PL83191B1 - - Google Patents
Download PDFInfo
- Publication number
- PL83191B1 PL83191B1 PL1971146335A PL14633571A PL83191B1 PL 83191 B1 PL83191 B1 PL 83191B1 PL 1971146335 A PL1971146335 A PL 1971146335A PL 14633571 A PL14633571 A PL 14633571A PL 83191 B1 PL83191 B1 PL 83191B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- so3h
- group
- och3
- amino
- Prior art date
Links
- 239000000975 dye Substances 0.000 claims description 34
- 238000000034 method Methods 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- -1 alkoxy radicals Chemical class 0.000 claims description 11
- 238000005859 coupling reaction Methods 0.000 claims description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- 230000008878 coupling Effects 0.000 claims description 9
- 238000010168 coupling process Methods 0.000 claims description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 7
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- FAOJNWOJCPKVTM-UHFFFAOYSA-N 2-methoxynaphthalen-1-amine Chemical compound C1=CC=CC2=C(N)C(OC)=CC=C21 FAOJNWOJCPKVTM-UHFFFAOYSA-N 0.000 claims description 5
- OXQJOAGKNHVOAI-UHFFFAOYSA-N 5-amino-6-methoxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=C(N)C(OC)=CC=C21 OXQJOAGKNHVOAI-UHFFFAOYSA-N 0.000 claims description 5
- 125000004442 acylamino group Chemical group 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 4
- 239000000835 fiber Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 150000001448 anilines Chemical class 0.000 claims description 3
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229910006069 SO3H Inorganic materials 0.000 claims 17
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims 12
- 101100483630 Arabidopsis thaliana UCH3 gene Proteins 0.000 claims 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 claims 1
- 150000003871 sulfonates Chemical class 0.000 claims 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 9
- 210000002268 wool Anatomy 0.000 description 8
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical group OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 238000004043 dyeing Methods 0.000 description 5
- 230000002349 favourable effect Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 125000001174 sulfone group Chemical group 0.000 description 3
- VMSLCPKYRPDHLN-UHFFFAOYSA-N (R)-Humulone Chemical compound CC(C)CC(=O)C1=C(O)C(CC=C(C)C)=C(O)C(O)(CC=C(C)C)C1=O VMSLCPKYRPDHLN-UHFFFAOYSA-N 0.000 description 2
- NBCOZXBHPKSFSA-UHFFFAOYSA-N 2,4-dichloro-6-methyl-5-nitropyrimidine Chemical compound CC1=NC(Cl)=NC(Cl)=C1[N+]([O-])=O NBCOZXBHPKSFSA-UHFFFAOYSA-N 0.000 description 2
- OBCQPUSRAUNDAB-UHFFFAOYSA-N 2-bromoprop-2-enoyl chloride Chemical compound ClC(=O)C(Br)=C OBCQPUSRAUNDAB-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- IAMALOVTVCLUKP-IHWYPQMZSA-N (z)-2-chlorobut-2-enoyl chloride Chemical compound C\C=C(/Cl)C(Cl)=O IAMALOVTVCLUKP-IHWYPQMZSA-N 0.000 description 1
- IHCXLFVGVATAND-UHFFFAOYSA-N 1,4-dichloro-2h-phthalazine-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)(Cl)NN=C(Cl)C2=C1 IHCXLFVGVATAND-UHFFFAOYSA-N 0.000 description 1
- WSYWQFNIYCGPFK-UHFFFAOYSA-N 1-(2,4,6-trichloropyrimidin-5-yl)ethanone Chemical compound CC(=O)C1=C(Cl)N=C(Cl)N=C1Cl WSYWQFNIYCGPFK-UHFFFAOYSA-N 0.000 description 1
