PL83152B1 - Process for preparing pentacyclic alkaloids[us3770724a] - Google Patents
Process for preparing pentacyclic alkaloids[us3770724a] Download PDFInfo
- Publication number
- PL83152B1 PL83152B1 PL1971147087A PL14708771A PL83152B1 PL 83152 B1 PL83152 B1 PL 83152B1 PL 1971147087 A PL1971147087 A PL 1971147087A PL 14708771 A PL14708771 A PL 14708771A PL 83152 B1 PL83152 B1 PL 83152B1
- Authority
- PL
- Poland
- Prior art keywords
- ethyl
- quinolysine
- cis
- compound
- reacted
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 14
- 229930013930 alkaloid Natural products 0.000 title claims description 5
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical class C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 claims abstract description 74
- 150000001875 compounds Chemical class 0.000 claims abstract description 71
- 238000000034 method Methods 0.000 claims abstract description 47
- -1 alkali metal methoxide Chemical class 0.000 claims abstract description 24
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 11
- 239000002585 base Substances 0.000 claims abstract description 10
- 230000003287 optical effect Effects 0.000 claims abstract description 6
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 claims description 46
- 229960002726 vincamine Drugs 0.000 claims description 41
- 238000002360 preparation method Methods 0.000 claims description 28
- 239000003795 chemical substances by application Substances 0.000 claims description 22
- 239000003153 chemical reaction reagent Substances 0.000 claims description 15
- 230000015572 biosynthetic process Effects 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 150000002923 oximes Chemical class 0.000 claims description 9
- 150000002576 ketones Chemical class 0.000 claims description 8
- 150000003951 lactams Chemical class 0.000 claims description 8
- 238000007127 saponification reaction Methods 0.000 claims description 8
- 238000000926 separation method Methods 0.000 claims description 8
- 238000003776 cleavage reaction Methods 0.000 claims description 7
- 230000007017 scission Effects 0.000 claims description 7
- 230000032050 esterification Effects 0.000 claims description 6
- 238000005886 esterification reaction Methods 0.000 claims description 6
- 230000001172 regenerating effect Effects 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 150000004702 methyl esters Chemical class 0.000 claims description 4
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims description 4
- 125000005594 diketone group Chemical group 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- VVCMGAUPZIKYTH-VGHSCWAPSA-N 2-acetyloxybenzoic acid;[(2s,3r)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate;1,3,7-trimethylpurine-2,6-dione Chemical class CC(=O)OC1=CC=CC=C1C(O)=O.CN1C(=O)N(C)C(=O)C2=C1N=CN2C.C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 VVCMGAUPZIKYTH-VGHSCWAPSA-N 0.000 claims 1
- WYFCZWSWFGJODV-MIANJLSGSA-N 4-[[(1s)-2-[(e)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(4-methyl-2-oxopiperazin-1-yl)-3,4-dihydro-1h-isoquinoline-1-carbonyl]amino]benzoic acid Chemical compound O=C1CN(C)CCN1C1=CC=CC2=C1CCN(C(=O)\C=C\C=1C(=CC=C(Cl)C=1F)N1N=NN=C1)[C@@H]2C(=O)NC1=CC=C(C(O)=O)C=C1 WYFCZWSWFGJODV-MIANJLSGSA-N 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 13
- 239000000543 intermediate Substances 0.000 abstract description 10
- 230000008569 process Effects 0.000 abstract description 10
- 150000003839 salts Chemical class 0.000 abstract description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 5
- 229910052717 sulfur Inorganic materials 0.000 abstract description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 60
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- 239000000243 solution Substances 0.000 description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 35
