NO149490B - Fremgangsmaate ved fremstilling av tabletter med regulert frigjoerelse av den aktive bestanddel - Google Patents
Fremgangsmaate ved fremstilling av tabletter med regulert frigjoerelse av den aktive bestanddel Download PDFInfo
- Publication number
- NO149490B NO149490B NO794290A NO794290A NO149490B NO 149490 B NO149490 B NO 149490B NO 794290 A NO794290 A NO 794290A NO 794290 A NO794290 A NO 794290A NO 149490 B NO149490 B NO 149490B
- Authority
- NO
- Norway
- Prior art keywords
- tablets
- active agent
- release
- ester
- methacrylic acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- 238000004519 manufacturing process Methods 0.000 title claims description 9
- 239000004480 active ingredient Substances 0.000 title description 14
- 239000013543 active substance Substances 0.000 claims description 29
- 239000000203 mixture Substances 0.000 claims description 17
- 238000007906 compression Methods 0.000 claims description 16
- 230000006835 compression Effects 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 239000006185 dispersion Substances 0.000 claims description 10
- 150000002148 esters Chemical class 0.000 claims description 8
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 5
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 5
- 239000000194 fatty acid Substances 0.000 claims description 5
- 229930195729 fatty acid Natural products 0.000 claims description 5
- 229920000642 polymer Polymers 0.000 claims description 5
- 150000004665 fatty acids Chemical class 0.000 claims description 4
- 239000008187 granular material Substances 0.000 claims description 4
- 239000011159 matrix material Substances 0.000 claims description 4
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 125000000129 anionic group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229920001577 copolymer Polymers 0.000 claims description 3
- 229920003145 methacrylic acid copolymer Polymers 0.000 claims description 3
- 150000004702 methyl esters Chemical class 0.000 claims description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 2
- 239000004359 castor oil Substances 0.000 claims description 2
- 235000019438 castor oil Nutrition 0.000 claims description 2
- 238000013270 controlled release Methods 0.000 claims description 2
- 125000004494 ethyl ester group Chemical group 0.000 claims description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 claims description 2
- 239000010514 hydrogenated cottonseed oil Substances 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 230000007935 neutral effect Effects 0.000 claims description 2
- 230000000979 retarding effect Effects 0.000 claims description 2
- -1 fatty acid ester Chemical class 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 239000003826 tablet Substances 0.000 description 32
- 235000013339 cereals Nutrition 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 11
- 238000004090 dissolution Methods 0.000 description 11
- 230000001105 regulatory effect Effects 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- 241001440269 Cutina Species 0.000 description 7
- 230000003111 delayed effect Effects 0.000 description 6
- 229920000193 polymethacrylate Polymers 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 210000001035 gastrointestinal tract Anatomy 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 230000000622 irritating effect Effects 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 229920003152 Eudragit® RS polymer Polymers 0.000 description 2