- CBMYGMRLSCLFPD-UHFFFAOYSA-N 1-(3-amino-4-ethoxyphenyl)ethanone Chemical compound CCOC1=CC=C(C(C)=O)C=C1N CBMYGMRLSCLFPD-UHFFFAOYSA-N 0.000 description 1
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 1
- KESAPMAPWGLLQL-UHFFFAOYSA-N 2,2,3,3-tetrafluorocyclobutane-1-carbonyl chloride Chemical compound FC1(F)CC(C(Cl)=O)C1(F)F KESAPMAPWGLLQL-UHFFFAOYSA-N 0.000 description 1
- BCOSEZGCLGPUSL-UHFFFAOYSA-N 2,3,3-trichloroprop-2-enoyl chloride Chemical compound ClC(Cl)=C(Cl)C(Cl)=O BCOSEZGCLGPUSL-UHFFFAOYSA-N 0.000 description 1
- FYSHPROTETTWKB-UHFFFAOYSA-N 2,4,5,6-tetrabromopyrimidine Chemical compound BrC1=NC(Br)=C(Br)C(Br)=N1 FYSHPROTETTWKB-UHFFFAOYSA-N 0.000 description 1
- FFIYVIOYHWWVFY-UHFFFAOYSA-N 2,4,5,6-tetrachloro-1h-pyridazine Chemical compound ClN1NC(Cl)=C(Cl)C(Cl)=C1 FFIYVIOYHWWVFY-UHFFFAOYSA-N 0.000 description 1
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 description 1
- KZMWBUVUQLGBBP-UHFFFAOYSA-N 2,4,5,6-tetrafluoropyrimidine Chemical compound FC1=NC(F)=C(F)C(F)=N1 KZMWBUVUQLGBBP-UHFFFAOYSA-N 0.000 description 1
- IUFVGONBAUNAOT-UHFFFAOYSA-N 2,4,5-trichloro-6-methylpyrimidine Chemical compound CC1=NC(Cl)=NC(Cl)=C1Cl IUFVGONBAUNAOT-UHFFFAOYSA-N 0.000 description 1
- GIKMWFAAEIACRF-UHFFFAOYSA-N 2,4,5-trichloropyrimidine Chemical compound ClC1=NC=C(Cl)C(Cl)=N1 GIKMWFAAEIACRF-UHFFFAOYSA-N 0.000 description 1
- LYBDHGMSPQBSNW-UHFFFAOYSA-N 2,4,5-trifluoropyrimidine Chemical compound FC1=NC=C(F)C(F)=N1 LYBDHGMSPQBSNW-UHFFFAOYSA-N 0.000 description 1
- QGFWFWSBFMRDNP-UHFFFAOYSA-N 2,4,6-trichloro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(Cl)N=C(Cl)N=C1Cl QGFWFWSBFMRDNP-UHFFFAOYSA-N 0.000 description 1
- IAJCAZVXGKGAQK-UHFFFAOYSA-N 2,4,6-trichloropyrimidine-5-carbonitrile Chemical compound ClC1=NC(Cl)=C(C#N)C(Cl)=N1 IAJCAZVXGKGAQK-UHFFFAOYSA-N 0.000 description 1
- RXAURVMWXQUURQ-UHFFFAOYSA-N 2,4,6-tris(methylsulfonyl)-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 RXAURVMWXQUURQ-UHFFFAOYSA-N 0.000 description 1
- UYIYVVDCJJPRAT-UHFFFAOYSA-N 2,4-dibromo-5-(bromomethyl)-6-methylpyrimidine Chemical compound CC1=NC(Br)=NC(Br)=C1CBr UYIYVVDCJJPRAT-UHFFFAOYSA-N 0.000 description 1
- OASGOHGVLUSVBZ-UHFFFAOYSA-N 2,4-dibromo-5-(bromomethyl)pyrimidine Chemical compound BrCC1=CN=C(Br)N=C1Br OASGOHGVLUSVBZ-UHFFFAOYSA-N 0.000 description 1
- AOEHEEBFRCAFGC-UHFFFAOYSA-N 2,4-dibromopyrimidine Chemical compound BrC1=CC=NC(Br)=N1 AOEHEEBFRCAFGC-UHFFFAOYSA-N 0.000 description 1
- LGHNAWJLGALXRN-UHFFFAOYSA-N 2,4-dichloro-1H-quinazoline-2-carboxylic acid Chemical compound C1=CC=C2C(Cl)=NC(C(=O)O)(Cl)NC2=C1 LGHNAWJLGALXRN-UHFFFAOYSA-N 0.000 description 1
- XPHHRYQLVDQYDR-UHFFFAOYSA-N 2,4-dichloro-5-(chloromethyl)-6-methylpyrimidine Chemical compound CC1=NC(Cl)=NC(Cl)=C1CCl XPHHRYQLVDQYDR-UHFFFAOYSA-N 0.000 description 1
- HSYWYCGJNMVGKA-UHFFFAOYSA-N 2,4-dichloro-6-(trichloromethyl)pyrimidine Chemical compound ClC1=CC(C(Cl)(Cl)Cl)=NC(Cl)=N1 HSYWYCGJNMVGKA-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- BHKZJIBMUGCBNJ-UHFFFAOYSA-N 2,4-dichloropyrimidine-5-sulfonic acid Chemical compound OS(=O)(=O)C1=CN=C(Cl)N=C1Cl BHKZJIBMUGCBNJ-UHFFFAOYSA-N 0.000 description 1
