PL92463B1 - - Google Patents
Download PDFInfo
- Publication number
- PL92463B1 PL92463B1 PL1971181167A PL18116771A PL92463B1 PL 92463 B1 PL92463 B1 PL 92463B1 PL 1971181167 A PL1971181167 A PL 1971181167A PL 18116771 A PL18116771 A PL 18116771A PL 92463 B1 PL92463 B1 PL 92463B1
- Authority
- PL
- Poland
- Prior art keywords
- azepine
- tetrahydro
- thiazolo
- prepared
- melting point
- Prior art date
Links
- -1 hexahydrobenzyl groups Chemical group 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 150000001538 azepines Chemical class 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 238000003776 cleavage reaction Methods 0.000 claims 1
- 230000007017 scission Effects 0.000 claims 1
- 238000002844 melting Methods 0.000 description 44
- 230000008018 melting Effects 0.000 description 44
- 238000000354 decomposition reaction Methods 0.000 description 31
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 230000003110 anti-inflammatory effect Effects 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 4
- 230000001624 sedative effect Effects 0.000 description 4
- 206010011224 Cough Diseases 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 230000000954 anitussive effect Effects 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000932 sedative agent Substances 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 2
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 description 2
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 2
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 230000004531 blood pressure lowering effect Effects 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 210000000548 hind-foot Anatomy 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 description 1
- PJHKXESPJOFGOA-UHFFFAOYSA-N 1h-azepine;dihydrochloride Chemical class Cl.Cl.N1C=CC=CC=C1 PJHKXESPJOFGOA-UHFFFAOYSA-N 0.000 description 1
- 125000006280 2-bromobenzyl group Chemical group [H]C1=C([H])C(Br)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical group CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- HJTPRRDDSXCLSU-UHFFFAOYSA-N 3,3a,4,5,6,7-hexahydro-2h-[1,3]thiazolo[4,5-d]azepine Chemical compound C1CNCC=C2SCNC21 HJTPRRDDSXCLSU-UHFFFAOYSA-N 0.000 description 1
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 description 1
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- CEUCVLQJAZKIJP-UHFFFAOYSA-N 6-(2-methylpropyl)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC(C)C CEUCVLQJAZKIJP-UHFFFAOYSA-N 0.000 description 1
- KGWBFSSZIQZOEV-UHFFFAOYSA-N 6-(cyclohexylmethyl)-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1CCCCC1 KGWBFSSZIQZOEV-UHFFFAOYSA-N 0.000 description 1
- QHNGFZZXGOFXPN-UHFFFAOYSA-N 6-[(4-chlorophenyl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C1CC=2SC(N)=NC=2CCN1CC1=CC=C(Cl)C=C1 QHNGFZZXGOFXPN-UHFFFAOYSA-N 0.000 description 1
- GBQLRACMWOCCOY-UHFFFAOYSA-N 6-[(4-methylphenyl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)C GBQLRACMWOCCOY-UHFFFAOYSA-N 0.000 description 1
- HERPWIXOKVOUMO-UHFFFAOYSA-N 6-[[3-(trifluoromethyl)phenyl]methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)C(F)(F)F HERPWIXOKVOUMO-UHFFFAOYSA-N 0.000 description 1
- MUXSAUXLYSCZLI-UHFFFAOYSA-N 6-[[4-(trifluoromethyl)phenyl]methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)C(F)(F)F MUXSAUXLYSCZLI-UHFFFAOYSA-N 0.000 description 1
- AMLGULYIHSPYOW-UHFFFAOYSA-N 6-[[4-(trifluoromethyl)phenyl]methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)C(F)(F)F AMLGULYIHSPYOW-UHFFFAOYSA-N 0.000 description 1
