NO124372B - - Google Patents
Download PDFInfo
- Publication number
- NO124372B NO124372B NO4711/69A NO471169A NO124372B NO 124372 B NO124372 B NO 124372B NO 4711/69 A NO4711/69 A NO 4711/69A NO 471169 A NO471169 A NO 471169A NO 124372 B NO124372 B NO 124372B
- Authority
- NO
- Norway
- Prior art keywords
- acid
- imidazole
- formula
- salts
- bromine
- Prior art date
Links
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 12
- -1 N-substituted imidazoles Chemical class 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 230000002140 halogenating effect Effects 0.000 claims description 3
- 239000003495 polar organic solvent Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 125000005358 mercaptoalkyl group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 230000026030 halogenation Effects 0.000 description 4
- 238000005658 halogenation reaction Methods 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 241000894007 species Species 0.000 description 3
- OHNIRLHFNZDKPJ-UHFFFAOYSA-N 2-(10-phenyl-9h-thioxanthen-10-yl)-1h-imidazole Chemical compound C12=CC=CC=C2CC2=CC=CC=C2S1(C=1C=CC=CC=1)C1=NC=CN1 OHNIRLHFNZDKPJ-UHFFFAOYSA-N 0.000 description 2
- 208000007163 Dermatomycoses Diseases 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 201000003929 dermatomycosis Diseases 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 229960000448 lactic acid Drugs 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229960004889 salicylic acid Drugs 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QRIIMGIILWNFQB-UHFFFAOYSA-N 10-hydroxy-10-phenyl-9h-thioxanthene Chemical compound C12=CC=CC=C2CC2=CC=CC=C2S1(O)C1=CC=CC=C1 QRIIMGIILWNFQB-UHFFFAOYSA-N 0.000 description 1
- PILWFRVWSLLHMB-UHFFFAOYSA-N 2-[9-(4-fluorophenyl)fluoren-9-yl]-1h-imidazole Chemical compound C1=CC(F)=CC=C1C1(C=2NC=CN=2)C2=CC=CC=C2C2=CC=CC=C21 PILWFRVWSLLHMB-UHFFFAOYSA-N 0.000 description 1
- IZPXIADHDVDTJY-UHFFFAOYSA-N 9-chloro-9-(4-fluorophenyl)fluorene Chemical compound C1=CC(F)=CC=C1C1(Cl)C2=CC=CC=C2C2=CC=CC=C21 IZPXIADHDVDTJY-UHFFFAOYSA-N 0.000 description 1
- 241001225321 Aspergillus fumigatus Species 0.000 description 1
- 241000351920 Aspergillus nidulans Species 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000223203 Coccidioides Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241001480035 Epidermophyton Species 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 241000228402 Histoplasma Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000251124 Mustelus canis Species 0.000 description 1
- 241000228143 Penicillium Species 0.000 description 1
- 241000222831 Phialophora <Chaetothyriales> Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241001609979 Trichophyton quinckeanum Species 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical compound C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- ONCCWDRMOZMNSM-FBCQKBJTSA-N compound Z Chemical compound N1=C2C(=O)NC(N)=NC2=NC=C1C(=O)[C@H]1OP(O)(=O)OC[C@H]1O ONCCWDRMOZMNSM-FBCQKBJTSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 244000000008 fungal human pathogen Species 0.000 description 1
- 230000001408 fungistatic effect Effects 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000002906 microbiologic effect Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 229940075566 naphthalene Drugs 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681811654 DE1811654C3 (de) | 1968-11-29 | N-substituierte Imidazole und deren Salze |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO124372B true NO124372B (index.php) | 1972-04-10 |
Family
ID=5714699
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO4711/69A NO124372B (index.php) | 1968-11-29 | 1969-11-28 |
Country Status (23)
| Country | Link |
|---|---|
| US (2) | US3647816A (index.php) |
| AT (1) | AT289786B (index.php) |
| BE (1) | BE742389A (index.php) |
| BG (1) | BG16338A3 (index.php) |
| BR (1) | BR6914425D0 (index.php) |
| CA (1) | CA925504A (index.php) |
