NO121721B - - Google Patents
Download PDFInfo
- Publication number
- NO121721B NO121721B NO167980A NO16798067A NO121721B NO 121721 B NO121721 B NO 121721B NO 167980 A NO167980 A NO 167980A NO 16798067 A NO16798067 A NO 16798067A NO 121721 B NO121721 B NO 121721B
- Authority
- NO
- Norway
- Prior art keywords
- chlorine
- alkali metal
- chlorate
- chloride
- sodium
- Prior art date
Links
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 claims description 104
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 69
- 239000004155 Chlorine dioxide Substances 0.000 claims description 52
- 235000019398 chlorine dioxide Nutrition 0.000 claims description 52
- 229910052783 alkali metal Inorganic materials 0.000 claims description 41
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 40
- -1 alkali metal chlorate Chemical class 0.000 claims description 38
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 36
- 239000000460 chlorine Substances 0.000 claims description 36
- 229910052801 chlorine Inorganic materials 0.000 claims description 34
- 238000000034 method Methods 0.000 claims description 24
- 239000011541 reaction mixture Substances 0.000 claims description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 229910001504 inorganic chloride Inorganic materials 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- 239000003638 chemical reducing agent Substances 0.000 claims description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 4
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Inorganic materials Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 claims description 4
- 239000005708 Sodium hypochlorite Substances 0.000 claims description 2
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 claims description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 claims description 2
- 230000001105 regulatory effect Effects 0.000 claims 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 72
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 51
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 50
- 239000011780 sodium chloride Substances 0.000 description 36
- 239000007789 gas Substances 0.000 description 26
- 239000000243 solution Substances 0.000 description 25
- 239000007788 liquid Substances 0.000 description 18
- 239000012295 chemical reaction liquid Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 238000009826 distribution Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000002699 waste material Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910001902 chlorine oxide Inorganic materials 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- 239000000498 cooling water Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- BOJKULTULYSRAS-OTESTREVSA-N Andrographolide Chemical compound C([C@H]1[C@]2(C)CC[C@@H](O)[C@]([C@H]2CCC1=C)(CO)C)\C=C1/[C@H](O)COC1=O BOJKULTULYSRAS-OTESTREVSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical group CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000011437 continuous method Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- IYGFDEZBVCNBRU-UHFFFAOYSA-L disodium sulfuric acid sulfate Chemical compound [H+].[H+].[H+].[H+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O IYGFDEZBVCNBRU-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012527 feed solution Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- SATVIFGJTRRDQU-UHFFFAOYSA-N potassium hypochlorite Chemical compound [K+].Cl[O-] SATVIFGJTRRDQU-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
- C07D217/16—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/04—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1966F0049122 DE1670694B2 (de) | 1966-05-05 | 1966-05-05 | Verfahren zur herstellung von tetrahydroisochinolinen |
| DE1670848A DE1670848C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von Tetrahydroisochinolinen |
