MXPA04010663A - 6-alquiliden-penems biciclicos como inhibidores de beta-lactamasas. - Google Patents
6-alquiliden-penems biciclicos como inhibidores de beta-lactamasas.Info
- Publication number
- MXPA04010663A MXPA04010663A MXPA04010663A MXPA04010663A MXPA04010663A MX PA04010663 A MXPA04010663 A MX PA04010663A MX PA04010663 A MXPA04010663 A MX PA04010663A MX PA04010663 A MXPA04010663 A MX PA04010663A MX PA04010663 A MXPA04010663 A MX PA04010663A
- Authority
- MX
- Mexico
- Prior art keywords
- optionally substituted
- thia
- oxo
- hept
- carboxylic acid
- Prior art date
Links
- 239000003112 inhibitor Substances 0.000 title description 11
- 102000006635 beta-lactamase Human genes 0.000 title description 10
- 108020004256 Beta-lactamase Proteins 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 155
- 208000035143 Bacterial infection Diseases 0.000 claims abstract description 5
- 208000022362 bacterial infectious disease Diseases 0.000 claims abstract description 5
- 239000000203 mixture Substances 0.000 claims description 233
- -1 NR ^ Chemical group 0.000 claims description 210
- 239000002253 acid Substances 0.000 claims description 136
- 229910052799 carbon Inorganic materials 0.000 claims description 114
- FYZUENZXIZCLAZ-UHFFFAOYSA-N 2-methylhept-2-enoic acid Chemical compound CCCCC=C(C)C(O)=O FYZUENZXIZCLAZ-UHFFFAOYSA-N 0.000 claims description 105
- 150000001721 carbon Chemical group 0.000 claims description 94
- 125000004432 carbon atom Chemical group C* 0.000 claims description 92
- 159000000000 sodium salts Chemical class 0.000 claims description 90
- 229910052717 sulfur Inorganic materials 0.000 claims description 64
- 229910052757 nitrogen Inorganic materials 0.000 claims description 56
- 125000000217 alkyl group Chemical group 0.000 claims description 50
- 125000001072 heteroaryl group Chemical group 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 30
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 29
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 24
- 125000003118 aryl group Chemical group 0.000 claims description 24
- 125000002619 bicyclic group Chemical group 0.000 claims description 19
- 125000005842 heteroatom Chemical group 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 18
- 239000003782 beta lactam antibiotic agent Substances 0.000 claims description 17
- 239000002132 β-lactam antibiotic Substances 0.000 claims description 17
- 229940124586 β-lactam antibiotics Drugs 0.000 claims description 17
- 208000015181 infectious disease Diseases 0.000 claims description 15
- 229920006395 saturated elastomer Polymers 0.000 claims description 15
- 125000004122 cyclic group Chemical group 0.000 claims description 13
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 12
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 12
- 125000003107 substituted aryl group Chemical group 0.000 claims description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 11
- 125000004429 atom Chemical group 0.000 claims description 11
- 125000000623 heterocyclic group Chemical class 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 125000000304 alkynyl group Chemical group 0.000 claims description 9
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 9
- 125000005326 heteroaryloxy alkyl group Chemical group 0.000 claims description 8
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 8
- 125000003003 spiro group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 125000002950 monocyclic group Chemical group 0.000 claims description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 6
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 6
- LZDUSDGRALPEID-UHFFFAOYSA-N 5,5-dimethylpiperidin-2-one Chemical compound CC1(C)CCC(=O)NC1 LZDUSDGRALPEID-UHFFFAOYSA-N 0.000 claims description 5
- 125000005018 aryl alkenyl group Chemical group 0.000 claims description 5
- 125000005325 aryloxy aryl group Chemical group 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- IWPOSDLLFZKGOW-UHFFFAOYSA-N oct-3-enoic acid Chemical compound CCCCC=CCC(O)=O IWPOSDLLFZKGOW-UHFFFAOYSA-N 0.000 claims description 5
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 5
- ZIHYVLFLVDRNED-UHFFFAOYSA-M sodium;2-methylhept-2-enoate Chemical compound [Na+].CCCCC=C(C)C([O-])=O ZIHYVLFLVDRNED-UHFFFAOYSA-M 0.000 claims description 5
