NO771449L - Kopolymeriserbar, hydrofil, filmdannende stivelsesblanding - Google Patents
Kopolymeriserbar, hydrofil, filmdannende stivelsesblandingInfo
- Publication number
- NO771449L NO771449L NO771449A NO771449A NO771449L NO 771449 L NO771449 L NO 771449L NO 771449 A NO771449 A NO 771449A NO 771449 A NO771449 A NO 771449A NO 771449 L NO771449 L NO 771449L
- Authority
- NO
- Norway
- Prior art keywords
- starch
- ethylenically unsaturated
- mixture
- weight
- water
- Prior art date
Links
- 229920002472 Starch Polymers 0.000 title claims description 607
- 235000019698 starch Nutrition 0.000 title claims description 605
- 239000008107 starch Substances 0.000 title claims description 549
- 239000000203 mixture Substances 0.000 title claims description 161
- 239000000178 monomer Substances 0.000 claims description 122
- 238000000576 coating method Methods 0.000 claims description 95
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 95
- 239000011248 coating agent Substances 0.000 claims description 61
- -1 hydroxyalkyl acrylate Chemical compound 0.000 claims description 61
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 44
- 229920001577 copolymer Polymers 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 32
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 26
- 238000006116 polymerization reaction Methods 0.000 claims description 23
- 239000003431 cross linking reagent Substances 0.000 claims description 22
- 239000000654 additive Substances 0.000 claims description 21
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 21
- 229920000856 Amylose Polymers 0.000 claims description 20
- 238000007334 copolymerization reaction Methods 0.000 claims description 20
- 239000003599 detergent Substances 0.000 claims description 20
- 239000000758 substrate Substances 0.000 claims description 19
- 229920000642 polymer Polymers 0.000 claims description 17
- 230000000977 initiatory effect Effects 0.000 claims description 16
- 238000004519 manufacturing process Methods 0.000 claims description 16
- 125000000962 organic group Chemical group 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 14
- 150000003254 radicals Chemical class 0.000 claims description 11
- 230000008569 process Effects 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000011521 glass Substances 0.000 claims description 9
- 238000006467 substitution reaction Methods 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 239000004698 Polyethylene Substances 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 229920000573 polyethylene Polymers 0.000 claims description 7
- 230000000996 additive effect Effects 0.000 claims description 6
- 229920001519 homopolymer Polymers 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 230000009477 glass transition Effects 0.000 claims description 5
- 239000003505 polymerization initiator Substances 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 230000000694 effects Effects 0.000 claims description 4
- 239000008240 homogeneous mixture Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000007870 radical polymerization initiator Substances 0.000 claims description 3
- 238000010526 radical polymerization reaction Methods 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 238000011161 development Methods 0.000 claims description 2
- TWNIBLMWSKIRAT-VFUOTHLCSA-N levoglucosan Chemical group O[C@@H]1[C@@H](O)[C@H](O)[C@H]2CO[C@@H]1O2 TWNIBLMWSKIRAT-VFUOTHLCSA-N 0.000 claims description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 2
- 230000007704 transition Effects 0.000 claims 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 238000006555 catalytic reaction Methods 0.000 claims 1
- 235000015243 ice cream Nutrition 0.000 claims 1
- 150000002500 ions Chemical class 0.000 claims 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 238000012360 testing method Methods 0.000 description 16
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 15
- 239000007787 solid Substances 0.000 description 15
- 230000002209 hydrophobic effect Effects 0.000 description 14
- 150000002170 ethers Chemical class 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical class OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 239000000123 paper Substances 0.000 description 9
- 230000002829 reductive effect Effects 0.000 description 9
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 239000000376 reactant Substances 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- 239000008199 coating composition Substances 0.000 description 7
