NO129633B - - Google Patents
Download PDFInfo
- Publication number
- NO129633B NO129633B NO00152913A NO15291364A NO129633B NO 129633 B NO129633 B NO 129633B NO 00152913 A NO00152913 A NO 00152913A NO 15291364 A NO15291364 A NO 15291364A NO 129633 B NO129633 B NO 129633B
- Authority
- NO
- Norway
- Prior art keywords
- acid
- group
- penicillin
- ether
- solution
- Prior art date
Links
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 30
- 229930182555 Penicillin Natural products 0.000 claims description 29
- 229940049954 penicillin Drugs 0.000 claims description 21
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims description 14
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 11
- 150000002960 penicillins Chemical class 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 231100000252 nontoxic Toxicity 0.000 claims description 4
- 230000003000 nontoxic effect Effects 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 150000002690 malonic acid derivatives Chemical class 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 40
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 13
- 238000004816 paper chromatography Methods 0.000 description 12
- 159000000000 sodium salts Chemical class 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical group [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 8
- 229960003669 carbenicillin Drugs 0.000 description 8
- 229940056360 penicillin g Drugs 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 108700023418 Amidases Proteins 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 102000005922 amidase Human genes 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 230000003115 biocidal effect Effects 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 235000019371 penicillin G benzathine Nutrition 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- QSBAHMROFICXDC-UHFFFAOYSA-N 3-oxo-2-phenyl-3-phenylmethoxypropanoic acid Chemical compound C=1C=CC=CC=1C(C(=O)O)C(=O)OCC1=CC=CC=C1 QSBAHMROFICXDC-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 241000588724 Escherichia coli Species 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- WWYDYZMNFQIYPT-UHFFFAOYSA-N ru78191 Chemical compound OC(=O)C(C(O)=O)C1=CC=CC=C1 WWYDYZMNFQIYPT-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 238000004737 colorimetric analysis Methods 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- LVKCSZQWLOVUGB-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].C[CH-]C LVKCSZQWLOVUGB-UHFFFAOYSA-M 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- -1 α-benzyloxycarbonyl-p-benzyloxycarbonylaminophenylacetic acid Chemical compound 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- GBHGMLJWDLOWTF-UHFFFAOYSA-N 2-(3-hydroxyphenyl)propanedioic acid Chemical compound OC=1C=C(C=CC1)C(C(=O)O)C(=O)O GBHGMLJWDLOWTF-UHFFFAOYSA-N 0.000 description 1
- NBFYQNBRQNGPJJ-UHFFFAOYSA-N 2-(3-phenylmethoxycarbonyloxyphenyl)propanedioic acid Chemical compound C(C1=CC=CC=C1)OC(=O)OC=1C=C(C=CC1)C(C(=O)O)C(=O)O NBFYQNBRQNGPJJ-UHFFFAOYSA-N 0.000 description 1
- CSEWAUGPAQPMDC-UHFFFAOYSA-N 2-(4-aminophenyl)acetic acid Chemical compound NC1=CC=C(CC(O)=O)C=C1 CSEWAUGPAQPMDC-UHFFFAOYSA-N 0.000 description 1
- HHHSHEZZJKIWLA-UHFFFAOYSA-N 2-(4-aminophenyl)propanedioic acid Chemical compound NC1=CC=C(C(C(O)=O)C(O)=O)C=C1 HHHSHEZZJKIWLA-UHFFFAOYSA-N 0.000 description 1
- HCEMITLHDQCRBV-UHFFFAOYSA-N 2-(4-chlorophenyl)propanedioic acid Chemical compound OC(=O)C(C(O)=O)C1=CC=C(Cl)C=C1 HCEMITLHDQCRBV-UHFFFAOYSA-N 0.000 description 1
- HKGWZPGNUJEGCT-UHFFFAOYSA-N 2-(4-methoxyphenyl)propanedioic acid Chemical compound COC1=CC=C(C(C(O)=O)C(O)=O)C=C1 HKGWZPGNUJEGCT-UHFFFAOYSA-N 0.000 description 1
- LKDMWXGBGIWRDD-UHFFFAOYSA-N 2-[4-(phenylmethoxycarbonylamino)phenyl]propanedioic acid Chemical compound C(C1=CC=CC=C1)OC(=O)NC1=CC=C(C=C1)C(C(=O)O)C(=O)O LKDMWXGBGIWRDD-UHFFFAOYSA-N 0.000 description 1
- GCOOGCQWQFRJEK-UHFFFAOYSA-N 2-thiophen-3-ylpropanedioic acid Chemical compound OC(=O)C(C(O)=O)C=1C=CSC=1 GCOOGCQWQFRJEK-UHFFFAOYSA-N 0.000 description 1
