003-01-27 WO PCT/EP2003/000777 patent/WO2003066055A1/en not_active Ceased
- 2003-01-27 BR BR0307441-2A patent/BR0307441A/pt not_active IP Right Cessation
- 2003-01-27 CA CA002473181A patent/CA2473181A1/en not_active Abandoned
- 2003-01-27 AU AU2003205679A patent/AU2003205679B2/en not_active Ceased
- 2003-01-27 PL PL03372295A patent/PL372295A1/xx not_active Application Discontinuation
- 2003-01-27 MX MXPA04007502A patent/MXPA04007502A/es active IP Right Grant
- 2003-01-27 EP EP03702533A patent/EP1474145B1/en not_active Expired - Lifetime
- 2003-01-27 KR KR1020047012036A patent/KR100659428B1/ko not_active Expired - Fee Related
- 2003-01-30 TW TW092102218A patent/TW200400032A/zh unknown
- 2003-01-31 AR ARP030100304A patent/AR038249A1/es not_active Application Discontinuation
- 2003-01-31 PE PE2003000111A patent/PE20040120A1/es not_active Application Discontinuation
- 2003-02-03 UY UY27646A patent/UY27646A1/es not_active Application Discontinuation
- 2003-02-04 US US10/358,006 patent/US6696467B2/en not_active Expired - Fee Related
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4035367A (en) * | 1974-09-09 | 1977-07-12 | Sandoz, Inc. | Hydroxyalkyl-substituted-amino-quinolines |
| RU2161967C2 (ru) * | 1994-08-18 | 2001-01-20 | Дзе Проктер Энд Гэмбл Компани | Соединения 7-(2-имидазолиниламино) хинолина, пригодные в качестве агонистов альфа-2-адренорецептора |
| WO1996037474A1 (en) * | 1995-05-26 | 1996-11-28 | Warner-Lambert Company | Sulfonylquinolines as neuropeptide y1 antagonists |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2520766C2 (ru) * | 2007-05-17 | 2014-06-27 | Хелперби Терапьютикс Лимитед | Применение соединений 4-(пирролидин-1-ил)хинолина для уничтожения клинически латентных микроорганизмов |
| RU2561132C2 (ru) * | 2009-06-29 | 2015-08-20 | Аджиос Фармасьютикалз, Инк. | Производные хинолинсульфонамидов и их применение для модулирования пкм2 активности |
| RU2620380C2 (ru) * | 2010-12-03 | 2017-05-25 | ДАУ АГРОСАЙЕНСИЗ ЭлЭлСи | Способы получения енаминов |
Also Published As
| Publication number | Publication date |
|---|---|
| MXPA04007502A (es) | 2004-11-10 |
| ES2304498T3 (es) | 2008-10-16 |
| JP2005523901A (ja) | 2005-08-11 |
| WO2003066055A1 (en) | 2003-08-14 |
| CA2473181A1 (en) | 2003-08-14 |
| ATE392897T1 (de) | 2008-05-15 |
| US20030153553A1 (en) | 2003-08-14 |
| JP4216196B2 (ja) | 2009-01-28 |
| US6696467B2 (en) | 2004-02-24 |
| PL372295A1 (en) | 2005-07-11 |
| RU2004126936A (ru) | 2005-10-10 |
| AR038249A1 (es) | 2005-01-05 |
| UY27646A1 (es) | 2003-08-29 |
| DE60320529T2 (de) | 2009-06-10 |
| KR20040081484A (ko) | 2004-09-21 |
| AU2003205679A1 (en) | 2003-09-02 |
| AU2003205679B2 (en) | 2006-06-29 |
| PE20040120A1 (es) | 2004-03-06 |
| TW200400032A (en) | 2004-01-01 |
| BR0307441A (pt) | 2005-01-04 |
| CN100383124C (zh) | 2008-04-23 |
| KR100659428B1 (ko) | 2006-12-19 |
| EP1474145B1 (en) | 2008-04-23 |
| EP1474145A1 (en) | 2004-11-10 |
| DE60320529D1 (de) | 2008-06-05 |
| CN1627945A (zh) | 2005-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6696467B2 (en) | Quinoline derivatives | |
| US6818767B2 (en) | Quinoline derivatives | |
| AU2002210474B2 (en) | Quinoline and quinazoline derivatives as ligands for the neuropetide Y receptor | |
| CN101679287B (zh) | 烟碱型乙酰胆碱受体调节剂 | |
| RU2300531C2 (ru) | Хинолиновые производные в качестве антагонистов нейропептида y | |
| JP2005509032A (ja) | カンナビノイドレセプターリガンド | |
| RU2324685C2 (ru) | Производные тиазола, способ их получения и применение, фармацевтическая композиция, обладающая свойствами антагонистов рецепторов npy | |
| JP2005521651A (ja) | ピロリドンカルボキサミド類 | |
| TWI576345B (zh) | 嗎啉-吡啶衍生物 | |
| RU2296757C2 (ru) | Производные хиназолина | |
| RU2321586C2 (ru) | Производные тиазола в качестве антагонистов npy | |
| JP2010229096A (ja) | 医薬組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | The patent is invalid due to non-payment of fees |
Effective date: 20090128 |