PL115792B1 - Insecticide - Google Patents
Insecticide Download PDFInfo
- Publication number
- PL115792B1 PL115792B1 PL1979216907A PL21690779A PL115792B1 PL 115792 B1 PL115792 B1 PL 115792B1 PL 1979216907 A PL1979216907 A PL 1979216907A PL 21690779 A PL21690779 A PL 21690779A PL 115792 B1 PL115792 B1 PL 115792B1
- Authority
- PL
- Poland
- Prior art keywords
- group
- phenyl
- carbon atoms
- urea
- halogen
- Prior art date
Links
- 239000002917 insecticide Substances 0.000 title claims description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 204
- 125000004432 carbon atom Chemical group C* 0.000 claims description 72
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 70
- 150000001875 compounds Chemical class 0.000 claims description 68
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- 125000005843 halogen group Chemical group 0.000 claims description 26
- -1 hydroxyimino Chemical group 0.000 claims description 25
- 229910052736 halogen Inorganic materials 0.000 claims description 24
- 239000003795 chemical substances by application Substances 0.000 claims description 22
- 150000002367 halogens Chemical group 0.000 claims description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 18
- 125000003342 alkenyl group Chemical group 0.000 claims description 15
- 125000001424 substituent group Chemical group 0.000 claims description 14
- 125000000304 alkynyl group Chemical group 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 239000004480 active ingredient Substances 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 6
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims description 5
- 125000001118 alkylidene group Chemical group 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- 150000003672 ureas Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004450 alkenylene group Chemical group 0.000 claims description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000000676 alkoxyimino group Chemical group 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000001072 heteroaryl group Chemical group 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 3
- ZBJJDYGJCNTNTH-UHFFFAOYSA-N Betahistine mesilate Chemical group CS(O)(=O)=O.CS(O)(=O)=O.CNCCC1=CC=CC=N1 ZBJJDYGJCNTNTH-UHFFFAOYSA-N 0.000 claims description 2
- 125000005277 alkyl imino group Chemical group 0.000 claims description 2
- 150000002466 imines Chemical class 0.000 claims description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims 1
- 239000004202 carbamide Substances 0.000 description 108
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 57
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- 238000002844 melting Methods 0.000 description 21
- 230000008018 melting Effects 0.000 description 21
- 239000000203 mixture Substances 0.000 description 20
- 239000013543 active substance Substances 0.000 description 19
- 239000000243 solution Substances 0.000 description 18
- 239000002904 solvent Substances 0.000 description 16
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- 230000000749 insecticidal effect Effects 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 241000238631 Hexapoda Species 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 239000004166 Lanolin Substances 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 229940039717 lanolin Drugs 0.000 description 5
- 235000019388 lanolin Nutrition 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 241000255925 Diptera Species 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 4
- 241000255969 Pieris brassicae Species 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000007900 aqueous suspension Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 230000000361 pesticidal effect Effects 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000002441 reversible effect Effects 0.000 description 3
- 239000000779 smoke Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- AVQOJMPSFFAARV-UHFFFAOYSA-N 2-bromo-n-[[4-(1-phenylethoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)OC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Br AVQOJMPSFFAARV-UHFFFAOYSA-N 0.000 description 2
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000254173 Coleoptera Species 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 231100000674 Phytotoxicity Toxicity 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 229960000892 attapulgite Drugs 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000005549 heteroarylene group Chemical group 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 2
- 229910052625 palygorskite Inorganic materials 0.000 description 2
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- 150000003606 tin compounds Chemical class 0.000 description 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- CRRUGYDDEMGVDY-UHFFFAOYSA-N 1-bromoethylbenzene Chemical compound CC(Br)C1=CC=CC=C1 CRRUGYDDEMGVDY-UHFFFAOYSA-N 0.000 description 1
- IXHUMNSUBIAWOS-UHFFFAOYSA-N 1-bromoheptylbenzene Chemical compound CCCCCCC(Br)C1=CC=CC=C1 IXHUMNSUBIAWOS-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- WCXOTZMTAOJBEM-UHFFFAOYSA-N 2,6-dichloro-n-[(4-hydroxyphenyl)carbamoyl]benzamide Chemical compound C1=CC(O)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl WCXOTZMTAOJBEM-UHFFFAOYSA-N 0.000 description 1