- IVFHCVAIVOSJKU-WAPJZHGLSA-N (6z)-6-[(7-methyl-6-oxo-5,8-dihydroimidazo[1,2-a]pyrazin-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1C(=O)N(C)CC2=NC(\C=C/3C(N4C(=CSC4\3)C(O)=O)=O)=CN21 IVFHCVAIVOSJKU-WAPJZHGLSA-N 0.000 claims description 4
- 125000005213 alkyl heteroaryl group Chemical group 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 125000005553 heteroaryloxy group Chemical group 0.000 claims description 4
- DMEYZPJEFHGESJ-BAQGIRSFSA-N (6z)-6-(6,8-dihydro-5h-imidazo[2,1-c][1,4]oxazin-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1COCC2=NC(/C=C3/C(=O)N4C3SC=C4C(=O)O)=CN21 DMEYZPJEFHGESJ-BAQGIRSFSA-N 0.000 claims description 3
- NJRJPWDAUDRBDD-NVNXTCNLSA-N (6z)-6-[(7-benzyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazin-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CSC2N1C(=O)\C2=C\C(N=C1C2)=CN1CCN2CC1=CC=CC=C1 NJRJPWDAUDRBDD-NVNXTCNLSA-N 0.000 claims description 3
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 claims description 3
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 3
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 3
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims description 3
- 125000002618 bicyclic heterocycle group Chemical group 0.000 claims description 3
- 125000005226 heteroaryloxycarbonyl group Chemical group 0.000 claims description 3
- 125000002911 monocyclic heterocycle group Chemical group 0.000 claims description 3
- 125000006574 non-aromatic ring group Chemical group 0.000 claims description 3
- IWYXYMFQSVAJLW-UHFFFAOYSA-N 4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CSC2CCN12 IWYXYMFQSVAJLW-UHFFFAOYSA-N 0.000 claims description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 2
- FVUCWGGFZNLYLD-UHFFFAOYSA-M [Na+].C(C=CCCCC)C(=O)[O-] Chemical compound [Na+].C(C=CCCCC)C(=O)[O-] FVUCWGGFZNLYLD-UHFFFAOYSA-M 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 239000003451 thiazide diuretic agent Substances 0.000 claims description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical class [H]O* 0.000 claims 1
- 229910052742 iron Inorganic materials 0.000 claims 1
- 108090000765 processed proteins & peptides Proteins 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 351
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 288
- 239000000243 solution Substances 0.000 description 280
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 242
- 239000011541 reaction mixture Substances 0.000 description 194
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 159
- 230000002829 reductive effect Effects 0.000 description 150
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 145
- 239000007787 solid Substances 0.000 description 124
- 229910001868 water Inorganic materials 0.000 description 123
- 238000006243 chemical reaction Methods 0.000 description 115
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 113
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 112
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 108
- 239000000706 filtrate Substances 0.000 description 107
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 104
- 239000012044 organic layer Substances 0.000 description 100
- 239000000047 product Substances 0.000 description 98
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 94
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 92
- 238000005481 NMR spectroscopy Methods 0.000 description 86
- 239000010410 layer Substances 0.000 description 83
- 238000002360 preparation method Methods 0.000 description 70
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 68
- 238000004440 column chromatography Methods 0.000 description 61
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 60
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 59
- 239000012299 nitrogen atmosphere Substances 0.000 description 58
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 58
- 229910052751 metal Inorganic materials 0.000 description 57
- 239000002184 metal Substances 0.000 description 57
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 56
- 101150041968 CDC13 gene Proteins 0.000 description 52
- 238000010992 reflux Methods 0.000 description 49
- 239000012267 brine Substances 0.000 description 48
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 48
- 239000007864 aqueous solution Substances 0.000 description 46
- 239000008363 phosphate buffer Substances 0.000 description 46