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 33
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- 238000002844 melting Methods 0.000 description 22
- 230000008018 melting Effects 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 235000019441 ethanol Nutrition 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- 239000002244 precipitate Substances 0.000 description 20
- 239000000047 product Substances 0.000 description 17
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 16
- 229910052708 sodium Inorganic materials 0.000 description 16
- 239000011734 sodium Substances 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 238000004458 analytical method Methods 0.000 description 14
- 239000012074 organic phase Substances 0.000 description 14
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 11
- 238000002329 infrared spectrum Methods 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 239000012299 nitrogen atmosphere Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 238000002211 ultraviolet spectrum Methods 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 5
- 239000007868 Raney catalyst Substances 0.000 description 5
- 229910000564 Raney nickel Inorganic materials 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- APJYDQYYACXCRM-UHFFFAOYSA-N tryptamine Chemical compound C1=CC=C2C(CCN)=CNC2=C1 APJYDQYYACXCRM-UHFFFAOYSA-N 0.000 description 4
- KWGRBVOPPLSCSI-PSASIEDQSA-N (1s,2r)-2-(methylamino)-1-phenylpropan-1-ol Chemical compound CN[C@H](C)[C@@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-PSASIEDQSA-N 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000002983 circular dichroism Methods 0.000 description 3
- 229950011119 eburnamonine Drugs 0.000 description 3
- 229960002179 ephedrine Drugs 0.000 description 3
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical group C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- JOOXCMJARBKPKM-UHFFFAOYSA-N 4-oxopentanoic acid Chemical compound CC(=O)CCC(O)=O JOOXCMJARBKPKM-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- UXMCFEBDJVHVNH-HOJAQTOUSA-N ac1l52id Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(O)=O)N5C2=C1 UXMCFEBDJVHVNH-HOJAQTOUSA-N 0.000 description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 2
- 229910001863 barium hydroxide Inorganic materials 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 210000005013 brain tissue Anatomy 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 2
- 238000006477 desulfuration reaction Methods 0.000 description 2
- 230000023556 desulfurization Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 238000000053 physical method Methods 0.000 description 2
- 239000012451 post-reaction mixture Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 230000017105 transposition Effects 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical group CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- HSUXNTJPIWXSEQ-UHFFFAOYSA-N C=1C=CC=CC=1C(C=1C=CC=CC=1)([Na])C1=CC=CC=C1 Chemical class C=1C=CC=CC=1C(C=1C=CC=CC=1)([Na])C1=CC=CC=C1 HSUXNTJPIWXSEQ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- CMEWLCATCRTSGF-UHFFFAOYSA-N N,N-dimethyl-4-nitrosoaniline Chemical compound CN(C)C1=CC=C(N=O)C=C1 CMEWLCATCRTSGF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241000511964 Tabernaemontana Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000003443 Unconsciousness Diseases 0.000 description 1
- 241000863480 Vinca Species 0.000 description 1
- 241000863486 Vinca minor Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- DCBDOYDVQJVXOH-UHFFFAOYSA-N azane;1h-indole Chemical compound N.C1=CC=C2NC=CC2=C1 DCBDOYDVQJVXOH-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 1