- DYAVCPODANMGPD-UHFFFAOYSA-N 6-benzyl-N-methyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound CNC=1SC=2CCN(CCC2N1)CC1=CC=CC=C1 DYAVCPODANMGPD-UHFFFAOYSA-N 0.000 description 1
- RCHRZZVXKQKIQH-UHFFFAOYSA-N 6-ethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C1CN(CC)CCC2=C1SC(N)=N2 RCHRZZVXKQKIQH-UHFFFAOYSA-N 0.000 description 1
- DAARCUOIXKLMOK-UHFFFAOYSA-N 6-ethyl-N-methyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.CNC=1SC=2CCN(CCC2N1)CC DAARCUOIXKLMOK-UHFFFAOYSA-N 0.000 description 1
- CBTKFPIEHCYQLR-UHFFFAOYSA-N 6-propan-2-yl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine dihydrochloride Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)C(C)C CBTKFPIEHCYQLR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- YMVIOJYYCBEICH-UHFFFAOYSA-N C(C)NC=1SC=2CCN(CCC2N1)CC1=CC=CC=C1 Chemical compound C(C)NC=1SC=2CCN(CCC2N1)CC1=CC=CC=C1 YMVIOJYYCBEICH-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CSDJVKBNDXZYLL-UHFFFAOYSA-N Cl.Cl.C(C)NC=1SC=2CCN(CCC2N1)CC Chemical compound Cl.Cl.C(C)NC=1SC=2CCN(CCC2N1)CC CSDJVKBNDXZYLL-UHFFFAOYSA-N 0.000 description 1
- RYWWPRHXSKUQDA-UHFFFAOYSA-N Cl.Cl.C(CC)NC=1SC=2CCN(CCC2N1)CC Chemical compound Cl.Cl.C(CC)NC=1SC=2CCN(CCC2N1)CC RYWWPRHXSKUQDA-UHFFFAOYSA-N 0.000 description 1
- UACDEVWISPJYPZ-UHFFFAOYSA-N Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)C(F)(F)F Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC(=CC=C1)C(F)(F)F UACDEVWISPJYPZ-UHFFFAOYSA-N 0.000 description 1
- MXBKKDQFRDZSSV-UHFFFAOYSA-N Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)OC Chemical compound Cl.Cl.NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)OC MXBKKDQFRDZSSV-UHFFFAOYSA-N 0.000 description 1
- 238000006228 Dieckmann condensation reaction Methods 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Natural products OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- IPCRBOOJBPETMF-UHFFFAOYSA-N N-acetylthiourea Chemical compound CC(=O)NC(N)=S IPCRBOOJBPETMF-UHFFFAOYSA-N 0.000 description 1
- 150000007945 N-acyl ureas Chemical class 0.000 description 1
- DEFQULRUMNNRKT-UHFFFAOYSA-N N-ethyl-6-propyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-amine Chemical compound C(C)NC=1SC=2CCN(CCC2N1)CCC DEFQULRUMNNRKT-UHFFFAOYSA-N 0.000 description 1
- SNLDSSYNIVAHDX-UHFFFAOYSA-N NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)F Chemical compound NC=1SC=2CCN(CCC2N1)CC1=CC=C(C=C1)F SNLDSSYNIVAHDX-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 1
- QWCKQJZIFLGMSD-UHFFFAOYSA-N alpha-aminobutyric acid Chemical class CCC(N)C(O)=O QWCKQJZIFLGMSD-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 229940124584 antitussives Drugs 0.000 description 1
- DXZDEAJXVCLRLE-UHFFFAOYSA-N azepin-2-one Chemical class O=C1C=CC=CC=N1 DXZDEAJXVCLRLE-UHFFFAOYSA-N 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 230000001914 calming effect Effects 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2040510A DE2040510C3 (de) | 1970-08-14 | 1970-08-14 | Oxazole- und Thiazole eckige Klammer auf 5,4-d] azepin- Derivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL92463B1 true PL92463B1 (en:Method) | 1977-04-30 |
Family
ID=5779804
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971181167A PL92463B1 (en:Method) | 1970-08-14 | 1971-08-13 | |
| PL1971181163A PL92458B1 (en:Method) | 1970-08-14 | 1971-08-13 | |
| PL1971181166A PL92462B1 (en:Method) | 1970-08-14 | 1971-08-13 | |