- YSKSNCNLMXAQLP-UHFFFAOYSA-N 2,6-bis(methylsulfonyl)pyridine-4-carbonyl chloride Chemical compound CS(=O)(=O)C1=CC(C(Cl)=O)=CC(S(C)(=O)=O)=N1 YSKSNCNLMXAQLP-UHFFFAOYSA-N 0.000 description 1
- NUYJCMGJLNVOML-UHFFFAOYSA-N 2,6-dichloropyrimidine-4-carbonyl chloride Chemical compound ClC(=O)C1=CC(Cl)=NC(Cl)=N1 NUYJCMGJLNVOML-UHFFFAOYSA-N 0.000 description 1
- GRGSHONWRKRWGP-UHFFFAOYSA-N 2-amino-4-sulfobenzoic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1C(O)=O GRGSHONWRKRWGP-UHFFFAOYSA-N 0.000 description 1
- MJNYPLCGWXFYPD-UHFFFAOYSA-N 2-amino-5-sulfobenzoic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1C(O)=O MJNYPLCGWXFYPD-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical class NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- GWIAAIUASRVOIA-UHFFFAOYSA-N 2-aminonaphthalene-1-sulfonic acid Chemical class C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 GWIAAIUASRVOIA-UHFFFAOYSA-N 0.000 description 1
- SYZRZLUNWVNNNV-UHFFFAOYSA-N 2-bromoacetyl chloride Chemical compound ClC(=O)CBr SYZRZLUNWVNNNV-UHFFFAOYSA-N 0.000 description 1
- HMENQNSSJFLQOP-UHFFFAOYSA-N 2-bromoprop-2-enoic acid Chemical class OC(=O)C(Br)=C HMENQNSSJFLQOP-UHFFFAOYSA-N 0.000 description 1
- NFIGVDJXMRCMOA-UHFFFAOYSA-N 2-chloro-1,3-benzothiazole-6-carbonyl chloride Chemical compound ClC(=O)C1=CC=C2N=C(Cl)SC2=C1 NFIGVDJXMRCMOA-UHFFFAOYSA-N 0.000 description 1
- YITWLIVLXWIUKF-UHFFFAOYSA-N 2-chloro-3h-1,3-benzothiazole-2-carbonyl chloride Chemical class C1=CC=C2SC(C(=O)Cl)(Cl)NC2=C1 YITWLIVLXWIUKF-UHFFFAOYSA-N 0.000 description 1
- WXOKMMPZBQJDNF-UHFFFAOYSA-N 2-chloro-3h-1,3-benzoxazole-2-carbonyl chloride Chemical class C1=CC=C2OC(C(=O)Cl)(Cl)NC2=C1 WXOKMMPZBQJDNF-UHFFFAOYSA-N 0.000 description 1
- SZTBMYHIYNGYIA-UHFFFAOYSA-N 2-chloroacrylic acid Chemical compound OC(=O)C(Cl)=C SZTBMYHIYNGYIA-UHFFFAOYSA-N 0.000 description 1
- SCDKUQBOSDILAR-UHFFFAOYSA-N 2-methoxy-5-phenoxyaniline Chemical compound C1=C(N)C(OC)=CC=C1OC1=CC=CC=C1 SCDKUQBOSDILAR-UHFFFAOYSA-N 0.000 description 1
- AXXYMKMFXNCXGM-UHFFFAOYSA-N 2-propoxyaniline Chemical compound CCCOC1=CC=CC=C1N AXXYMKMFXNCXGM-UHFFFAOYSA-N 0.000 description 1
- GFUOUWSNGFXKIY-UHFFFAOYSA-N 3,3-dibromoprop-2-enoyl chloride Chemical compound ClC(=O)C=C(Br)Br GFUOUWSNGFXKIY-UHFFFAOYSA-N 0.000 description 1
- XTKMAPVHLBPKPE-UHFFFAOYSA-N 3,4,5,6-tetrachloropyridazine Chemical compound ClC1=NN=C(Cl)C(Cl)=C1Cl XTKMAPVHLBPKPE-UHFFFAOYSA-N 0.000 description 1
- UGKIAJNNQAMSHX-UHFFFAOYSA-N 3,6-dichloropyridazine-4-carbonyl chloride Chemical compound ClC(=O)C1=CC(Cl)=NN=C1Cl UGKIAJNNQAMSHX-UHFFFAOYSA-N 0.000 description 1
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 1
- CXJAFLQWMOMYOW-UHFFFAOYSA-N 3-chlorofuran-2,5-dione Chemical compound ClC1=CC(=O)OC1=O CXJAFLQWMOMYOW-UHFFFAOYSA-N 0.000 description 1
- NZXOCWXWWQNPOF-UHFFFAOYSA-N 4,5-dichloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1Cl NZXOCWXWWQNPOF-UHFFFAOYSA-N 0.000 description 1
- SJCTXIKOXTUQHC-UHFFFAOYSA-N 4-amino-2,5-dichlorobenzenesulfonic acid Chemical compound NC1=CC(Cl)=C(S(O)(=O)=O)C=C1Cl SJCTXIKOXTUQHC-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- NDYYJXGERWTRSD-UHFFFAOYSA-N 4-aminonaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 NDYYJXGERWTRSD-UHFFFAOYSA-N 0.000 description 1