- 229920003134 Eudragit® polymer Polymers 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- FSXVSUSRJXIJHB-UHFFFAOYSA-M ethyl prop-2-enoate;methyl 2-methylprop-2-enoate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride Chemical compound [Cl-].CCOC(=O)C=C.COC(=O)C(C)=C.CC(=C)C(=O)OCC[N+](C)(C)C FSXVSUSRJXIJHB-UHFFFAOYSA-M 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 238000005469 granulation Methods 0.000 description 2
- 230000003179 granulation Effects 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- LOUPRKONTZGTKE-LHHVKLHASA-N quinidine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 238000005245 sintering Methods 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- AKYHKWQPZHDOBW-VJAUXQICSA-N (s)-[(2r,4s,5r)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;sulfuric acid Chemical compound OS(O)(=O)=O.C([C@H]([C@H](C1)C=C)C2)CN1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 AKYHKWQPZHDOBW-VJAUXQICSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 229920003136 Eudragit® L polymer Polymers 0.000 description 1
- 229920003151 Eudragit® RL polymer Polymers 0.000 description 1
- 229920003137 Eudragit® S polymer Polymers 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229960003511 macrogol Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000013563 matrix tablet Substances 0.000 description 1
- 206010027175 memory impairment Diseases 0.000 description 1
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical compound CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 1
- 229960003105 metformin Drugs 0.000 description 1
- DNKKLDKIFMDAPT-UHFFFAOYSA-N n,n-dimethylmethanamine;2-methylprop-2-enoic acid Chemical compound CN(C)C.CC(=C)C(O)=O.CC(=C)C(O)=O DNKKLDKIFMDAPT-UHFFFAOYSA-N 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 229960001404 quinidine Drugs 0.000 description 1
- 229960002693 quinidine bisulfate Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
- A61K9/2013—Organic compounds, e.g. phospholipids, fats
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
- A61K9/2022—Organic macromolecular compounds
- A61K9/2027—Organic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyvinyl pyrrolidone, poly(meth)acrylates
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Medicinal Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Biophysics (AREA)
- Molecular Biology (AREA)
- Medicinal Preparation (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI790350A FI63335B (fi) | 1979-02-02 | 1979-02-02 | Foerfarande foer framstaellning av tabletter med foerdroejd loslighet av effektaemne |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO794290L NO794290L (no) | 1980-08-05 |
| NO149490B true NO149490B (no) | 1984-01-23 |
Family
ID=8512353
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO794290A NO149490B (no) | 1979-02-02 | 1979-12-27 | Fremgangsmaate ved fremstilling av tabletter med regulert frigjoerelse av den aktive bestanddel |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4351825A (da) |
| EP (1) | EP0014514B1 (da) |
| JP (1) | JPS55129222A (da) |
| AR (1) | AR222207A1 (da) |
| AT (1) | ATE20182T1 (da) |
| CA (1) | CA1144071A (da) |
| DE (1) | DE3071625D1 (da) |
| DK (1) | DK28480A (da) |
| ES (1) | ES8102702A1 (da) |
| FI (1) | FI63335B (da) |
| GR (1) | GR65623B (da) |
| IE (1) | IE51741B1 (da) |
| NO (1) | NO149490B (da) |
| PT (1) | PT70719A (da) |
| ZA (1) | ZA80553B (da) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1168014B (it) * | 1981-08-05 | 1987-05-20 | Erba Farmitalia | Forme farmaceutiche a cessione protratta |
| DE3314003A1 (de) * | 1983-04-18 | 1984-10-18 | Boehringer Ingelheim KG, 6507 Ingelheim | Teilbare tablette mit verzoegerter wirkstofffreigabe und verfahren zu deren herstellung |