| DE1670849A DE1670849C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von 8-Acylamino-1,23,4-tetrahydroisochinolinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121721B true NO121721B (OSRAM) | 1971-04-05 |
Family
ID=27210480
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO167980A NO121721B (OSRAM) | 1966-05-05 | 1967-05-03 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3577424A (OSRAM) |
| AT (3) | AT282634B (OSRAM) |
| BE (1) | BE698033A (OSRAM) |
| CH (3) | CH487893A (OSRAM) |
| DE (3) | DE1670694B2 (OSRAM) |
| DK (1) | DK123598B (OSRAM) |
| FR (2) | FR6496M (OSRAM) |
| GB (1) | GB1164192A (OSRAM) |
| NL (1) | NL157899B (OSRAM) |
| NO (1) | NO121721B (OSRAM) |
| SE (1) | SE330170B (OSRAM) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4048180A (en) * | 1968-03-18 | 1977-09-13 | Imperial Chemical Industries Limited | Pyridyl-tetrahydropyrans and process for preparing same |
| CH538477A (de) * | 1970-01-06 | 1973-06-30 | Hoffmann La Roche | Verfahren zur Herstellung von Isochinolin-Derivaten |
| US3666763A (en) * | 1970-01-06 | 1972-05-30 | Hoffmann La Roche | 4-phenyl isoquinolines and process for preparing same |
| US3947456A (en) * | 1970-01-06 | 1976-03-30 | Hoffman-La Roche Inc. | Substituted 4-phenyl isoquinolines |
| FR2081572B1 (OSRAM) * | 1970-03-12 | 1973-04-06 | Rhone Poulenc Sa | |
| US4419517A (en) * | 1973-06-01 | 1983-12-06 | E. I. Du Pont De Nemours & Co. | 4a-Aryl-trans-decahydroisoquinolines |
| IL45823A (en) * | 1973-10-20 | 1977-10-31 | Hoechst Ag | Substituted 1-phenyl-4-alkyl(dialkyl or cyclic) aminoalkyl-1,4-dihydro-2h-isoquinoline-3-one derivatives |
| SE7509022L (sv) | 1974-09-09 | 1976-03-10 | Du Pont | Foreningar med analgetisk verkan |
| DE2723524A1 (de) * | 1977-05-25 | 1978-12-14 | Hoechst Ag | 8-amino-2-methyl-4-phenyl-1,2,3,4- tetrahydroisochinolin-8-n-glucuronid und verfahren zu seiner herstellung |
| DE2724683A1 (de) * | 1977-06-01 | 1978-12-14 | Hoechst Ag | Antidepressiv wirksame pharmazeutische praeparate |
| DE2724610A1 (de) * | 1977-06-01 | 1978-12-14 | Hoechst Ag | 4-phenyl-8-amino-tetrahydroisochinoline |
| US4340600A (en) * | 1980-05-22 | 1982-07-20 | Smithkline Corporation | Renal dilating methods and compositions using 4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinolines |
| US4375471A (en) * | 1981-02-19 | 1983-03-01 | Hoechst-Roussel Pharmaceuticals Inc. | 4-Aryloxy-1,2,3,4-tetrahydroisoquinolines |
| US4477670A (en) * | 1981-02-19 | 1984-10-16 | Hoechst-Roussel Pharmaceuticals Inc. | 4-Aryloxy-1,2,3,4-tetrahydroisoquinolines |
| BG33347A1 (en) * | 1981-06-10 | 1983-02-15 | Zabunova Cvetanova | Method for obtaining of n- (2- aminobenzyl)- 1- phenyl- 2- methylaminoethanol |
| HU186518B (en) * | 1982-06-04 | 1985-08-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing 8-bracket-amino-acyl-amino-bracket closed-4-aryl-2-methyl-1,2,3,4-tetrahydro-isoquinoline derivatives |
| DE3333994A1 (de) * | 1983-09-21 | 1985-04-04 | Troponwerke GmbH & Co KG, 5000 Köln | Neue pyridoindolderivate, verfahren zu ihrer herstellung und ihre verwendung |
| BG39661A1 (en) * | 1984-04-13 | 1986-08-29 | Ivanova | Antiulcer means |
| GB8509834D0 (en) * | 1985-04-17 | 1985-05-22 | Beecham Group Plc | Compounds |
| US4876261A (en) * | 1987-03-27 | 1989-10-24 | Akihiro Tanaka | Substituted tetrahydroisoquinoline compounds and composition containing them |
| GB9816984D0 (en) * | 1998-08-05 | 1998-09-30 | Smithkline Beecham Plc | Novel compounds |
| GB9817424D0 (en) | 1998-08-11 | 1998-10-07 | Smithkline Beecham Plc | Novel compounds |
| MXPA05011225A (es) * | 2003-04-18 | 2005-12-14 | Pharmacia & Upjohn Co Llc | Politerapias. |
| WO2009111031A2 (en) * | 2008-03-04 | 2009-09-11 | Intra-Cellular Therapies, Inc. | Methods of treating vasomotor symptoms |
-
1966
- 1966-05-05 DE DE1966F0049122 patent/DE1670694B2/de active Granted
-
1967
- 1967-04-15 DE DE1670848A patent/DE1670848C3/de not_active Expired