- RXEFAZTXJLGKBT-UHFFFAOYSA-N 2,6-dichloro-n-[[4-[(4-chlorophenyl)methoxy]phenyl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1COC(C=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl RXEFAZTXJLGKBT-UHFFFAOYSA-N 0.000 description 1
- CAZJNJNFIHYFAH-UHFFFAOYSA-N 2,6-difluoro-N-[[4-(thiophen-2-ylmethylsulfanyl)phenyl]carbamoyl]benzamide Chemical compound FC1=C(C(=O)NC(=O)NC2=CC=C(C=C2)SCC=2SC=CC=2)C(=CC=C1)F CAZJNJNFIHYFAH-UHFFFAOYSA-N 0.000 description 1
- REEAEKGJGVSAHM-UHFFFAOYSA-N 2,6-difluoro-n-[(3-methyl-4-phenylmethoxyphenyl)carbamoyl]benzamide Chemical compound C=1C=C(OCC=2C=CC=CC=2)C(C)=CC=1NC(=O)NC(=O)C1=C(F)C=CC=C1F REEAEKGJGVSAHM-UHFFFAOYSA-N 0.000 description 1
- IYEKVWVDGMIYIV-UHFFFAOYSA-N 2,6-difluoro-n-[(4-phenylmethoxyphenyl)carbamoyl]benzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1)=CC=C1OCC1=CC=CC=C1 IYEKVWVDGMIYIV-UHFFFAOYSA-N 0.000 description 1
- QHYWLFZCXUCJQI-UHFFFAOYSA-N 2,6-difluoro-n-[[3-methyl-4-(1-phenylethoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)OC(C(=C1)C)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F QHYWLFZCXUCJQI-UHFFFAOYSA-N 0.000 description 1
- SFVWTVDANSZENQ-UHFFFAOYSA-N 2,6-difluoro-n-[[3-methyl-4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]carbamoyl]benzamide Chemical compound C=1C=C(OCC=2C=CC(OC(F)(F)F)=CC=2)C(C)=CC=1NC(=O)NC(=O)C1=C(F)C=CC=C1F SFVWTVDANSZENQ-UHFFFAOYSA-N 0.000 description 1
- CTDZIEJVANGEAT-UHFFFAOYSA-N 2,6-difluoro-n-[[4-(1-phenylbutan-2-yloxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=C(NC(=O)NC(=O)C=2C(=CC=CC=2F)F)C=CC=1OC(CC)CC1=CC=CC=C1 CTDZIEJVANGEAT-UHFFFAOYSA-N 0.000 description 1
- LMVZHOCDLRRLFB-UHFFFAOYSA-N 2,6-difluoro-n-[[4-(1-phenylcyclohexyl)oxyphenyl]carbamoyl]benzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1)=CC=C1OC1(C=2C=CC=CC=2)CCCCC1 LMVZHOCDLRRLFB-UHFFFAOYSA-N 0.000 description 1
- SCLVKDHFLFUBKJ-UHFFFAOYSA-N 2,6-difluoro-n-[[4-(1-phenylethoxy)phenyl]carbamothioyl]benzenecarbothioamide Chemical compound C=1C=CC=CC=1C(C)OC(C=C1)=CC=C1NC(=S)NC(=S)C1=C(F)C=CC=C1F SCLVKDHFLFUBKJ-UHFFFAOYSA-N 0.000 description 1
- KFVDUBADHUIKII-UHFFFAOYSA-N 2,6-difluoro-n-[[4-(1-phenylpropoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(CC)OC(C=C1)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F KFVDUBADHUIKII-UHFFFAOYSA-N 0.000 description 1
- AZGZXNYNEXYTIG-UHFFFAOYSA-N 2,6-difluoro-n-[[4-(2,2,2-trifluoro-1-phenylethoxy)phenyl]carbamoyl]benzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1)=CC=C1OC(C(F)(F)F)C1=CC=CC=C1 AZGZXNYNEXYTIG-UHFFFAOYSA-N 0.000 description 1
- MJZHVMNUKOTQQF-UHFFFAOYSA-N 2,6-difluoro-n-[[4-(2-hydroxy-1-phenylpropoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C(O)C)OC(C=C1)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F MJZHVMNUKOTQQF-UHFFFAOYSA-N 0.000 description 1
- IZZIYCQKEHRDNN-UHFFFAOYSA-N 2,6-difluoro-n-[[4-(3-phenylpropoxy)phenyl]carbamoyl]benzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1)=CC=C1OCCCC1=CC=CC=C1 IZZIYCQKEHRDNN-UHFFFAOYSA-N 0.000 description 1
- MWGAQKDAYJNOKE-UHFFFAOYSA-N 2,6-difluoro-n-[[4-(thiophen-2-ylmethoxy)phenyl]carbamoyl]benzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1)=CC=C1OCC1=CC=CS1 MWGAQKDAYJNOKE-UHFFFAOYSA-N 0.000 description 1
- YUKYPAOZCNNOQS-UHFFFAOYSA-N 2,6-difluoro-n-[[4-[(4-fluorophenyl)methoxy]phenyl]carbamoyl]benzamide Chemical compound C1=CC(F)=CC=C1COC(C=C1)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F YUKYPAOZCNNOQS-UHFFFAOYSA-N 0.000 description 1
- JBJQYFQYHJRZOE-UHFFFAOYSA-N 2,6-difluoro-n-[[4-phenylmethoxy-3-(trifluoromethyl)phenyl]carbamoyl]benzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1C(F)(F)F)=CC=C1OCC1=CC=CC=C1 JBJQYFQYHJRZOE-UHFFFAOYSA-N 0.000 description 1
- YTOPFCCWCSOHFV-UHFFFAOYSA-N 2,6-dimethyl-4-tridecylmorpholine Chemical compound CCCCCCCCCCCCCN1CC(C)OC(C)C1 YTOPFCCWCSOHFV-UHFFFAOYSA-N 0.000 description 1
- NZUXRGMXFCTGBV-UHFFFAOYSA-N 2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical compound C1CC=CC2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)C21 NZUXRGMXFCTGBV-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- UPTVJAJPBGIRLZ-UHFFFAOYSA-N 2-(trichloromethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical compound C1CC=CC2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C21 UPTVJAJPBGIRLZ-UHFFFAOYSA-N 0.000 description 1
- NHNAEZDWNCRWRW-UHFFFAOYSA-N 2-bromobenzamide Chemical compound NC(=O)C1=CC=CC=C1Br NHNAEZDWNCRWRW-UHFFFAOYSA-N 0.000 description 1
- ROAYZGRQSMUXRN-UHFFFAOYSA-N 2-chloro-n-[(3,5-dichloro-4-phenylmethoxyphenyl)carbamoyl]benzamide Chemical compound ClC1=CC=CC=C1C(=O)NC(=O)NC(C=C1Cl)=CC(Cl)=C1OCC1=CC=CC=C1 ROAYZGRQSMUXRN-UHFFFAOYSA-N 0.000 description 1
- BRXYAJOBNXFMEF-UHFFFAOYSA-N 2-chloro-n-[(3,5-dimethyl-4-phenylmethoxyphenyl)carbamoyl]benzamide Chemical compound C=1C(C)=C(OCC=2C=CC=CC=2)C(C)=CC=1NC(=O)NC(=O)C1=CC=CC=C1Cl BRXYAJOBNXFMEF-UHFFFAOYSA-N 0.000 description 1
- YVMAUXVJAGQSSX-UHFFFAOYSA-N 2-chloro-n-[(3-chloro-4-phenylmethoxyphenyl)carbamoyl]benzamide Chemical compound C=1C=C(OCC=2C=CC=CC=2)C(Cl)=CC=1NC(=O)NC(=O)C1=CC=CC=C1Cl YVMAUXVJAGQSSX-UHFFFAOYSA-N 0.000 description 1