- 230000002441 reversible effect Effects 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 6
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 6
- 230000003213 activating effect Effects 0.000 description 6
- 238000001212 derivatisation Methods 0.000 description 6
- 239000002270 dispersing agent Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- 239000003999 initiator Substances 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 5
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 5
- 229920000945 Amylopectin Polymers 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 5
- 229910000831 Steel Inorganic materials 0.000 description 5
- 150000003926 acrylamides Chemical class 0.000 description 5
- 125000000129 anionic group Chemical group 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000010959 steel Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 5
- 150000003672 ureas Chemical class 0.000 description 5
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- OROQEEMZZJQQSA-UHFFFAOYSA-N [N].NC(=O)C=C Chemical group [N].NC(=O)C=C OROQEEMZZJQQSA-UHFFFAOYSA-N 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 4
- 230000001070 adhesive effect Effects 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000001125 extrusion Methods 0.000 description 4
- 230000006870 function Effects 0.000 description 4
- 238000001879 gelation Methods 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 230000008961 swelling Effects 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 238000005266 casting Methods 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- 239000002706 dry binder Substances 0.000 description 3
- 238000006266 etherification reaction Methods 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 238000007654 immersion Methods 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- 239000002198 insoluble material Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- LVHBHZANLOWSRM-UHFFFAOYSA-N itaconic acid Chemical compound OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000002195 soluble material Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- INQDDHNZXOAFFD-UHFFFAOYSA-N 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOCCOC(=O)C=C INQDDHNZXOAFFD-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 229920001685 Amylomaize Polymers 0.000 description 2
- 239000004859 Copal Substances 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 229920001353 Dextrin Polymers 0.000 description 2
- 239000004375 Dextrin Substances 0.000 description 2
- 241000782205 Guibourtia conjugata Species 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 235000019759 Maize starch Nutrition 0.000 description 2
- 240000003183 Manihot esculenta Species 0.000 description 2
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 2
- 229920000877 Melamine resin Polymers 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- 229920000881 Modified starch Polymers 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 240000004713 Pisum sativum Species 0.000 description 2
- 235000010582 Pisum sativum Nutrition 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- 240000006394 Sorghum bicolor Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 238000007605 air drying Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 102000004139 alpha-Amylases Human genes 0.000 description 2
- 108090000637 alpha-Amylases Proteins 0.000 description 2
- 229940024171 alpha-amylase Drugs 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000002518 antifoaming agent Substances 0.000 description 2
- 239000008365 aqueous carrier Substances 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 238000003490 calendering Methods 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 230000007515 enzymatic degradation Effects 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 238000005530 etching Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 239000007970 homogeneous dispersion Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 125000005027 hydroxyaryl group Chemical group 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- 229920000193 polymethacrylate Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- 238000007639 printing Methods 0.000 description 2
- YKYONYBAUNKHLG-UHFFFAOYSA-N propyl acetate Chemical compound CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000012966 redox initiator Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 125000004964 sulfoalkyl group Chemical group 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 description 1
