PH27181A - New histidyl amino acid derivatives and pharmaceutical composition comprising the same - Google Patents
New histidyl amino acid derivatives and pharmaceutical composition comprising the same Download PDFInfo
- Publication number
- PH27181A PH27181A PH37089A PH37089A PH27181A PH 27181 A PH27181 A PH 27181A PH 37089 A PH37089 A PH 37089A PH 37089 A PH37089 A PH 37089A PH 27181 A PH27181 A PH 27181A
- Authority
- PH
- Philippines
- Prior art keywords
- methyl
- methanol
- chloroform
- group
- amino
- Prior art date
Links
- -1 histidyl amino acid derivatives Chemical class 0.000 title claims description 273
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 130
- 150000003839 salts Chemical class 0.000 claims description 79
- 125000000217 alkyl group Chemical group 0.000 claims description 69
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 62
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 48
- 238000000034 method Methods 0.000 claims description 35
- 229910052757 nitrogen Inorganic materials 0.000 claims description 33
- SJNKSJOXLPSIJA-LSLKUGRBSA-N (3s)-1-amino-1-cyclohexyl-6-methylheptan-3-ol Chemical compound CC(C)CC[C@H](O)CC(N)C1CCCCC1 SJNKSJOXLPSIJA-LSLKUGRBSA-N 0.000 claims description 29
- 239000001257 hydrogen Substances 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 125000003545 alkoxy group Chemical group 0.000 claims description 20
- 125000001424 substituent group Chemical group 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 125000002252 acyl group Chemical group 0.000 claims description 15
- 125000003277 amino group Chemical group 0.000 claims description 15
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 15
- 125000000623 heterocyclic group Chemical group 0.000 claims description 14
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000006518 morpholino carbonyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])N(C(*)=O)C1([H])[H] 0.000 claims description 11
- 102100028255 Renin Human genes 0.000 claims description 9
- 108090000783 Renin Proteins 0.000 claims description 9
- 125000001589 carboacyl group Chemical group 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 206010019280 Heart failures Diseases 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- 206010020772 Hypertension Diseases 0.000 claims description 4
- 125000000539 amino acid group Chemical group 0.000 claims description 4
- 230000002401 inhibitory effect Effects 0.000 claims description 4
- 125000004043 oxo group Chemical group O=* 0.000 claims description 4
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 150000001413 amino acids Chemical class 0.000 claims description 3
- 230000001225 therapeutic effect Effects 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 6
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 918
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 596
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 547
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 309
- 229960001701 chloroform Drugs 0.000 description 298
- 239000000243 solution Substances 0.000 description 155
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 154
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 117
- 235000011054 acetic acid Nutrition 0.000 description 103
- 238000002360 preparation method Methods 0.000 description 97
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 86
- 239000002904 solvent Substances 0.000 description 80
- 238000006243 chemical reaction Methods 0.000 description 76
- 239000000203 mixture Substances 0.000 description 72
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 71
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 70
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 69
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 52
- 238000001704 evaporation Methods 0.000 description 48
- 230000008020 evaporation Effects 0.000 description 48
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 43
- 235000019341 magnesium sulphate Nutrition 0.000 description 43
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 38
- 239000002253 acid Substances 0.000 description 32
- 235000017557 sodium bicarbonate Nutrition 0.000 description 31
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 31
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 29
- 230000002829 reductive effect Effects 0.000 description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 27
- 239000003921 oil Substances 0.000 description 25
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 23
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 20
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 19
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 17
- 239000002585 base Substances 0.000 description 16
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 16
- 238000003379 elimination reaction Methods 0.000 description 15
- JVSWJIKNEAIKJW-UHFFFAOYSA-N 2-Methylheptane Chemical compound CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 14
- 125000002066 L-histidyl group Chemical group [H]N1C([H])=NC(C([H])([H])[C@](C(=O)[*])([H])N([H])[H])=C1[H] 0.000 description 14
- 125000000487 histidyl group Chemical group [H]N([H])C(C(=O)O*)C([H])([H])C1=C([H])N([H])C([H])=N1 0.000 description 14
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 13
- 239000003054 catalyst Substances 0.000 description 13
- 238000001816 cooling Methods 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 12
- 239000000284 extract Substances 0.000 description 12
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 12
- 239000000843 powder Substances 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 239000012267 brine Substances 0.000 description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 10
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- 239000003638 chemical reducing agent Substances 0.000 description 9
- 239000003480 eluent Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- 238000010898 silica gel chromatography Methods 0.000 description 8
- TXVNAWMHIJXEAW-AWEZNQCLSA-N (3S)-1-cyclohexyl-6-methylheptan-3-ol Chemical compound CC(C)CC[C@H](O)CCC1CCCCC1 TXVNAWMHIJXEAW-AWEZNQCLSA-N 0.000 description 7
- BWDBEAQIHAEVLV-UHFFFAOYSA-N 6-methylheptan-1-ol Chemical compound CC(C)CCCCCO BWDBEAQIHAEVLV-UHFFFAOYSA-N 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 7
- 150000003862 amino acid derivatives Chemical class 0.000 description 7
- 230000008030 elimination Effects 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 238000006722 reduction reaction Methods 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 229960001866 silicon dioxide Drugs 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 6
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- 239000011777 magnesium Substances 0.000 description 6
- 229910052749 magnesium Inorganic materials 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 238000004809 thin layer chromatography Methods 0.000 description 6
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 6
- 229910052720 vanadium Inorganic materials 0.000 description 6
- ZRFFLPADOMMJFO-SFHVURJKSA-N 3-[methyl-[(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl]oxycarbonylamino]propanoic acid Chemical compound C([C@H](OC(=O)N(CCC(O)=O)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 ZRFFLPADOMMJFO-SFHVURJKSA-N 0.000 description 5
- 101800000734 Angiotensin-1 Proteins 0.000 description 5
- 102400000344 Angiotensin-1 Human genes 0.000 description 5
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 230000002411 adverse Effects 0.000 description 5