- FVMDYYGIDFPZAX-UHFFFAOYSA-N 3-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=CC(O)=C1 FVMDYYGIDFPZAX-UHFFFAOYSA-N 0.000 description 1
- 108090000531 Amidohydrolases Proteins 0.000 description 1
- 102000004092 Amidohydrolases Human genes 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 108010087702 Penicillinase Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- FPPNZSSZRUTDAP-UWFZAAFLSA-N carbenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C(C(O)=O)C1=CC=CC=C1 FPPNZSSZRUTDAP-UWFZAAFLSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229950009506 penicillinase Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB15889/63A GB1004670A (en) | 1963-04-23 | 1963-04-23 | Penicillins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO129633B true NO129633B (enExample) | 1974-05-06 |
Family
ID=10067366
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO00152913A NO129633B (enExample) | 1963-04-23 | 1964-04-21 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3282926A (enExample) |
| AT (1) | AT259759B (enExample) |
| BE (1) | BE646991A (enExample) |
| BR (1) | BR6458467D0 (enExample) |
| CH (1) | CH447173A (enExample) |
| CY (1) | CY428A (enExample) |
| DE (1) | DE1295558B (enExample) |
| DK (1) | DK118133B (enExample) |
| ES (1) | ES299038A1 (enExample) |
| FI (1) | FI44912C (enExample) |
| FR (1) | FR3684M (enExample) |
| GB (1) | GB1004670A (enExample) |
| NL (1) | NL142590B (enExample) |
| NO (1) | NO129633B (enExample) |
| SE (1) | SE337376B (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1125557A (en) * | 1966-05-13 | 1968-08-28 | Beecham Group Ltd | Penicillins |
| US3853849A (en) * | 1969-05-29 | 1974-12-10 | Beecham Group Ltd | Alpha(aryloxycarbonyl)-and alpha(alkoxy-carbonyl)-aralkyl penicillins |
| US3881013A (en) * | 1966-11-05 | 1975-04-29 | Beecham Group Ltd | Penicillin compositions and their administration |
| US3669980A (en) * | 1968-09-17 | 1972-06-13 | American Home Prod | 2-amido-6-amino penicillanic acids and related compounds |
| AT290728B (de) * | 1968-09-28 | 1971-05-15 | Takeda Chemical Industries Ltd | Verfahren zur herstellung neuer penicilline |
| GB1250970A (enExample) * | 1969-09-24 | 1971-10-27 | ||
| BE758350A (fr) * | 1969-12-30 | 1971-05-03 | Pfizer | Procede de fabrication des sels mono- et bi-metalliques alcalins de l'alpha-carboxybenzylpenicilline |
| US3697506A (en) * | 1970-08-07 | 1972-10-10 | Pfizer | Crystalline alkali metal salts of {60 -carboxybenzylpenicillin and process therefor |
| US3905960A (en) * | 1970-10-22 | 1975-09-16 | Beecham Inc | Crystalline anhydrous penicillins and preparation thereof |
| US3681342A (en) * | 1970-11-12 | 1972-08-01 | Pfizer | Esters of -carboxybenzylpenicillin |
| US3676427A (en) * | 1971-01-26 | 1972-07-11 | Pfizer | Process for the manufacture of the disodium salt of alpha-carboxybenzylpenicillin |
| DE2224121A1 (de) * | 1971-05-18 | 1973-01-18 | Vni Skij I Antibiotikow | Verfahren zur herstellung von alphaaminobenzylpenizillin |
| GB1424186A (en) * | 1971-10-08 | 1976-02-11 | Beecham Group Ltd | Penicillins |
| JPS4891218A (enExample) * | 1972-03-06 | 1973-11-28 | ||
| US3862933A (en) * | 1972-07-12 | 1975-01-28 | Pfizer | Process for making esters of 6-(alpha-(carboxy)aryla-cetamido)penicillanic acids |
| HU168914B (enExample) * | 1974-07-30 | 1976-08-28 | ||
| US4171303A (en) * | 1974-07-30 | 1979-10-16 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt. | Process for the preparation of reactive penicillanic acid and cephalosporanic acid derivatives |
| NZ182630A (en) * | 1975-11-21 | 1979-07-11 | Merck & Co Inc | Substituted n-methylene dervatives of thienamycin and pharmaceutical compositions |
| DK523276A (da) * | 1975-11-21 | 1977-05-22 | Merck & Co Inc | Fremgangsmade til fremstilling af n-acylderivater af thienamycin |
| CH632508A5 (de) * | 1975-11-21 | 1982-10-15 | Merck & Co Inc | Verfahren zur herstellung von neuen estern des n-acylierten thienamycins. |
| US4236002A (en) | 1977-12-23 | 1980-11-25 | Yeda Research & Development Co., Ltd. | Cephalosporin derivatives |
| US4598074A (en) * | 1982-10-15 | 1986-07-01 | Beecham Group P.L.C. | β-lactam antibiotics |