- KMPWYEUPVWOPIM-LSOMNZGLSA-N cinchonine Chemical compound C1=CC=C2C([C@@H]([C@H]3N4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-LSOMNZGLSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000004455 differential thermal analysis Methods 0.000 description 1
- ASURECOXOZVQDX-UHFFFAOYSA-N dimethyl 4-ethyl-4-formylheptanedioate Chemical compound COC(=O)CCC(CC)(CCC(=O)OC)C=O ASURECOXOZVQDX-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 125000002587 enol group Chemical group 0.000 description 1
- OHDZSMOOVOPGAC-UHFFFAOYSA-N ethyl 1-ethyl-2-oxocyclopentane-1-carboxylate Chemical compound CCOC(=O)C1(CC)CCCC1=O OHDZSMOOVOPGAC-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229940040102 levulinic acid Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 210000003625 skull Anatomy 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 230000008733 trauma Effects 0.000 description 1
- 208000009999 tuberous sclerosis Diseases 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D461/00—Heterocyclic compounds containing indolo [3,2,1-d,e] pyrido [3,2,1,j] [1,5]-naphthyridine ring systems, e.g. vincamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7011406A FR2081593A1 (en) | 1970-03-31 | 1970-03-31 | Vincamine process |
| FR7032889A FR2104959A2 (en) | 1970-09-10 | 1970-09-10 | Vincamine process |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL83152B1 true PL83152B1 (en) | 1975-12-31 |
Family
ID=26215644
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971147087A PL83152B1 (en) | 1970-03-31 | 1971-03-23 | Process for preparing pentacyclic alkaloids[us3770724a] |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3770724A (Direct) |
| JP (3) | JPS5144960B1 (Direct) |
| AT (1) | AT309699B (Direct) |
| BE (1) | BE765006A (Direct) |
| CA (1) | CA937570A (Direct) |
| CH (1) | CH546777A (Direct) |
| DE (3) | DE2167044C2 (Direct) |
| DK (1) | DK149345C (Direct) |
| GB (3) | GB1351261A (Direct) |
| HU (1) | HU163769B (Direct) |
| IL (1) | IL36474A (Direct) |
| IT (1) | IT8048032A0 (Direct) |
| NL (1) | NL158497B (Direct) |
| PL (1) | PL83152B1 (Direct) |
| SE (2) | SE390414B (Direct) |
| SU (1) | SU505365A3 (Direct) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL153199B (nl) * | 1971-10-25 | 1977-05-16 | Omnium Chimique Sa | Werkwijze voor de bereiding van esters van vincaminezuur, alsmede werkwijze voor de bereiding van een geneesmiddel dat een dergelijke ester bevat en gevormd geneesmiddel dat aldus is verkregen. |
| CH578001A5 (Direct) * | 1972-04-14 | 1976-07-30 | Sandoz Ag | |
| FR2179620B1 (Direct) * | 1972-04-14 | 1975-12-26 | Roussel Uclaf | |
| US4033969A (en) * | 1972-06-19 | 1977-07-05 | Agence Nationale De Valorisation De La Recherche (Anvar) | Vincamine derivatives |
| FR2259612B1 (Direct) * | 1974-01-31 | 1977-09-09 | Synthelabo | |
| CH625239A5 (Direct) * | 1974-08-09 | 1981-09-15 | Buskine Sa | |
| JPS536264U (Direct) * | 1976-06-30 | 1978-01-20 | ||
| HU174502B (hu) * | 1976-12-30 | 1980-01-28 | Richter Gedeon Vegyeszet | Sposob poluchenija novykh proizvodnykh oktagidro-indolo/2,3-a/-khinolizina |
| US4315011A (en) * | 1978-07-12 | 1982-02-09 | Richter Gedeon Vegyeszeti Gyar Rt. | 1-Alkyl-9-bromohexahydroindolo quinolizium salts and use thereof to increase blood flow |
| US4428877A (en) | 1978-07-12 | 1984-01-31 | Richter Gedeon Vegyeszeti Gyar Rt. | Cis-10-bromo-E-homoeburnanes |
| FR2445328A1 (fr) * | 1978-07-12 | 1980-07-25 | Richter Gedeon Vegyeszet | Derives du 14-oxo-e-homo-eburnane, leur procede de preparation et leur utilisation comme medicament |
| AU532001B2 (en) * | 1978-11-20 | 1983-09-15 | Sumitomo Chemical Company, Limited | Polycyclic indole derivatives |
| US4316028A (en) * | 1978-11-20 | 1982-02-16 | Sumitomo Chemical Company, Limited | Process for producing eburnane derivatives |
| HU179292B (en) * | 1978-12-01 | 1982-09-28 | Richter Gedeon Vegyeszet | Process for preparing ester derivatives of apovincaminic acid |