- 1967-04-15 DE DE1670849A patent/DE1670849C3/de not_active Expired
- 1967-05-03 AT AT06072/69A patent/AT282634B/de not_active IP Right Cessation
- 1967-05-03 AT AT607169A patent/AT289804B/de not_active IP Right Cessation
- 1967-05-03 NO NO167980A patent/NO121721B/no unknown
- 1967-05-03 AT AT413967A patent/AT281827B/de not_active IP Right Cessation
- 1967-05-03 DK DK236067AA patent/DK123598B/da not_active IP Right Cessation
- 1967-05-03 SE SE06265/67A patent/SE330170B/xx unknown
- 1967-05-05 GB GB21016/67A patent/GB1164192A/en not_active Expired
- 1967-05-05 BE BE698033D patent/BE698033A/xx not_active IP Right Cessation
- 1967-05-05 CH CH225270A patent/CH487893A/de not_active IP Right Cessation
- 1967-05-05 NL NL6706322.A patent/NL157899B/xx not_active IP Right Cessation
- 1967-05-05 CH CH641467A patent/CH487892A/de not_active IP Right Cessation
- 1967-05-05 CH CH225370A patent/CH501628A/de not_active IP Right Cessation
- 1967-08-04 FR FR116866A patent/FR6496M/fr not_active Expired
- 1967-08-04 FR FR116865A patent/FR6646M/fr not_active Expired
-
1969
- 1969-10-20 US US867932A patent/US3577424A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1670848A1 (de) | 1971-04-08 |
| DE1670848B2 (de) | 1979-10-11 |
| BE698033A (OSRAM) | 1967-11-06 |
| SE330170B (OSRAM) | 1970-11-09 |
| US3577424A (en) | 1971-05-04 |
| DE1670849C3 (de) | 1978-07-20 |
| AT289804B (de) | 1971-05-10 |
| FR6496M (OSRAM) | 1968-11-25 |
| AT281827B (de) | 1970-06-10 |
| DK123598B (da) | 1972-07-10 |
| DE1670848C3 (de) | 1980-06-19 |
| NL157899B (nl) | 1978-09-15 |
| NL6706322A (OSRAM) | 1967-11-06 |
| DE1670694B2 (de) | 1976-07-22 |
| DE1670849A1 (de) | 1971-02-25 |
| CH501628A (de) | 1971-01-15 |
| CH487892A (de) | 1970-03-31 |
| AT282634B (de) | 1970-07-10 |
| CH487893A (de) | 1970-03-31 |
| DE1670694A1 (de) | 1970-12-03 |
| GB1164192A (en) | 1969-09-17 |
| FR6646M (OSRAM) | 1969-01-20 |
| DE1670849B2 (de) | 1977-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO121721B (OSRAM) | ||
| NO314798B1 (no) | Fremgangsmåte ved kontinuerlig fremstilling av klordioksyd | |
| RU2562858C2 (ru) | Способ производства диоксида хлора | |
| US3933988A (en) | Method of simultaneously producing chlorine dioxide and a sulfate salt | |
| US3920801A (en) | Method of producing chlorine dioxide from hydrogen chloride | |
| US3754081A (en) | Process for the production of chlorine dioxide,chlorine and a mixtureof an alkali metal sulfate and bisulfate | |
| US3341288A (en) | Production of chlorine dioxide | |
| US20180334384A1 (en) | Systems, reactors, methods and compositions for producing chlorine dioxide | |
| US4216195A (en) | Production of chlorine dioxide having low chlorine content | |
| US2895801A (en) | Process for producing chlorine dioxide | |
| JPH03115102A (ja) | 二酸化塩素の製造法 | |
| US4543243A (en) | Process and a device for the production of chlorine dioxide | |
| AU2005285645B2 (en) | A process for the production of chlorine dioxide | |
| AU2010305879B2 (en) | Process for production of chlorine dioxide | |
| RU2091509C1 (ru) | Способ получения гидроокиси щелочного металла | |
| CN102648151A (zh) | 生产二氧化氯的方法 | |
| US3864457A (en) | Process for the production of chlorine dioxide | |
| NO303573B1 (no) | FremgangsmÕte for fjerning av vesentlig kromfritt sulfat fra en kromat- og sulfatholdig vandig alkalimetallkloratoppl°sning, samt kontinuerlig fremgangsmÕte for fremstilling av alkalimetallklorat | |
| NO152645B (no) | Fremgangsmaate for fremstilling av klordioksyd | |
| EP0131378B1 (en) | Process for the production of chlorine dioxide | |
| JPH0621004B2 (ja) | 二酸化塩素の製造法 | |
| CA2946017A1 (en) | A method for hydrogen peroxide based chlorine dioxide production process with a vertical generator | |
| NO309519B1 (no) | Fremgangsmåte for fremstilling av klordioksid | |
| US20060067873A1 (en) | Process for the production of chlorine dioxide | |
| NO771329L (no) | Fremgangsm}te ved fremstilling av klordioxyd. |