| CH (1) | CH531518A (index.php) |
| CS (1) | CS169796B2 (index.php) |
| CY (1) | CY734A (index.php) |
| DK (1) | DK124546B (index.php) |
| ES (1) | ES374002A1 (index.php) |
| FI (1) | FI50876C (index.php) |
| FR (1) | FR2024563B1 (index.php) |
| GB (1) | GB1244798A (index.php) |
| IE (1) | IE33644B1 (index.php) |
| IL (1) | IL33324A (index.php) |
| LU (1) | LU59909A1 (index.php) |
| NL (1) | NL149792B (index.php) |
| NO (1) | NO124372B (index.php) |
| PH (1) | PH9275A (index.php) |
| PL (1) | PL72709B1 (index.php) |
| RO (1) | RO55863A (index.php) |
| SE (1) | SE365514B (index.php) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3764609A (en) * | 1970-06-22 | 1973-10-09 | Koninklijke Pharma Fab Nv | 1 (dibenzo {8 4,d{9 {0 cyclohepten-5-yl), 1-(dibenzo {8 a,d{9 {0 cycloheptan-5-yl) and 1-(dibenzo {8 a,d{9 {0 cyclooctanyl)imidazoles |
| CA962269A (en) * | 1971-05-05 | 1975-02-04 | Robert E. Grahame (Jr.) | Thiazoles, and their use as insecticides |
| US3996364A (en) * | 1975-08-06 | 1976-12-07 | Smithkline Corporation | 9-Xanthylamin oalkylpyridine derivatives |
| US4087434A (en) * | 1976-09-22 | 1978-05-02 | Research Corporation | Hetero-N containing polycyclic chlorinated hydrocarbons resulting from cyclo additions of pentachloro-β-pyrrolenine with olefins |
| US4182884A (en) * | 1976-09-22 | 1980-01-08 | Research Corporation | Polycyclic chlorinated hydrocarbons containing bridgehead or imino nitrogen |
| DE2650171A1 (de) * | 1976-10-30 | 1978-05-11 | Bayer Ag | Azolyl-9,10-dihydro-anthracen-derivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| US4092322A (en) * | 1977-02-14 | 1978-05-30 | Warner-Lambert Company | 1-Benzoxepino[4,3-c]pyridines |
| US4169205A (en) * | 1978-10-25 | 1979-09-25 | E. R. Squibb & Sons, Inc. | Imidazole derivatives of 6,11-dihydrodibenz[b,e]oxepines and 6,11-dihydrodibenz[b,e]thiepines |
| DE3017881A1 (de) * | 1980-05-09 | 1981-11-12 | Bayer Ag, 5090 Leverkusen | Imidazolyl-indeno-thiophene, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4757082A (en) * | 1984-06-18 | 1988-07-12 | Eli Lilly And Company | Method of inhibiting aromatase |
| US5173489A (en) * | 1986-04-10 | 1992-12-22 | The Dupont Merck Pharmaceutical Co. | α,α-disubstituted aromatics and heteroaromatics as cognition enhancers |
| US5006513A (en) * | 1987-11-09 | 1991-04-09 | Miles Inc. | Antimycotic compositions of nikkomycin compounds and azole antimycotica |
| US5096889A (en) * | 1987-11-09 | 1992-03-17 | Bayer Ag | Antimycotic compositions of nikkomycin compounds and azole antimycotics |
| US5194427A (en) * | 1987-11-09 | 1993-03-16 | Bayer Ag | Antimycotic compositions of nikkomycin compounds and azole antimycotics |
| US4914087A (en) * | 1988-02-29 | 1990-04-03 | Bayer Ag | Nikkomycin derivatives, antimycotic compositions of nikkomycin derivatives and azole antimycotics |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1511875A (fr) * | 1966-02-17 | 1968-02-02 | Lilly Co Eli | Nouvelles pyridines 3-substituées, leur procédé de fabrication et compositions pesticides les contenant |
| GB1170188A (en) * | 1967-09-15 | 1969-11-12 | Bayer Ag | N-trityl-imidazoles and salts and uses thereof |
-
1969
- 1969-11-07 CH CH1658769A patent/CH531518A/de not_active IP Right Cessation
- 1969-11-07 IL IL33324A patent/IL33324A/xx unknown
- 1969-11-12 US US876033A patent/US3647816A/en not_active Expired - Lifetime
- 1969-11-12 CA CA067244A patent/CA925504A/en not_active Expired
- 1969-11-19 GB GB56580/69A patent/GB1244798A/en not_active Expired
- 1969-11-19 IE IE1567/69A patent/IE33644B1/xx unknown
- 1969-11-22 RO RO61642A patent/RO55863A/ro unknown
- 1969-11-24 PH PH10932*UA patent/PH9275A/en unknown
- 1969-11-24 BR BR214425/69A patent/BR6914425D0/pt unknown
- 1969-11-24 BG BG013418A patent/BG16338A3/bg unknown
- 1969-11-25 FI FI693423A patent/FI50876C/fi active
- 1969-11-25 DK DK625869AA patent/DK124546B/da unknown
- 1969-11-25 CS CS7763A patent/CS169796B2/cs unknown