| CN106117159B (zh) * | 2016-07-08 | 2018-10-16 | 上海上药新亚药业有限公司 | 一种羧苄西林钠杂质d的合成方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR617E (fr) * | 1901-09-16 | 1903-02-16 | Henriot Edouard | Une traverse en fer ou en acier avec cases pour rendre invariable l'écartement de la voie ferrée dans les courbes |
| US2528174A (en) * | 1948-07-01 | 1950-10-31 | Lilly Co Eli | Procaine salts of biosynthetic penicillins |
| GB874415A (en) * | 1959-05-25 | 1961-08-10 | Beecham Res Lab | Antibacterial agents |
| US3142673A (en) * | 1961-03-31 | 1964-07-28 | Pfizer & Co C | Derivatives of 6-aminopenicillanic acid |
-
1963
- 1963-04-23 GB GB15889/63A patent/GB1004670A/en not_active Expired
-
1964
- 1964-04-15 SE SE04665/64A patent/SE337376B/xx unknown
- 1964-04-16 BR BR158467/64A patent/BR6458467D0/pt unknown
- 1964-04-17 US US360760A patent/US3282926A/en not_active Expired - Lifetime
- 1964-04-21 NO NO00152913A patent/NO129633B/no unknown
- 1964-04-22 ES ES0299038A patent/ES299038A1/es not_active Expired
- 1964-04-22 FR FR971849A patent/FR3684M/fr active Active
- 1964-04-22 NL NL646404384A patent/NL142590B/xx not_active IP Right Cessation
- 1964-04-23 FI FI640858A patent/FI44912C/fi active
- 1964-04-23 BE BE646991A patent/BE646991A/xx unknown
- 1964-04-23 DE DEB76480A patent/DE1295558B/de active Pending
- 1964-04-23 AT AT357964A patent/AT259759B/de active
- 1964-04-23 CH CH526164A patent/CH447173A/de unknown
- 1964-04-23 DK DK202964AA patent/DK118133B/da unknown
-
1968
- 1968-01-08 CY CY42868A patent/CY428A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES299038A1 (es) | 1964-08-16 |
| GB1004670A (en) | 1965-09-15 |
| US3282926A (en) | 1966-11-01 |
| DE1295558B (de) | 1969-05-22 |
| NL6404384A (enExample) | 1964-10-26 |
| FI44912B (enExample) | 1971-11-01 |
| AT259759B (de) | 1968-02-12 |
| CH447173A (de) | 1967-11-30 |
| BE646991A (enExample) | 1964-08-17 |
| DK118133B (da) | 1970-07-13 |
| NL142590B (nl) | 1974-07-15 |
| FR3684M (fr) | 1965-11-15 |
| CY428A (en) | 1968-01-08 |
| SE337376B (enExample) | 1971-08-09 |
| BR6458467D0 (pt) | 1973-09-20 |
| FI44912C (fi) | 1972-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO129633B (enExample) | ||
| NO144169B (no) | Analogifremgangsmaate for fremstilling av terapeutisk anvendelig 6-(d(-)-alfa-aminofenylacetamido)penicillansyreftalidester | |
| NO152913B (no) | List, fortrinnsvis fotlist | |
| SU629880A3 (ru) | Способ получени 7-д-(-)-2формилокси-2-(4ацилоксифенилацетамидо)-цефалоспорановых кислот или их солей | |
| KR870001944B1 (ko) | 퀴놀린 카르복실산 유도체의 제조방법 | |
| NO135777B (enExample) | ||
| NO172577B (no) | Fremgangsmaate og mellomprodukter ved fremstilling av substituerte indolinonderivater | |
| SU587866A3 (ru) | Способ получени тиазолидиназетидинонов | |
| NO170322B (no) | Fremgangsmaate for syklisk fremstilling av hydrogenperoksid | |
| US3492291A (en) | Benzyloxycarbonylbenzylpenicillins and their catalytic hydrogenation | |
| SU577966A3 (ru) | Способ расщеплени аллетролона | |
| Cornforth et al. | 330. A synthesis of acylamidomalondialdehydes | |
| NO832810L (no) | 1,3-dioksolo(4,5-g)-kinoliner og fremgangsmaate for deres fremstilling. | |
| NO154493B (no) | Analogifremgangsmaate for fremstilling av nye, terapeutisk aktive 1-substituerte-3-cycloalkyl-sulfonyl-pyrrolidin-2,5-dion-derivater. | |
| NO134153B (enExample) | ||
| US4927964A (en) | Method for production of 2-oxyimino-3-oxobutyric acids | |
| US4200757A (en) | Process for the production of 3-aminoisoxazoles | |
| EP0010262B1 (en) | Process for preparing 3-amino-5-t-butylisoxazole | |
| DK149859B (da) | Fremgangsmaade til fremstilling af rifamycin p og q eller 25-deacetylderivater deraf | |
| EP0220025A1 (en) | 3-perfluoroalkyl-5-hydroxyisoxazoles | |
| US2965634A (en) | Norleucine derivatives and process for producing same | |
| US4237280A (en) | Intermediate for cephalosporin type compound | |
| NO140103B (no) | Analogifremgangsmaate til fremstilling av terapeutisk virksomme penicilliner | |
| US4330555A (en) | Indanyloxamic derivatives, their preparation and pharmaceutical compositions containing them | |
| US4343951A (en) | Method for the preparation of fluoroaniline |