| HU180928B (en) * | 1979-08-06 | 1983-05-30 | Richter Gedeon Vegyeszet | Process for preparing new brominated 15-hydroxy-e-homo-eburane derivatives |
| HU181496B (en) * | 1979-08-13 | 1983-07-28 | Richter Gedeon Vegyeszet | Process for preparing 10-bromo-15-hydroxy-e-homo-eburnanes |
| JPS5689589U (Direct) * | 1979-12-13 | 1981-07-17 | ||
| JPS5693693U (Direct) * | 1979-12-14 | 1981-07-25 | ||
| HU185305B (en) * | 1981-08-23 | 1985-01-28 | Richter Gedeon Vegyeszet | Process for preparing vincine and apovincine |
| HU183234B (en) * | 1980-10-17 | 1984-04-28 | Richter Gedeon Vegyeszet | Process for the enantioselective synthesis of optically active cys-14-oxo-e-homo-eburnan |
| HU182411B (en) * | 1981-11-03 | 1984-01-30 | Richter Gedeon Vegyeszet | Process for preparing eburnamonine derivatives |
| HU186891B (en) * | 1981-06-12 | 1985-10-28 | Richter Gedeon Vegyeszet | Process for producing esters of apovincaminic acid |
| HU182380B (en) * | 1981-09-30 | 1983-12-28 | Richter Gedeon Vegyeszet | Process for producing esters of vincaminic acid |
| JPS59258U (ja) * | 1982-06-24 | 1984-01-05 | 日本ピラ−工業株式会社 | 平板形電子管式表示装置 |
| HU187139B (en) * | 1982-06-30 | 1985-11-28 | Richter Gedeon Vegyeszet | Process for preparing new eburnan derivatives |
| HU187140B (en) * | 1982-06-30 | 1985-11-28 | Richter Gedeon Vegyeszet | Process for preparing new aburnan-oxima ethers |
| HU187733B (en) * | 1982-06-30 | 1986-02-28 | Richter Gedeon Vegyeszeti Gyar Rt,Hu | Process for preparing apovincaminic acid derivatives |
| JPS6032240A (ja) * | 1983-07-30 | 1985-02-19 | Sony Corp | 螢光表示装置 |
| JP3835763B2 (ja) | 2002-08-19 | 2006-10-18 | ファイザー・プロダクツ・インク | 増殖亢進疾患のための組み合わせ治療 |
| US7741317B2 (en) | 2005-10-21 | 2010-06-22 | Bristol-Myers Squibb Company | LXR modulators |
| US7888376B2 (en) | 2005-11-23 | 2011-02-15 | Bristol-Myers Squibb Company | Heterocyclic CETP inhibitors |
| ATE547394T1 (de) | 2006-12-01 | 2012-03-15 | Bristol Myers Squibb Co | N-((3-benzyl)-2,2-(bis-phenyl)-propan-1- aminderivate als cetp-hemmer für die behandlung von atherosklerose und herz-kreislauf- erkrankungen |
| JP2016516804A (ja) | 2013-04-17 | 2016-06-09 | ファイザー・インク | 心血管疾患を治療するためのn−ピペリジン−3−イルベンズアミド誘導体 |
| WO2016055901A1 (en) | 2014-10-08 | 2016-04-14 | Pfizer Inc. | Substituted amide compounds |
| HRP20241674T1 (hr) | 2019-01-18 | 2025-02-14 | Astrazeneca Ab | 6'-[[(1s,3s)-3-[[5-(difluormetoksi)-2-pirimidinil]amino]ciklopentil]amino][1(2h),3'-bipiridin]-2-on kao inhibitor pcsk9 i postupci njegove upotrebe |
| CN111205288B (zh) * | 2020-02-19 | 2021-03-30 | 四川大学 | 一种(1S,12bS)内酰胺酯化合物的合成方法 |
-
1971
- 1971-03-22 US US00126929A patent/US3770724A/en not_active Expired - Lifetime
- 1971-03-23 CH CH422071A patent/CH546777A/fr not_active IP Right Cessation
- 1971-03-23 IL IL36474A patent/IL36474A/xx unknown
- 1971-03-23 PL PL1971147087A patent/PL83152B1/pl unknown
- 1971-03-25 HU HURO609A patent/HU163769B/hu unknown
- 1971-03-30 BE BE765006A patent/BE765006A/xx not_active IP Right Cessation
- 1971-03-30 SU SU711633905A patent/SU505365A3/ru active
- 1971-03-30 CA CA109157A patent/CA937570A/en not_active Expired
- 1971-03-31 DE DE2167044A patent/DE2167044C2/de not_active Expired
- 1971-03-31 DE DE19712167043 patent/DE2167043A1/de not_active Ceased
- 1971-03-31 DK DK153171A patent/DK149345C/da not_active IP Right Cessation
- 1971-03-31 SE SE7405749A patent/SE390414B/xx not_active IP Right Cessation
- 1971-03-31 DE DE2115718A patent/DE2115718C3/de not_active Expired
- 1971-03-31 SE SE7104214A patent/SE386179B/xx unknown
- 1971-03-31 JP JP46018828A patent/JPS5144960B1/ja active Pending
- 1971-03-31 AT ATA2739/71A patent/AT309699B/de not_active IP Right Cessation
- 1971-03-31 NL NL7104275.A patent/NL158497B/xx not_active IP Right Cessation