- UTLZHTBFJMFHID-UHFFFAOYSA-N 2-chloro-n-[(4-phenylmethoxyphenyl)carbamoyl]benzamide Chemical compound ClC1=CC=CC=C1C(=O)NC(=O)NC(C=C1)=CC=C1OCC1=CC=CC=C1 UTLZHTBFJMFHID-UHFFFAOYSA-N 0.000 description 1
- WTQQZYNTJWHAEA-UHFFFAOYSA-N 2-chloro-n-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1COC(C(=C1)Cl)=C(Cl)C=C1NC(=O)NC(=O)C1=CC=CC=C1Cl WTQQZYNTJWHAEA-UHFFFAOYSA-N 0.000 description 1
- SFGLQGSKIMQBBU-UHFFFAOYSA-N 2-chloro-n-[[3,5-dichloro-4-[(4-cyanophenyl)methoxy]phenyl]carbamoyl]benzamide Chemical compound ClC1=CC=CC=C1C(=O)NC(=O)NC(C=C1Cl)=CC(Cl)=C1OCC1=CC=C(C#N)C=C1 SFGLQGSKIMQBBU-UHFFFAOYSA-N 0.000 description 1
- PJCYLIVXGZSHIG-UHFFFAOYSA-N 2-chloro-n-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]carbamoyl]benzamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(C(=C1)Cl)=C(Cl)C=C1NC(=O)NC(=O)C1=CC=CC=C1Cl PJCYLIVXGZSHIG-UHFFFAOYSA-N 0.000 description 1
- OMCYVUYRAXTZHT-UHFFFAOYSA-N 2-chloro-n-[[3-chloro-4-(1-phenylethoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)OC(C(=C1)Cl)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl OMCYVUYRAXTZHT-UHFFFAOYSA-N 0.000 description 1
- CSZFOKSASKYSDM-UHFFFAOYSA-N 2-chloro-n-[[3-chloro-4-(1-phenylethylsulfanyl)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)SC(C(=C1)Cl)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl CSZFOKSASKYSDM-UHFFFAOYSA-N 0.000 description 1
- FIDCXDFVQUBEFS-UHFFFAOYSA-N 2-chloro-n-[[3-chloro-4-(thiophen-2-ylmethoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=C(OCC=2SC=CC=2)C(Cl)=CC=1NC(=O)NC(=O)C1=CC=CC=C1Cl FIDCXDFVQUBEFS-UHFFFAOYSA-N 0.000 description 1
- JAJPZVLVSHYCOQ-UHFFFAOYSA-N 2-chloro-n-[[3-chloro-4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]carbamoyl]benzamide Chemical compound C1=CC(OC(F)(F)F)=CC=C1COC(C(=C1)Cl)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl JAJPZVLVSHYCOQ-UHFFFAOYSA-N 0.000 description 1
- QCTGTDPBHBMIOZ-UHFFFAOYSA-N 2-chloro-n-[[3-methyl-4-(1-phenylethoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)OC(C(=C1)C)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl QCTGTDPBHBMIOZ-UHFFFAOYSA-N 0.000 description 1
- ZIOUORAQMGXYNH-UHFFFAOYSA-N 2-chloro-n-[[3-methyl-4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]carbamoyl]benzamide Chemical compound C=1C=C(OCC=2C=CC(OC(F)(F)F)=CC=2)C(C)=CC=1NC(=O)NC(=O)C1=CC=CC=C1Cl ZIOUORAQMGXYNH-UHFFFAOYSA-N 0.000 description 1
- GQRHSCYBOUAVFU-UHFFFAOYSA-N 2-chloro-n-[[4-(1-phenylbutan-2-yloxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=C(NC(=O)NC(=O)C=2C(=CC=CC=2)Cl)C=CC=1OC(CC)CC1=CC=CC=C1 GQRHSCYBOUAVFU-UHFFFAOYSA-N 0.000 description 1
- XWDVVBMEAWFJQU-UHFFFAOYSA-N 2-chloro-n-[[4-(1-phenylethoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)OC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl XWDVVBMEAWFJQU-UHFFFAOYSA-N 0.000 description 1
- QOSQJSZKYILAFT-UHFFFAOYSA-N 2-chloro-n-[[4-(1-phenylheptoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(CCCCCC)OC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl QOSQJSZKYILAFT-UHFFFAOYSA-N 0.000 description 1
- XGKLHVZDRKRSKW-UHFFFAOYSA-N 2-chloro-n-[[4-(2-hydroxy-1-phenylpropoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C(O)C)OC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl XGKLHVZDRKRSKW-UHFFFAOYSA-N 0.000 description 1
- BVEUHOOECXMGPE-UHFFFAOYSA-N 2-chloro-n-[[4-(2-phenylpropoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)COC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl BVEUHOOECXMGPE-UHFFFAOYSA-N 0.000 description 1
- AHZHHWJHUMRYIL-UHFFFAOYSA-N 2-chloro-n-[[4-(pyridin-3-ylmethyl)phenyl]carbamoyl]benzamide Chemical compound ClC1=CC=CC=C1C(=O)NC(=O)NC(C=C1)=CC=C1CC1=CC=CN=C1 AHZHHWJHUMRYIL-UHFFFAOYSA-N 0.000 description 1
- CUFPHDHKGCPEKE-UHFFFAOYSA-N 2-chloro-n-[[4-(thiophen-2-ylmethoxy)phenyl]carbamoyl]benzamide Chemical compound ClC1=CC=CC=C1C(=O)NC(=O)NC(C=C1)=CC=C1OCC1=CC=CS1 CUFPHDHKGCPEKE-UHFFFAOYSA-N 0.000 description 1
- HSIYQEDVZVEQLZ-UHFFFAOYSA-N 2-chloro-n-[[4-(thiophen-2-ylmethylsulfanyl)phenyl]carbamoyl]benzamide Chemical compound ClC1=CC=CC=C1C(=O)NC(=O)NC(C=C1)=CC=C1SCC1=CC=CS1 HSIYQEDVZVEQLZ-UHFFFAOYSA-N 0.000 description 1
- XGFKHQSVKKZOPF-UHFFFAOYSA-N 2-chloro-n-[[4-[(4-chlorophenyl)methoxy]-3,5-dimethylphenyl]carbamoyl]benzamide Chemical compound C=1C(C)=C(OCC=2C=CC(Cl)=CC=2)C(C)=CC=1NC(=O)NC(=O)C1=CC=CC=C1Cl XGFKHQSVKKZOPF-UHFFFAOYSA-N 0.000 description 1
- FMLZWDZWFBDTJQ-UHFFFAOYSA-N 2-chloro-n-[[4-[(4-chlorophenyl)methoxy]-3-methylphenyl]carbamoyl]benzamide Chemical compound C=1C=C(OCC=2C=CC(Cl)=CC=2)C(C)=CC=1NC(=O)NC(=O)C1=CC=CC=C1Cl FMLZWDZWFBDTJQ-UHFFFAOYSA-N 0.000 description 1
- LOAQIZKGQYAUET-UHFFFAOYSA-N 2-chloro-n-[[4-[(4-chlorophenyl)methoxy]phenyl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1COC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl LOAQIZKGQYAUET-UHFFFAOYSA-N 0.000 description 1
- IXPXXIRRGBWCRX-UHFFFAOYSA-N 2-chloro-n-[[4-[(4-cyanophenyl)methoxy]phenyl]carbamoyl]benzamide Chemical compound ClC1=CC=CC=C1C(=O)NC(=O)NC(C=C1)=CC=C1OCC1=CC=C(C#N)C=C1 IXPXXIRRGBWCRX-UHFFFAOYSA-N 0.000 description 1