- LOOYILPGRRZJKX-WAYWQWQTSA-N (Z)-2,3-bis(2-sulfoethyl)but-2-enedioic acid Chemical compound OS(=O)(=O)CC/C(C(=O)O)=C(\CCS(O)(=O)=O)C(O)=O LOOYILPGRRZJKX-WAYWQWQTSA-N 0.000 description 1
- BXJGOEHRDAKYMX-BQYQJAHWSA-N (e)-2,3-bis(3-hydroxypropyl)but-2-enedioic acid Chemical compound OCCC\C(C(O)=O)=C(C(O)=O)\CCCO BXJGOEHRDAKYMX-BQYQJAHWSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KAJRUHJCBCZULP-UHFFFAOYSA-N 1-cyclohepta-1,3-dien-1-ylcyclohepta-1,3-diene Chemical compound C1CCC=CC=C1C1=CC=CCCC1 KAJRUHJCBCZULP-UHFFFAOYSA-N 0.000 description 1
- QRIMLDXJAPZHJE-UHFFFAOYSA-N 2,3-dihydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(O)CO QRIMLDXJAPZHJE-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- MZJSINIFJJRPLQ-ARJAWSKDSA-N 2-[(z)-4-ethoxy-4-oxobut-2-enoyl]oxyethanesulfonic acid Chemical compound CCOC(=O)\C=C/C(=O)OCCS(O)(=O)=O MZJSINIFJJRPLQ-ARJAWSKDSA-N 0.000 description 1
- ZOHYZXHOQZNECJ-UHFFFAOYSA-N 2-[3-(2-sulfoethoxycarbonyl)but-3-enoyloxy]ethanesulfonic acid Chemical compound OS(=O)(=O)CCOC(=O)CC(=C)C(=O)OCCS(O)(=O)=O ZOHYZXHOQZNECJ-UHFFFAOYSA-N 0.000 description 1
- WFUGQJXVXHBTEM-UHFFFAOYSA-N 2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane Chemical compound CCC(C)(OO)OOC(C)(CC)OO WFUGQJXVXHBTEM-UHFFFAOYSA-N 0.000 description 1
- SQVSEQUIWOQWAH-UHFFFAOYSA-N 2-hydroxy-3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid Chemical compound CC(=C)C(=O)OCC(O)CS(O)(=O)=O SQVSEQUIWOQWAH-UHFFFAOYSA-N 0.000 description 1
- UBYWYEGPDNYPHZ-NSCUHMNNSA-N 2-hydroxyethyl (e)-but-2-enoate Chemical compound C\C=C\C(=O)OCCO UBYWYEGPDNYPHZ-NSCUHMNNSA-N 0.000 description 1
- GWZMWHWAWHPNHN-UHFFFAOYSA-N 2-hydroxypropyl prop-2-enoate Chemical compound CC(O)COC(=O)C=C GWZMWHWAWHPNHN-UHFFFAOYSA-N 0.000 description 1
- BQZJOQXSCSZQPS-UHFFFAOYSA-N 2-methoxy-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(OC)C(=O)C1=CC=CC=C1 BQZJOQXSCSZQPS-UHFFFAOYSA-N 0.000 description 1
- KDTZBYPBMTXCSO-UHFFFAOYSA-N 2-phenoxyphenol Chemical compound OC1=CC=CC=C1OC1=CC=CC=C1 KDTZBYPBMTXCSO-UHFFFAOYSA-N 0.000 description 1
- GQTFHSAAODFMHB-UHFFFAOYSA-N 2-prop-2-enoyloxyethanesulfonic acid Chemical compound OS(=O)(=O)CCOC(=O)C=C GQTFHSAAODFMHB-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- FIHBHSQYSYVZQE-UHFFFAOYSA-N 6-prop-2-enoyloxyhexyl prop-2-enoate Chemical compound C=CC(=O)OCCCCCCOC(=O)C=C FIHBHSQYSYVZQE-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 235000005273 Canna coccinea Nutrition 0.000 description 1
- 240000008555 Canna flaccida Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 125000002353 D-glucosyl group Chemical group C1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 206010059866 Drug resistance Diseases 0.000 description 1
- 239000004908 Emulsion polymer Substances 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical class OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 229910001335 Galvanized steel Inorganic materials 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- DRAJWRKLRBNJRQ-UHFFFAOYSA-N Hydroxycarbamic acid Chemical compound ONC(O)=O DRAJWRKLRBNJRQ-UHFFFAOYSA-N 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 1
- 229920001612 Hydroxyethyl starch Polymers 0.000 description 1
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 1
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 1
- 244000017020 Ipomoea batatas Species 0.000 description 1
- 235000002678 Ipomoea batatas Nutrition 0.000 description 1
- 244000151018 Maranta arundinacea Species 0.000 description 1
- 235000010804 Maranta arundinacea Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920005372 Plexiglas® Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101000916532 Rattus norvegicus Zinc finger and BTB domain-containing protein 38 Proteins 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 240000008548 Shorea javanica Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 101100028325 Streptomyces rimosus oxyT gene Proteins 0.000 description 1
- 235000012419 Thalia geniculata Nutrition 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- HVVWZTWDBSEWIH-UHFFFAOYSA-N [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate Chemical compound C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C HVVWZTWDBSEWIH-UHFFFAOYSA-N 0.000 description 1
- URNGCTWQCDHJPL-UHFFFAOYSA-M [3-[hydroxymethyl(prop-2-enoyl)amino]-3-methylbutyl]-trimethylazanium;chloride Chemical compound [Cl-].C[N+](C)(C)CCC(C)(C)N(CO)C(=O)C=C URNGCTWQCDHJPL-UHFFFAOYSA-M 0.000 description 1
- GLXGDSIDFQEZRG-UHFFFAOYSA-N [Ca].[I] Chemical compound [Ca].[I] GLXGDSIDFQEZRG-UHFFFAOYSA-N 0.000 description 1