- 1971-04-19 GB GB2578671*A patent/GB1351261A/en not_active Expired
- 1971-04-19 GB GB2578671*A patent/GB1351262A/en not_active Expired
- 1971-04-19 GB GB2578671*A patent/GB1351263A/en not_active Expired
-
1975
- 1975-10-15 JP JP12333275A patent/JPS5337360B2/ja not_active Expired
- 1975-10-15 JP JP50123333A patent/JPS5227160B2/ja not_active Expired
-
1980
- 1980-02-28 IT IT8048032A patent/IT8048032A0/it unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1351261A (en) | 1974-04-24 |
| JPS5144960B1 (Direct) | 1976-12-01 |
| JPS5227160B2 (Direct) | 1977-07-19 |
| NL7104275A (Direct) | 1971-10-04 |
| JPS5337360B2 (Direct) | 1978-10-07 |
| DK149345C (da) | 1986-10-13 |
| DE2167043A1 (de) | 1977-10-13 |
| DE2115718B2 (de) | 1978-11-02 |
| HU163769B (Direct) | 1973-10-27 |
| CH546777A (fr) | 1974-03-15 |
| DE2167044A1 (de) | 1977-11-10 |
| IT8048032A0 (it) | 1980-02-28 |
| NL158497B (nl) | 1978-11-15 |
| GB1351262A (en) | 1974-04-24 |
| US3770724A (en) | 1973-11-06 |
| JPS5163197A (Direct) | 1976-06-01 |
| DE2115718A1 (de) | 1971-10-14 |
| DE2115718C3 (de) | 1979-07-19 |
| SE390414B (sv) | 1976-12-20 |
| DE2167044C2 (de) | 1983-07-14 |
| BE765006A (fr) | 1971-09-30 |
| IL36474A (en) | 1975-08-31 |
| JPS5163198A (Direct) | 1976-06-01 |
| IL36474A0 (en) | 1971-05-26 |
| GB1351263A (en) | 1974-04-24 |
| AT309699B (de) | 1973-07-15 |
| CA937570A (en) | 1973-11-27 |
| SE386179B (sv) | 1976-08-02 |
| SU505365A3 (ru) | 1976-02-28 |
| DK149345B (da) | 1986-05-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL83152B1 (en) | Process for preparing pentacyclic alkaloids[us3770724a] | |
| Bawdekar et al. | Terpenoids—LXVIII: Structure and absolute configuration of costic acid—a new sesquiterpenic acid from costus root oil | |
| US4992561A (en) | Simple conversion of artemisinic acid into artemisinin | |
| SU843749A3 (ru) | Способ получени 4а,9в-транс- гЕКСАгидРО- -КАРбОлиНА | |
| SU1055333A3 (ru) | Способ получени алкалоидов типа лейрозина или их кислых аддитивных солей | |
| US3976641A (en) | Cephalosporin intermediates and process therefor | |
| SU612632A3 (ru) | Способ получени индольных алкалоидов и их 16-эпимеров | |
| US7442809B2 (en) | Method for producing 1,3-dioxolan-4,6-dione compound | |
| Frenette et al. | Stereoselective reduction of. gamma.-oxobenzenebutanoic acids | |
| SU576951A3 (ru) | Способ получени производных лейрозина или их солей | |
| Taguchi et al. | Thermal Behavior of dl-trans-and dl-cis-2-Iodo-N, N-dimethylcyclohexylamines1 | |
| Panetta et al. | Trichloroacetylation of dipeptides by hexachloroacetone in dimethyl sulfoxide under neutral conditions | |
| US3124587A (en) | Process for the production of pyrtooxal- | |
| US4162255A (en) | Process for extracting aristolochic acids | |
| Grunewald et al. | Synthesis of bridgehead hydroxyl-substituted benzobicyclo [3.2. 1] octenes and-octadienes via an acyloin rearrangement in the benzobicyclo [2.2. 2] octene ring system | |
| Meinwald et al. | D-nor steroids. VI. Stereochemical effects on carbonium ion reactions of C/D cis D-nor steroids | |
| CA1112241A (en) | Process for the rearrangement of 10,11-epoxy-10,11- dihydro-5h-dibenz¬b,f|azepine-5-carboxamide to 10- oxo-10,11-dihydro-5h-dibenz¬b,f|azepine-5- carboxamide | |
| US3950345A (en) | Process for the preparation of cis-vincamine | |
| US2947757A (en) | Process for preparing 5-hydroxy-tryptamine through new intermediates | |
| EP0009290B1 (en) | 3-azabicyclo(3.1.0)hexane derivatives and process for their preparation | |
| CA2425014A1 (en) | Processes for the production of methyl dithiocarbazinate | |
| US3047578A (en) | Substituted reserpine and process of making the same | |
| US3331868A (en) | A-nor-b-norsteroids and intermediates | |
| US3969404A (en) | Process for preparation of 2-methoxy-3,6-dichloro-benzoic acid | |
| US2990407A (en) | Co cha |