- QDOQBUFDQRUSRL-UHFFFAOYSA-N 2-chloro-n-[[4-[(4-fluorophenyl)methoxy]phenyl]carbamoyl]benzamide Chemical compound C1=CC(F)=CC=C1COC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl QDOQBUFDQRUSRL-UHFFFAOYSA-N 0.000 description 1
- RECYDMWNFGSHBN-UHFFFAOYSA-N 2-chloro-n-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]carbamoyl]benzamide Chemical compound C1=CC(OC(F)(F)F)=CC=C1COC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl RECYDMWNFGSHBN-UHFFFAOYSA-N 0.000 description 1
- UNACTDLGYRQXGM-UHFFFAOYSA-N 2-chloro-n-[[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]carbamoyl]benzamide Chemical compound C1=CC(C(F)(F)F)=CC=C1COC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl UNACTDLGYRQXGM-UHFFFAOYSA-N 0.000 description 1
- ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 2-chlorobenzoyl isocyanate Chemical compound ClC1=CC=CC=C1C(=O)N=C=O ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 0.000 description 1
- JJMGRLVCTXXSGL-UHFFFAOYSA-N 2-ethylsulfanylethylsulfanyl-dihydroxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCSCCSP(O)(O)=S JJMGRLVCTXXSGL-UHFFFAOYSA-N 0.000 description 1
- XZALZJSNGIXJKK-UHFFFAOYSA-N 2-methyl-n-[(3-methyl-4-phenylmethoxyphenyl)carbamoyl]benzamide Chemical compound C=1C=C(OCC=2C=CC=CC=2)C(C)=CC=1NC(=O)NC(=O)C1=CC=CC=C1C XZALZJSNGIXJKK-UHFFFAOYSA-N 0.000 description 1
- XTRHUTRHYQKGGF-UHFFFAOYSA-N 2-methyl-n-[[3-methyl-4-(1-phenylethoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)OC(C(=C1)C)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1C XTRHUTRHYQKGGF-UHFFFAOYSA-N 0.000 description 1
- QXIHVNJNRSMVLC-UHFFFAOYSA-N 2-methyl-n-[[4-(1-phenylcyclohexyl)oxyphenyl]carbamoyl]benzamide Chemical compound CC1=CC=CC=C1C(=O)NC(=O)NC(C=C1)=CC=C1OC1(C=2C=CC=CC=2)CCCCC1 QXIHVNJNRSMVLC-UHFFFAOYSA-N 0.000 description 1
- UAJLZHFNDRQDGX-UHFFFAOYSA-N 2-methyl-n-[[4-(1-phenylethoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)OC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1C UAJLZHFNDRQDGX-UHFFFAOYSA-N 0.000 description 1
- PAYDXABKPDIPTA-UHFFFAOYSA-N 2-methyl-n-[[4-(2-phenylpropoxy)phenyl]carbamoyl]benzamide Chemical compound C=1C=CC=CC=1C(C)COC(C=C1)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1C PAYDXABKPDIPTA-UHFFFAOYSA-N 0.000 description 1
- MXAKIMGSDYJBCD-UHFFFAOYSA-N 2-methyl-n-[[4-(pyridin-3-ylmethyl)phenyl]carbamoyl]benzamide Chemical compound CC1=CC=CC=C1C(=O)NC(=O)NC(C=C1)=CC=C1CC1=CC=CN=C1 MXAKIMGSDYJBCD-UHFFFAOYSA-N 0.000 description 1
- IMBUMQRARFNHQJ-UHFFFAOYSA-N 2-methyl-n-[[4-(thiophen-2-ylmethoxy)phenyl]carbamoyl]benzamide Chemical compound CC1=CC=CC=C1C(=O)NC(=O)NC(C=C1)=CC=C1OCC1=CC=CS1 IMBUMQRARFNHQJ-UHFFFAOYSA-N 0.000 description 1
- ZXJKGDJCDACTST-UHFFFAOYSA-N 2-methyl-n-[[4-phenylmethoxy-3-(trifluoromethyl)phenyl]carbamoyl]benzamide Chemical compound CC1=CC=CC=C1C(=O)NC(=O)NC(C=C1C(F)(F)F)=CC=C1OCC1=CC=CC=C1 ZXJKGDJCDACTST-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- QYAODHFJFSYEMK-UHFFFAOYSA-N 4-(1-phenylethoxy)aniline Chemical compound C=1C=CC=CC=1C(C)OC1=CC=C(N)C=C1 QYAODHFJFSYEMK-UHFFFAOYSA-N 0.000 description 1
- CDIJOYCNNFLOAX-UHFFFAOYSA-N 4-(trichloromethylsulfanyl)isoindole-1,3-dione Chemical compound ClC(Cl)(Cl)SC1=CC=CC2=C1C(=O)NC2=O CDIJOYCNNFLOAX-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- HQKGVRZWBGUKBE-UHFFFAOYSA-N 4-nitro-1-[4-nitro-2-(1-phenylethyl)phenoxy]-2-(1-phenylethyl)benzene Chemical compound C=1C([N+]([O-])=O)=CC=C(OC=2C(=CC(=CC=2)[N+]([O-])=O)C(C)C=2C=CC=CC=2)C=1C(C)C1=CC=CC=C1 HQKGVRZWBGUKBE-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- 241000256118 Aedes aegypti Species 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 235000004221 Brassica oleracea var gemmifera Nutrition 0.000 description 1
- 244000308368 Brassica oleracea var. gemmifera Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000256113 Culicidae Species 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- DAUPAJFELAJLPW-UHFFFAOYSA-N N-[(2-amino-4-benzylidenecyclohexa-1,5-dien-1-yl)carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=C(C(=O)NC(=O)NC2=C(CC(C=C2)=CC2=CC=CC=C2)N)C(=CC=C1)F DAUPAJFELAJLPW-UHFFFAOYSA-N 0.000 description 1
- FULZLIGZKMKICU-UHFFFAOYSA-N N-phenylthiourea Chemical compound NC(=S)NC1=CC=CC=C1 FULZLIGZKMKICU-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000410864 Palaephatidae Species 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 241000500437 Plutella xylostella Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ISRUGXGCCGIOQO-UHFFFAOYSA-N Rhoden Chemical compound CNC(=O)OC1=CC=CC=C1OC(C)C ISRUGXGCCGIOQO-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- BABJTMNVJXLAEX-UHFFFAOYSA-N Triamiphos Chemical compound N1=C(N)N(P(=O)(N(C)C)N(C)C)N=C1C1=CC=CC=C1 BABJTMNVJXLAEX-UHFFFAOYSA-N 0.000 description 1