- KYIKRXIYLAGAKQ-UHFFFAOYSA-N abcn Chemical compound C1CCCCC1(C#N)N=NC1(C#N)CCCCC1 KYIKRXIYLAGAKQ-UHFFFAOYSA-N 0.000 description 1
- 150000001253 acrylic acids Chemical class 0.000 description 1
- 229920006397 acrylic thermoplastic Polymers 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000002390 adhesive tape Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000005529 alkyleneoxy group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 1
- 229910000387 ammonium dihydrogen phosphate Inorganic materials 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000008365 aromatic ketones Chemical class 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- OQIGOLHVINAODB-UHFFFAOYSA-N azanium;2-prop-2-enoyloxyethanesulfonate Chemical class [NH4+].[O-]S(=O)(=O)CCOC(=O)C=C OQIGOLHVINAODB-UHFFFAOYSA-N 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 230000008953 bacterial degradation Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000000721 bacterilogical effect Effects 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 125000005026 carboxyaryl group Chemical group 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 229920003090 carboxymethyl hydroxyethyl cellulose Polymers 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 230000007073 chemical hydrolysis Effects 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- SPTHWAJJMLCAQF-UHFFFAOYSA-M ctk4f8481 Chemical compound [O-]O.CC(C)C1=CC=CC=C1C(C)C SPTHWAJJMLCAQF-UHFFFAOYSA-M 0.000 description 1
- XJOBOFWTZOKMOH-UHFFFAOYSA-N decanoyl decaneperoxoate Chemical compound CCCCCCCCCC(=O)OOC(=O)CCCCCCCCC XJOBOFWTZOKMOH-UHFFFAOYSA-N 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical compound OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- UZUODNWWWUQRIR-UHFFFAOYSA-L disodium;3-aminonaphthalene-1,5-disulfonate Chemical compound [Na+].[Na+].C1=CC=C(S([O-])(=O)=O)C2=CC(N)=CC(S([O-])(=O)=O)=C21 UZUODNWWWUQRIR-UHFFFAOYSA-L 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000005203 dry scrubbing Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 238000009713 electroplating Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 230000007071 enzymatic hydrolysis Effects 0.000 description 1
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 1
- YQGOJNYOYNNSMM-UHFFFAOYSA-N eosin Chemical compound [Na+].OC(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C(O)=C(Br)C=C21 YQGOJNYOYNNSMM-UHFFFAOYSA-N 0.000 description 1
- 239000012374 esterification agent Substances 0.000 description 1
- BAPCLPLHWVGHGN-UHFFFAOYSA-N ethene 2-methylprop-2-enoic acid Chemical class C=C.C=C.C=C.CC(=C)C(O)=O BAPCLPLHWVGHGN-UHFFFAOYSA-N 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 238000007765 extrusion coating Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 239000008394 flocculating agent Substances 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000008397 galvanized steel Substances 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229960001330 hydroxycarbamide Drugs 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 229940050526 hydroxyethylstarch Drugs 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000001459 lithography Methods 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- HNEGQIOMVPPMNR-NSCUHMNNSA-N mesaconic acid Chemical compound OC(=O)C(/C)=C/C(O)=O HNEGQIOMVPPMNR-NSCUHMNNSA-N 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- DCUFMVPCXCSVNP-UHFFFAOYSA-N methacrylic anhydride Chemical compound CC(=C)C(=O)OC(=O)C(C)=C DCUFMVPCXCSVNP-UHFFFAOYSA-N 0.000 description 1
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- 235000019837 monoammonium phosphate Nutrition 0.000 description 1
- 239000006012 monoammonium phosphate Substances 0.000 description 1
- QBVZYNWNXIKIEZ-UHFFFAOYSA-N n-(10-hydroxydecyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCCCCCCCCCCO QBVZYNWNXIKIEZ-UHFFFAOYSA-N 0.000 description 1
- CSKOCSQWGIDTHQ-UHFFFAOYSA-N n-(hydroxymethyl)-2-methylidenepentanamide Chemical compound CCCC(=C)C(=O)NCO CSKOCSQWGIDTHQ-UHFFFAOYSA-N 0.000 description 1
- DNTMQTKDNSEIFO-UHFFFAOYSA-N n-(hydroxymethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCO DNTMQTKDNSEIFO-UHFFFAOYSA-N 0.000 description 1
- IZCNRYLWCFSAHP-UHFFFAOYSA-N n-(hydroxymethyl)-3-methyl-2-methylidenenonanamide Chemical compound CCCCCCC(C)C(=C)C(=O)NCO IZCNRYLWCFSAHP-UHFFFAOYSA-N 0.000 description 1
- BEBFQENAYPXOFB-UHFFFAOYSA-N n-(sulfanylmethyl)prop-2-enamide Chemical compound SCNC(=O)C=C BEBFQENAYPXOFB-UHFFFAOYSA-N 0.000 description 1
- OHLHOLGYGRKZMU-UHFFFAOYSA-N n-benzylprop-2-enamide Chemical class C=CC(=O)NCC1=CC=CC=C1 OHLHOLGYGRKZMU-UHFFFAOYSA-N 0.000 description 1