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000011534 incubation Methods 0.000 description 5
- XMWFMEYDRNJSOO-UHFFFAOYSA-N morpholine-4-carbonyl chloride Chemical compound ClC(=O)N1CCOCC1 XMWFMEYDRNJSOO-UHFFFAOYSA-N 0.000 description 5
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- WLDRFJDGKMTPPV-UHFFFAOYSA-N 1,2-dimethylhydrazine dihydrochloride Chemical compound Cl.Cl.CNNC WLDRFJDGKMTPPV-UHFFFAOYSA-N 0.000 description 4
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 229910017052 cobalt Inorganic materials 0.000 description 4
- 239000010941 cobalt Substances 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000005755 formation reaction Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 229910052697 platinum Inorganic materials 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- YRXIMPFOTQVOHG-UHFFFAOYSA-N 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid Chemical compound OC(=O)CN(C)C(=O)OC(C)(C)C YRXIMPFOTQVOHG-UHFFFAOYSA-N 0.000 description 3
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- GFMRZAMDGJIWRB-UHFFFAOYSA-N 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC(C)(C)OC(=O)NCCCCC(O)=O GFMRZAMDGJIWRB-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 235000004279 alanine Nutrition 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 3
- LOIZLIUVFMTMSX-UHFFFAOYSA-N benzyl n-methyl-n-(methylamino)carbamate Chemical compound CNN(C)C(=O)OCC1=CC=CC=C1 LOIZLIUVFMTMSX-UHFFFAOYSA-N 0.000 description 3
- PKOQSEJQFOHVPB-UHFFFAOYSA-N benzyl pyrazolidine-1-carboxylate Chemical compound C1CCNN1C(=O)OCC1=CC=CC=C1 PKOQSEJQFOHVPB-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 3
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 3
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 3
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000003127 radioimmunoassay Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 3
- 229960004319 trichloroacetic acid Drugs 0.000 description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 3
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- YXZFFTJAHVMMLF-UHFFFAOYSA-N 1-bromo-3-methylbutane Chemical compound CC(C)CCBr YXZFFTJAHVMMLF-UHFFFAOYSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 2
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 241000282693 Cercopithecidae Species 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- 241000282567 Macaca fascicularis Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- QIAFMBKCNZACKA-UHFFFAOYSA-N N-benzoylglycine Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1 QIAFMBKCNZACKA-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 101150052863 THY1 gene Proteins 0.000 description 2
- UFYLUYRZDTVJGF-SFHVURJKSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 1,3-thiazolidine-3-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1CSCC1)OCC1=CC=CC=C1 UFYLUYRZDTVJGF-SFHVURJKSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 229940024606 amino acid Drugs 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- NDTNAZJVGFFTOC-QHCPKHFHSA-N benzyl (2s)-2-[methyl-[3-(2-methylpropylsulfanyl)propyl]carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)CCCSCC(C)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 NDTNAZJVGFFTOC-QHCPKHFHSA-N 0.000 description 2
- XFULYMQQCZRWQB-HNNXBMFYSA-N benzyl (2s)-2-hydroxy-3-phenylpropanoate Chemical compound C([C@H](O)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 XFULYMQQCZRWQB-HNNXBMFYSA-N 0.000 description 2
- FSUYCTZYHDQXDW-UHFFFAOYSA-N benzyl diazinane-1-carboxylate Chemical compound C1CCCNN1C(=O)OCC1=CC=CC=C1 FSUYCTZYHDQXDW-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001728 carbonyl compounds Chemical class 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 125000006639 cyclohexyl carbonyl group Chemical group 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 2
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- COQRGFWWJBEXRC-UHFFFAOYSA-N hydron;methyl 2-aminoacetate;chloride Chemical compound Cl.COC(=O)CN COQRGFWWJBEXRC-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 230000001077 hypotensive effect Effects 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 2
- 125000001998 leucyl group Chemical group 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- WJGVYRMMIIWBAU-UHFFFAOYSA-M magnesium;2-methylbutane;bromide Chemical compound [Mg+2].[Br-].CC(C)C[CH2-] WJGVYRMMIIWBAU-UHFFFAOYSA-M 0.000 description 2
- MFTYFRRACGZPDJ-UHFFFAOYSA-N methyl 5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate Chemical compound COC(=O)CCCCN(C)C(=O)OC(C)(C)C MFTYFRRACGZPDJ-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- BHIWKHZACMWKOJ-UHFFFAOYSA-N methyl isobutyrate Chemical compound COC(=O)C(C)C BHIWKHZACMWKOJ-UHFFFAOYSA-N 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 2
- KMFVUBFMFJOFIN-UHFFFAOYSA-N n-(2-aminoethyl)-2-methylpropanamide Chemical compound CC(C)C(=O)NCCN KMFVUBFMFJOFIN-UHFFFAOYSA-N 0.000 description 2
- SASNBVQSOZSTPD-UHFFFAOYSA-N n-methylphenethylamine Chemical compound CNCCC1=CC=CC=C1 SASNBVQSOZSTPD-UHFFFAOYSA-N 0.000 description 2
- AMOCDAHKAWUHGK-UHFFFAOYSA-N n-propan-2-ylpyrazolidine-1-carboxamide Chemical compound CC(C)NC(=O)N1CCCN1 AMOCDAHKAWUHGK-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- RLZZZVKAURTHCP-UHFFFAOYSA-N phenanthrene-3,4-diol Chemical compound C1=CC=C2C3=C(O)C(O)=CC=C3C=CC2=C1 RLZZZVKAURTHCP-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- DYUMLJSJISTVPV-UHFFFAOYSA-N phenyl propanoate Chemical compound CCC(=O)OC1=CC=CC=C1 DYUMLJSJISTVPV-UHFFFAOYSA-N 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RFNKSYJHMUYMKA-UHFFFAOYSA-N tert-butyl n-(2-hydroxy-5-methylhexyl)-n-methylcarbamate Chemical compound CC(C)CCC(O)CN(C)C(=O)OC(C)(C)C RFNKSYJHMUYMKA-UHFFFAOYSA-N 0.000 description 2
- GJGLBUZZTLPCOT-UHFFFAOYSA-N tert-butyl n-(3-hydroxypropyl)-n-methylcarbamate Chemical compound OCCCN(C)C(=O)OC(C)(C)C GJGLBUZZTLPCOT-UHFFFAOYSA-N 0.000 description 2
- MGQGDTMEIUJUEW-UHFFFAOYSA-N tert-butyl n-[5-oxo-5-(propan-2-ylamino)pentyl]carbamate Chemical compound CC(C)NC(=O)CCCCNC(=O)OC(C)(C)C MGQGDTMEIUJUEW-UHFFFAOYSA-N 0.000 description 2
- MSWTVSDFEYSRMQ-UHFFFAOYSA-N tert-butyl n-methyl-n-(2-oxoethyl)carbamate Chemical compound O=CCN(C)C(=O)OC(C)(C)C MSWTVSDFEYSRMQ-UHFFFAOYSA-N 0.000 description 2
- DFVRUHANEXOZGT-UHFFFAOYSA-N tert-butyl n-methyl-n-[2-(methylamino)ethyl]carbamate Chemical compound CNCCN(C)C(=O)OC(C)(C)C DFVRUHANEXOZGT-UHFFFAOYSA-N 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 229940005605 valeric acid Drugs 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- TXTWXQXDMWILOF-UHFFFAOYSA-N (2-ethoxy-2-oxoethyl)azanium;chloride Chemical compound [Cl-].CCOC(=O)C[NH3+] TXTWXQXDMWILOF-UHFFFAOYSA-N 0.000 description 1
- VBEBFUCDEHUNSF-ZDUSSCGKSA-N (2s)-2-(4-methylpiperazine-1-carbonyl)oxy-3-phenylpropanoic acid Chemical compound C1CN(C)CCN1C(=O)O[C@H](C(O)=O)CC1=CC=CC=C1 VBEBFUCDEHUNSF-ZDUSSCGKSA-N 0.000 description 1
- RXSSENVGBNPHJJ-LBPRGKRZSA-N (2s)-2-(morpholine-4-carbonyloxy)-3-phenylpropanoic acid Chemical compound C([C@@H](C(=O)O)OC(=O)N1CCOCC1)C1=CC=CC=C1 RXSSENVGBNPHJJ-LBPRGKRZSA-N 0.000 description 1
- AYMLQYFMYHISQO-QMMMGPOBSA-N (2s)-3-(1h-imidazol-3-ium-5-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CC1=CN=CN1 AYMLQYFMYHISQO-QMMMGPOBSA-N 0.000 description 1
- CKGMOMHVIYUFJU-KBPBESRZSA-N (2s,3s)-2-amino-1-cyclohexyl-6-methylheptan-3-ol Chemical compound CC(C)CC[C@H](O)[C@@H](N)CC1CCCCC1 CKGMOMHVIYUFJU-KBPBESRZSA-N 0.000 description 1
- VGRXAHXMIDCTNV-UHFFFAOYSA-N (6-chlorobenzotriazol-1-yl) 4-chlorobenzenesulfonate Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)ON1C2=CC(Cl)=CC=C2N=N1 VGRXAHXMIDCTNV-UHFFFAOYSA-N 0.000 description 1