- 229910052760 oxygen Inorganic materials 0.000 description 42
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 41
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 40
- 239000013078 crystal Substances 0.000 description 40
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 38
- 239000000741 silica gel Substances 0.000 description 37
- 229910002027 silica gel Inorganic materials 0.000 description 37
- 238000010898 silica gel chromatography Methods 0.000 description 37
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 36
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 34
- 229910000027 potassium carbonate Inorganic materials 0.000 description 33
- 125000001424 substituent group Chemical group 0.000 description 31
- 239000000843 powder Substances 0.000 description 30
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 28
- 229920005989 resin Polymers 0.000 description 28
- 239000011347 resin Substances 0.000 description 28
- 239000003921 oil Substances 0.000 description 26
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 24
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 24
- 229910001623 magnesium bromide Inorganic materials 0.000 description 24
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 24
- 239000011701 zinc Substances 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- 238000001179 sorption measurement Methods 0.000 description 23
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 22
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 21
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 20
- 235000015320 potassium carbonate Nutrition 0.000 description 19
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 18
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 18
- 238000005160 1H NMR spectroscopy Methods 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 17
- 150000002148 esters Chemical class 0.000 description 17
- 125000004494 ethyl ester group Chemical group 0.000 description 17
- 238000003756 stirring Methods 0.000 description 16
- 239000012298 atmosphere Substances 0.000 description 15
- 238000004587 chromatography analysis Methods 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 14
- 241000699670 Mus sp. Species 0.000 description 14
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 241001465754 Metazoa Species 0.000 description 13
- 239000003242 anti bacterial agent Substances 0.000 description 13
- 150000005840 aryl radicals Chemical class 0.000 description 13
- 238000001914 filtration Methods 0.000 description 13
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Inorganic materials O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 13
- 125000002217 penem group Chemical group 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 12
- 150000001299 aldehydes Chemical class 0.000 description 12
- 235000019270 ammonium chloride Nutrition 0.000 description 12
- 239000000463 material Substances 0.000 description 12
- VQWYSTGIQKLGAL-WVZVXSGGSA-N (5r,6s)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CS[C@@H]2[C@@H](Br)C(=O)N12 VQWYSTGIQKLGAL-WVZVXSGGSA-N 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 11
- 229940078552 o-xylene Drugs 0.000 description 11
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 10
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 10
- 229940088710 antibiotic agent Drugs 0.000 description 10
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 10
- 235000011181 potassium carbonates Nutrition 0.000 description 10
- 239000012300 argon atmosphere Substances 0.000 description 9
- 238000003818 flash chromatography Methods 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- 102000004190 Enzymes Human genes 0.000 description 8
- 108090000790 Enzymes Proteins 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 239000012429 reaction media Substances 0.000 description 8
- 239000012047 saturated solution Substances 0.000 description 8
- 230000000844 anti-bacterial effect Effects 0.000 description 7
- 229910052681 coesite Inorganic materials 0.000 description 7
- 229910052906 cristobalite Inorganic materials 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- 230000002441 reversible effect Effects 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- 229910052682 stishovite Inorganic materials 0.000 description 7
- 229910052905 tridymite Inorganic materials 0.000 description 7