- RPKWNMFDAOACCX-UHFFFAOYSA-N 4-chloro-3-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 RPKWNMFDAOACCX-UHFFFAOYSA-N 0.000 description 1
- OLOLDTJCNAOMQJ-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=CC(Cl)=NC(S(C)(=O)=O)=N1 OLOLDTJCNAOMQJ-UHFFFAOYSA-N 0.000 description 1
- RJWBTWIBUIGANW-UHFFFAOYSA-N 4-chlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-N 0.000 description 1
- GKTWIIVEUYLSCS-UHFFFAOYSA-N 5-bromo-2,4,6-trichloropyrimidine Chemical compound ClC1=NC(Cl)=C(Br)C(Cl)=N1 GKTWIIVEUYLSCS-UHFFFAOYSA-N 0.000 description 1
- GOYNRDSJTYLXBU-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Cl)C(F)=N1 GOYNRDSJTYLXBU-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- FCMIDLUGAKOJNR-UHFFFAOYSA-N 5-chloro-4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=C1Cl FCMIDLUGAKOJNR-UHFFFAOYSA-N 0.000 description 1
- VDBJCDWTNCKRTF-UHFFFAOYSA-N 6'-hydroxyspiro[2-benzofuran-3,9'-9ah-xanthene]-1,3'-dione Chemical compound O1C(=O)C2=CC=CC=C2C21C1C=CC(=O)C=C1OC1=CC(O)=CC=C21 VDBJCDWTNCKRTF-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- HYZNAKZLQTZMDK-UHFFFAOYSA-N C=C(C(CC1)(C1(F)F)F)C(Cl)=O Chemical compound C=C(C(CC1)(C1(F)F)F)C(Cl)=O HYZNAKZLQTZMDK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- ATMLPEJAVWINOF-UHFFFAOYSA-N acrylic acid acrylic acid Chemical compound OC(=O)C=C.OC(=O)C=C ATMLPEJAVWINOF-UHFFFAOYSA-N 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical group OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- VSANMHWDSONVEE-UHFFFAOYSA-N carbyl sulfate Chemical compound O=S1(=O)CCOS(=O)(=O)O1 VSANMHWDSONVEE-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 150000005694 halopyrimidines Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- MKJZRZRIEWBTMN-UHFFFAOYSA-N prop-2-ynoyl chloride Chemical compound ClC(=O)C#C MKJZRZRIEWBTMN-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
- C09B62/008—Monoazo dyes
- C09B62/0081—Monoazo dyes with coupling components containing an amino directing group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH247870A CH562866A5 (en:Method) | 1970-02-20 | 1970-02-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL83191B1 true PL83191B1 (en:Method) | 1975-12-31 |
Family
ID=4234697
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971146335A PL83191B1 (en:Method) | 1970-02-20 | 1971-02-18 |
Country Status (10)
| Country | Link |
|---|---|
| BE (1) | BE763183A (en:Method) |
| BR (1) | BR7101149D0 (en:Method) |
| CH (1) | CH562866A5 (en:Method) |
| CS (1) | CS170167B2 (en:Method) |
| DE (1) | DE2107427C2 (en:Method) |
| FR (1) | FR2078723A5 (en:Method) |
| GB (1) | GB1340016A (en:Method) |
| NL (1) | NL7102269A (en:Method) |
| PL (1) | PL83191B1 (en:Method) |
| ZA (1) | ZA71981B (en:Method) |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1143176A (fr) * | 1954-11-29 | 1957-09-27 | Ici Ltd | Matières colorantes monoazoïques nouvelles |
| FR1184700A (fr) * | 1956-09-14 | 1959-07-24 | Ciba Geigy | Nouveaux colorants azoïques, leur préparation et leurs emplois |
| DE1079757B (de) * | 1957-03-07 | 1960-04-14 | Ciba Geigy | Verfahren zur Herstellung von Azofarbstoffen |
| FR1225282A (fr) * | 1958-05-23 | 1960-06-30 | Geigy Ag J R | Colorants azoïques réactifs, leur procédé de préparation et leurs applications |