- 208000003152 Yellow Fever Diseases 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- KJMVNRNZVSKECT-UHFFFAOYSA-N [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl]methyl-methylsulfamic acid Chemical compound CCCCC1=C(C)N=C(NCC)N=C1CN(C)S(O)(=O)=O KJMVNRNZVSKECT-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- JYZIHLWOWKMNNX-UHFFFAOYSA-N benzimidazole Chemical compound C1=C[CH]C2=NC=NC2=C1 JYZIHLWOWKMNNX-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 235000008429 bread Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- WCMMILVIRZAPLE-UHFFFAOYSA-M cyhexatin Chemical compound C1CCCCC1[Sn](C1CCCCC1)(O)C1CCCCC1 WCMMILVIRZAPLE-UHFFFAOYSA-M 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- BNKAXGCRDYRABM-UHFFFAOYSA-N ethenyl dihydrogen phosphate Chemical compound OP(O)(=O)OC=C BNKAXGCRDYRABM-UHFFFAOYSA-N 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- OJZGWRZUOHSWMB-UHFFFAOYSA-L ethoxy-dioxido-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP([O-])([O-])=S OJZGWRZUOHSWMB-UHFFFAOYSA-L 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- WDQNIWFZKXZFAY-UHFFFAOYSA-M fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 1
- BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 229940091173 hydantoin Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- MXXXIJCUVMBRHD-UHFFFAOYSA-N n-[(3,5-dichloro-4-phenylmethoxyphenyl)carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC(Cl)=C1OCC1=CC=CC=C1 MXXXIJCUVMBRHD-UHFFFAOYSA-N 0.000 description 1
- SQJLIAGZWKUYQH-UHFFFAOYSA-N n-[(3-chloro-4-phenylmethoxyphenyl)carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC=C1OCC1=CC=CC=C1 SQJLIAGZWKUYQH-UHFFFAOYSA-N 0.000 description 1
- MBLBSWDKAZXXKP-UHFFFAOYSA-N n-[(4-aminophenyl)carbamoyl]-2,6-difluorobenzamide Chemical compound C1=CC(N)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F MBLBSWDKAZXXKP-UHFFFAOYSA-N 0.000 description 1
- UICOBNFAVRDMSY-UHFFFAOYSA-N n-[(4-benzoylsulfonyl-3-chlorophenyl)carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC1=CC=C(S(=O)(=O)C(=O)C=2C=CC=CC=2)C(Cl)=C1 UICOBNFAVRDMSY-UHFFFAOYSA-N 0.000 description 1
- DXHWSQGQYVIKJU-UHFFFAOYSA-N n-[(4-benzylsulfanyl-3-chlorophenyl)carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC=C1SCC1=CC=CC=C1 DXHWSQGQYVIKJU-UHFFFAOYSA-N 0.000 description 1
- NFENSTDCABKWFQ-UHFFFAOYSA-N n-[(4-benzylsulfanyl-3-chlorophenyl)carbamoyl]-2-chlorobenzamide Chemical compound C=1C=C(SCC=2C=CC=CC=2)C(Cl)=CC=1NC(=O)NC(=O)C1=CC=CC=C1Cl NFENSTDCABKWFQ-UHFFFAOYSA-N 0.000 description 1
- VWWXLZFVDQJKHU-UHFFFAOYSA-N n-[(4-benzylsulfonyl-3-chlorophenyl)carbamoyl]-2-chlorobenzamide Chemical compound ClC1=CC=CC=C1C(=O)NC(=O)NC1=CC=C(S(=O)(=O)CC=2C=CC=CC=2)C(Cl)=C1 VWWXLZFVDQJKHU-UHFFFAOYSA-N 0.000 description 1
- FEIBWZXQDGFFHK-UHFFFAOYSA-N n-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC(Cl)=C1OCC1=CC=C(Cl)C=C1 FEIBWZXQDGFFHK-UHFFFAOYSA-N 0.000 description 1
- MJJYYYHFDLBGEZ-UHFFFAOYSA-N n-[[3,5-dichloro-4-[(4-cyanophenyl)methoxy]phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC(Cl)=C1OCC1=CC=C(C#N)C=C1 MJJYYYHFDLBGEZ-UHFFFAOYSA-N 0.000 description 1
- QFWXULKNEKTOFG-UHFFFAOYSA-N n-[[3-chloro-4-(1-phenylethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound C=1C=CC=CC=1C(C)OC(C(=C1)Cl)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F QFWXULKNEKTOFG-UHFFFAOYSA-N 0.000 description 1
- RMSBHWOUMGEPLO-UHFFFAOYSA-N n-[[3-chloro-4-(1-phenylpropoxy)phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound C=1C=CC=CC=1C(CC)OC(C(=C1)Cl)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F RMSBHWOUMGEPLO-UHFFFAOYSA-N 0.000 description 1
- QZGALINOEYNVBM-UHFFFAOYSA-N n-[[3-chloro-4-(1-phenylpropoxy)phenyl]carbamoyl]-2-methylbenzamide Chemical compound C=1C=CC=CC=1C(CC)OC(C(=C1)Cl)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1C QZGALINOEYNVBM-UHFFFAOYSA-N 0.000 description 1
- NMHTZFYKEIQZQZ-UHFFFAOYSA-N n-[[3-chloro-4-(thiophen-2-ylmethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC=C1OCC1=CC=CS1 NMHTZFYKEIQZQZ-UHFFFAOYSA-N 0.000 description 1
- DTISZHOZLFJYME-UHFFFAOYSA-N n-[[3-chloro-4-[(4-chlorophenyl)methoxy]phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC=C1OCC1=CC=C(Cl)C=C1 DTISZHOZLFJYME-UHFFFAOYSA-N 0.000 description 1
- KTYWLWCJAZJEFA-UHFFFAOYSA-N n-[[3-chloro-4-[(4-cyanophenyl)methoxy]phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC=C1OCC1=CC=C(C#N)C=C1 KTYWLWCJAZJEFA-UHFFFAOYSA-N 0.000 description 1
- CEMHZIRIBPDLSW-UHFFFAOYSA-N n-[[3-chloro-4-[(4-cyanophenyl)methoxy]phenyl]carbamoyl]-2-methylbenzamide Chemical compound CC1=CC=CC=C1C(=O)NC(=O)NC(C=C1Cl)=CC=C1OCC1=CC=C(C#N)C=C1 CEMHZIRIBPDLSW-UHFFFAOYSA-N 0.000 description 1
- FAJGPNJHNNGXCT-UHFFFAOYSA-N n-[[3-chloro-4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC=C1OCC1=CC=C(OC(F)(F)F)C=C1 FAJGPNJHNNGXCT-UHFFFAOYSA-N 0.000 description 1
- FPSBYZFVFQXYGK-UHFFFAOYSA-N n-[[4-(2-ethyl-2-phenylbutoxy)phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound C=1C=CC=CC=1C(CC)(CC)COC(C=C1)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F FPSBYZFVFQXYGK-UHFFFAOYSA-N 0.000 description 1
- NFKQAICLNYIWEH-UHFFFAOYSA-N n-[[4-(benzylideneamino)phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC1=CC=C(N=CC=2C=CC=CC=2)C=C1 NFKQAICLNYIWEH-UHFFFAOYSA-N 0.000 description 1
- KJVAWIHFRLCTFS-UHFFFAOYSA-N n-[[4-[(4-chlorophenyl)methoxy]-3,5-dimethylphenyl]carbamoyl]-2-methylbenzamide Chemical compound CC1=CC=CC=C1C(=O)NC(=O)NC(C=C1C)=CC(C)=C1OCC1=CC=C(Cl)C=C1 KJVAWIHFRLCTFS-UHFFFAOYSA-N 0.000 description 1