- RDOAUPPSCNSYPM-UHFFFAOYSA-N 3,4-dihydropyridine Chemical compound C1CC=NC=C1 RDOAUPPSCNSYPM-UHFFFAOYSA-N 0.000 description 6
- VQWYSTGIQKLGAL-UHFFFAOYSA-N 6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CSC2C(Br)C(=O)N12 VQWYSTGIQKLGAL-UHFFFAOYSA-N 0.000 description 6
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 230000003115 biocidal effect Effects 0.000 description 6
- OAIVIYSBZFEOIU-UHFFFAOYSA-N chloroform;propan-2-one Chemical compound CC(C)=O.ClC(Cl)Cl OAIVIYSBZFEOIU-UHFFFAOYSA-N 0.000 description 6
- 239000008367 deionised water Substances 0.000 description 6
- 229910021641 deionized water Inorganic materials 0.000 description 6
- FMVJYQGSRWVMQV-UHFFFAOYSA-N ethyl propiolate Chemical compound CCOC(=O)C#C FMVJYQGSRWVMQV-UHFFFAOYSA-N 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 5
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 5
- 239000012448 Lithium borohydride Substances 0.000 description 5
- 239000003781 beta lactamase inhibitor Substances 0.000 description 5
- 229940126813 beta-lactamase inhibitor Drugs 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 229960002292 piperacillin Drugs 0.000 description 5
- WCMIIGXFCMNQDS-IDYPWDAWSA-M piperacillin sodium Chemical compound [Na+].O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N2[C@@H](C([O-])=O)C(C)(C)S[C@@H]21 WCMIIGXFCMNQDS-IDYPWDAWSA-M 0.000 description 5
- 238000004007 reversed phase HPLC Methods 0.000 description 5
- YFUNNTKEYQOTKY-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-(hydroxymethyl)-6,7-dihydro-4h-pyrazolo[1,5-a]pyrazine-5-carboxylate Chemical compound C1CN2N=C(CO)C=C2CN1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 YFUNNTKEYQOTKY-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 4
- 229930186147 Cephalosporin Natural products 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 108090000204 Dipeptidase 1 Proteins 0.000 description 4
- HDJLSECJEQSPKW-UHFFFAOYSA-N Methyl 2-Furancarboxylate Chemical compound COC(=O)C1=CC=CO1 HDJLSECJEQSPKW-UHFFFAOYSA-N 0.000 description 4
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 4
- 229930182555 Penicillin Natural products 0.000 description 4
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 description 4
- 229960003022 amoxicillin Drugs 0.000 description 4
- 238000010533 azeotropic distillation Methods 0.000 description 4
- 230000001580 bacterial effect Effects 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 4
- 229940124587 cephalosporin Drugs 0.000 description 4
- 150000001780 cephalosporins Chemical class 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- 238000001990 intravenous administration Methods 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 4
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 238000006894 reductive elimination reaction Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- GRSYTAZHKXFUII-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-formyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-7-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1CC2=NC(C=O)=CN2CC1 GRSYTAZHKXFUII-UHFFFAOYSA-N 0.000 description 3
- UAILHDKDBBFHDN-BAQGIRSFSA-N (6z)-6-(6,8-dihydro-5h-imidazo[2,1-c][1,4]thiazin-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1CSCC2=NC(/C=C3/C(=O)N4C3SC=C4C(=O)O)=CN21 UAILHDKDBBFHDN-BAQGIRSFSA-N 0.000 description 3
- QFPFAMXSPHDRJE-UHFFFAOYSA-N 1,3-thiazolidine-4-thione Chemical compound S=C1CSCN1 QFPFAMXSPHDRJE-UHFFFAOYSA-N 0.000 description 3
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Chemical compound C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 3
- URLSDGMHUWQLDE-UHFFFAOYSA-N 2,3-dihydropyrazolo[5,1-b][1,3]thiazole-6-carbaldehyde Chemical compound S1CCN2N=C(C=O)C=C21 URLSDGMHUWQLDE-UHFFFAOYSA-N 0.000 description 3
- YSZSXROLSODLRW-UHFFFAOYSA-N 2h-1,4-thiazine-2-carbaldehyde Chemical compound O=CC1SC=CN=C1 YSZSXROLSODLRW-UHFFFAOYSA-N 0.000 description 3
- SEOMGBFEZSRSQR-UHFFFAOYSA-N 6,6-dimethyl-7,8-dihydro-5h-imidazo[1,2-a]pyridine-2-carbaldehyde Chemical compound C1C(C)(C)CCC2=NC(C=O)=CN21 SEOMGBFEZSRSQR-UHFFFAOYSA-N 0.000 description 3
- IFOAVNDPIZTQMU-UHFFFAOYSA-N 6,7-dihydro-5h-pyrrolo[1,2-a]imidazole-2-carbaldehyde Chemical compound C1CCC2=NC(C=O)=CN21 IFOAVNDPIZTQMU-UHFFFAOYSA-N 0.000 description 3
- AFYFINMBQAGTFW-UHFFFAOYSA-N 7-methyl-6-oxo-5,8-dihydroimidazo[1,2-a]pyrazine-2-carbaldehyde Chemical compound C1C(=O)N(C)CC2=NC(C=O)=CN21 AFYFINMBQAGTFW-UHFFFAOYSA-N 0.000 description 3