- HAAZJWVQKLGNDT-LURJTMIESA-N (8as)-2,3,6,7,8,8a-hexahydro-1h-pyrrolo[1,2-a]pyrazin-4-one Chemical compound O=C1CNC[C@@H]2CCCN12 HAAZJWVQKLGNDT-LURJTMIESA-N 0.000 description 1
- JMEPIRYFOZYOHN-UHFFFAOYSA-N 1,1,3-trimethyl-3-(methylamino)urea Chemical compound CNN(C)C(=O)N(C)C JMEPIRYFOZYOHN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- DIIIISSCIXVANO-UHFFFAOYSA-N 1,2-Dimethylhydrazine Chemical compound CNNC DIIIISSCIXVANO-UHFFFAOYSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- NEDAXSVASAYYHF-UHFFFAOYSA-N 1,3-dimethyl-1-(methylamino)urea Chemical compound CNN(C)C(=O)NC NEDAXSVASAYYHF-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- ZQXIMYREBUZLPM-UHFFFAOYSA-N 1-aminoethanethiol Chemical compound CC(N)S ZQXIMYREBUZLPM-UHFFFAOYSA-N 0.000 description 1
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- SQCZQTSHSZLZIQ-UHFFFAOYSA-N 1-chloropentane Chemical compound CCCCCCl SQCZQTSHSZLZIQ-UHFFFAOYSA-N 0.000 description 1
- WGNMVJLGJVALRG-UHFFFAOYSA-N 1-methyl-1-(methylamino)-3-propan-2-ylurea Chemical compound CNN(C)C(=O)NC(C)C WGNMVJLGJVALRG-UHFFFAOYSA-N 0.000 description 1
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 1
- 125000001917 2,4-dinitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1*)[N+]([O-])=O)[N+]([O-])=O 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- WOXFMYVTSLAQMO-UHFFFAOYSA-N 2-Pyridinemethanamine Chemical compound NCC1=CC=CC=N1 WOXFMYVTSLAQMO-UHFFFAOYSA-N 0.000 description 1
- VRPJIFMKZZEXLR-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid Chemical compound CC(C)(C)OC(=O)NCC(O)=O VRPJIFMKZZEXLR-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- IXPZWUHQBQUDLB-UHFFFAOYSA-N 2-carbamoyloxy-3-phenylpropanoic acid Chemical compound NC(=O)OC(C(O)=O)CC1=CC=CC=C1 IXPZWUHQBQUDLB-UHFFFAOYSA-N 0.000 description 1
- AVZBOAGCVKEESJ-UHFFFAOYSA-O 2-ethyl-1,2-benzoxazol-2-ium-7-ol Chemical class C1=CC(O)=C2O[N+](CC)=CC2=C1 AVZBOAGCVKEESJ-UHFFFAOYSA-O 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- BDFAOUQQXJIZDG-UHFFFAOYSA-N 2-methylpropane-1-thiol Chemical compound CC(C)CS BDFAOUQQXJIZDG-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- NKVHAENNZGLZOW-UHFFFAOYSA-N 2-methylpropyl n-methyl-n-(methylamino)carbamate Chemical compound CNN(C)C(=O)OCC(C)C NKVHAENNZGLZOW-UHFFFAOYSA-N 0.000 description 1
- TVHLGQYAZTXGPB-UXHICEINSA-N 2-o-methyl 1-o-[(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] (2r)-pyrrolidine-1,2-dicarboxylate Chemical compound COC(=O)[C@H]1CCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 TVHLGQYAZTXGPB-UXHICEINSA-N 0.000 description 1
- TVHLGQYAZTXGPB-PMACEKPBSA-N 2-o-methyl 1-o-[(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] (2s)-pyrrolidine-1,2-dicarboxylate Chemical compound COC(=O)[C@@H]1CCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 TVHLGQYAZTXGPB-PMACEKPBSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- MDQHTWMXYBVSHU-UHFFFAOYSA-N 2-trimethylsilylacetamide Chemical compound C[Si](C)(C)CC(N)=O MDQHTWMXYBVSHU-UHFFFAOYSA-N 0.000 description 1
- NSHAOELVDPKZIC-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonic acid;hydroxide Chemical compound [OH-].O1[N+](CC)=CC=C1C1=CC=CC(S(O)(=O)=O)=C1 NSHAOELVDPKZIC-UHFFFAOYSA-N 0.000 description 1
- ZZKYUIXZEQLWAH-UHFFFAOYSA-N 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl methanesulfonate Chemical compound CC(C)(C)OC(=O)N(C)CCCOS(C)(=O)=O ZZKYUIXZEQLWAH-UHFFFAOYSA-N 0.000 description 1
- CHYUVTUNIZMMOH-UHFFFAOYSA-N 3-benzyl-1-methyl-1-(methylamino)urea Chemical compound CNN(C)C(=O)NCC1=CC=CC=C1 CHYUVTUNIZMMOH-UHFFFAOYSA-N 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical compound C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- RDTALXUBMCLWBB-UHFFFAOYSA-N 4-(dimethylamino)butanoic acid;hydron;chloride Chemical compound Cl.CN(C)CCCC(O)=O RDTALXUBMCLWBB-UHFFFAOYSA-N 0.000 description 1
- HIDJWBGOQFTDLU-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)(C)OC(=O)NCCCC(O)=O HIDJWBGOQFTDLU-UHFFFAOYSA-N 0.000 description 1
- PXAKQDWAISFHCM-UHFFFAOYSA-N 4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid Chemical compound CC(C)(C)OC(=O)N(C)CCCC(O)=O PXAKQDWAISFHCM-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 102000004881 Angiotensinogen Human genes 0.000 description 1
- 108090001067 Angiotensinogen Proteins 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- SSUFDOMYCBCHML-UHFFFAOYSA-N CCCCC[S](=O)=O Chemical group CCCCC[S](=O)=O SSUFDOMYCBCHML-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 235000003385 Diospyros ebenum Nutrition 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 241000792913 Ebenaceae Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 206010021036 Hyponatraemia Diseases 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- MONXCRDSDZQGGT-DWIKVQACSA-N Jhanol Natural products O1[C@@](C)(C=C)CC[C@@H]2[C@@]3(C)CCC[C@@](C)(CO)[C@@H]3CC[C@]21C MONXCRDSDZQGGT-DWIKVQACSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical class OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- WXNXCEHXYPACJF-ZETCQYMHSA-N N-acetyl-L-leucine Chemical compound CC(C)C[C@@H](C(O)=O)NC(C)=O WXNXCEHXYPACJF-ZETCQYMHSA-N 0.000 description 1
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N N-methylaminoacetic acid Natural products C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 108010077895 Sarcosine Proteins 0.000 description 1
- 241000593989 Scardinius erythrophthalmus Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 241000473945 Theria <moth genus> Species 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- PFJVVVCQRMOXRC-RTWAWAEBSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] (2r)-2-(dimethylcarbamoyl)pyrrolidine-1-carboxylate Chemical compound CN(C)C(=O)[C@H]1CCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 PFJVVVCQRMOXRC-RTWAWAEBSA-N 0.000 description 1
- KWNUMUQLQRFAJI-GOTSBHOMSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] (2s)-4-methyl-2-(2-methylpropyl)-3-oxopiperazine-1-carboxylate Chemical compound C1CN(C)C(=O)[C@H](CC(C)C)N1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 KWNUMUQLQRFAJI-GOTSBHOMSA-N 0.000 description 1
- KMLHZGJNPYHQSG-HSYKDVHTSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 1-oxo-1,3-thiazolidine-3-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1CS(=O)CC1)OCC1=CC=CC=C1 KMLHZGJNPYHQSG-HSYKDVHTSA-N 0.000 description 1
- ZOMUAMIPJLGHSX-IBGZPJMESA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 1-oxo-1,4-thiazinane-4-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1CCS(=O)CC1)OCC1=CC=CC=C1 ZOMUAMIPJLGHSX-IBGZPJMESA-N 0.000 description 1
- YJVGHODWZVNZEM-VWLOTQADSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-(2-benzamidoacetyl)pyrazolidine-1-carboxylate Chemical compound C1CCN(C(=O)O[C@@H](CC=2C=CC=CC=2)C(=O)OCC=2C=CC=CC=2)N1C(=O)CNC(=O)C1=CC=CC=C1 YJVGHODWZVNZEM-VWLOTQADSA-N 0.000 description 1
- WOOUHJSZCQYKGE-QFIPXVFZSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-(2-methylpropanoyl)diazinane-1-carboxylate Chemical compound CC(C)C(=O)N1CCCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WOOUHJSZCQYKGE-QFIPXVFZSA-N 0.000 description 1
- PXROOZSABWGLMM-NRFANRHFSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-(2-methylpropanoyl)pyrazolidine-1-carboxylate Chemical compound CC(C)C(=O)N1CCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 PXROOZSABWGLMM-NRFANRHFSA-N 0.000 description 1
- PTCJSHGURWQBFX-VWLOTQADSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-(cyclohexanecarbonyl)diazinane-1-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1N(CCCC1)C(=O)C1CCCCC1)OCC1=CC=CC=C1 PTCJSHGURWQBFX-VWLOTQADSA-N 0.000 description 1