- SWPMNMYLORDLJE-UHFFFAOYSA-N n-ethylprop-2-enamide Chemical compound CCNC(=O)C=C SWPMNMYLORDLJE-UHFFFAOYSA-N 0.000 description 1
- AIEVEPHXLRLSEY-UHFFFAOYSA-N n-methylprop-2-enethioamide Chemical class CNC(=S)C=C AIEVEPHXLRLSEY-UHFFFAOYSA-N 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- WSGCRAOTEDLMFQ-UHFFFAOYSA-N nonan-5-one Chemical compound CCCCC(=O)CCCC WSGCRAOTEDLMFQ-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 238000007645 offset printing Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 239000010893 paper waste Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical class OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000013520 petroleum-based product Substances 0.000 description 1
- YFMFSCRSAWIWOP-UHFFFAOYSA-N phenyl(trityl)diazene Chemical compound C1=CC=CC=C1N=NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 YFMFSCRSAWIWOP-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000003504 photosensitizing agent Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- AZIQALWHRUQPHV-UHFFFAOYSA-N prop-2-eneperoxoic acid Chemical compound OOC(=O)C=C AZIQALWHRUQPHV-UHFFFAOYSA-N 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 230000033458 reproduction Effects 0.000 description 1
- 239000003340 retarding agent Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000009991 scouring Methods 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 238000005201 scrubbing Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000003351 stiffener Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000003396 thiol group Chemical class [H]S* 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005200 wet scrubbing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F290/00—Macromolecular compounds obtained by polymerising monomers on to polymers modified by introduction of aliphatic unsaturated end or side groups
- C08F290/08—Macromolecular compounds obtained by polymerising monomers on to polymers modified by introduction of aliphatic unsaturated end or side groups on to polymers modified by introduction of unsaturated side groups
- C08F290/10—Polymers provided for in subclass C08B
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Graft Or Block Polymers (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Macromonomer-Based Addition Polymer (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polymerisation Methods In General (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/680,549 US4079025A (en) | 1976-04-27 | 1976-04-27 | Copolymerized starch composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO771449L true NO771449L (no) | 1977-10-28 |
Family
ID=24731562
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO771449A NO771449L (no) | 1976-04-27 | 1977-04-26 | Kopolymeriserbar, hydrofil, filmdannende stivelsesblanding |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US4079025A (pt) |
| JP (1) | JPS6017209B2 (pt) |
| BE (1) | BE854010A (pt) |
| BR (1) | BR7702648A (pt) |
| CA (1) | CA1082829A (pt) |
| DE (1) | DE2718210A1 (pt) |
| DK (1) | DK181877A (pt) |
| ES (1) | ES458239A1 (pt) |
| FR (1) | FR2349617A1 (pt) |
| GB (1) | GB1575246A (pt) |
| IT (1) | IT1081941B (pt) |
| MX (1) | MX3583E (pt) |
| NL (1) | NL7704541A (pt) |
| NO (1) | NO771449L (pt) |
| SE (1) | SE432429B (pt) |
Families Citing this family (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4060506A (en) * | 1976-04-27 | 1977-11-29 | A. E. Staley Manufacturing Company | Starch acrylamides and the method for preparing the same |
| DE2659133C2 (de) * | 1976-12-28 | 1978-09-21 | Roehm Gmbh, 6100 Darmstadt | Verfahren zur Herstellung von blockfesten Überzügen |
| CA1090027A (en) * | 1977-06-20 | 1980-11-18 | Austin H. Young | Water-absorbent starch copolymerizates |
| US4235237A (en) * | 1978-05-08 | 1980-11-25 | Johnson & Johnson | Absorbent open network structure |
| US4323487A (en) * | 1979-10-22 | 1982-04-06 | Henkel Corporation | Absorbent starch graft polymer and method of its preparation |
| US4263363A (en) * | 1979-12-20 | 1981-04-21 | Colgate-Palmolive Company | Emulsion-containing absorbent article having improved water holding capacity |
| US4375535A (en) * | 1980-04-28 | 1983-03-01 | Standard Brands Incorporated | Stable liquid, amylopectin starch graft copolymer compositions |
| US4301017A (en) * | 1980-04-28 | 1981-11-17 | Standard Brands Incorporated | Stable, liquid starch graft copolymer composition |
| BE888605A (fr) * | 1980-04-28 | 1981-10-28 | Standard Brands Inc | Compositions liquides stables de copolymeres greffes d'amidon d'amylopectine, |