- UVVPVKHUHFPIHV-UHFFFAOYSA-N 7-methyl-6-oxo-5,8-dihydroimidazo[1,2-a]pyrazine-3-carbaldehyde Chemical compound C1C(=O)N(C)CC2=NC=C(C=O)N21 UVVPVKHUHFPIHV-UHFFFAOYSA-N 0.000 description 3
- 101000740462 Escherichia coli Beta-lactamase TEM Proteins 0.000 description 3
- 229910010084 LiAlH4 Inorganic materials 0.000 description 3
- 206010034133 Pathogen resistance Diseases 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 239000004599 antimicrobial Substances 0.000 description 3
- 239000007810 chemical reaction solvent Substances 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- FDSGHYHRLSWSLQ-UHFFFAOYSA-N dichloromethane;propan-2-one Chemical compound ClCCl.CC(C)=O FDSGHYHRLSWSLQ-UHFFFAOYSA-N 0.000 description 3
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- BFWQGQXCGLKWIO-UHFFFAOYSA-N ethyl 2,3-dihydropyrazolo[5,1-b][1,3]thiazole-6-carboxylate Chemical compound S1CCN2N=C(C(=O)OCC)C=C21 BFWQGQXCGLKWIO-UHFFFAOYSA-N 0.000 description 3
- IKGCWYHCYQPRBM-UHFFFAOYSA-N ethyl 3,4-dihydropyridine-2-carboxylate Chemical compound C(C)OC(=O)C1=NC=CCC1 IKGCWYHCYQPRBM-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 3
- 239000002054 inoculum Substances 0.000 description 3
- 239000013067 intermediate product Substances 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- JGZKUKYUQJUUNE-UHFFFAOYSA-L magnesium;ethoxyethane;dibromide Chemical compound [Mg+2].[Br-].[Br-].CCOCC JGZKUKYUQJUUNE-UHFFFAOYSA-L 0.000 description 3
- HHXMXAQDOUCLDN-RXMQYKEDSA-N penem Chemical compound S1C=CN2C(=O)C[C@H]21 HHXMXAQDOUCLDN-RXMQYKEDSA-N 0.000 description 3
- 150000002960 penicillins Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002953 phosphate buffered saline Substances 0.000 description 3
- 238000002953 preparative HPLC Methods 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 3
- BCQLGSCBQKKBIM-CMPLNLGQSA-N (4-nitrophenyl)methyl (5r,6s)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=CS[C@H]2N1C(=O)[C@@H]2Br BCQLGSCBQKKBIM-CMPLNLGQSA-N 0.000 description 2
- MHSGOABISYIYKP-UHFFFAOYSA-N (4-nitrophenyl)methyl carbonochloridate Chemical compound [O-][N+](=O)C1=CC=C(COC(Cl)=O)C=C1 MHSGOABISYIYKP-UHFFFAOYSA-N 0.000 description 2
- LGLMHMRNPVACGS-VKHMYHEASA-N (4r)-3-nitroso-1,3-thiazolidine-4-carboxylic acid Chemical compound OC(=O)[C@@H]1CSCN1N=O LGLMHMRNPVACGS-VKHMYHEASA-N 0.000 description 2
- LHNIIDJCEODSHA-OQRUQETBSA-N (6r,7r)-3-[(e)-2-(2,4-dinitrophenyl)ethenyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N([C@H]1[C@H]2SCC(=C(N2C1=O)C(=O)O)\C=C\C=1C(=CC(=CC=1)[N+]([O-])=O)[N+]([O-])=O)C(=O)CC1=CC=CS1 LHNIIDJCEODSHA-OQRUQETBSA-N 0.000 description 2
- SZEAVITUDYBJGA-BAQGIRSFSA-N (6z)-7-oxo-6-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-2-ylmethylidene)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1CNCC2=NC(/C=C3/C(=O)N4C3SC=C4C(=O)O)=CN21 SZEAVITUDYBJGA-BAQGIRSFSA-N 0.000 description 2
- JOKIQGQOKXGHDV-BYPYZUCNSA-N (R)-thiomorpholine-3-carboxylic acid Chemical compound OC(=O)[C@@H]1CSCCN1 JOKIQGQOKXGHDV-BYPYZUCNSA-N 0.000 description 2
- LBJIORYARIDXKA-IWQZZHSRSA-N (z)-2-bromo-3-hydroxyprop-2-enal Chemical compound O\C=C(/Br)C=O LBJIORYARIDXKA-IWQZZHSRSA-N 0.000 description 2
- UCDIXJKWUCLMJK-XQRVVYSFSA-N (z)-2-bromo-3-propan-2-yloxyprop-2-enal Chemical compound CC(C)O\C=C(/Br)C=O UCDIXJKWUCLMJK-XQRVVYSFSA-N 0.000 description 2
- FKASFBLJDCHBNZ-UHFFFAOYSA-N 1,3,4-oxadiazole Chemical compound C1=NN=CO1 FKASFBLJDCHBNZ-UHFFFAOYSA-N 0.000 description 2
- ZGTFNNUASMWGTM-UHFFFAOYSA-N 1,3-thiazole-2-carbaldehyde Chemical compound O=CC1=NC=CS1 ZGTFNNUASMWGTM-UHFFFAOYSA-N 0.000 description 2
- NOLHRFLIXVQPSZ-UHFFFAOYSA-N 1,3-thiazolidin-4-one Chemical compound O=C1CSCN1 NOLHRFLIXVQPSZ-UHFFFAOYSA-N 0.000 description 2
- JVZZMANDNMZDTQ-UHFFFAOYSA-N 1,3a,4,5,6,7-hexahydrooxadiazolo[3,4-a]pyridin-3-one Chemical compound C1CCCC2C(=O)ONN21 JVZZMANDNMZDTQ-UHFFFAOYSA-N 0.000 description 2
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 2
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 2
- CMHFMCGVOOGCHL-UHFFFAOYSA-N 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazole-3,5-dicarbaldehyde Chemical compound CC(C)(C)[Si](C)(C)OCCN1N=C(C=O)C=C1C=O CMHFMCGVOOGCHL-UHFFFAOYSA-N 0.000 description 2
- OMAFFHIGWTVZOH-UHFFFAOYSA-N 1-methyltetrazole Chemical compound CN1C=NN=N1 OMAFFHIGWTVZOH-UHFFFAOYSA-N 0.000 description 2