| HU190619B (en) * | 1983-11-11 | 1986-09-29 | Bezzegh,Denes,Hu | Process for producing tablets with controlled dissolution of active ingredients |
| FR2556965B1 (fr) * | 1983-12-21 | 1986-08-22 | Rhone Poulenc Sante | Nouvelle forme galenique du ketoprofene a liberation controlee |
| US4844984A (en) * | 1984-03-19 | 1989-07-04 | Alza Corporation | Dispensing system with means for increasing delivery of beneficial agent from the system |
| US4624945A (en) * | 1984-03-19 | 1986-11-25 | Alza Corporation | Dispensing system with means for increasing delivery of beneficial agent from the system |
| US5000957A (en) * | 1984-03-19 | 1991-03-19 | Alza Corporation | Dispenser comprising hydrophilic osmopolymer |
| US4684524A (en) * | 1984-03-19 | 1987-08-04 | Alza Corporation | Rate controlled dispenser for administering beneficial agent |
| US4729793A (en) * | 1985-08-09 | 1988-03-08 | Alza Corporation | Composition for manufacturing wall of dispensing device |
| US4927633A (en) * | 1984-03-19 | 1990-05-22 | Alza Corporation | Dispenser for delivering drug to livestock |
| US4629621A (en) * | 1984-07-23 | 1986-12-16 | Zetachron, Inc. | Erodible matrix for sustained release bioactive composition |
| FR2573307B1 (fr) * | 1984-11-22 | 1988-06-10 | Virbac Ctre Rech Biolog | Implants anabolisants a liberation prolongee |
| DE3524003A1 (de) * | 1985-07-04 | 1987-01-08 | Heumann Ludwig & Co Gmbh | Arzneimittelgranulat mit verzoegerter wirkstofffreisetzung und verfahren zu seiner herstellung |
| GB2186485B (en) * | 1986-02-13 | 1988-09-07 | Ethical Pharma Ltd | Slow release formulation |
| IT1204294B (it) * | 1986-03-11 | 1989-03-01 | Gentili Ist Spa | Metodo di fabbricazione di granulari atti a produzione di compresse rivestite,per uso orale,a rilascio controllato |
| US5624683A (en) * | 1986-08-06 | 1997-04-29 | Eisai Co., Ltd. | Sustained-release multi-granule tablet |
| WO1989009066A1 (en) * | 1988-03-24 | 1989-10-05 | Bukh Meditec A/S | Controlled release composition |
| US6056992A (en) * | 1988-06-02 | 2000-05-02 | Campbell Soup Company | Encapsulated additives |
| US5268182A (en) * | 1988-06-24 | 1993-12-07 | Abbott Laboratories | Sustained-release drug dosage units of terazosin |
| US5169642A (en) * | 1988-06-24 | 1992-12-08 | Abbott Laboratories | Sustained-release drug dosage units |
| PH26730A (en) * | 1988-12-30 | 1992-09-28 | Ciba Geigy Ag | Coated adhesive tablets |
| US4970081A (en) * | 1989-01-03 | 1990-11-13 | Sterling Drug Inc. | Controlled-release, low-dose aspirin formulation and method of treating vascular occlusive disease therewith |
| IL96311A (en) † | 1989-12-01 | 1995-05-26 | Abbott Lab | Medications with delayed release |
| GB9015822D0 (en) * | 1990-07-18 | 1990-09-05 | Beecham Group Plc | Compositions |
| US5266331A (en) * | 1991-11-27 | 1993-11-30 | Euroceltique, S.A. | Controlled release oxycodone compositions |
| US20080075781A1 (en) * | 1992-11-25 | 2008-03-27 | Purdue Pharma Lp | Controlled release oxycodone compositions |
| US20070275062A1 (en) * | 1993-06-18 | 2007-11-29 | Benjamin Oshlack | Controlled release oxycodone compositions |
| US5431630A (en) * | 1993-09-07 | 1995-07-11 | Surgic-Acid, Inc. | Needle guard and nonreusable syringe |
| US6103262A (en) * | 1994-01-27 | 2000-08-15 | G. D. Searle & Company | Modified-release metronidazole compositions and methods for making and using same |
| US5484608A (en) * | 1994-03-28 | 1996-01-16 | Pharmavene, Inc. | Sustained-release drug delivery system |
| CA2154640A1 (en) * | 1994-07-27 | 1996-01-28 | Fakhruddin Ahmed | Coated pesticidal agents, processes for their preparation and compositions containing them |