| JPS5923791B2 (ja) * | 1980-12-23 | 1984-06-05 | 旭化成株式会社 | 固定化微生物の製造法 |
| US4511646A (en) * | 1983-03-03 | 1985-04-16 | Minnesota Mining And Manufacturing Company | Ethylenically-unsaturated dextrin composition for preparing a durable hydrophilic photopolymer |
| US4507382A (en) * | 1983-03-03 | 1985-03-26 | Minnesota Mining And Manufacturing Company | Water developable positive acting lithographic printing plate |
| US4451613A (en) * | 1983-03-03 | 1984-05-29 | Minnesota Mining And Manufacturing Company | Ethylenically-unsaturated dextrin oligomers |
| US4454268A (en) * | 1983-06-23 | 1984-06-12 | The United States Of America As Represented By The Secretary Of Agriculture | Starch-based semipermeable films |
| US4557951A (en) * | 1983-11-22 | 1985-12-10 | A. E. Staley Manufacturing Company | Cellulosic organic solvent soluble products |
| US4778880A (en) * | 1984-09-28 | 1988-10-18 | Symes Kenneth C | Process for producing derivatives of hydroxy compounds, the products and their uses |
| US4690996A (en) * | 1985-08-28 | 1987-09-01 | National Starch And Chemical Corporation | Inverse emulsions |
| JPS6299391U (pt) * | 1985-12-11 | 1987-06-24 | ||
| JPS63181406U (pt) * | 1987-05-12 | 1988-11-22 | ||
| US4990338A (en) * | 1988-05-09 | 1991-02-05 | Dow Corning Corporation | Antimicrobial superabsorbent compositions and methods |
| US5035892A (en) * | 1988-05-09 | 1991-07-30 | Dow Corning Corporation | Antimicrobial superabsorbent compositions and methods |
| US5505718A (en) * | 1990-04-02 | 1996-04-09 | The Procter & Gamble Company | Absorbent structures containing specific particle size distributions of superabsorbent hydrogel-forming materials |
| JPH0768316B2 (ja) * | 1990-09-07 | 1995-07-26 | 三洋化成工業株式会社 | 吸水性樹脂の製造法 |
| DE4028704A1 (de) * | 1990-09-10 | 1992-03-12 | Bostik Gmbh | 2-komponenten-polyurethan-dichtungsmassen |
| US5422169A (en) * | 1991-04-12 | 1995-06-06 | The Procter & Gamble Company | Absorbent structures containing specific particle size distributions of superabsorbent hydrogel-forming materials in relatively high concentrations |
| US5419956A (en) * | 1991-04-12 | 1995-05-30 | The Procter & Gamble Company | Absorbent structures containing specific particle size distributions of superabsorbent hydrogel-forming materials mixed with inorganic powders |
| US5274018A (en) * | 1991-05-24 | 1993-12-28 | Massachusetts Institute Of Technology | Salt tolerant super absorbents |
| DE4133192A1 (de) * | 1991-10-07 | 1993-04-08 | Basf Ag | Verfahren zum ueberziehen von arzneiformen |
| ATE144716T1 (de) * | 1991-12-11 | 1996-11-15 | Hoechst Celanese Corp | Verfahren zur immobilisierung eines superabsorbierenden polymers und davon abgeleitete produkte |
| JPH05170845A (ja) * | 1991-12-20 | 1993-07-09 | Nippon Paint Co Ltd | 有機ポリマー微粒子およびその製法 |
| US5433994A (en) * | 1992-12-18 | 1995-07-18 | Mckinney; Betty J. | Superabsorbent structure |
| US5362766A (en) * | 1993-03-09 | 1994-11-08 | Hoechst Celanese Corporation | Method for immobilizing superabsorbent polymers by homogenization of a suspension of same |
| US5540929A (en) * | 1995-03-08 | 1996-07-30 | Board Of Trustees Operating Michigan State University | Polysaccharides grafted with aliphatic polyesters derived from cyclic esters |
| US6176915B1 (en) | 1995-04-14 | 2001-01-23 | Standard Starch, L.L.C. | Sorghum meal-based biodegradable formulations, shaped products made therefrom, and methods of making said shaped products |
| US20010048176A1 (en) | 1995-04-14 | 2001-12-06 | Hans G. Franke | Resilient biodegradable packaging materials |
| US5618876A (en) * | 1995-06-05 | 1997-04-08 | National Starch And Chemical Investment Holding Corporation | Latex binders and coatings containing polymers derived from polymerizable saccharide monomers |
| US5719244A (en) * | 1995-06-05 | 1998-02-17 | National Starch And Chemical Investment Holding Corporation | Latex binders and coatings containing polymers derived from polymerizable saccharide monomers |
| DE19521695A1 (de) * | 1995-06-14 | 1996-12-19 | Sandoz Ag | Polymerisate, deren Herstellung und Verwendung |
| US5650454A (en) * | 1995-08-23 | 1997-07-22 | Flow Polymers, Inc. | Rubber additive and rubber compounds |
| US5877244A (en) * | 1995-08-23 | 1999-03-02 | Flow Polymers, Inc. | Latex rubber additive and latex rubber compounds |
| US6296757B1 (en) | 1995-10-17 | 2001-10-02 | Exxon Research And Engineering Company | Synthetic diesel fuel and process for its production |
| JP3383497B2 (ja) * | 1995-11-30 | 2003-03-04 | ユニ・チャーム株式会社 | 使い捨ての体液吸収性着用物品 |
