RU2133246C1 - Способ получения сульфонилмочевин и продукт присоединения - Google Patents
Способ получения сульфонилмочевин и продукт присоединения Download PDFInfo
- Publication number
- RU2133246C1 RU2133246C1 RU93004630A RU93004630A RU2133246C1 RU 2133246 C1 RU2133246 C1 RU 2133246C1 RU 93004630 A RU93004630 A RU 93004630A RU 93004630 A RU93004630 A RU 93004630A RU 2133246 C1 RU2133246 C1 RU 2133246C1
- Authority
- RU
- Russia
- Prior art keywords
- formula
- compound
- alkyl
- compounds
- iii
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 63
- 238000000034 method Methods 0.000 title claims abstract description 35
- 229940100389 Sulfonylurea Drugs 0.000 title claims abstract description 5
- 230000015572 biosynthetic process Effects 0.000 title abstract description 5
- 238000003786 synthesis reaction Methods 0.000 title abstract 4
- 150000001768 cations Chemical class 0.000 claims abstract description 12
- 238000002955 isolation Methods 0.000 claims abstract description 12
- 229910052751 metal Inorganic materials 0.000 claims abstract description 11
- 239000002184 metal Substances 0.000 claims abstract description 11
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000001453 quaternary ammonium group Chemical group 0.000 claims abstract description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 6
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims abstract description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 4
- 238000006243 chemical reaction Methods 0.000 claims description 31
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 13
- 150000002431 hydrogen Chemical class 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 230000003993 interaction Effects 0.000 claims description 8
- 239000003960 organic solvent Substances 0.000 claims description 8
- 239000003049 inorganic solvent Substances 0.000 claims description 7
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 125000006526 (C1-C2) alkyl group Chemical group 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 239000003495 polar organic solvent Substances 0.000 claims description 3
- ZVCDLGYNFYZZOK-UHFFFAOYSA-M sodium cyanate Chemical compound [Na]OC#N ZVCDLGYNFYZZOK-UHFFFAOYSA-M 0.000 claims description 3
- 125000006536 (C1-C2)alkoxy group Chemical group 0.000 claims description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 2
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims description 2
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000010 aprotic solvent Substances 0.000 claims 1
- 150000008282 halocarbons Chemical class 0.000 claims 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract description 2
- 239000000126 substance Substances 0.000 abstract description 2
- 229910006024 SO2Cl2 Inorganic materials 0.000 abstract 1
- 150000002500 ions Chemical group 0.000 abstract 1
- 125000004430 oxygen atom Chemical group O* 0.000 abstract 1
- -1 alkali metal salts Chemical class 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000002585 base Substances 0.000 description 9
- 229910001867 inorganic solvent Inorganic materials 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- LVFRCHIUUKWBLR-UHFFFAOYSA-N 4,6-dimethoxypyrimidin-2-amine Chemical compound COC1=CC(OC)=NC(N)=N1 LVFRCHIUUKWBLR-UHFFFAOYSA-N 0.000 description 2
- CTTHWASMBLQOFR-UHFFFAOYSA-N Amidosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)=N1 CTTHWASMBLQOFR-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 238000004811 liquid chromatography Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- MOEFFSWKSMRFRQ-UHFFFAOYSA-N 2-ethoxyphenol Chemical compound CCOC1=CC=CC=C1O MOEFFSWKSMRFRQ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 1
- UWVKRNOCDUPIDM-UHFFFAOYSA-N Ethoxysulfuron Chemical compound CCOC1=CC=CC=C1OS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 UWVKRNOCDUPIDM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N methyl monoether Natural products COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- UHNHTTIUNATJKL-UHFFFAOYSA-N n-methylmethanesulfonamide Chemical compound CNS(C)(=O)=O UHNHTTIUNATJKL-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 238000002604 ultrasonography Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D521/00—Heterocyclic compounds containing unspecified hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Saccharide Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4207242 | 1992-03-07 | ||