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 2
- KOPFEFZSAMLEHK-UHFFFAOYSA-N 1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- GPWNWKWQOLEVEQ-UHFFFAOYSA-N 2,4-diaminopyrimidine-5-carbaldehyde Chemical compound NC1=NC=C(C=O)C(N)=N1 GPWNWKWQOLEVEQ-UHFFFAOYSA-N 0.000 description 2
- KMZYCZWDCPQIAR-UHFFFAOYSA-N 2,5-dihydro-1,3-thiazol-4-amine Chemical compound N=C1CSCN1 KMZYCZWDCPQIAR-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- MDFFZNIQPLKQSG-UHFFFAOYSA-N 2-bromoprop-2-en-1-ol Chemical compound OCC(Br)=C MDFFZNIQPLKQSG-UHFFFAOYSA-N 0.000 description 2
- OTTZHAVKAVGASB-UHFFFAOYSA-N 2-heptene Natural products CCCCC=CC OTTZHAVKAVGASB-UHFFFAOYSA-N 0.000 description 2
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 2
- OQNUXPUTBZWBBN-UHFFFAOYSA-N 2H-1,4-oxazine-2-carbaldehyde Chemical compound O=CC1OC=CN=C1 OQNUXPUTBZWBBN-UHFFFAOYSA-N 0.000 description 2
- ZAISDHPZTZIFQF-UHFFFAOYSA-N 2h-1,4-thiazine Chemical compound C1SC=CN=C1 ZAISDHPZTZIFQF-UHFFFAOYSA-N 0.000 description 2
- ZAKYENDYKUVXTA-UHFFFAOYSA-N 3,3-dichloro-5,5-dimethylpiperidin-2-one Chemical compound CC1(C)CNC(=O)C(Cl)(Cl)C1 ZAKYENDYKUVXTA-UHFFFAOYSA-N 0.000 description 2
- VWNDYNSRQHQQPH-UHFFFAOYSA-N 3,3-dimethyl-4,5-dihydro-2h-pyridin-6-amine;hydrochloride Chemical compound Cl.CC1(C)CCC(=N)NC1 VWNDYNSRQHQQPH-UHFFFAOYSA-N 0.000 description 2
- STHMLYNOSSMXOM-UHFFFAOYSA-N 3,6-dihydro-2h-1,4-thiazin-5-amine;hydrochloride Chemical compound Cl.N=C1CSCCN1 STHMLYNOSSMXOM-UHFFFAOYSA-N 0.000 description 2
- JGRLFNQZUOIYAX-UHFFFAOYSA-N 3-chloro-5,5-dimethylpiperidin-2-one Chemical compound CC1(C)CNC(=O)C(Cl)C1 JGRLFNQZUOIYAX-UHFFFAOYSA-N 0.000 description 2
- HSJKGGMUJITCBW-UHFFFAOYSA-N 3-hydroxybutanal Chemical compound CC(O)CC=O HSJKGGMUJITCBW-UHFFFAOYSA-N 0.000 description 2
- KLYNVOGUPOIIDZ-UHFFFAOYSA-N 3-nitroso-2,4-dihydro-1,3-thiazine-4-carboxylic acid Chemical compound C1N(C(C=CS1)C(=O)O)N=O KLYNVOGUPOIIDZ-UHFFFAOYSA-N 0.000 description 2
- TVRMEVCXUUCIJJ-UHFFFAOYSA-N 4,4-dimethyl-1-nitrosopyrrolidine-2-carboxylic acid Chemical compound CC1(C)CC(C(O)=O)N(N=O)C1 TVRMEVCXUUCIJJ-UHFFFAOYSA-N 0.000 description 2
- OOGKXAWZILGOBA-UHFFFAOYSA-N 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine Chemical compound C1NCCN2N=CC=C21 OOGKXAWZILGOBA-UHFFFAOYSA-N 0.000 description 2
- MZCSOYIOCUGVPG-UHFFFAOYSA-N 4,6-dihydropyrazolo[1,5-c][1,3]thiazole-2-carbaldehyde Chemical compound C1SCN2N=C(C=O)C=C21 MZCSOYIOCUGVPG-UHFFFAOYSA-N 0.000 description 2
- LRGULUNPYYHYMY-UHFFFAOYSA-N 4-nitrosomorpholin-4-ium-3-carboxylate Chemical compound OC(=O)C1COCCN1N=O LRGULUNPYYHYMY-UHFFFAOYSA-N 0.000 description 2
- LRCDFYBOUFMFOW-UHFFFAOYSA-N 4-nitrosopiperazine-1,3-dicarboxylic acid Chemical compound OC(=O)C1CN(C(O)=O)CCN1N=O LRCDFYBOUFMFOW-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- SWBUHQQTIPEPMK-UHFFFAOYSA-N 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine Chemical compound C1NCCN2C=CN=C21 SWBUHQQTIPEPMK-UHFFFAOYSA-N 0.000 description 2
- RTZLJDDSFCFBML-UHFFFAOYSA-N 5,6-dihydro-4h-pyrrolo[1,2-b]pyrazole-2-carbaldehyde Chemical compound C1CCN2N=C(C=O)C=C21 RTZLJDDSFCFBML-UHFFFAOYSA-N 0.000 description 2
- GXQPVPNALQNROT-UHFFFAOYSA-N 5-methylsulfanyl-3,6-dihydro-2h-1,4-oxazine Chemical compound CSC1=NCCOC1 GXQPVPNALQNROT-UHFFFAOYSA-N 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- OKHWXBHLURLUPN-UHFFFAOYSA-N 6,7-dihydro-4h-pyrazolo[5,1-c][1,4]thiazine-2-carbaldehyde Chemical compound C1SCCN2N=C(C=O)C=C21 OKHWXBHLURLUPN-UHFFFAOYSA-N 0.000 description 2
- HRVCHPXADXEUPW-UHFFFAOYSA-N 6,7-dihydro-5h-pyrazolo[5,1-b][1,3]oxazine-2-carbaldehyde Chemical compound O1CCCN2N=C(C=O)C=C21 HRVCHPXADXEUPW-UHFFFAOYSA-N 0.000 description 2
- BQGZMWAWDNEWGS-UHFFFAOYSA-N 6,8-dihydro-5h-imidazo[2,1-c][1,4]oxazine-2-carbaldehyde Chemical compound C1COCC2=NC(C=O)=CN21 BQGZMWAWDNEWGS-UHFFFAOYSA-N 0.000 description 2
- MAAUMVMSNORHOV-UHFFFAOYSA-N 6,8-dihydro-5h-imidazo[2,1-c][1,4]thiazine Chemical compound C1SCCN2C=CN=C21 MAAUMVMSNORHOV-UHFFFAOYSA-N 0.000 description 2
- BBFVFWAFXDNSSX-UHFFFAOYSA-N 6,8-dihydro-5h-imidazo[2,1-c][1,4]thiazine-2-carbaldehyde Chemical compound C1CSCC2=NC(C=O)=CN21 BBFVFWAFXDNSSX-UHFFFAOYSA-N 0.000 description 2
- JVGNWLWFTHSDOM-UHFFFAOYSA-N 6-amino-4-methyl-2,5-dihydropyrazin-3-one;hydrochloride Chemical compound Cl.CN1CC(N)=NCC1=O JVGNWLWFTHSDOM-UHFFFAOYSA-N 0.000 description 2