| GB9522403D0 (en) * | 1995-11-01 | 1996-01-03 | Hoechst Roussel Ltd | Intravaginal drug delivery device |
| US6776996B2 (en) | 1997-07-09 | 2004-08-17 | Basf Aktiengesellschaft | Pesticidal matrices |
| ID20839A (id) * | 1997-07-09 | 1999-03-11 | American Cyanamid Co | Bahan acuan pestisida berlapis lebih baik, pengolahan pada pembuatannya serta komposisi-komposisi yang terkandung di dalamnya |
| FR2775188B1 (fr) * | 1998-02-23 | 2001-03-09 | Lipha | Forme galenique a liberation immediate ou liberation prolongee administrable par voie orale comprenant un agent promoteur d'absorption et utilisation de cet agent promoteur d'absorption |
| KR100620935B1 (ko) | 1998-03-19 | 2006-09-13 | 브리스톨-마이어스스퀴브컴파니 | 용해도가 높은 약물에 대한 2상 서방성 전달 시스템과 방법 |
| US6099859A (en) * | 1998-03-20 | 2000-08-08 | Andrx Pharmaceuticals, Inc. | Controlled release oral tablet having a unitary core |
| AU779277B2 (en) * | 1999-06-04 | 2005-01-13 | Alza Corporation | Implantable gel compositions and method of manufacture |
| EP1949890A3 (en) | 1999-06-04 | 2011-05-18 | ALZA Corporation | Implantable gel compositions and method of manufacture |
| US6676966B1 (en) | 2000-05-09 | 2004-01-13 | Intellipharmaceutics Corp. | Extended release metformin hydrochloride formulations |
| GB0102342D0 (en) * | 2001-01-30 | 2001-03-14 | Smithkline Beecham Plc | Pharmaceutical formulation |
| US20050175687A1 (en) * | 2001-01-30 | 2005-08-11 | Mcallister Stephen M. | Pharmaceutical formulations |
| US7883721B2 (en) | 2001-01-30 | 2011-02-08 | Smithkline Beecham Limited | Pharmaceutical formulation |
| UA81224C2 (uk) * | 2001-05-02 | 2007-12-25 | Euro Celtic S A | Дозована форма оксикодону та її застосування |
| DE10127134A1 (de) * | 2001-06-05 | 2002-12-12 | Roehm Gmbh | verfahren zur Herstellung von Formkörpern aus (Meth)acrylat-Copolymeren mittels Spritzguß |
| WO2003105809A1 (en) | 2002-06-17 | 2003-12-24 | Themis Laboratories Private Limited | Multilayer tablets containing thiazolidinedione and biguanides and methods for producing them |
| US7214387B2 (en) * | 2002-08-02 | 2007-05-08 | Penwest Pharmaceuticals Company | Sustained release formulations of metformin |
| US20040086566A1 (en) * | 2002-11-04 | 2004-05-06 | Alpharma, Inc. | Waxy matrix dosage forms |
| US7135436B2 (en) * | 2003-05-05 | 2006-11-14 | J.F. Daley International, Ltd. | Solid algicide, preparation and usage in recirculating water |
| PE20060003A1 (es) | 2004-03-12 | 2006-03-01 | Smithkline Beecham Plc | Formulacion farmaceutica polimerica para moldear por inyeccion |
| WO2018107080A1 (en) | 2016-12-08 | 2018-06-14 | R.P. Scherer Technologies, Llc | A method to relieve stress in capsule shells to reduce propensity to break |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2987445A (en) * | 1958-10-10 | 1961-06-06 | Rohm & Haas | Drug composition |
| US3062720A (en) * | 1959-05-20 | 1962-11-06 | Philips Roxane | Sustained release pharmaceutical tablet |
| US3148124A (en) * | 1962-06-12 | 1964-09-08 | William E Gaunt | Method of preparing sustained release pharmaceutical tablets |
| CH415963A (de) * | 1964-09-04 | 1966-06-30 | Wander Ag Dr A | Masse zur Herstellung von Tabletten mit protrahierter Wirkung |
| US3577512A (en) * | 1968-10-11 | 1971-05-04 | Nat Patent Dev Corp | Sustained release tablets |
| SE353229B (da) * | 1970-06-04 | 1973-01-29 | Haessle Ab | |
| GB1500300A (en) * | 1975-01-06 | 1978-02-08 | Ciba Geigy Ag | Pharmaceutical preparation for the treatment of circulatory disorders |
| JPS6191314A (ja) * | 1984-10-12 | 1986-05-09 | Nippon Kokan Kk <Nkk> | 取鍋精錬炉による溶鋼の精錬方法 |
-
1979