- 1969-11-26 NL NL696917811A patent/NL149792B/xx not_active IP Right Cessation
- 1969-11-27 LU LU59909D patent/LU59909A1/xx unknown
- 1969-11-27 AT AT1108969A patent/AT289786B/de active
- 1969-11-28 SE SE16429/69A patent/SE365514B/xx unknown
- 1969-11-28 BE BE742389D patent/BE742389A/xx unknown
- 1969-11-28 PL PL1969137176A patent/PL72709B1/pl unknown
- 1969-11-28 FR FR696941182A patent/FR2024563B1/fr not_active Expired
- 1969-11-28 ES ES374002A patent/ES374002A1/es not_active Expired
- 1969-11-28 NO NO4711/69A patent/NO124372B/no unknown
-
1971
- 1971-07-09 US US00161270A patent/US3737548A/en not_active Expired - Lifetime
-
1974
- 1974-04-16 CY CY73474A patent/CY734A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE365514B (index.php) | 1974-03-25 |
| DK124546B (da) | 1972-10-30 |
| ES374002A1 (es) | 1971-11-16 |
| RO55863A (index.php) | 1974-03-01 |
| DE1811654A1 (de) | 1970-06-11 |
| CY734A (en) | 1974-04-16 |
| IL33324A0 (en) | 1970-01-29 |
| CA925504A (en) | 1973-05-01 |
| PL72709B1 (index.php) | 1974-08-30 |
| US3647816A (en) | 1972-03-07 |
| IL33324A (en) | 1972-09-28 |
| BR6914425D0 (pt) | 1973-02-22 |
| US3737548A (en) | 1973-06-05 |
| FI50876C (fi) | 1976-08-10 |
| IE33644L (en) | 1970-05-29 |
| IE33644B1 (en) | 1974-09-04 |
| PH9275A (en) | 1975-08-05 |
| FI50876B (index.php) | 1976-04-30 |
| NL6917811A (index.php) | 1970-06-02 |
| AT289786B (de) | 1971-05-10 |
| LU59909A1 (index.php) | 1970-01-27 |
| CH531518A (de) | 1972-12-15 |
| FR2024563A1 (index.php) | 1970-08-28 |
| FR2024563B1 (index.php) | 1973-07-13 |
| BE742389A (index.php) | 1970-05-28 |
| GB1244798A (en) | 1971-09-02 |
| DE1811654B2 (de) | 1977-02-24 |
| BG16338A3 (bg) | 1972-08-20 |
| NL149792B (nl) | 1976-06-15 |
| CS169796B2 (index.php) | 1976-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO124372B (index.php) | ||
| NO135363B (index.php) | ||
| NO980055L (no) | Antisoppmiddel, forbindelse derfor og fremgangsmåte for fremstilling derav | |
| DD148773A5 (de) | Verfahren zur herstellung von imidazol-derivaten | |
| NO763724L (index.php) | ||
| DE2504250A1 (de) | Tetrahydroisochinolin-derivate und verfahren zu ihrer herstellung | |
| NO138564B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktivt 1-(2-carboxy-chromon-5-yloxy)-2-(hydroxy)-3-(p-cyanfenoxy) propan eller derivater herav | |
| CN115385917B (zh) | 一类色胺酮7位或9位取代芳香硫醚衍生物、其制备方法及应用 | |
| NO132395B (index.php) | ||
| NO127970B (index.php) | ||
| DE2932967A1 (de) | Imidazol-derivate, verfahren zu ihrer herstellung und solche derivate enthaltende arzneimittel | |
| DE2800316A1 (de) | Oximether enthaltende arzneimittel zur bekaempfung von ulcera, oximether und verfahren zu ihrer herstellung | |
| DE2503136A1 (de) | 5-methylthiopyrimidine, die als antidiabetische und hypocholesterinaemische arzneimittel geeignet sind | |
| NO780040L (no) | Fremgangsmaate ved fremstilling av nye piperidinderivater | |
| US3046283A (en) | 10-(omega-aminoalkylidene)-thioxanthenes | |
| DE1960910A1 (de) | Neue Benzylidenamino-oxyalkylcarbonsaeuren und Carbonsaeurederivate | |
| DE2642877A1 (de) | Substituierte 2-nitro-3-phenylbenzofuranverbindungen | |
| DE2253914A1 (de) | Neue chromonderivate und verfahren zu ihrer herstellung | |
| NO176050B (no) | Analogifremgangsmåte for fremstilling av nye basiske substituerte 5-halogentienoisoltiazol-3(2H)-on-1,1-dioksyd | |
| DE2734270C2 (index.php) | ||
| CH638494A5 (de) | Verfahren zur herstellung von 1-(p-chlorbenzoyl)-5-methoxy-2-methyl-3-indolylessigsaeure-2'-phenyl-2'-carboxyaethylester. | |
| Browning et al. | The trypanocidal action of some derivatives of anil and styryl quinolines.—II | |
| US3015658A (en) | Process for the preparation of new | |
| US5264432A (en) | 5-(1-aminoacyl)-5,10-dihydro-11H-dibenzo[b,e](1,4)diazepin-11-ones | |
| US4259335A (en) | 1-Methyl-4-piperidinol esters of 4-quinolinylamino benzoates and antiinflammatory and analgesic compositions and methods employing them |