- MRZKLRRPMOKDMB-IBGZPJMESA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-(methylcarbamoyl)pyrazolidine-1-carboxylate Chemical compound CNC(=O)N1CCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 MRZKLRRPMOKDMB-IBGZPJMESA-N 0.000 description 1
- UPHOBLAEUYQROX-QFIPXVFZSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-(morpholine-4-carbonyl)pyrazolidine-1-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1N(CCC1)C(=O)N1CCOCC1)OCC1=CC=CC=C1 UPHOBLAEUYQROX-QFIPXVFZSA-N 0.000 description 1
- CKPPYARKOXAORL-NRFANRHFSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-(propan-2-ylcarbamoyl)pyrazolidine-1-carboxylate Chemical compound CC(C)NC(=O)N1CCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 CKPPYARKOXAORL-NRFANRHFSA-N 0.000 description 1
- QIVHBTPIVRVAGS-QHCPKHFHSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-[4-(dimethylamino)butanoyl]pyrazolidine-1-carboxylate Chemical compound CN(C)CCCC(=O)N1CCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 QIVHBTPIVRVAGS-QHCPKHFHSA-N 0.000 description 1
- VSYQSEOLCGVNLG-NRFANRHFSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-acetyldiazinane-1-carboxylate Chemical compound CC(=O)N1CCCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 VSYQSEOLCGVNLG-NRFANRHFSA-N 0.000 description 1
- NDUGJLNBVMCAJT-FQEVSTJZSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-acetylpyrazolidine-1-carboxylate Chemical compound CC(=O)N1CCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 NDUGJLNBVMCAJT-FQEVSTJZSA-N 0.000 description 1
- HMPBAOLPFHJNIQ-QFIPXVFZSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-butanoyldiazinane-1-carboxylate Chemical compound CCCC(=O)N1CCCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 HMPBAOLPFHJNIQ-QFIPXVFZSA-N 0.000 description 1
- SDMRNVLEZOYWAB-KRWDZBQOSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-oxo-1,3-oxazolidine-3-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1C(OCC1)=O)OCC1=CC=CC=C1 SDMRNVLEZOYWAB-KRWDZBQOSA-N 0.000 description 1
- IXJMEWPMXLXYTF-ANYOKISRSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 3-hydroxypiperidine-1-carboxylate Chemical compound C1C(O)CCCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 IXJMEWPMXLXYTF-ANYOKISRSA-N 0.000 description 1
- CFDIERIXEDRRTM-GGYWPGCISA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 3-hydroxypyrrolidine-1-carboxylate Chemical compound C1C(O)CCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 CFDIERIXEDRRTM-GGYWPGCISA-N 0.000 description 1
- CTINUMWVHGOQJT-SFHVURJKSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 3-oxopiperazine-1-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1CC(=O)NCC1)OCC1=CC=CC=C1 CTINUMWVHGOQJT-SFHVURJKSA-N 0.000 description 1
- VXZMGOMLMQGLCU-FQEVSTJZSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 3-oxopiperidine-1-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1CC(=O)CCC1)OCC1=CC=CC=C1 VXZMGOMLMQGLCU-FQEVSTJZSA-N 0.000 description 1
- MDQOBXDVZPQTKG-FQEVSTJZSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 4-(methylcarbamoyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)NC)CCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 MDQOBXDVZPQTKG-FQEVSTJZSA-N 0.000 description 1
- GRWDZUBTIYMBJP-QHCPKHFHSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 4-(morpholine-4-carbonyl)piperazine-1-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1CCN(CC1)C(=O)N1CCOCC1)OCC1=CC=CC=C1 GRWDZUBTIYMBJP-QHCPKHFHSA-N 0.000 description 1
- HMRKABWLQRYVBI-QHCPKHFHSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)CNC(=O)OC(C)(C)C)CCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 HMRKABWLQRYVBI-QHCPKHFHSA-N 0.000 description 1
- YLSONALZTPOCIV-IBGZPJMESA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 4-methyl-3-oxopiperazine-1-carboxylate Chemical compound C1C(=O)N(C)CCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 YLSONALZTPOCIV-IBGZPJMESA-N 0.000 description 1
- RJEYOXJNZRMIQD-FQEVSTJZSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 4-methylpiperazine-1-carboxylate Chemical compound C1CN(C)CCN1C(=O)O[C@H](C(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 RJEYOXJNZRMIQD-FQEVSTJZSA-N 0.000 description 1
- FRGVGHNUJLAREB-NRFANRHFSA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] azepane-1-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1CCCCCC1)OCC1=CC=CC=C1 FRGVGHNUJLAREB-NRFANRHFSA-N 0.000 description 1
- DZXBHUOBEYOSHF-IBGZPJMESA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] morpholine-4-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1CCOCC1)OCC1=CC=CC=C1 DZXBHUOBEYOSHF-IBGZPJMESA-N 0.000 description 1
- DJJNLKWQBUDMPO-IBGZPJMESA-N [(2s)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] thiomorpholine-4-carboxylate Chemical compound O=C([C@H](CC=1C=CC=CC=1)OC(=O)N1CCSCC1)OCC1=CC=CC=C1 DJJNLKWQBUDMPO-IBGZPJMESA-N 0.000 description 1
- HVVNJUAVDAZWCB-YFKPBYRVSA-N [(2s)-pyrrolidin-2-yl]methanol Chemical compound OC[C@@H]1CCCN1 HVVNJUAVDAZWCB-YFKPBYRVSA-N 0.000 description 1
- ZCHPKWUIAASXPV-UHFFFAOYSA-N acetic acid;methanol Chemical compound OC.CC(O)=O ZCHPKWUIAASXPV-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001980 alanyl group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 108010058865 angiotensinase Proteins 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 229940127219 anticoagulant drug Drugs 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 150000001509 aspartic acid derivatives Chemical class 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- DOAQONGOBDQGFN-IBGZPJMESA-N benzyl (2s)-2-(diethylcarbamoyloxy)-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(CC)CC)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 DOAQONGOBDQGFN-IBGZPJMESA-N 0.000 description 1
- ACCJUXSRLTZXQX-SFHVURJKSA-N benzyl (2s)-2-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)CC(=O)OC)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 ACCJUXSRLTZXQX-SFHVURJKSA-N 0.000 description 1
- JEJDRFDIULITKA-QHCPKHFHSA-N benzyl (2s)-2-[[3-(cyclopentylamino)-3-oxopropyl]-methylcarbamoyl]oxy-3-phenylpropanoate Chemical compound O([C@@H](CC=1C=CC=CC=1)C(=O)OCC=1C=CC=CC=1)C(=O)N(C)CCC(=O)NC1CCCC1 JEJDRFDIULITKA-QHCPKHFHSA-N 0.000 description 1
- AJHZJYKTJAFXKP-FQEVSTJZSA-N benzyl (2s)-2-[[3-(dimethylamino)-3-oxopropyl]-methylcarbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)CCC(=O)N(C)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 AJHZJYKTJAFXKP-FQEVSTJZSA-N 0.000 description 1
- BPWIRAPLZSSUPL-IBGZPJMESA-N benzyl (2s)-2-[ethyl(2-hydroxyethyl)carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(CCO)CC)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 BPWIRAPLZSSUPL-IBGZPJMESA-N 0.000 description 1
- QXWJVYGYOFGOCV-NRFANRHFSA-N benzyl (2s)-2-[methyl(2-propan-2-ylsulfonylethyl)carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)CCS(=O)(=O)C(C)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 QXWJVYGYOFGOCV-NRFANRHFSA-N 0.000 description 1
- VRVWWWPAEZOHPO-SANMLTNESA-N benzyl (2s)-2-[methyl-(3-oxo-3-phenacyloxypropyl)carbamoyl]oxy-3-phenylpropanoate Chemical compound O([C@@H](CC=1C=CC=CC=1)C(=O)OCC=1C=CC=CC=1)C(=O)N(C)CCC(=O)OCC(=O)C1=CC=CC=C1 VRVWWWPAEZOHPO-SANMLTNESA-N 0.000 description 1
- YUNCZXLFKRXUEN-QFIPXVFZSA-N benzyl (2s)-2-[methyl-(3-oxo-3-thiomorpholin-4-ylpropyl)carbamoyl]oxy-3-phenylpropanoate Chemical compound O([C@@H](CC=1C=CC=CC=1)C(=O)OCC=1C=CC=CC=1)C(=O)N(C)CCC(=O)N1CCSCC1 YUNCZXLFKRXUEN-QFIPXVFZSA-N 0.000 description 1
- XYHBOCHRQHEWQI-QHCPKHFHSA-N benzyl (2s)-2-[methyl-(4-morpholin-4-yl-4-oxobutyl)carbamoyl]oxy-3-phenylpropanoate Chemical compound O([C@@H](CC=1C=CC=CC=1)C(=O)OCC=1C=CC=CC=1)C(=O)N(C)CCCC(=O)N1CCOCC1 XYHBOCHRQHEWQI-QHCPKHFHSA-N 0.000 description 1