| PL1971181164A PL92460B1 (en:Method) | 1970-08-14 | 1971-08-13 | |
| PL1971181165A PL92461B1 (en:Method) | 1970-08-14 | 1971-08-13 |
Family Applications After (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971181163A PL92458B1 (en:Method) | 1970-08-14 | 1971-08-13 | |
| PL1971181166A PL92462B1 (en:Method) | 1970-08-14 | 1971-08-13 | |
| PL1971181164A PL92460B1 (en:Method) | 1970-08-14 | 1971-08-13 | |
| PL1971181165A PL92461B1 (en:Method) | 1970-08-14 | 1971-08-13 |
Country Status (8)
| Country | Link |
|---|---|
| AT (5) | AT310182B (en:Method) |
| CH (4) | CH562829A5 (en:Method) |
| DE (1) | DE2040510C3 (en:Method) |
| ES (2) | ES396452A1 (en:Method) |
| PL (5) | PL92463B1 (en:Method) |
| RO (1) | RO59322A (en:Method) |
| SU (5) | SU461507A3 (en:Method) |
| ZA (1) | ZA715393B (en:Method) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795257A (fr) * | 1972-02-10 | 1973-08-09 | Thomae Gmbh Dr K | Nouveaux oxazols |
| GB2173187B (en) * | 1985-03-23 | 1988-05-18 | Erba Farmitalia | Condensed 2-substituted thiazole derivatives |
| US4826686A (en) * | 1985-12-14 | 1989-05-02 | Boehringer Ingelheim Kg | Therapeutic system |
| DE3610388A1 (de) * | 1986-03-27 | 1987-10-01 | Bernhard Dr Wessling | Stabile elektroden auf basis makromolekularer werkstoffe und verfahren zu ihrer verwendung |
| WO2000023066A2 (en) * | 1998-10-20 | 2000-04-27 | Omeros Medical Systems, Inc. | Irrigation solution and method for inhibition of pain and inflammation |
| US7091181B2 (en) | 1994-12-12 | 2006-08-15 | Omeros Corporation | Method of inhibition of pain and inflammation during surgery comprising administration of soluble TNF receptors |
| US7973068B2 (en) | 1998-10-20 | 2011-07-05 | Omeros Corporation | Arthroscopic irrigation solution and method for peripheral vasoconstriction and inhibition of pain and inflammation |
| US20030087962A1 (en) | 1998-10-20 | 2003-05-08 | Omeros Corporation | Arthroscopic irrigation solution and method for peripheral vasoconstriction and inhibition of pain and inflammation |
| WO2014094357A1 (en) * | 2012-12-21 | 2014-06-26 | Abbvie Inc. | Heterocyclic nuclear hormone receptor modulators |
-
1970
- 1970-08-14 DE DE2040510A patent/DE2040510C3/de not_active Expired
-
1971
- 1971-08-04 RO RO70459A patent/RO59322A/ro unknown
- 1971-08-05 SU SU1896325A patent/SU461507A3/ru active
- 1971-08-05 SU SU1691527A patent/SU442601A3/ru active
- 1971-08-05 SU SU1896328A patent/SU474151A3/ru active
- 1971-08-05 SU SU1896327A patent/SU461508A3/ru active
- 1971-08-11 CH CH160075A patent/CH562829A5/xx not_active IP Right Cessation
- 1971-08-11 CH CH160175A patent/CH571009A5/xx not_active IP Right Cessation
- 1971-08-11 CH CH159975A patent/CH561730A5/xx not_active IP Right Cessation
- 1971-08-11 CH CH160275A patent/CH562830A5/xx not_active IP Right Cessation
- 1971-08-12 ZA ZA715393A patent/ZA715393B/xx unknown
- 1971-08-13 PL PL1971181167A patent/PL92463B1/pl unknown
- 1971-08-13 AT AT899472A patent/AT310182B/de active
- 1971-08-13 AT AT899172A patent/AT310180B/de active
- 1971-08-13 AT AT899272A patent/AT310181B/de active
- 1971-08-13 PL PL1971181163A patent/PL92458B1/pl unknown
- 1971-08-13 PL PL1971181166A patent/PL92462B1/pl unknown
- 1971-08-13 PL PL1971181164A patent/PL92460B1/pl unknown
- 1971-08-13 AT AT899372A patent/AT310764B/de not_active IP Right Cessation
- 1971-08-13 AT AT899072A patent/AT310179B/de active
- 1971-08-13 PL PL1971181165A patent/PL92461B1/pl unknown
- 1971-10-28 ES ES396452A patent/ES396452A1/es not_active Expired