| DEP4207242,5 | 1992-03-07 | ||
| DEP4207242.5 | 1992-03-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU93004630A RU93004630A (ru) | 1996-04-27 |
| RU2133246C1 true RU2133246C1 (ru) | 1999-07-20 |
Family
ID=6453464
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU93004630A RU2133246C1 (ru) | 1992-03-07 | 1993-03-05 | Способ получения сульфонилмочевин и продукт присоединения |
Country Status (18)
| Country | Link |
|---|---|
| US (3) | US5364937A (enExample) |
| EP (1) | EP0560178B1 (enExample) |
| JP (1) | JP3754460B2 (enExample) |
| KR (1) | KR100318190B1 (enExample) |
| CN (1) | CN1045205C (enExample) |
| AT (1) | ATE145399T1 (enExample) |
| BR (1) | BR9300759A (enExample) |
| CA (1) | CA2091138A1 (enExample) |
| CZ (1) | CZ34893A3 (enExample) |
| DE (1) | DE59304502D1 (enExample) |
| DK (1) | DK0560178T3 (enExample) |
| ES (1) | ES2096786T3 (enExample) |
| HU (1) | HU213453B (enExample) |
| IL (1) | IL104970A (enExample) |
| MX (1) | MX9301256A (enExample) |
| PL (1) | PL297956A1 (enExample) |
| RU (1) | RU2133246C1 (enExample) |
| ZA (1) | ZA931586B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5486517A (en) * | 1994-05-10 | 1996-01-23 | Warner-Lambert Company | Benzimidazoles and imidazopyridines as central nervous system agents |
| CN1281403C (zh) | 2001-07-31 | 2006-10-25 | 艾弗里·丹尼森公司 | 可整合的全息标签 |
| MXPA04012896A (es) | 2002-06-26 | 2005-03-31 | Avery Dennison Corp | Peliculas polimericas orientadas en la direccion de mecanizado y metodos de preparacion de las mismas. |
| WO2007146986A1 (en) | 2006-06-14 | 2007-12-21 | Avery Dennison Corporation | Conformable and die-cuttable machine direction oriented labelstocks and labels, and process for preparing |
| AU2007261011B2 (en) | 2006-06-20 | 2012-04-05 | Avery Dennison Corporation | Multilayered polymeric film for hot melt adhesive labeling and label stock and label thereof |
| CN101489787B (zh) | 2006-07-17 | 2012-12-12 | 艾利丹尼森公司 | 非对称多层聚合物膜和标签材料及其标签 |
| US9676532B2 (en) | 2012-08-15 | 2017-06-13 | Avery Dennison Corporation | Packaging reclosure label for high alcohol content products |
| BR112016028445B1 (pt) | 2014-06-02 | 2022-05-31 | Avery Dennison Corporation | Filme orientado com resistência à abrasão, clareza e conformabilidade, conjunto de rótulo compreendendo o filme e método para produzir um artigo rotulado |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3422569A1 (en) * | 2017-06-30 | 2019-01-02 | Nxp B.V. | An amplifier circuit |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2257240A1 (de) * | 1972-11-22 | 1974-05-30 | Hoechst Ag | Neue isocyanate und verfahren zu ihrer herstellung |
| US4191553A (en) * | 1978-03-02 | 1980-03-04 | E. I. Du Pont De Nemours And Company | Herbicidal sulfamates |
| EP0013258B1 (de) * | 1978-12-29 | 1982-07-07 | Ciba-Geigy Ag | Propenylsubstituierte Phenolglycidyläther, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE3324802A1 (de) * | 1983-07-09 | 1985-01-17 | Hoechst Ag, 6230 Frankfurt | Neue n-alkoxy- und n- alkylsulfonylaminosulfonylharnstoffe, und neue (pyrimido) triazino-thiadiazinoxide als vorprodukte |
| DE3816704A1 (de) * | 1988-05-17 | 1989-11-30 | Hoechst Ag | Heterocyclische 2-alkoxyphenoxysulfonylharnstoffe und ihre verwendung als herbizide oder pflanzenwachstumsregulatoren |
-
1993
- 1993-03-02 DE DE59304502T patent/DE59304502D1/de not_active Expired - Lifetime
- 1993-03-02 AT AT93103302T patent/ATE145399T1/de active
- 1993-03-02 ES ES93103302T patent/ES2096786T3/es not_active Expired - Lifetime
- 1993-03-02 EP EP93103302A patent/EP0560178B1/de not_active Expired - Lifetime
- 1993-03-02 DK DK93103302.1T patent/DK0560178T3/da active
- 1993-03-04 US US08/026,557 patent/US5364937A/en not_active Expired - Lifetime
- 1993-03-05 MX MX9301256A patent/MX9301256A/es unknown
- 1993-03-05 RU RU93004630A patent/RU2133246C1/ru active
- 1993-03-05 JP JP04549993A patent/JP3754460B2/ja not_active Expired - Lifetime
- 1993-03-05 BR BR9300759A patent/BR9300759A/pt not_active IP Right Cessation
- 1993-03-05 HU HU9300617A patent/HU213453B/hu not_active IP Right Cessation