- YSTFTDRVLGKUIX-QHCPKHFHSA-N benzyl (2s)-2-[methyl-(5-methyl-3-oxohexyl)carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)CCC(=O)CC(C)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 YSTFTDRVLGKUIX-QHCPKHFHSA-N 0.000 description 1
- XVBOVUAXPGESQY-QFIPXVFZSA-N benzyl (2s)-2-[methyl-[2-[methyl(2-methylpropanoyl)amino]ethyl]carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)CCN(C)C(=O)C(C)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 XVBOVUAXPGESQY-QFIPXVFZSA-N 0.000 description 1
- FUXCBBKKPVRBRU-SANMLTNESA-N benzyl (2s)-2-[methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl]oxy-3-phenylpropanoate Chemical compound O([C@@H](CC=1C=CC=CC=1)C(=O)OCC=1C=CC=CC=1)C(=O)N(C)CC(=O)N(C)CCC1=CC=CC=C1 FUXCBBKKPVRBRU-SANMLTNESA-N 0.000 description 1
- QERRXPFOFUIFMX-QHCPKHFHSA-N benzyl (2s)-2-[methyl-[2-[methyl(3-methylbutanoyl)amino]ethyl]carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)CCN(C)C(=O)CC(C)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 QERRXPFOFUIFMX-QHCPKHFHSA-N 0.000 description 1
- PVPUDNWJQQBRFT-QFIPXVFZSA-N benzyl (2s)-2-[methyl-[3-(2-methylpropylamino)-3-oxopropyl]carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)CCC(=O)NCC(C)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 PVPUDNWJQQBRFT-QFIPXVFZSA-N 0.000 description 1
- ATJSTRVNGSBSHB-QFIPXVFZSA-N benzyl (2s)-2-[methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl]oxy-3-phenylpropanoate Chemical compound O([C@@H](CC=1C=CC=CC=1)C(=O)OCC=1C=CC=CC=1)C(=O)N(C)CCC(=O)NN1CCOCC1 ATJSTRVNGSBSHB-QFIPXVFZSA-N 0.000 description 1
- MFTRWJITDRSWJX-QHCPKHFHSA-N benzyl (2s)-2-[methyl-[3-[methyl(2-methylpropyl)amino]-3-oxopropyl]carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)CCC(=O)N(C)CC(C)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 MFTRWJITDRSWJX-QHCPKHFHSA-N 0.000 description 1
- CSKNRFSVEAQDDD-NRFANRHFSA-N benzyl (2s)-2-[methyl-[methyl(2-methylpropoxycarbonyl)amino]carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)N(C)C(=O)OCC(C)C)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 CSKNRFSVEAQDDD-NRFANRHFSA-N 0.000 description 1
- ARUWRTLLSSHGQM-SFHVURJKSA-N benzyl (2s)-2-[methyl-[methyl(methylcarbamoyl)amino]carbamoyl]oxy-3-phenylpropanoate Chemical compound C([C@H](OC(=O)N(C)N(C)C(=O)NC)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 ARUWRTLLSSHGQM-SFHVURJKSA-N 0.000 description 1
- RJOWFUQHHDDVEO-UHFFFAOYSA-N benzyl 2-(cyclohexanecarbonyl)diazinane-1-carboxylate Chemical compound C1CCCN(C(=O)C2CCCCC2)N1C(=O)OCC1=CC=CC=C1 RJOWFUQHHDDVEO-UHFFFAOYSA-N 0.000 description 1
- DGKBKTKXONAOAM-UHFFFAOYSA-N benzyl 2-[4-(dimethylamino)butanoyl]pyrazolidine-1-carboxylate Chemical compound CN(C)CCCC(=O)N1CCCN1C(=O)OCC1=CC=CC=C1 DGKBKTKXONAOAM-UHFFFAOYSA-N 0.000 description 1
- KCDLQEUGFMVNHK-UHFFFAOYSA-N benzyl 2-butanoyldiazinane-1-carboxylate Chemical compound CCCC(=O)N1CCCCN1C(=O)OCC1=CC=CC=C1 KCDLQEUGFMVNHK-UHFFFAOYSA-N 0.000 description 1
- UUQMNUMQCIQDMZ-UHFFFAOYSA-N betahistine Chemical compound CNCCC1=CC=CC=N1 UUQMNUMQCIQDMZ-UHFFFAOYSA-N 0.000 description 1
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- 125000006637 cyclobutyl carbonyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000006638 cyclopentyl carbonyl group Chemical group 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002697 cystyl group Chemical group 0.000 description 1
- HTFFABIIOAKIBH-UHFFFAOYSA-N diazinane Chemical compound C1CCNNC1 HTFFABIIOAKIBH-UHFFFAOYSA-N 0.000 description 1
- PJUZEZLTRTTWOK-UHFFFAOYSA-N diazinane;dihydrochloride Chemical compound Cl.Cl.C1CCNNC1 PJUZEZLTRTTWOK-UHFFFAOYSA-N 0.000 description 1
- QFEOTYVTTQCYAZ-UHFFFAOYSA-N dimanganese decacarbonyl Chemical group [Mn].[Mn].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] QFEOTYVTTQCYAZ-UHFFFAOYSA-N 0.000 description 1
- WQABCVAJNWAXTE-UHFFFAOYSA-N dimercaprol Chemical compound OCC(S)CS WQABCVAJNWAXTE-UHFFFAOYSA-N 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 125000000291 glutamic acid group Chemical group N[C@@H](CCC(O)=O)C(=O)* 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- DCPMPXBYPZGNDC-UHFFFAOYSA-N hydron;methanediimine;chloride Chemical compound Cl.N=C=N DCPMPXBYPZGNDC-UHFFFAOYSA-N 0.000 description 1
- VLECDMDGMKPUSK-UHFFFAOYSA-N hydron;piperidin-3-ol;chloride Chemical compound Cl.OC1CCCNC1 VLECDMDGMKPUSK-UHFFFAOYSA-N 0.000 description 1
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- WDAXFOBOLVPGLV-UHFFFAOYSA-N isobutyric acid ethyl ester Natural products CCOC(=O)C(C)C WDAXFOBOLVPGLV-UHFFFAOYSA-N 0.000 description 1
- YDNLNVZZTACNJX-UHFFFAOYSA-N isocyanatomethylbenzene Chemical compound O=C=NCC1=CC=CC=C1 YDNLNVZZTACNJX-UHFFFAOYSA-N 0.000 description 1
- 125000000741 isoleucyl group Chemical group [H]N([H])C(C(C([H])([H])[H])C([H])([H])C([H])([H])[H])C(=O)O* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 229950003188 isovaleryl diethylamide Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229960003136 leucine Drugs 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- DQDWATOXYCARFV-UHFFFAOYSA-M magnesium;2-methanidylpropane;bromide Chemical compound [Mg+2].[Br-].CC(C)[CH2-] DQDWATOXYCARFV-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- KQSSATDQUYCRGS-UHFFFAOYSA-N methyl glycinate Chemical compound COC(=O)CN KQSSATDQUYCRGS-UHFFFAOYSA-N 0.000 description 1
- 229940073584 methylene chloride Drugs 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- MKQLBNJQQZRQJU-UHFFFAOYSA-N morpholin-4-amine Chemical compound NN1CCOCC1 MKQLBNJQQZRQJU-UHFFFAOYSA-N 0.000 description 1
- QRFWUPFGDJAVNO-UHFFFAOYSA-N morpholin-4-yl(piperazin-1-yl)methanone Chemical compound C1COCCN1C(=O)N1CCNCC1 QRFWUPFGDJAVNO-UHFFFAOYSA-N 0.000 description 1
- QKYWADPCTHTJHQ-UHFFFAOYSA-N n,2-dimethylpropan-1-amine Chemical compound CNCC(C)C QKYWADPCTHTJHQ-UHFFFAOYSA-N 0.000 description 1
- UHAAFJWANJYDIS-UHFFFAOYSA-N n,n'-diethylmethanediimine Chemical compound CCN=C=NCC UHAAFJWANJYDIS-UHFFFAOYSA-N 0.000 description 1
- ZVKNBDFRACXEJV-UHFFFAOYSA-N n,n'-dimethylmorpholine-4-carbohydrazide Chemical compound CNN(C)C(=O)N1CCOCC1 ZVKNBDFRACXEJV-UHFFFAOYSA-N 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- RWIVICVCHVMHMU-UHFFFAOYSA-N n-aminoethylmorpholine Chemical compound NCCN1CCOCC1 RWIVICVCHVMHMU-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- JVHPKYBRJQNPAT-UHFFFAOYSA-N n-cyclohexyl-2,2-diphenylethenimine Chemical compound C1CCCCC1N=C=C(C=1C=CC=CC=1)C1=CC=CC=C1 JVHPKYBRJQNPAT-UHFFFAOYSA-N 0.000 description 1
- OOTKJPZEEVPWCR-UHFFFAOYSA-N n-methyl-1-pyridin-2-ylmethanamine Chemical compound CNCC1=CC=CC=N1 OOTKJPZEEVPWCR-UHFFFAOYSA-N 0.000 description 1
- GVWISOJSERXQBM-UHFFFAOYSA-N n-methylpropan-1-amine Chemical compound CCCNC GVWISOJSERXQBM-UHFFFAOYSA-N 0.000 description 1
- SVEUVITYHIHZQE-UHFFFAOYSA-N n-methylpyridin-2-amine Chemical compound CNC1=CC=CC=N1 SVEUVITYHIHZQE-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000005933 neopentyloxycarbonyl group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- 125000000405 phenylalanyl group Chemical group 0.000 description 1
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229940093916 potassium phosphate Drugs 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- KOODSCBKXPPKHE-UHFFFAOYSA-N propanethioic s-acid Chemical compound CCC(S)=O KOODSCBKXPPKHE-UHFFFAOYSA-N 0.000 description 1
- DKORSYDQYFVQNS-UHFFFAOYSA-N propyl methanesulfonate Chemical compound CCCOS(C)(=O)=O DKORSYDQYFVQNS-UHFFFAOYSA-N 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- LUXXPABUPDCSHU-UHFFFAOYSA-N pyrazolidine;dihydrochloride Chemical compound Cl.Cl.C1CNNC1 LUXXPABUPDCSHU-UHFFFAOYSA-N 0.000 description 1