- 1979-02-02 FI FI790350A patent/FI63335B/fi not_active Application Discontinuation
- 1979-12-27 NO NO794290A patent/NO149490B/no unknown
-
1980
- 1980-01-02 EP EP80300008A patent/EP0014514B1/en not_active Expired
- 1980-01-02 DE DE8080300008T patent/DE3071625D1/de not_active Expired
- 1980-01-02 AT AT80300008T patent/ATE20182T1/de not_active IP Right Cessation
- 1980-01-14 US US06/111,962 patent/US4351825A/en not_active Expired - Lifetime
- 1980-01-23 DK DK28480A patent/DK28480A/da not_active Application Discontinuation
- 1980-01-23 PT PT70719A patent/PT70719A/pt active IP Right Revival
- 1980-01-24 JP JP641580A patent/JPS55129222A/ja active Pending
- 1980-01-28 CA CA000344502A patent/CA1144071A/en not_active Expired
- 1980-01-30 ZA ZA00800553A patent/ZA80553B/xx unknown
- 1980-01-31 GR GR61091A patent/GR65623B/el unknown
- 1980-02-01 ES ES488168A patent/ES8102702A1/es not_active Expired
- 1980-02-01 IE IE202/80A patent/IE51741B1/en not_active IP Right Cessation
- 1980-12-30 AR AR279792A patent/AR222207A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| EP0014514B1 (en) | 1986-06-04 |
| PT70719A (en) | 1980-02-01 |
| ES488168A0 (es) | 1981-02-16 |
| EP0014514A2 (en) | 1980-08-20 |
| FI63335B (fi) | 1983-02-28 |
| DK28480A (da) | 1980-08-03 |
| EP0014514A3 (en) | 1981-06-10 |
| AR222207A1 (es) | 1981-04-30 |
| ZA80553B (en) | 1981-02-25 |
| ATE20182T1 (de) | 1986-06-15 |
| US4351825A (en) | 1982-09-28 |
| GR65623B (en) | 1980-10-15 |
| CA1144071A (en) | 1983-04-05 |
| IE800202L (en) | 1980-08-02 |
| ES8102702A1 (es) | 1981-02-16 |
| IE51741B1 (en) | 1987-03-18 |
| JPS55129222A (en) | 1980-10-06 |
| NO794290L (no) | 1980-08-05 |
| FI790350A7 (fi) | 1980-08-03 |
| DE3071625D1 (en) | 1986-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO149490B (no) | Fremgangsmaate ved fremstilling av tabletter med regulert frigjoerelse av den aktive bestanddel | |
| DK170110B1 (da) | Farmaceutisk præparat med langsom frigivelse og anvendelse af fumarsyre til fremstilling af præpar atet | |
| AU596183B2 (en) | Controlled release bases for pharmaceuticals | |
| DE69623087T2 (de) | Brausemittel und dessen Herstellung | |
| DE2336218C3 (de) | Orale Arzneiform | |
| KR20050083750A (ko) | 위-체류성 레보도파 전달 형태 | |
| CN101489560A (zh) | 具有s形释放曲线的奥卡西平控释制剂 | |
| Alhalmi et al. | Sustained release matrix system: an overview | |
| EP1195160A1 (en) | Sustained release trimetazidine pharmaceutical compositions and a method of their preparation | |
| DE602006000819T2 (de) | Dipyridamol enthaltende Zusammensetzungen mit verlängerter Freisetzung und Verfahren zu deren Herstellung | |
| EP2349218A1 (de) | Verfahren zur herstellung oraler darreichungsformen mit kontrollierter freisetzung | |
| EP3337458B1 (de) | Verwendung von wasserlöslichen polymeren auf basis von n-vinylpyrrolidon und acrylsäure als pharmazeutische hilfstoffe | |
| EP2679216B1 (de) | Arzneiform zur modifizierten Freisetzung von Betahistin | |
| EP0691843B1 (de) | Retardmikrotablette von beta-phenylpropiophenonderivaten | |
| US5158776A (en) | Solid oral dosage forms of ifosfamide | |
| CN102008469B (zh) | 一种替米沙坦氨氯地平片的制备方法 | |
| CN113476420B (zh) | 一种盐酸二甲双胍缓释片剂及其制备方法 | |
| KR20090086128A (ko) | 메만틴 약학 조성물 | |
| WO2006123213A1 (en) | Modified release formulations of gliclazide | |
| JP2638604B2 (ja) | 徐放性製剤 | |
| CN105250233A (zh) | 右旋布洛芬肠溶缓释片及其制备方法 | |
| RU2318497C2 (ru) | Фармацевтические композиции | |
| IE69555B1 (en) | An erosion-controlled release system for active agents and a process for its preparation | |
| CN1242745C (zh) | 豆腐果素的缓、控释制剂 | |
| DE4230563A1 (de) | Hochdosierte Kompaktgranulate und daraus hergestellte Tabletten |