- 1993-03-05 PL PL29795693A patent/PL297956A1/xx unknown
- 1993-03-05 CZ CZ93348A patent/CZ34893A3/cs unknown
- 1993-03-05 ZA ZA931586A patent/ZA931586B/xx unknown
- 1993-03-05 CA CA002091138A patent/CA2091138A1/en not_active Abandoned
- 1993-03-06 CN CN93102463A patent/CN1045205C/zh not_active Expired - Lifetime
- 1993-03-06 KR KR1019930003361A patent/KR100318190B1/ko not_active Expired - Lifetime
- 1993-03-07 IL IL104970A patent/IL104970A/xx not_active IP Right Cessation
-
1995
- 1995-05-25 US US08/450,398 patent/US5912379A/en not_active Expired - Lifetime
-
1999
- 1999-03-02 US US09/260,885 patent/US6111102A/en not_active Expired - Lifetime
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3422569A1 (en) * | 2017-06-30 | 2019-01-02 | Nxp B.V. | An amplifier circuit |
Non-Patent Citations (1)
| Title |
|---|
| Chem. Ber.96, 1963, s.56-67. * |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0560178A3 (enExample) | 1994-01-26 |
| DK0560178T3 (da) | 1997-04-14 |
| DE59304502D1 (de) | 1997-01-02 |
| US5364937A (en) | 1994-11-15 |
| US5912379A (en) | 1999-06-15 |
| MX9301256A (es) | 1993-09-01 |
| CN1076193A (zh) | 1993-09-15 |
| HUT63619A (en) | 1993-09-28 |
| CA2091138A1 (en) | 1993-09-08 |
| JPH069581A (ja) | 1994-01-18 |
| HU213453B (en) | 1997-06-30 |
| ZA931586B (en) | 1993-09-27 |
| ES2096786T3 (es) | 1997-03-16 |
| IL104970A0 (en) | 1993-07-08 |
| CZ34893A3 (en) | 1994-01-19 |
| JP3754460B2 (ja) | 2006-03-15 |
| ATE145399T1 (de) | 1996-12-15 |
| KR930019646A (ko) | 1993-10-18 |
| HU9300617D0 (en) | 1993-05-28 |
| CN1045205C (zh) | 1999-09-22 |
| KR100318190B1 (ko) | 2002-03-21 |
| PL297956A1 (en) | 1993-09-20 |
| BR9300759A (pt) | 1993-09-14 |
| IL104970A (en) | 1997-04-15 |
| US6111102A (en) | 2000-08-29 |
| EP0560178B1 (de) | 1996-11-20 |
| EP0560178A2 (de) | 1993-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4521597A (en) | Process for producing sulfonylureas having a herbicidal action | |
| EP0547035A1 (en) | Pyridinecarboxamides | |
| RU2133246C1 (ru) | Способ получения сульфонилмочевин и продукт присоединения | |
| US4546179A (en) | Process for preparing sulfonylureas | |
| US20090088571A1 (en) | Synthesis of 6,7-Dihydro-5H-imidazo[1,2-a]imidazole-3-sulfonic acid amides | |
| KR20010012732A (ko) | 구아니딘화 시약 | |
| KR20070014135A (ko) | N-([1,2,4]트리아졸로피리미딘-2-일)아릴 술폰아미드의개선된 제조 방법 | |
| US20050070593A1 (en) | Novel process for the preparation of trans-3-ethyl-2,5-dihydro-4-methyl-N-[2-[4-[[[[(4-methyl cyclohexyl) amino]carbonyl] amino]sulfonyl] phenyl]ethyl]-2-oxo-1H-pyrrole-1-carboxamide | |
| US4656273A (en) | Process for producing sulfonylureas | |
| RU2309948C2 (ru) | Метиловый эфир 4-йод-2-[n-(n-алкиламинокарбонил)аминосульфонил]-бензойной кислоты, его производные и способ их получения | |
| PL215158B1 (pl) | Sposób wytwarzania podstawionych fenylosulfonylomoczników | |
| RU2359963C2 (ru) | Производные нитросульфобензамида, способ их получения и их применение для получения производных сульфонилмочевины и их предшественников | |
| JPH0442379B2 (enExample) | ||
| RU2224750C2 (ru) | Способы получения 4,6-дизамещенных 2-изоцианатопиримидинов и их применение в качестве промежуточных продуктов для синтезов биологически активных веществ | |
| US5569761A (en) | Process for the preparation of sulfonylureas | |
| US7026477B1 (en) | Process for preparing substituted phenylsulfonylureas from sulfonyl halides | |
| CZ279743B6 (cs) | Způsob výroby N-sukcinimidylkarbonátů | |
| KR960015005B1 (ko) | 설포닐우레아 유도체의 제조방법 | |
| KR950007920B1 (ko) | 신규 4-에톡시카보닐-1-메틸피라졸-5-설폰 카바메이트 유도체 및 그의 제조방법 | |
| EP0339964B1 (en) | Improved synthesis of 4-methyl-3-thiosemicarbazide | |
| JP3117780B2 (ja) | スルホニル尿素類の製造方法 | |
| RU2177002C2 (ru) | Способ получения гербицидных сульфонилмочевин и n-(пиримидинил- или триазинил)-карбаматов в качестве промежуточных продуктов | |
| JPH05331152A (ja) | (1,3,5−トリアジン−2−イル)カルバミン酸フェニル誘導体の製造方法 | |
| NZ329428A (en) | N-phenylsuponamides and o-aminophenyl ketones as intermediates in the manufacture of sulfamoyl urea herbicides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PC43 | Official registration of the transfer of the exclusive right without contract for inventions |
Effective date: 20100609 |
|
| PC4A | Invention patent assignment |
Effective date: 20100812 |