- HDOUGSFASVGDCS-UHFFFAOYSA-N pyridin-3-ylmethanamine Chemical compound NCC1=CC=CN=C1 HDOUGSFASVGDCS-UHFFFAOYSA-N 0.000 description 1
- TXQWFIVRZNOPCK-UHFFFAOYSA-N pyridin-4-ylmethanamine Chemical compound NCC1=CC=NC=C1 TXQWFIVRZNOPCK-UHFFFAOYSA-N 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- INTJZENRAYCATA-UHFFFAOYSA-N pyrrol-3-one Chemical compound O=C1C=CN=C1 INTJZENRAYCATA-UHFFFAOYSA-N 0.000 description 1
- MRUMAIRJPMUAPZ-UHFFFAOYSA-N quinolin-8-ol;sulfuric acid Chemical compound OS(O)(=O)=O.C1=CN=C2C(O)=CC=CC2=C1 MRUMAIRJPMUAPZ-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000002461 renin inhibitor Substances 0.000 description 1
- 229940086526 renin-inhibitors Drugs 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 230000000452 restraining effect Effects 0.000 description 1
- 229940043230 sarcosine Drugs 0.000 description 1
- 125000005930 sec-butyloxycarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 125000002072 seryl group Chemical group 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 229940100996 sodium bisulfate Drugs 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- UDYFLDICVHJSOY-UHFFFAOYSA-N sulfur trioxide-pyridine complex Substances O=S(=O)=O.C1=CC=NC=C1 UDYFLDICVHJSOY-UHFFFAOYSA-N 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 1
- YDBPZCVWPFMBDH-QMMMGPOBSA-N tert-butyl (2s)-2-formylpyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@H]1C=O YDBPZCVWPFMBDH-QMMMGPOBSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- PVPLWNKSNCRQIL-UHFFFAOYSA-N tert-butyl n-(2-oxo-2-piperazin-1-ylethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCC(=O)N1CCNCC1 PVPLWNKSNCRQIL-UHFFFAOYSA-N 0.000 description 1
- PJTWPKBONLYELA-UHFFFAOYSA-N tert-butyl n-(2-propan-2-ylsulfanylethyl)carbamate Chemical compound CC(C)SCCNC(=O)OC(C)(C)C PJTWPKBONLYELA-UHFFFAOYSA-N 0.000 description 1
- RCCFFUWZUZTCKS-UHFFFAOYSA-N tert-butyl n-(4-morpholin-4-yl-4-oxobutyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCC(=O)N1CCOCC1 RCCFFUWZUZTCKS-UHFFFAOYSA-N 0.000 description 1
- IUKIKGAICKWMEB-JTQLQIEISA-N tert-butyl n-[(2s)-1-cyclohexyl-1-oxopropan-2-yl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@@H](C)C(=O)C1CCCCC1 IUKIKGAICKWMEB-JTQLQIEISA-N 0.000 description 1
- XLZIHYVTYKBURB-UHFFFAOYSA-N tert-butyl n-[2-(2-methylpropanoylamino)ethyl]carbamate Chemical compound CC(C)C(=O)NCCNC(=O)OC(C)(C)C XLZIHYVTYKBURB-UHFFFAOYSA-N 0.000 description 1
- KDUVCUPPTBXJBO-UHFFFAOYSA-N tert-butyl n-[2-(2-methylpropylamino)ethyl]carbamate Chemical compound CC(C)CNCCNC(=O)OC(C)(C)C KDUVCUPPTBXJBO-UHFFFAOYSA-N 0.000 description 1
- QZRWPFZTDCFKJD-UHFFFAOYSA-N tert-butyl n-methyl-n-(2-morpholin-4-yl-2-oxoethyl)carbamate Chemical compound CC(C)(C)OC(=O)N(C)CC(=O)N1CCOCC1 QZRWPFZTDCFKJD-UHFFFAOYSA-N 0.000 description 1
- GRXWPQAWZSPNEL-UHFFFAOYSA-N tert-butyl n-methyl-n-(2-propan-2-ylsulfanylethyl)carbamate Chemical compound CC(C)SCCN(C)C(=O)OC(C)(C)C GRXWPQAWZSPNEL-UHFFFAOYSA-N 0.000 description 1
- JVLKRTPEOBUMND-UHFFFAOYSA-N tert-butyl n-methyl-n-(4-morpholin-4-yl-4-oxobutyl)carbamate Chemical compound CC(C)(C)OC(=O)N(C)CCCC(=O)N1CCOCC1 JVLKRTPEOBUMND-UHFFFAOYSA-N 0.000 description 1
- JMJKJPYCYXYIKX-UHFFFAOYSA-N tert-butyl n-methyl-n-(5-methyl-2-oxohexyl)carbamate Chemical compound CC(C)CCC(=O)CN(C)C(=O)OC(C)(C)C JMJKJPYCYXYIKX-UHFFFAOYSA-N 0.000 description 1
- AYPUSKFCXWLMPC-UHFFFAOYSA-N tert-butyl n-methyl-n-[2-[methyl(2-methylpropanoyl)amino]ethyl]carbamate Chemical compound CC(C)C(=O)N(C)CCN(C)C(=O)OC(C)(C)C AYPUSKFCXWLMPC-UHFFFAOYSA-N 0.000 description 1
- GGTOAXIBHBEVAY-UHFFFAOYSA-N tert-butyl n-methyl-n-[2-[methyl(3-methylbutanoyl)amino]ethyl]carbamate Chemical compound CC(C)CC(=O)N(C)CCN(C)C(=O)OC(C)(C)C GGTOAXIBHBEVAY-UHFFFAOYSA-N 0.000 description 1
- PFXNTPGOTWVMMJ-UHFFFAOYSA-N tert-butyl n-methyl-n-[3-(2-methylpropylsulfanyl)propyl]carbamate Chemical compound CC(C)CSCCCN(C)C(=O)OC(C)(C)C PFXNTPGOTWVMMJ-UHFFFAOYSA-N 0.000 description 1
- KCCYLHGGUGVWHR-UHFFFAOYSA-N tert-butyl n-methyl-n-[4-[methyl(propan-2-yl)amino]-4-oxobutyl]carbamate Chemical compound CC(C)N(C)C(=O)CCCN(C)C(=O)OC(C)(C)C KCCYLHGGUGVWHR-UHFFFAOYSA-N 0.000 description 1
- LWTRJLXQUHESTO-UHFFFAOYSA-N tert-butyl n-methyl-n-[5-[methyl(propan-2-yl)amino]-5-oxopentyl]carbamate Chemical compound CC(C)N(C)C(=O)CCCCN(C)C(=O)OC(C)(C)C LWTRJLXQUHESTO-UHFFFAOYSA-N 0.000 description 1
- BNOQLZQAFGIEIE-UHFFFAOYSA-N tert-butyl n-methyl-n-[5-oxo-5-(propan-2-ylamino)pentyl]carbamate Chemical compound CC(C)NC(=O)CCCCN(C)C(=O)OC(C)(C)C BNOQLZQAFGIEIE-UHFFFAOYSA-N 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000000341 threoninyl group Chemical group [H]OC([H])(C([H])([H])[H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- LZTRCELOJRDYMQ-UHFFFAOYSA-N triphenylmethanol Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)C1=CC=CC=C1 LZTRCELOJRDYMQ-UHFFFAOYSA-N 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000430 tryptophan group Chemical group [H]N([H])C(C(=O)O*)C([H])([H])C1=C([H])N([H])C2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- 125000002114 valyl group Chemical group 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/64—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms, e.g. histidine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/205—Radicals derived from carbonic acid
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S530/00—Chemistry: natural resins or derivatives; peptides or proteins; lignins or reaction products thereof
- Y10S530/86—Renin inhibitors
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Cardiology (AREA)
- Public Health (AREA)
- Heart & Thoracic Surgery (AREA)
- Hospice & Palliative Care (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB878714597A GB8714597D0 (en) | 1987-06-22 | 1987-06-22 | Peptide compounds |
GB878725511A GB8725511D0 (en) | 1987-10-30 | 1987-10-30 | Peptide compounds |
GB888805389A GB8805389D0 (en) | 1988-03-07 | 1988-03-07 | New peptide compounds process for preparation thereof & pharmaceutical composition comprising same |
Publications (1)
Publication Number | Publication Date |
---|---|
PH27181A true PH27181A (en) | 1993-04-16 |
Family
ID=27263470
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PH37089A PH27181A (en) | 1987-06-22 | 1988-06-17 | New histidyl amino acid derivatives and pharmaceutical composition comprising the same |
Country Status (20)
Country | Link |
---|---|
US (2) | US4921855A (es) |
EP (1) | EP0300189B1 (es) |
JP (1) | JPH0625147B2 (es) |
KR (1) | KR950003926B1 (es) |
CN (1) | CN1026892C (es) |
AR (1) | AR247733A1 (es) |
AT (1) | ATE113585T1 (es) |
AU (1) | AU617674B2 (es) |
DE (1) | DE3851986T2 (es) |
DK (1) | DK340088A (es) |
ES (1) | ES2067456T3 (es) |
FI (1) | FI96202C (es) |
HK (1) | HK18796A (es) |
HU (2) | HU202212B (es) |
IE (1) | IE65807B1 (es) |
IL (1) | IL86782A (es) |
NO (1) | NO175371C (es) |
PH (1) | PH27181A (es) |
PT (1) | PT87754B (es) |
RU (1) | RU1801107C (es) |
Families Citing this family (73)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0236734A3 (de) * | 1986-02-07 | 1988-05-11 | Ciba-Geigy Ag | Durch schwefelhaltigen Gruppen substituierte 5-Amino-4-hydroxyvalerylderivate |
FI89058C (fi) * | 1987-02-27 | 1993-08-10 | Yamanouchi Pharma Co Ltd | Foerfarande foer framstaellning av som remin-inhibitorer anvaenda 2-(l-alanyl-l-histidylamino)-butanol-derivat |
DE68916271T2 (de) * | 1988-01-26 | 1995-02-23 | Sankyo Co | Renin inhibierende Polypeptide, ihre Herstellung und Anwendung. |
US5151513A (en) * | 1988-04-29 | 1992-09-29 | E. R. Squibb & Sons, Inc. | N-heterocyclic alcohol derivatives |