| US5806593A (en) * | 1996-07-22 | 1998-09-15 | Texaco Inc | Method to increase sand grain coating coverage |
| US6780903B2 (en) | 1996-12-31 | 2004-08-24 | Valtion Teknillinen Tutkimuskeskus | Process for the preparation of polymer dispersions |
| US5766274A (en) | 1997-02-07 | 1998-06-16 | Exxon Research And Engineering Company | Synthetic jet fuel and process for its production |
| US6090884A (en) * | 1998-05-07 | 2000-07-18 | S. C. Johnson Commercial Markets, Inc. | Starch degradation/graft polymerization composition, process, and uses thereof |
| US6296696B1 (en) | 1998-12-15 | 2001-10-02 | National Starch & Chemical Investment Holding Corporation | One-pass method for preparing paper size emulsions |
| DE19903979C2 (de) * | 1999-01-25 | 2000-12-21 | Worlee Chemie G M B H | Pfropfpolymerisat auf Stärkebasis, Verfahren zu seiner Herstellung und seine Verwendung in Druckfarben über Überdrucklacken |
| NZ503232A (en) | 1999-03-08 | 2001-11-30 | Humatro Corp | Melt processable starch compositions comprising amylopectin and a high polymer (such as polyacrylamide) |
| US6228158B1 (en) | 1999-04-16 | 2001-05-08 | Corn Products International, Inc. | Preblended carrier starches for corrugating adhesives |
| US7029620B2 (en) | 2000-11-27 | 2006-04-18 | The Procter & Gamble Company | Electro-spinning process for making starch filaments for flexible structure |
| US20030203196A1 (en) * | 2000-11-27 | 2003-10-30 | Trokhan Paul Dennis | Flexible structure comprising starch filaments |
| US6811740B2 (en) | 2000-11-27 | 2004-11-02 | The Procter & Gamble Company | Process for making non-thermoplastic starch fibers |
| US6715316B2 (en) * | 2001-05-08 | 2004-04-06 | Corning Incorporated | Water-removable coatings for LCD glass |
| US7276201B2 (en) * | 2001-09-06 | 2007-10-02 | The Procter & Gamble Company | Process for making non-thermoplastic starch fibers |
| CA2464302A1 (en) * | 2001-11-26 | 2003-06-05 | Amersham Biosciences Ab | Post-modification of a porous support |
| US6723160B2 (en) * | 2002-02-01 | 2004-04-20 | The Procter & Gamble Company | Non-thermoplastic starch fibers and starch composition for making same |
| DE60211902T2 (de) * | 2002-09-30 | 2007-01-11 | The Procter & Gamble Company, Cincinnati | Hydrophile Vliese enthaltende absorbierende Artikel |
| US7118797B2 (en) * | 2003-11-19 | 2006-10-10 | Crum Jesse D | Printed communication materials having reduced odor and textural or tactile properties |
| US6955850B1 (en) | 2004-04-29 | 2005-10-18 | The Procter & Gamble Company | Polymeric structures and method for making same |
| US6977116B2 (en) | 2004-04-29 | 2005-12-20 | The Procter & Gamble Company | Polymeric structures and method for making same |
| CA2564588A1 (en) * | 2004-05-12 | 2005-12-01 | Surmodics, Inc. | Natural biodegradable polysaccharide coatings for medical articles |
| FR2873123B1 (fr) * | 2004-07-13 | 2006-09-15 | Rhodia Chimie Sa | Nouveaux glycopolymeres, leurs utilisations, et monomeres utiles pour leur preparation |
| WO2006030965A1 (en) * | 2004-09-15 | 2006-03-23 | Seikagaku Corporation | Photoreactive polysaccharide, photocrosslinked polysaccharide products, the method of making them and medical materials therefrom |
| US8241656B2 (en) * | 2005-09-21 | 2012-08-14 | Surmodics, Inc | Articles including natural biodegradable polysaccharides and uses thereof |
| DE602006011764D1 (de) * | 2005-09-21 | 2010-03-04 | Surmodics Inc | In situ okklusionszusammensetzungen mit natürlichen biologisch abbaubaren polysacchariden |
| WO2008073295A2 (en) * | 2006-12-07 | 2008-06-19 | Surmodics, Inc. | Latent stabilization of bioactive agents releasable from implantable medical articles |
| MX2009012724A (es) * | 2007-05-31 | 2009-12-16 | Hercules Inc | Composicion aditiva de perdida de fluido de cemento para pozo petrolifero. |
| WO2009137689A2 (en) | 2008-05-07 | 2009-11-12 | Surmodics, Inc. | Delivery of nucleic acid complexes from particles |
| EP2123310B1 (en) * | 2008-05-19 | 2012-12-12 | The Procter & Gamble Company | Absorbent product comprising a cationic modified starch |
| JP5813515B2 (ja) * | 2009-02-18 | 2015-11-17 | クイック−メッド テクノロジーズ、インク． | 過酸化物からなる高吸収性材料 |
| US8901092B2 (en) | 2010-12-29 | 2014-12-02 | Surmodics, Inc. | Functionalized polysaccharides for active agent delivery |
| EP2532682A1 (en) | 2011-04-20 | 2012-12-12 | Basf Se | A process for the preparation of co-polymerizable polysaccharide derivatives |
| US8791198B2 (en) | 2012-04-30 | 2014-07-29 | H.B. Fuller Company | Curable aqueous composition |