- IPWSNVOTJVBLKR-UHFFFAOYSA-N n-[[4-[(4-chlorophenyl)methoxy]-3-(trifluoromethyl)phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1C(F)(F)F)=CC=C1OCC1=CC=C(Cl)C=C1 IPWSNVOTJVBLKR-UHFFFAOYSA-N 0.000 description 1
- PSWMCCQNBFIZSJ-UHFFFAOYSA-N n-[[4-[(4-chlorophenyl)methoxy]-3-methylphenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound C=1C=C(OCC=2C=CC(Cl)=CC=2)C(C)=CC=1NC(=O)NC(=O)C1=C(F)C=CC=C1F PSWMCCQNBFIZSJ-UHFFFAOYSA-N 0.000 description 1
- MRINMDYOUXHFBK-UHFFFAOYSA-N n-[[4-[(4-chlorophenyl)methylsulfanyl]phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1)=CC=C1SCC1=CC=C(Cl)C=C1 MRINMDYOUXHFBK-UHFFFAOYSA-N 0.000 description 1
- PTWLTASIMVQBDR-UHFFFAOYSA-N n-[[4-[(4-cyanophenyl)methoxy]phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1)=CC=C1OCC1=CC=C(C#N)C=C1 PTWLTASIMVQBDR-UHFFFAOYSA-N 0.000 description 1
- VMNGZXMZOJMTPY-UHFFFAOYSA-N n-[[4-[1-(4-chlorophenyl)ethoxy]-3-(trifluoromethyl)phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound C=1C=C(Cl)C=CC=1C(C)OC(C(=C1)C(F)(F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F VMNGZXMZOJMTPY-UHFFFAOYSA-N 0.000 description 1
- OEHRRDCYRQAQDH-UHFFFAOYSA-N n-[[4-[2-(4-chlorophenyl)-2-methoxyiminoethoxy]phenyl]carbamoyl]-2,6-difluorobenzamide Chemical compound C=1C=C(Cl)C=CC=1C(=NOC)COC(C=C1)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F OEHRRDCYRQAQDH-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- 150000002825 nitriles Chemical group 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 239000001272 nitrous oxide Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000004045 organic chlorine compounds Chemical class 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 238000004525 petroleum distillation Methods 0.000 description 1
- FFNMBRCFFADNAO-UHFFFAOYSA-N pirenzepine hydrochloride Chemical compound [H+].[H+].[Cl-].[Cl-].C1CN(C)CCN1CC(=O)N1C2=NC=CC=C2NC(=O)C2=CC=CC=C21 FFNMBRCFFADNAO-UHFFFAOYSA-N 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000002352 surface water Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002641 tar oil Substances 0.000 description 1
- MLGCXEBRWGEOQX-UHFFFAOYSA-N tetradifon Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl MLGCXEBRWGEOQX-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- FIDXVVHZWRFINX-UHFFFAOYSA-N tris(2-methyl-2-phenylpropyl)tin Chemical compound C=1C=CC=CC=1C(C)(C)C[Sn](CC(C)(C)C=1C=CC=CC=1)CC(C)(C)C1=CC=CC=C1 FIDXVVHZWRFINX-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/34—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the groups, e.g. biuret; Thio analogues thereof; Urea-aldehyde condensation products
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/54—Y being a carbon atom of a six-membered aromatic ring, e.g. benzoylureas
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C317/34—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring
- C07C317/38—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring with the nitrogen atom of at least one amino group being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfones
- C07C317/42—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/18—Radicals substituted by singly bound hetero atoms other than halogen by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7807316 | 1978-07-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL216907A1 PL216907A1 (enExample) | 1980-03-24 |
| PL115792B1 true PL115792B1 (en) | 1981-04-30 |
Family
ID=19831203
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1979216907A PL115792B1 (en) | 1978-07-06 | 1979-07-06 | Insecticide |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US4350706A (enExample) |
| JP (1) | JPS5540667A (enExample) |
| AR (1) | AR227761A1 (enExample) |
| AT (1) | AT367604B (enExample) |
| AU (1) | AU529840B2 (enExample) |
| BE (1) | BE877486A (enExample) |
| BR (1) | BR7904225A (enExample) |
| CA (1) | CA1124240A (enExample) |
| CH (1) | CH642061A5 (enExample) |
| CS (1) | CS216201B2 (enExample) |
| DD (1) | DD144709A5 (enExample) |
| DE (1) | DE2926480A1 (enExample) |
| DK (1) | DK155597C (enExample) |
| EG (1) | EG13906A (enExample) |
| ES (1) | ES482183A1 (enExample) |
| FR (1) | FR2430415A1 (enExample) |
| GB (1) | GB2028803B (enExample) |
| HU (1) | HU182947B (enExample) |
| IE (1) | IE48771B1 (enExample) |
| IL (1) | IL57714A (enExample) |
| IT (1) | IT1122009B (enExample) |
| NZ (1) | NZ190892A (enExample) |
| PL (1) | PL115792B1 (enExample) |
| SE (1) | SE7905822L (enExample) |
| YU (1) | YU164379A (enExample) |
| ZA (1) | ZA793186B (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5245071A (en) * | 1970-05-15 | 1993-09-14 | Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| US5342958A (en) * | 1970-05-15 | 1994-08-30 | Solvay Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| US4405552A (en) | 1981-03-03 | 1983-09-20 | Eli Lilly And Company | 1-Benzoyl-3-(arylphyridyl)urea compounds |
| DE3132020A1 (de) * | 1981-08-13 | 1983-03-03 | Basf Ag, 6700 Ludwigshafen | N-benzoyl-n'-phenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von insekten und spinnentieren |
| US5416102A (en) * | 1981-11-10 | 1995-05-16 | Ciba-Geigy Corporation | Method of preventing the reinfestation of dogs and cats by fleas |