US5229369A (en) * | 1988-07-01 | 1993-07-20 | G. D. Searle & Co. | Aminoalkylaminocarbonyl aminodiol amino acid derivatives as anti-hypertensive agents |
US4900746A (en) * | 1988-07-01 | 1990-02-13 | G. D. Searle & Co. | Ethereal N-terminal aminodiol amino acid derivatives as anti-hypertensive agents |
US5229420A (en) * | 1988-07-01 | 1993-07-20 | G. D. Searle & Co. | Ethereal N-terminal aminodiol amino acid derivatives as anti-hypertensive agents |
US5246959A (en) * | 1988-07-01 | 1993-09-21 | G. D. Searle & Co. | Poly(aminoalkyl)aminocarbonyl aminoacyl aminodiol amino acid derivatives as anti-hypertensive agents |
US4902706A (en) * | 1988-07-01 | 1990-02-20 | G. D. Searle & Co. | Aminoalkylaminocarbonyl aminodiol amino acid derivatives as antihypertensive agents |
FI893212A (fi) * | 1988-07-01 | 1990-01-02 | Searle & Co | Antihypertensiva aminoalkylaminokarbo- nylaminodiolaminsyraderivat. |
NO892727L (no) * | 1988-07-01 | 1990-01-02 | Searle & Co | Eterholdige n-terminale aminodiolaminosyre derivater som anti-hypertensive midler. |
EP0355331A3 (en) * | 1988-07-01 | 1991-08-14 | G.D. Searle & Co. | Poly(aminoalkyl)aminocarbonyl aminoacyl aminodiol amino acid derivatives as anti-hypertensive agents |
US4900745A (en) * | 1988-07-01 | 1990-02-13 | G. D. Searle & Co. | Poly(aminoalkyl)aminocarbonyl aminodiol amino acid derivatives as anti-hypertensive agents |
JPH03204860A (ja) * | 1989-05-02 | 1991-09-06 | Japan Tobacco Inc | レニン阻害活性を有する新規アミノ酸誘導体 |
ATE135368T1 (de) * | 1989-09-12 | 1996-03-15 | Hoechst Ag | Aminosäurederivate mit reninhemmenden eigenschaften, verfahren zu deren herstellung, diese enthaltende mittel und deren verwendung |
US5104869A (en) * | 1989-10-11 | 1992-04-14 | American Cyanamid Company | Renin inhibitors |
US5231111A (en) * | 1989-12-04 | 1993-07-27 | G. D. Searle & Co. | Imidazolyl/imidazolylalkyl-N-terminal cycloalkoxy-C-terminal amino hydroxy β-amino acid derivatives |
US5175181A (en) * | 1989-12-04 | 1992-12-29 | G. D. Searle & Co. | Imidazolyl/imidazolylalkyl-N-terminal amino hydroxy |
US5217989A (en) * | 1989-12-04 | 1993-06-08 | G. D. Searle & Co. | Benothiophenyl/benzothiophenylalkyl-N-terminal cycloalkoxy-C-terminal amino hydroxy β-amino acid derivatives |
US5147888A (en) * | 1989-12-04 | 1992-09-15 | G. D. Searle & Co. | N-terminal indolyy indolylalkylaminodiol β-amino acid derivatives |
US5175170A (en) * | 1989-12-04 | 1992-12-29 | G. D. Searle & Co. | β-amino acid derivatives |
US5215996A (en) * | 1989-12-04 | 1993-06-01 | G. D. Searle & Co. | Naphthyridinyl/naphthyridinylalkyl-N-terminal cycloalkoxy-C-terminal amino hydroxy β-amino acid derivatives |
US5212175A (en) * | 1989-12-04 | 1993-05-18 | G. D. Searle & Co. | Benzothiophenyl benzothiophenylalkyl-N-terminal amino hydroxy β-amino acid derivatives |
US5171751A (en) * | 1989-12-04 | 1992-12-15 | G. D. Searle & Co. | Benzofuran/benzofuranalkyl-N-terminal amino hydroxy |
DE69016760T2 (de) * | 1989-12-04 | 1995-07-06 | Searle & Co | Heterozyklische Acylaminodiol-beta-aminosäure-Derivate. |
US5223512A (en) * | 1989-12-04 | 1993-06-29 | G. D. Searle & Co. | Quinolonyl/quinolonylalkyl-N-terminal cycloalkoxy-C-terminal amino hydroxy β-amino acid derivatives |
US5210095A (en) * | 1989-12-04 | 1993-05-11 | G. D. Searle & Co. | Chromonyl/chromonylalkyl-N-terminal amino hydroxy |
US5179102A (en) * | 1989-12-04 | 1993-01-12 | G. D. Searle & Co. | Naphthyridinyl/naphthyridinylalkyl-n-terminal anino hydroxy β-amino acid derivatives |
US5217991A (en) * | 1989-12-04 | 1993-06-08 | G. D. Searle & Co. | Cycloalkyl/cycloalkylalkyl-N-terminal cycloalkoxy-C-terminal amino hydroxy β-amino acid derivatives |
US5217988A (en) * | 1989-12-04 | 1993-06-08 | G. D. Searle & Co. | Indolyl indolylakyl-N-terminal cycloalkoxy-C-terminal amino hydroxyβ-amino acid derivatives |
US5180725A (en) * | 1989-12-04 | 1993-01-19 | G. D. Searle & Co. | Quinoxalinyl/quinoxaliy; alkyl-N-terminal amino hydroxy |
US5223514A (en) * | 1989-12-04 | 1993-06-29 | G. D. Searle & Co. | Quinolinyl/quinolinylalkyl-N-terminal cycloalkoxy-C-terminal amino hydroxy β-amino acid derivatives |
US5223534A (en) * | 1989-12-04 | 1993-06-29 | G. D. Searle & Co. | Benzofuuranyl/benofuranylaklyl-N-terminal cycloalkoxy-C-terminal amino hydroxy β-amino acid derivatives |
US5223532A (en) * | 1989-12-04 | 1993-06-29 | G. D. Searle & Co. | Chromonyl/chromonylalkyl-N-terminal cycloalkoxy-C-terminal amino hydroxy β-amino derivatives |
US5216013A (en) * | 1989-12-04 | 1993-06-01 | G. D. Searle & Co. | Aralkyl-N-terminal cycloalkoxy-C terminal amino hydroxy β-amino acid derivatives |
US5180744A (en) * | 1989-12-04 | 1993-01-19 | G. D. Searle & Co. | Aralkyl-N-terminal amino hydroxy |
US5194605A (en) * | 1989-12-08 | 1993-03-16 | Merck & Co., Inc. | Cyclic renin inhibitors containing 2-substituted (3S,4S)-4-amino-5-cyclohexyl-3-hydroxy pentanoic acid, 2-substituted (3S,4S)-5-cyclohexyl-3,4-di-hydroxy pentanoic acid or 2-substituted (4S,5S)-5-amino-6-cyclohexyl-4-hydroxyhexanoic acid or its analogs |
US5254682A (en) * | 1989-12-08 | 1993-10-19 | Merck & Co., Inc. | Cyclic renin inhibitors containing 3(S)-amino-4-cyclohexyl-2(R)-hydroxy-butanoic acid or 4-cyclo-hexyl-(2R, 3S)-dihydroxybutanoic acid or related analogs |
DE4008403A1 (de) * | 1990-03-16 | 1991-09-19 | Merck Patent Gmbh | Glykolsaeurederivate |
US5430022A (en) * | 1990-05-14 | 1995-07-04 | Fujisawa Pharmaceutical Co., Ltd. | Peptide compound and its preparation |
CA2044564A1 (en) * | 1990-06-28 | 1991-12-29 | Quirico Branca | Amino acid derivatives |
US5278161A (en) * | 1990-06-28 | 1994-01-11 | Hoffmann-La Roche Inc. | Amino acid derivatives useful as renin inhibitors |
IL99389A0 (en) * | 1990-09-17 | 1992-08-18 | Fujisawa Pharmaceutical Co | Amino acid derivatives,processes for the preparation thereof and pharmaceutical compositions containing the same |
ZA921381B (en) * | 1991-03-01 | 1992-11-25 | Fujisawa Pharmaceutical Co | New use of amino acid derivatives |
WO1992017456A1 (en) * | 1991-03-26 | 1992-10-15 | Fujisawa Pharmaceutical Co., Ltd. | Amino acid derivative and salt thereof |
US5223535A (en) * | 1991-10-29 | 1993-06-29 | G. D. Searle & Co. | Propargyl glycine amino propargyl diol compounds for treatment of hypertension |
US5227401A (en) * | 1991-10-29 | 1993-07-13 | G. D. Searle & Co. | Ethynyl alanine amino diol compounds for treatment of hypertension |
US5330996A (en) * | 1991-10-29 | 1994-07-19 | G. D. Searle & Co. | Amino acyl amino propargyl diol compounds for treatment of hypertension |
GB9127041D0 (en) * | 1991-12-20 | 1992-02-19 | Fujisawa Pharmaceutical Co | New use |
JP2578044B2 (ja) * | 1992-03-14 | 1997-02-05 | 呉羽化学工業株式会社 | フェニルアラニン−グリシン誘導体、その製造方法、及びその誘導体を含有する抗腫瘍剤 |
US5523410A (en) * | 1992-07-02 | 1996-06-04 | Fujisawa Pharmaceutical Co., Ltd. | Intermediate for synthesis and production of amino acid derivative |
US5268391A (en) * | 1992-07-20 | 1993-12-07 | C. D. Searle & Co. | Propargyl-terminated cycloalkylalkyl-P2-site substituted aryl/alkylsulfonyl-terminated alanine amino-diol compounds for treatment of hypertension |
US5314920A (en) * | 1992-07-20 | 1994-05-24 | G. D. Searle & Co. | Ethynyl-alanine aryl/alkylsulfonyl-terminated amino-diol compounds for treatment of hypertension |
US5317039A (en) * | 1992-07-20 | 1994-05-31 | G. D. Searle & Co. | Cyclopropyl-alanine aryl/alkylsulfide/sulfonyl-terminated amino-diol compounds for treatment of hypertension |
US5246969A (en) * | 1992-07-20 | 1993-09-21 | G. D. Searle & Co. | Di-propargyl-containing aryl/alkylsulfonyl-terminated alanine amino-diol compounds for treatment of hypertension |
US5252591A (en) * | 1992-08-14 | 1993-10-12 | G. D. Searle & Company | Pyridinyl-terminated alkylamino ethynyl alanine amino diol compounds for treatment of hypertension |