| US9416294B2 (en) | 2012-04-30 | 2016-08-16 | H.B. Fuller Company | Curable epoxide containing formaldehyde-free compositions, articles including the same, and methods of using the same |
| US10442963B1 (en) | 2015-12-22 | 2019-10-15 | McTron Technologies, LLC | Durable and hydrophobic polymeric binder and adhesive |
| US11447618B2 (en) | 2016-03-01 | 2022-09-20 | Kemira Oyj | Polymer composition, its use and a surface size |
| EP3636836A1 (en) | 2018-10-09 | 2020-04-15 | Polytex Sportbeläge Produktions-GmbH | Method for improving sports flooring comprising natural grass |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2668156A (en) * | 1950-04-06 | 1954-02-02 | Nat Starch Products Inc | Unsaturated starch compounds and insoluble derivatives thereof |
| US3033852A (en) * | 1958-01-29 | 1962-05-08 | Corn Products Co | Preparation of propionamide ethers of starch |
| US2928827A (en) * | 1958-05-09 | 1960-03-15 | Corn Products Co | Preparation of propionamide ethers of starch |
| US3135738A (en) * | 1959-04-23 | 1964-06-02 | Staley Mfg Co A E | Modification of starch with n, n' methylene bisacrylamide, n-methylol acrylamide, or acrylamide and formaldehyde |
| GB1413301A (en) * | 1972-03-13 | 1975-11-12 | Allied Colloids Ltd | Polysaccharide ethers and their use as flocculants |
-
1976
- 1976-04-27 US US05/680,549 patent/US4079025A/en not_active Expired - Lifetime
-
1977
- 1977-03-16 CA CA274,111A patent/CA1082829A/en not_active Expired
- 1977-04-06 MX MX775613U patent/MX3583E/es unknown
- 1977-04-13 GB GB15265/77A patent/GB1575246A/en not_active Expired
- 1977-04-23 DE DE19772718210 patent/DE2718210A1/de not_active Withdrawn
- 1977-04-25 FR FR7712380A patent/FR2349617A1/fr active Granted
- 1977-04-26 IT IT49105/77A patent/IT1081941B/it active
- 1977-04-26 NL NL7704541A patent/NL7704541A/xx not_active Application Discontinuation
- 1977-04-26 SE SE7704794A patent/SE432429B/xx unknown
- 1977-04-26 DK DK181877A patent/DK181877A/da not_active Application Discontinuation
- 1977-04-26 NO NO771449A patent/NO771449L/no unknown
- 1977-04-27 BE BE177065A patent/BE854010A/xx not_active IP Right Cessation
- 1977-04-27 BR BR7702648A patent/BR7702648A/pt unknown
- 1977-04-27 JP JP52049018A patent/JPS6017209B2/ja not_active Expired
- 1977-04-27 ES ES458239A patent/ES458239A1/es not_active Expired
- 1977-06-20 US US05/808,482 patent/US4115332A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS52130887A (en) | 1977-11-02 |
| CA1082829A (en) | 1980-07-29 |
| ES458239A1 (es) | 1978-06-01 |
| US4115332A (en) | 1978-09-19 |
| DE2718210A1 (de) | 1977-11-10 |
| BE854010A (fr) | 1977-10-27 |
| DK181877A (da) | 1977-10-28 |
| SE7704794L (sv) | 1977-10-28 |
| IT1081941B (it) | 1985-05-21 |
| NL7704541A (nl) | 1977-10-31 |
| MX3583E (es) | 1981-03-19 |
| SE432429B (sv) | 1984-04-02 |
| FR2349617A1 (fr) | 1977-11-25 |
| BR7702648A (pt) | 1978-03-21 |
| US4079025A (en) | 1978-03-14 |
| JPS6017209B2 (ja) | 1985-05-01 |
| FR2349617B1 (pt) | 1981-10-02 |
| GB1575246A (en) | 1980-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO771449L (no) | Kopolymeriserbar, hydrofil, filmdannende stivelsesblanding | |
| US4060506A (en) | Starch acrylamides and the method for preparing the same | |
| AU621206B2 (en) | Starch graft polymers | |
| EP0005000B1 (en) | Method for preparing a water-absorbent starch product | |
| RU2528639C2 (ru) | Композиция меловального пигмента и бумага или картон, имеющие покрытие из нее | |
| AU596878B2 (en) | Printing ink composition | |
| US3891584A (en) | Water-dispersible hot melt adhesives and products using same | |
| US4474923A (en) | Self-curable latex compositions | |
| US4521565A (en) | Aqueous dispersion | |
| EP0606431A4 (en) | Cationic starch/vinyl acetate coating board binders. | |
| US6423775B1 (en) | Starch-based graft polymer, process for its preparation, and use thereof in printing inks and overprint varnishes | |
| JPH0213078B2 (pt) | ||
| US4940741A (en) | Process for the production of hardboard | |
| EP0000247B1 (en) | Water-absorbent starch copolymerisates and method for their preparation. | |
| US4395515A (en) | Resin dispersions having high pigment binding capacity | |
| JP4974428B2 (ja) | 樹脂強化糖ベース化ビニルエマルジョンコポリマー類から構成されるインキおよびその製造法 | |
| US4575528A (en) | Viscosity modifiers for grafted starch polymer solutions | |
| JP2002285493A (ja) | 製紙用表面サイズ剤及びその製造方法 | |
| JPH10245450A (ja) | 共重合体ラテックスおよび紙塗工用組成物 | |
| JPS6019927B2 (ja) | 共重合体ラテックスの製造方法 | |
| JPH10259590A (ja) | 変成澱粉を用いた表面紙質向上剤 | |
| JPS5831195A (ja) | 紙被覆用組成物 | |
| JPH05163697A (ja) | 紙の表面強度改良剤 | |
| JPS5945370A (ja) | グラビア印刷紙用塗工液組成物 |