| US4880838A (en) * | 1982-06-30 | 1989-11-14 | Rhone-Poulenc | Pesticidal 1-(4-Phenoxyphenyl)-5-Benzoyl urea compounds and process for preparation |
| EP0116729B1 (en) * | 1983-01-24 | 1988-10-12 | Duphar International Research B.V | Benzoylurea compounds and pesticidal compositions comprisingsame |
| EP0116728B1 (en) * | 1983-01-24 | 1987-08-12 | Duphar International Research B.V | Composition active against mites, whitefly and thrips, pharmaceutical composition, and new benzoylureau compounds |
| DE3371508D1 (en) * | 1983-01-24 | 1987-06-19 | Duphar Int Res | Benzoylurea compounds, and pesticidal and pharmaceutical compositions comprising same |
| US4783485A (en) * | 1983-01-24 | 1988-11-08 | Duphar International Research B.V. | Benzoylurea compounds, and insecticidal and acaricidal compositions comprising same |
| US4665097A (en) * | 1983-03-31 | 1987-05-12 | Union Carbide Corporation | Novel bicyclooxyaryl thioureas and process for preparation |
| US4873264A (en) * | 1983-05-20 | 1989-10-10 | Rhone-Poulenc Nederlands B.V. | Novel pesticidal 1-(alkyl-phenoxy-aryl)-3-benzoyl ureas and process for preparation |
| DE3433152A1 (de) * | 1984-09-10 | 1985-04-11 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Insektizid wirksame kombinationen von benzoylharnstoff-derivaten mit 1,2-methylendioxybenzol-derivaten und gegebenenfalls pyrethrinen bzw. pyrethroiden |
| US4638088A (en) * | 1984-11-15 | 1987-01-20 | Union Carbide Corporation | Pesticidal biphenylyloxy and biphenylylalkoxy aryl acyl urea compounds |
| JPS61126151A (ja) * | 1984-11-21 | 1986-06-13 | Nippon Zeon Co Ltd | 耐油性ゴム組成物 |
| US5135953A (en) * | 1984-12-28 | 1992-08-04 | Ciba-Geigy | Use of acyl urea compounds for controlling endoparasites and ectoparasites of warm-blooded animals |
| AU601145B2 (en) * | 1985-03-01 | 1990-09-06 | Duphar International Research B.V. | Benzoyl urea derivatives having anti-tumor activity |
| IT1208512B (it) * | 1985-03-14 | 1989-07-10 | Donegani Guido Ist | Benzoil-uree ad attivita'insetticida. |
| US4578402A (en) * | 1985-03-15 | 1986-03-25 | Union Carbide Corporation | Pesticidal alpha-cyanobenzyl phenyl benzoyl urea compounds |
| US4870089A (en) * | 1985-11-25 | 1989-09-26 | Fmc Corporation | N-[(alpha-perhaloalkylbenzyloxy)pyridyl]-N'-benzoylurea insecticides |
| US4609732A (en) * | 1986-01-03 | 1986-09-02 | Fmc Corporation | 2-(alpha-perhaloalkylbenzyloxy)pyridyl insecticide intermediates |
| NZ221262A (en) * | 1986-08-06 | 1990-08-28 | Ciba Geigy Ag | Preventing the reinfestation of dogs and cats by fleas by administering to the host a flea growth inhibiting substance orally, parenterally or by implant |
| US4737509A (en) * | 1986-12-04 | 1988-04-12 | Fmc Corporation | N-(4-(2-aryltetrafluoroethoxy)-3-methoxyphenyl)-N'-benzoylurea insect growth regulators |
| US5008277A (en) * | 1987-12-21 | 1991-04-16 | Fmc Corporation | N-[(alpha-perhaloalkylbenzyloxy)pyridyl]N'-benzoylurea insecticides |
| JPH01180115U (enExample) * | 1988-06-03 | 1989-12-25 | ||
| US5439924A (en) * | 1991-12-23 | 1995-08-08 | Virbac, Inc. | Systemic control of parasites |
| HUP0100860A3 (en) * | 1997-12-11 | 2003-03-28 | Janssen Pharmaceutica Nv | Retinoic acid mimetic anilides, process for their preparation and pharmaceutical compositions containing them |
| AU2001262318B2 (en) * | 2000-06-09 | 2005-09-08 | Sanofi-Aventis Deutschland Gmbh | Acylphenyl urea derivatives, methods for the production thereof and use thereof as a medicament |
| PE20021091A1 (es) | 2001-05-25 | 2003-02-04 | Aventis Pharma Gmbh | Derivados de fenilurea sustituidos con carbonamida y procedimiento para su preparacion |
| MXPA05005379A (es) * | 2002-11-19 | 2006-02-17 | Achillion Pharmaceuticals Inc | Tioureas de arilo sustituidas y compuestos relacionados; inhibidores de duplicacion viral. |
| DE10346245A1 (de) * | 2003-10-06 | 2005-04-28 | Bayer Cropscience Gmbh | Verfahren zur Herstellung von Acylharnstoffderivaten, Salze dieser Acylharnstoffderivate und deren Verwendung als Schädlingsbekämpfungsmittel |
| TW200600492A (en) * | 2004-05-18 | 2006-01-01 | Achillion Pharmaceuticals Inc | Substituted aryl acylthioureas and related compounds; inhibitors of viral replication |
| US8912184B1 (en) | 2010-03-01 | 2014-12-16 | Alzheimer's Institute Of America, Inc. | Therapeutic and diagnostic methods |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB969022A (en) * | 1961-04-27 | 1964-09-09 | Olin Mathieson | Substituted ureas |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| US3933908A (en) * | 1970-05-15 | 1976-01-20 | U.S. Philips Corporation | Substituted benzoyl ureas |
| NL177823C (nl) * | 1971-04-21 | 1989-12-18 | Duphar Int Res | Werkwijze ter bereiding van ureum- en thioureumverbindingen met insecticide werking alsmede van insecticide preparaten. |
| DE2438747C2 (de) * | 1974-08-13 | 1982-10-14 | Bayer Ag, 5090 Leverkusen | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| GB1460419A (en) * | 1975-02-06 | 1977-01-06 | Bayer Ag | Benzoylureido-diphenyl ethers and their use as insecticides |
| US4123449A (en) * | 1975-02-06 | 1978-10-31 | Bayer Aktiengesellschaft | 4-Nitro-4-isocyanato- or amino-diphenyl ethers |