- JKRKHPFTFGBKCV-UHFFFAOYSA-N 6-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CSC2C(=O)CN12 JKRKHPFTFGBKCV-UHFFFAOYSA-N 0.000 description 2
- SQDAAERVOICMTB-UHFFFAOYSA-N 7-benzyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-2-carbaldehyde Chemical compound C1C2=NC(C=O)=CN2CCN1CC1=CC=CC=C1 SQDAAERVOICMTB-UHFFFAOYSA-N 0.000 description 2
- IMLXOMJBYPJJOI-UHFFFAOYSA-N 7-methyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-2-carbaldehyde Chemical compound C1N(C)CCN2C=C(C=O)N=C21 IMLXOMJBYPJJOI-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CDLLVQLSMWNFAC-UHFFFAOYSA-N CCC(C1)(C(O)=O)SC(CC2)=C1CN2C(OC(C)(C)C)=O Chemical compound CCC(C1)(C(O)=O)SC(CC2)=C1CN2C(OC(C)(C)C)=O CDLLVQLSMWNFAC-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- DZLNHFMRPBPULJ-VKHMYHEASA-N L-thioproline Chemical compound OC(=O)[C@@H]1CSCN1 DZLNHFMRPBPULJ-VKHMYHEASA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 2
- 241000588652 Neisseria gonorrhoeae Species 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- KRMFJYDCIDDHGN-UHFFFAOYSA-N [5-(4,5-dihydro-1,3-thiazol-2-yl)-6,7-dihydro-4h-pyrazolo[1,5-a]pyrazin-2-yl]methanol Chemical compound C1CN2N=C(CO)C=C2CN1C1=NCCS1 KRMFJYDCIDDHGN-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 229960000723 ampicillin Drugs 0.000 description 2
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000009635 antibiotic susceptibility testing Methods 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000002393 azetidinyl group Chemical group 0.000 description 2
- 125000004069 aziridinyl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 150000003997 cyclic ketones Chemical class 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- UAYKGOMDUQLCJS-UHFFFAOYSA-N ethylsulfanyl acetate Chemical compound CCSOC(C)=O UAYKGOMDUQLCJS-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 125000004634 hexahydroazepinyl group Chemical group N1(CCCCCC1)* 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 2
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- NYSSRYDWEDXXBC-UHFFFAOYSA-N oxazin-2-ylmethanol Chemical compound O1N(C=CC=C1)CO NYSSRYDWEDXXBC-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 235000011837 pasties Nutrition 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 239000008055 phosphate buffer solution Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 2
- SUDYQKKBKMGXKU-UHFFFAOYSA-N piperazine-1,3-dicarboxylic acid Chemical compound OC(=O)C1CN(C(O)=O)CCN1 SUDYQKKBKMGXKU-UHFFFAOYSA-N 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- XFTQRUTUGRCSGO-UHFFFAOYSA-N pyrazin-2-amine Chemical compound NC1=CN=CC=N1 XFTQRUTUGRCSGO-UHFFFAOYSA-N 0.000 description 2
- DXBWJLDFSICTIH-UHFFFAOYSA-N pyrazine-2-carbaldehyde Chemical compound O=CC1=CN=CC=N1 DXBWJLDFSICTIH-UHFFFAOYSA-N 0.000 description 2
- NIPZZXUFJPQHNH-UHFFFAOYSA-N pyrazine-2-carboxylic acid Chemical compound OC(=O)C1=CN=CC=N1 NIPZZXUFJPQHNH-UHFFFAOYSA-N 0.000 description 2
- DXKXZXHDDYMNSU-UHFFFAOYSA-N pyrazole-1-carbaldehyde Chemical compound O=CN1C=CC=N1 DXKXZXHDDYMNSU-UHFFFAOYSA-N 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 150000003385 sodium Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- FKENQMMABCRJMK-RITPCOANSA-N sulbactam Chemical compound O=S1(=O)C(C)(C)[C@H](C(O)=O)N2C(=O)C[C@H]21 FKENQMMABCRJMK-RITPCOANSA-N 0.000 description 2
- 229960005256 sulbactam Drugs 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- LPQZKKCYTLCDGQ-WEDXCCLWSA-N tazobactam Chemical compound C([C@]1(C)S([C@H]2N(C(C2)=O)[C@H]1C(O)=O)(=O)=O)N1C=CN=N1 LPQZKKCYTLCDGQ-WEDXCCLWSA-N 0.000 description 2
- 229960003865 tazobactam Drugs 0.000 description 2
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 2
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 2
- OVRJVKCZJCNSOW-UHFFFAOYSA-N thian-4-one Chemical compound O=C1CCSCC1 OVRJVKCZJCNSOW-UHFFFAOYSA-N 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- OHKOGUYZJXTSFX-KZFFXBSXSA-N ticarcillin Chemical compound C=1([C@@H](C(O)=O)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)C=CSC=1 OHKOGUYZJXTSFX-KZFFXBSXSA-N 0.000 description 2
- 229960004659 ticarcillin Drugs 0.000 description 2
- 150000003852 triazoles Chemical class 0.000 description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 2
- 229940126085 β‑Lactamase Inhibitor Drugs 0.000 description 2
