PL76345B1 - - Google Patents
Download PDFInfo
- Publication number
- PL76345B1 PL76345B1 PL14621971A PL14621971A PL76345B1 PL 76345 B1 PL76345 B1 PL 76345B1 PL 14621971 A PL14621971 A PL 14621971A PL 14621971 A PL14621971 A PL 14621971A PL 76345 B1 PL76345 B1 PL 76345B1
- Authority
- PL
- Poland
- Prior art keywords
- oxime
- group
- alcohol
- aldehyde
- dioxane
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 13
- 150000002923 oximes Chemical class 0.000 claims description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 claims description 6
- 150000005045 1,10-phenanthrolines Chemical class 0.000 claims description 5
- 125000003172 aldehyde group Chemical group 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000003544 oxime group Chemical group 0.000 claims description 3
- -1 methoxyl group Chemical group 0.000 claims description 2
- 235000019441 ethanol Nutrition 0.000 description 9
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000003385 bacteriostatic effect Effects 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- SURLLZFZRLZTBI-UHFFFAOYSA-N 1,10-phenanthroline-2-carbaldehyde Chemical compound C1=CN=C2C3=NC(C=O)=CC=C3C=CC2=C1 SURLLZFZRLZTBI-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
Landscapes
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL14621971A PL76345B1 (https=) | 1971-02-13 | 1971-02-13 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL14621971A PL76345B1 (https=) | 1971-02-13 | 1971-02-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL76345B1 true PL76345B1 (https=) | 1975-06-30 |
Family
ID=19953473
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL14621971A PL76345B1 (https=) | 1971-02-13 | 1971-02-13 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL76345B1 (https=) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP2002863A1 (en) * | 2007-06-11 | 2008-12-17 | Noscira, S.A. | [1,10]-phenanthroline derivatives for the treatment of neurodegenerative or haematological diseases |
| EP2196466A1 (en) | 2008-12-10 | 2010-06-16 | Noscira, S.A. | Triple substituted phenanthroline derivatives for the treatment of neurodegenerative or heamatological diseases or conditions |
-
1971
- 1971-02-13 PL PL14621971A patent/PL76345B1/pl unknown
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP2002863A1 (en) * | 2007-06-11 | 2008-12-17 | Noscira, S.A. | [1,10]-phenanthroline derivatives for the treatment of neurodegenerative or haematological diseases |
| WO2008152068A3 (en) * | 2007-06-11 | 2009-05-07 | Noscira Sa | [1,10]-phenanthroline derivatives for the treatment of neurodegenerative or haematological diseases |
| US8592446B2 (en) | 2007-06-11 | 2013-11-26 | Noscira, S.A. | [1,10]-phenanthroline derivatives for the treatment of neurodegenerative or haematological diseases |
| EP2196466A1 (en) | 2008-12-10 | 2010-06-16 | Noscira, S.A. | Triple substituted phenanthroline derivatives for the treatment of neurodegenerative or heamatological diseases or conditions |
| US20110306631A1 (en) * | 2008-12-10 | 2011-12-15 | Noscira, S.A. | Triple substituted phenanthroline derivatives for the treatment of neurodegenerative or haematological diseases or conditions, or cancer |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU503521A3 (ru) | Способ получени производных морфолина | |
| PL76345B1 (https=) | ||
| SU488408A3 (ru) | Способ получени замещенных 3-(2-4фенил-1-пиперазинил-этил)-индолинов или их солей, или их четвертичных аммониевых солей | |
| SE439482B (sv) | Sett att framstella p-hydroxifenylglycin | |
| Essery et al. | Penicillin sulfoxides | |
| JP2532121B2 (ja) | ヒドロキシフェネチルアミン誘導体 | |
| US3088947A (en) | Benzoylcarbinol-aminoacetates | |
| US1051578A (en) | 3.4-dioxyphenylglyoxims and process of preparing same. | |
| SU432718A3 (ru) | Способ получения2-замещенных производных1-циннамилбензимидазола | |
| US3210348A (en) | 6h-6-trichloromethylmercapto-dibenzo[c, e][1, 2]thiazine 5, 5-dioxide compounds | |
| SU384331A1 (ru) | Способ получени 1-замещенных карбамоил-4(2-оксиарил)-семинарбазидов | |
| DE1121052B (de) | Verfahren zur Herstellung von 4, 5-substituierten 2-Amino-oxazolen | |
| SU117044A1 (ru) | Способ получени 1-фенил-2, 3 диметил-4-диметиламинопиразолона-5 (пирамидона) | |
| SU644375A3 (ru) | Способ получени 3-цианамидо4-трифторметил-2,6-динитроанилинов или их основных солей | |
| SU469702A1 (ru) | Способ получени производных 4-нитро-5-арил-1,2,3-триазола | |
| AT206440B (de) | Verfahren zur Herstellung von neuen Piperidyl-(2)-phenylmethanol-Derivaten | |
| SU724510A1 (ru) | Способ очистки 2,7-диаминодифениленсульфона | |
| NO122348B (https=) | ||
| SU93725A1 (ru) | Способ получени полиметиновых красителей (7-алкоксиродакарбоцианинов) | |
| AT206899B (de) | Verfahren zur Herstellung von neuen, substituierten 3,5-Dioxo-tetrahydro-1,2,6-thiadiazin-1,1-dioxyden | |
| SU598560A3 (ru) | Способ получени замещенных 2-хлор-4-алкиламино-6цианоалкиламино-1,3,5триазинов | |
| SU279622A1 (ru) | Способ получени 3-(5"-нитро-2"-фурфурилиденамино)-2-оксазолидона(фуразолидона) | |
| SU596587A1 (ru) | Способ получени 8-азакофеина | |
| DE1470283C (de) | l-Methyl-5-sulfanilamido-pyridazon-(6)-derivate | |
| SU93461A1 (ru) | Способ получени четвертичных солей 2(4)-бета-алкокси- или аралкоксивинильных производных азотистых гетероциклических оснований |