| DE2504983C2 (de) * | 1975-02-06 | 1982-10-21 | Bayer Ag, 5090 Leverkusen | Benzoylureido-nitro-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2531202C2 (de) * | 1975-07-12 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | 2',4-Dichlor-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2531743C2 (de) * | 1975-07-16 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | 2',3,6'-Trichlor-4-cyano-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwenung als Insektizide |
| DE2601780B2 (de) * | 1976-01-20 | 1979-07-26 | Bayer Ag, 5090 Leverkusen | N-Phenyl-N'-benzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| NZ183570A (en) * | 1976-03-19 | 1979-06-08 | Mcneilab Inc | Heterocyclic guanidine derivatives, having anti-secretory and hypogliycaemic activity |
| TR19459A (tr) * | 1976-08-25 | 1979-05-01 | Bayer Ag | Suebstitueye benzoliuereidodifenil eterleri,bunlarin hazirlanisi icin usuller ve bunlarin ensektisidler olarak kullanilmalari |
| JPS5344544A (en) * | 1976-09-30 | 1978-04-21 | Sumitomo Chem Co Ltd | Substituted phenylurea derivatives, their preparation, and selective herbicide comprising the corresponding compounds |
| JPS6029382B2 (ja) * | 1977-06-24 | 1985-07-10 | 住友化学工業株式会社 | N−〔p−(置換ベンジルオキシ)フエニル〕n′−ベンゾイル尿素誘導体、その製造法およびそれらを有効成分とする殺虫、殺ダニ剤 |
| BE868406A (fr) * | 1977-06-28 | 1978-12-27 | Sumitomo Chemical Co | N'-phenyl-n-methyl-urees, leur preparation et leur emploi |
| JPS54122252A (en) | 1978-03-13 | 1979-09-21 | Sumitomo Chem Co Ltd | Substitued phenylurea derivative, its preparation, and herbicide containing the same |
-
1979
- 1979-06-26 ZA ZA793186A patent/ZA793186B/xx unknown
- 1979-06-27 US US06/052,371 patent/US4350706A/en not_active Expired - Lifetime
- 1979-06-30 DE DE19792926480 patent/DE2926480A1/de not_active Withdrawn
- 1979-07-02 AU AU48581/79A patent/AU529840B2/en not_active Ceased
- 1979-07-03 CS CS794674A patent/CS216201B2/cs unknown
- 1979-07-03 AT AT0464579A patent/AT367604B/de not_active IP Right Cessation
- 1979-07-03 CH CH621779A patent/CH642061A5/de not_active IP Right Cessation
- 1979-07-03 HU HU79DU310A patent/HU182947B/hu not_active IP Right Cessation
- 1979-07-03 SE SE7905822A patent/SE7905822L/xx not_active Application Discontinuation
- 1979-07-03 CA CA330,989A patent/CA1124240A/en not_active Expired
- 1979-07-03 NZ NZ190892A patent/NZ190892A/xx unknown
- 1979-07-03 DK DK280879A patent/DK155597C/da not_active IP Right Cessation
- 1979-07-03 GB GB7923053A patent/GB2028803B/en not_active Expired
- 1979-07-03 IT IT24075/79A patent/IT1122009B/it active
- 1979-07-03 IL IL57714A patent/IL57714A/xx unknown
- 1979-07-04 BR BR7904225A patent/BR7904225A/pt unknown
- 1979-07-04 BE BE0/196137A patent/BE877486A/fr not_active IP Right Cessation
- 1979-07-04 FR FR7917383A patent/FR2430415A1/fr active Granted
- 1979-07-04 ES ES482183A patent/ES482183A1/es not_active Expired
- 1979-07-05 DD DD79214146A patent/DD144709A5/de unknown
- 1979-07-05 YU YU01643/79A patent/YU164379A/xx unknown
- 1979-07-06 AR AR277231A patent/AR227761A1/es active
- 1979-07-06 PL PL1979216907A patent/PL115792B1/pl unknown
- 1979-07-06 JP JP8581179A patent/JPS5540667A/ja active Granted
- 1979-07-07 EG EG412/79A patent/EG13906A/xx active
- 1979-08-08 IE IE1242/79A patent/IE48771B1/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL115792B1 (en) | Insecticide | |
| US4920135A (en) | Insecticidal ureas and thioureas | |
| US4013717A (en) | Benzoyl phenyl urea derivatives having insecticidal activities | |
| US4572914A (en) | Insecticidal 4-substituted-3-chlorophenyl-1-(fluoroalkoxyphenylcarbamoyl)pyrazolines | |
| EP0116729B1 (en) | Benzoylurea compounds and pesticidal compositions comprisingsame | |
| EP0117320B1 (en) | Benzoylurea compounds, and pesticidal compositions comprising same | |
| US4166124A (en) | Insecticidal 2,6-dihalobenzoyl urea derivatives | |
| US4567295A (en) | Composition active against mites, whitefly and thrips, pharmaceutical composition, and new benzoylurea compounds | |
| US4276309A (en) | Acylurea insecticides | |
| EP0131071B1 (en) | Benzoylurea compounds, and pesticidal and pharmaceutical compositions comprising same | |
| US4439440A (en) | 1-Alkoxycarbonylphenylcarbamoyl-3-phenyl-4-cyanoalkyl-2-pyrazolines and use as insecticides | |
| US4110469A (en) | Insecticidal N-(2,6-dichlorobenzoyl)-N'-(4-cyanophenyl) urea | |
| US3953546A (en) | Thio(dithio)phosphorates | |
| US4783485A (en) | Benzoylurea compounds, and insecticidal and acaricidal compositions comprising same | |
| JPS5835174A (ja) | ベンゾイルウレア系化合物及びそれらを含有する殺虫剤 | |
| EP0031974A2 (en) | New urea compounds and thiourea compounds, method of preparing the new compounds, and insecticidal compositions on the basis of these compounds | |
| JPH0153869B2 (enExample) | ||
| JPS5835163A (ja) | N−ベンゾイル−n′−フエノキシフエニルウレア系化合物及びそれらを含有する殺虫剤 | |
| JPS61215304A (ja) | 農薬アルフア‐シアノベンジルフエニルベンゾイル尿素化合物 | |
| KR0185125B1 (ko) | (4-벤조일 우레이도)벤조일우레아 유도체와 이의 제조방법 및 이를 함유하는 농약 조성물 | |
| JPS5839657A (ja) | N−ベンゾイル−n′−フエニルウレア系化合物及びそれらを含有する殺虫剤 | |
| JPS6317062B2 (enExample) | ||
| NL7905155A (nl) | Nieuwe ureum- en thioureumverbindingen, werkwijze ter bereiding van de nieuwe verbindingen, alsmede insecti- cide preparaten op basis van deze verbindingen. |