- 1971-10-28 ES ES396451A patent/ES396451A1/es not_active Expired
-
1973
- 1973-03-20 SU SU1896326A patent/SU503526A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| CH562829A5 (en:Method) | 1975-06-13 |
| AT310180B (de) | 1973-09-25 |
| AT310182B (de) | 1973-09-25 |
| ZA715393B (en) | 1972-05-31 |
| ES396451A1 (es) | 1974-05-16 |
| AT310764B (de) | 1973-10-10 |
| SU474151A3 (ru) | 1975-06-14 |
| PL92460B1 (en:Method) | 1977-04-30 |
| PL92458B1 (en:Method) | 1977-04-30 |
| PL92462B1 (en:Method) | 1977-04-30 |
| SU461508A3 (ru) | 1975-02-25 |
| AT310179B (de) | 1973-09-25 |
| DE2040510A1 (de) | 1972-02-17 |
| SU442601A3 (ru) | 1974-09-05 |
| CH571009A5 (en:Method) | 1975-12-31 |
| AT310181B (de) | 1973-09-25 |
| CH561730A5 (en:Method) | 1975-05-15 |
| SU461507A3 (ru) | 1975-02-25 |
| PL92461B1 (en:Method) | 1977-04-30 |
| CH562830A5 (en:Method) | 1975-06-13 |
| RO59322A (en:Method) | 1976-02-15 |
| DE2040510B2 (de) | 1979-07-05 |
| SU503526A3 (ru) | 1976-02-15 |
| ES396452A1 (es) | 1974-05-16 |
| DE2040510C3 (de) | 1980-03-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7897607B2 (en) | Cyclic compounds | |
| CA1157470A (en) | Imidazo[1,2,a]pyridine derivatives useful in therapy and their preparations | |
| EP0518530B1 (en) | Improvements in or relating to excitatory amino acid receptor antagonists | |
| JPS6322075A (ja) | 1―シクロプロピル―6―フルオロ―1,4―ジヒドロ―4―オキソ―7―ピペラジノ―キノリン―3―カルボン酸類の製造方法 | |
| SK99795A3 (en) | Imidazopyrimidines, method of their preparation, treating with their contents and use | |
| PL92463B1 (en:Method) | ||
| DE2740588A1 (de) | Imidazo- eckige klammer auf 1,2-a eckige klammer zu -chinolin-2-carbon- saeuren und deren derivate sowie pharmazeutische zubereitungen, die diese verbindungen enthalten | |
| US4291036A (en) | Pyrido[1,2-A]pyrimidine derivatives and method of analgesic treatment | |
| NZ207410A (en) | Pyrazolopyridine derivatives and pharmaceutical compositions | |
| NO129745B (en:Method) | ||
| JPH0311067A (ja) | 興奮性アミノ酸拮抗剤 | |
| US3790573A (en) | Imidazo and pyrimido(2,1-b)quinazolines | |
| CA2108800A1 (en) | Substituted (pyridinylamino)-benzisoxazoles and -benzoisothiazoles, a process for their preparation and their use as medicaments | |
| EP0180318B1 (en) | Amide derivatives | |
| HUT72666A (en) | 5,6-dihydro-4h-imidazo[2',1':2,3]imidazo[4,5,1-ij]quinoline and 4,5-dihydroimidazo[1,2-a]pyrrolo[1,2,3-cd]benzimidazol derivatives, process for producing them and pharmaceutical composition containing them | |
| US4187306A (en) | Benzodiazepine-diones, a process for their production and their use as medicaments | |
| DD253821A5 (de) | Verfahren zur herstellung von pyrrolo-benzimidozolen, pyrrolo-benzooxazolen und pyrrolo-benzthiozole | |
| US4797403A (en) | Quinazolinediones and pyridopyrimidinediones | |
| HUT50477A (en) | Process for producing tricyclic condensed pyrimidine derivatives and pharmaceutical compositions comprising such compounds | |
| EP0076035B1 (en) | Pyrazolo(3,4-b)pyridine derivatives | |
| US3745216A (en) | Compositions and methods for producing hypotensive activity with imidazo and pyrimido(2,1-b)quinazoline compounds | |
| US3859291A (en) | 9-(p-anisidino)-7-methyl-(1h)-pyrazolo(3,4-f)quinoline | |
| Maryanoff et al. | Azepinoindole derivatives with high affinity for brain dopamine and serotonin receptors | |
| US3423412A (en) | Benzopyrroloquinazolinones | |
| CS241026B2 (en) | Method of pyrazolo(1,5-c)-quinozoline derivatives production |