US5212185A (en) * | 1992-08-14 | 1993-05-18 | G. D. Searle & Co. | Piperidinyl-terminated alkylamino ethynyl alanine amino diol compounds for treatment of hypertension |
US5298505A (en) * | 1992-08-14 | 1994-03-29 | G. D. Searle & Co. | Ethynyl alanine amino diol compounds having a piperazinyl-terminated group or a piperazinyl-alkylamino-terminated group for treatment of hypertension |
US5422349A (en) * | 1992-08-14 | 1995-06-06 | G. D. Seale & Co. | Morpholino-oxazinyl-terminated alkylamino ethynyl alanine amino diol compounds for treatment of hypertension |
US5373017A (en) * | 1992-08-14 | 1994-12-13 | G. D. Searle & Co. | Imidazolyl/benzimidazolyl-terminated alkylamino ethynyl alanine amino diol compounds for treatment of hypertension |
US5312838A (en) * | 1992-09-21 | 1994-05-17 | G. D. Searle & Co. | β-alanineamide aryl/alkylsulfide/sulfonyl-terminated amino-diol compounds for treatment of hypertension |
JP3134936B2 (ja) * | 1992-10-16 | 2001-02-13 | 沖電気工業株式会社 | 衝撃センサ |
GB9313330D0 (en) * | 1993-06-28 | 1993-08-11 | Fujisawa Pharmaceutical Co | New compound and its preparation |
US5414018A (en) * | 1993-09-24 | 1995-05-09 | G. D. Searle & Co. | Alkylaminoalkyl-terminated sulfide/sulfonyl-containing propargyl amino-diol compounds for treatment of hypertension |
US5383540A (en) * | 1993-10-04 | 1995-01-24 | Ford Motor Company | Torque converter bypass clutch piston-pump drive for an automatic transmission |
US5416119A (en) * | 1993-10-25 | 1995-05-16 | G. D. Searle & Co. | Alkylaminoalkyl-terminated sulfide/sulfonyl-containing cycloalkyl-alanine amino-diol compounds for treatment of hypertension |
US5432201A (en) * | 1993-11-22 | 1995-07-11 | G. D. Searle & Co. | Alkylaminoalkyl-sulfonyl-terminated β-alanineamide amino-diol compounds for treatment of hypertension |
US5780494A (en) * | 1994-11-14 | 1998-07-14 | G. D. Searle & Co. | Piperidinyl-terminated alkylamino ethynl alanine amino diol compounds for treatment of hypertension |
US6750344B1 (en) * | 1997-09-05 | 2004-06-15 | Isis Pharmaceuticals, Inc. | Amine compounds and combinatorial libraries comprising same |
DE10032878A1 (de) * | 2000-07-06 | 2002-01-17 | Bayer Ag | Anthelmintika zur Verhinderung von parasitären Infektionen bei Mensch und Tier |
WO2007028654A1 (en) | 2005-09-09 | 2007-03-15 | Smithkline Beecham Corporation | Pyridine derivatives and their use in the treatment of psychotic disorders |
WO2012068251A2 (en) | 2010-11-16 | 2012-05-24 | Texas Heart Institute | Agonists that enhance binding of integrin-expressing cells to integrin receptors |
CN104510481A (zh) * | 2013-09-26 | 2015-04-15 | 温州市高德医疗器械有限公司 | 高血压三项酶抑制剂真空采血管及其制作方法 |
Family Cites Families (13)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4073905A (en) * | 1971-07-19 | 1978-02-14 | Boehringer Ingelheim Gmbh | 2-Amino-4-phenyl-2-imidazolines and salts thereof |
JPS60163899A (ja) * | 1984-02-03 | 1985-08-26 | Sankyo Co Ltd | レニン阻害ペプチド類 |
US4652551A (en) * | 1984-06-22 | 1987-03-24 | Abbott Laboratories | Renin inhibiting compounds |
US4845079A (en) * | 1985-01-23 | 1989-07-04 | Luly Jay R | Peptidylaminodiols |
DK34086A (da) * | 1985-01-23 | 1986-07-24 | Abbott Lab | Peptidylaminodioler |
JPS61236770A (ja) * | 1985-04-15 | 1986-10-22 | Kissei Pharmaceut Co Ltd | 新規なアミノ酸誘導体 |
US4826815A (en) * | 1985-05-17 | 1989-05-02 | Abbott Laboratories | Renin inhibiting compounds |
EP0206807A3 (en) * | 1985-06-28 | 1988-01-20 | Kissei Pharmaceutical Co. Ltd. | Novel amino acid derivatives |
IL81234A (en) * | 1986-01-16 | 1992-09-06 | Abbott Lab | Peptidylaminodiols,process for their preparation and pharmaceutical compositions comprising them |
EP0258289A4 (en) * | 1986-01-16 | 1991-01-02 | Joseph Dellaria | Peptide analogs |
EP0244083A3 (en) * | 1986-04-01 | 1989-11-15 | Kissei Pharmaceutical Co. Ltd. | Amino acid derivatives |
US4656269A (en) * | 1986-04-15 | 1987-04-07 | Kissei Pharmaceutical Co., Ltd. | Histidine derivatives |
US4895834A (en) * | 1986-12-15 | 1990-01-23 | Warner-Lambert Company | Renin inhibitors III |
-
1988
- 1988-06-09 US US07/204,549 patent/US4921855A/en not_active Expired - Fee Related
- 1988-06-13 IE IE177888A patent/IE65807B1/en not_active IP Right Cessation
- 1988-06-14 EP EP88109430A patent/EP0300189B1/en not_active Expired - Lifetime
- 1988-06-14 DE DE3851986T patent/DE3851986T2/de not_active Expired - Fee Related
- 1988-06-14 AT AT88109430T patent/ATE113585T1/de not_active IP Right Cessation
- 1988-06-14 ES ES88109430T patent/ES2067456T3/es not_active Expired - Lifetime
- 1988-06-16 FI FI882875A patent/FI96202C/fi not_active IP Right Cessation
- 1988-06-16 IL IL86782A patent/IL86782A/xx not_active IP Right Cessation
- 1988-06-17 PH PH37089A patent/PH27181A/en unknown
- 1988-06-17 PT PT87754A patent/PT87754B/pt not_active IP Right Cessation
- 1988-06-18 KR KR1019880007364A patent/KR950003926B1/ko not_active IP Right Cessation
- 1988-06-21 AU AU18190/88A patent/AU617674B2/en not_active Ceased
- 1988-06-21 RU SU884356019A patent/RU1801107C/ru active
- 1988-06-21 CN CN88103878A patent/CN1026892C/zh not_active Expired - Fee Related
- 1988-06-21 AR AR88311180A patent/AR247733A1/es active
- 1988-06-21 DK DK340088A patent/DK340088A/da not_active Application Discontinuation
- 1988-06-21 HU HU883164A patent/HU202212B/hu not_active IP Right Cessation
- 1988-06-21 NO NO882732A patent/NO175371C/no unknown
- 1988-06-21 JP JP63153041A patent/JPH0625147B2/ja not_active Expired - Lifetime
-
1990
- 1990-01-08 US US07/462,117 patent/US5142048A/en not_active Expired - Fee Related
-
1995
- 1995-06-22 HU HU95P/P00356P patent/HU211977A9/hu unknown
-
1996
- 1996-02-01 HK HK18796A patent/HK18796A/xx not_active IP Right Cessation
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
PH27181A (en) | New histidyl amino acid derivatives and pharmaceutical composition comprising the same | |
US4963530A (en) | Renin inhibitor peptide compounds, a process for the preparation thereof and pharmaceutical composition comprising the same | |
US4548926A (en) | Hypotensive peptides and their use | |
US4914129A (en) | Antihypertensive 5-amino-4-hydroxyvaleryl derivatives substituted by sulphur-containing groups | |
RU2092491C1 (ru) | Производные пептидов или их фармацевтически приемлемые соли, способ получения производных пептидов и фармацевтическая композиция | |
US5273982A (en) | Acetic acid derivatives | |
US5045537A (en) | Hydrophilic renin inhibitors, their preparation and use | |
US6100278A (en) | N-(arylsulphonyl)amino acid derivatives, process for their preparation and pharmaceutical compositions containing them | |
AU2935002A (en) | New alpha-amino acid sulphonyl compounds, a process for their preparation and pharmaceutical compositions comprising them | |
EP0513675B1 (en) | New peptide compound and a process for the preparation thereof | |
SK279706B6 (sk) | Ýroby, ako aj medziproduktyna ich výrobu | |
US5523410A (en) | Intermediate for synthesis and production of amino acid derivative | |
US5223489A (en) | Amino acid derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
US5491132A (en) | Amino acid derivatives, a process for the preparation thereof and pharmaceutical composition comprising the same | |
CA1285563C (en) | Ureidoalkanoylaminocarbonyl amino and imino acids and esters | |
RU2070195C1 (ru) | Аминокислотные производные или их фармацевтически приемлемые соли и фармацевтическая композиция на их основе | |
US4749781A (en) | Aminocarbonyl renin inhibitors | |
US5126451A (en) | Renin inhibitors containing α-heteroatom amino acids | |
JPH06172318A (ja) | 新規合成中間体およびアミノ酸誘導体の製造法 | |
JPH0616645A (ja) | 新規合成中間体およびアミノ酸誘導体の製造法 |