| FR1312636A (fr) * | 1961-11-24 | 1962-12-21 | Ici Ltd | Nouveaux colorants pour matières textiles |
| FR1403165A (fr) * | 1963-06-10 | 1965-06-18 | Hoechst Ag | Colorants organiques et leur procédé de préparation |
| FR1432259A (fr) * | 1964-05-05 | 1966-03-18 | Cassella Farbwerke Mainkur Ag | Nouveaux colorants organiques solubles dans l'eau et leur préparation |
| FR1467293A (fr) * | 1964-12-28 | 1967-01-27 | Bayer Ag | Colorants réactifs et procédé de fabrication et application |
| DE1644203B2 (de) * | 1967-03-25 | 1977-11-17 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
-
1970
- 1970-02-20 CH CH247870A patent/CH562866A5/xx not_active IP Right Cessation
-
1971
- 1971-02-16 ZA ZA710981A patent/ZA71981B/xx unknown
- 1971-02-16 DE DE2107427A patent/DE2107427C2/de not_active Expired
- 1971-02-17 FR FR7105412A patent/FR2078723A5/fr not_active Expired
- 1971-02-18 PL PL1971146335A patent/PL83191B1/pl unknown
- 1971-02-19 CS CS1285A patent/CS170167B2/cs unknown
- 1971-02-19 BR BR1149/71A patent/BR7101149D0/pt unknown
- 1971-02-19 NL NL7102269A patent/NL7102269A/xx unknown
- 1971-02-19 BE BE763183A patent/BE763183A/xx unknown
- 1971-04-19 GB GB2212771A patent/GB1340016A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CS170167B2 (en:Method) | 1976-08-27 |
| ZA71981B (en) | 1971-10-27 |
| DE2107427A1 (de) | 1971-09-02 |
| FR2078723A5 (en:Method) | 1971-11-05 |
| BE763183A (fr) | 1971-08-19 |
| BR7101149D0 (pt) | 1973-03-13 |
| GB1340016A (en) | 1973-12-05 |
| CH562866A5 (en:Method) | 1975-06-13 |
| NL7102269A (en:Method) | 1971-08-24 |
| DE2107427C2 (de) | 1982-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6147177B2 (en:Method) | ||
| JPS61233063A (ja) | 反応性アゾ染料 | |
| DE2238795A1 (de) | Azoverbindungen, deren herstellung und verwendung | |
| DE2331518A1 (de) | Neue farbstoffe, deren herstellung und verwendung | |
| PL83191B1 (en:Method) | ||
| US3197456A (en) | Azo-dyestuffs | |
| GB2271776A (en) | Fibre-reactive azo dyestuffs | |
| CH366611A (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE2141453A1 (de) | Azoverbindungen, deren Herstellung und Verwendung | |
| DE2201030A1 (de) | Azofarbstoffe,deren Herstellung und Verwendung | |
| JPH0247162A (ja) | アゾ染料、その製造方法およびその用法 | |
| JPH07331100A (ja) | 新規な反応性染料、それらの製造およびそれらの使用 | |
| CS197332B2 (en) | Process for preparing monoazodyes | |
| US3966704A (en) | Naphthylazo naphthyl copper complex dyestuffs | |
| JPH03190971A (ja) | アゾ染料 | |
| DE1937361A1 (de) | Azofarbstoffe | |
| DE2450884A1 (de) | Neue metallkomplexfarbstoffe, deren herstellung und verwendung | |
| JPH0273868A (ja) | 水容性の繊維反応性染料、その製法及び用途 | |
| US2384751A (en) | Monoazo acid dyestuffs | |
| CS259897B2 (en) | Method of reactive dye stuffs production | |
| US4039528A (en) | Sulphonic acid-, hydroxy-substituted phenyl azo-naphthyl azo-N-aryl amino dyes | |
| JPH02269774A (ja) | 水溶性の繊維反応性染料、その製法及び用途 | |
| DE1644374B1 (de) | Verfahren zur Herstellung von Reaktivfarbstoffen | |
| US1688044A (en) | Monazo dyes from pyrazolones and aminobenzene-polysulphonic acids | |
| CH450594A (de) | Verfahren zur Herstellung von neuen Metallkomplexen von Bis- und Polyazoverbindungen |