- BEKSOLPMSVHHRU-SSDOTTSWSA-N (2s)-4,4-difluoro-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CC(F)(F)C(C)(C)[C@H]1C(O)=O BEKSOLPMSVHHRU-SSDOTTSWSA-N 0.000 description 1
- JETQIUPBHQNHNZ-NJBDSQKTSA-N (2s,5r,6r)-3,3-dimethyl-7-oxo-6-[[(2r)-2-phenyl-2-sulfoacetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C1([C@H](C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)S(O)(=O)=O)=CC=CC=C1 JETQIUPBHQNHNZ-NJBDSQKTSA-N 0.000 description 1
- LMWRIZCWHDQLQP-BYPYZUCNSA-N (3r)-4-nitrosothiomorpholine-3-carboxylic acid Chemical compound OC(=O)[C@@H]1CSCCN1N=O LMWRIZCWHDQLQP-BYPYZUCNSA-N 0.000 description 1
- KQBDNQQUBREETF-UHFFFAOYSA-N (4-nitrophenyl)methyl 2-methoxypiperazine-1-carboxylate Chemical compound COC1CNCCN1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 KQBDNQQUBREETF-UHFFFAOYSA-N 0.000 description 1
- ZWSZQIGAYDIYDM-UHFFFAOYSA-N (4-nitrophenyl)methyl 3-oxopiperazine-1-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1CC(=O)NCC1 ZWSZQIGAYDIYDM-UHFFFAOYSA-N 0.000 description 1
- NHKGBUFCOREANA-UHFFFAOYSA-N (4-nitrophenyl)methyl 6-amino-3,5-dihydro-2h-pyrazine-4-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1CC(=N)NCC1 NHKGBUFCOREANA-UHFFFAOYSA-N 0.000 description 1
- KJQIVTIQHAUTJV-UHFFFAOYSA-N (4-nitrophenyl)methyl pyrazine-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1=CN=CC=N1 KJQIVTIQHAUTJV-UHFFFAOYSA-N 0.000 description 1
- IMPOWBGVGHJTHS-UHFFFAOYSA-N (5,5-dimethyl-4,6-dihydropyrrolo[1,2-b]pyrazol-2-yl)methanol Chemical compound OCC1=NN2CC(C)(C)CC2=C1 IMPOWBGVGHJTHS-UHFFFAOYSA-N 0.000 description 1
- BJDTWVQNEWIULP-RXMQYKEDSA-N (5R)-3-bromo-4-thia-1-azabicyclo[3.2.0]hept-2-en-7-one Chemical class BrC=1S[C@H]2N(C=1)C(C2)=O BJDTWVQNEWIULP-RXMQYKEDSA-N 0.000 description 1
- UKDNAZGLKVEUNV-NFOQDIRWSA-N (5r)-6-[acetyloxy-(7-benzyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S([C@@H]12)C=C(C(O)=O)N1C(=O)C2(Br)C(OC(=O)C)C(N=C1C2)=CN1CCN2CC1=CC=CC=C1 UKDNAZGLKVEUNV-NFOQDIRWSA-N 0.000 description 1
- SNPKUXYQCMHUTL-DSSZZKGTSA-N (5r)-6-[acetyloxy-(7-methyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1N(C)CCN2C=C(C(OC(C)=O)C3(Br)C(N4C(=CS[C@@H]43)C(O)=O)=O)N=C21 SNPKUXYQCMHUTL-DSSZZKGTSA-N 0.000 description 1
- SDGCXMDTXHFBPH-SDMSXHDGSA-N (5r)-6-bromo-4-thia-1-azabicyclo[3.2.0]hept-2-en-7-one Chemical class S1C=CN2C(=O)C(Br)[C@H]21 SDGCXMDTXHFBPH-SDMSXHDGSA-N 0.000 description 1
- VQWYSTGIQKLGAL-SDMSXHDGSA-N (5r)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CS[C@@H]2C(Br)C(=O)N12 VQWYSTGIQKLGAL-SDMSXHDGSA-N 0.000 description 1
- QQDDJIUJAPMCCX-SIBGDRKGSA-N (5r,6z)-6-[(5-benzyl-6,7-dihydro-4h-thieno[3,2-c]pyridin-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound N1([C@@H]2SC=C1C(=O)O)C(=O)\C2=C\C(SC=1CC2)=CC=1CN2CC1=CC=CC=C1 QQDDJIUJAPMCCX-SIBGDRKGSA-N 0.000 description 1
- TZHYRIOYHMAWIJ-KGHNQEBZSA-N (5r,6z)-7-oxo-6-[(4-oxo-6,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)methylidene]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1=C2C(=O)OCCN2N=C1/C=C1/C(=O)N2[C@@H]1SC=C2C(=O)O TZHYRIOYHMAWIJ-KGHNQEBZSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- KTZQTRPPVKQPFO-UHFFFAOYSA-N 1,2-benzoxazole Chemical compound C1=CC=C2C=NOC2=C1 KTZQTRPPVKQPFO-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- OZBZQLHFHVWHPS-UHFFFAOYSA-N 1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCC2CCN12 OZBZQLHFHVWHPS-UHFFFAOYSA-N 0.000 description 1
- MCTWTZJPVLRJOU-UHFFFAOYSA-N 1-methyl-1H-imidazole Chemical compound CN1C=CN=C1 MCTWTZJPVLRJOU-UHFFFAOYSA-N 0.000 description 1
- CCWYHRCNIUKIIZ-UHFFFAOYSA-N 1-methyl-4-nitrobenzene Chemical compound [CH2]C1=CC=C([N+]([O-])=O)C=C1 CCWYHRCNIUKIIZ-UHFFFAOYSA-N 0.000 description 1
- FGYADSCZTQOAFK-UHFFFAOYSA-N 1-methylbenzimidazole Chemical compound C1=CC=C2N(C)C=NC2=C1 FGYADSCZTQOAFK-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- JUUZQMUWOVDZSD-UHFFFAOYSA-N 1h-imidazole;pyrazine Chemical class C1=CNC=N1.C1=CN=CC=N1 JUUZQMUWOVDZSD-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- FOHHSCDLYKDGMP-UHFFFAOYSA-N 2,3,3a,5-tetrahydro-1h-pyrazolo[5,1-b][1,3]oxazin-2-ylmethanol Chemical compound O1CC=CN2NC(CO)CC21 FOHHSCDLYKDGMP-UHFFFAOYSA-N 0.000 description 1
- FJRPOHLDJUJARI-UHFFFAOYSA-N 2,3-dihydro-1,2-oxazole Chemical compound C1NOC=C1 FJRPOHLDJUJARI-UHFFFAOYSA-N 0.000 description 1
- KEQTWHPMSVAFDA-UHFFFAOYSA-N 2,3-dihydro-1h-pyrazole Chemical compound C1NNC=C1 KEQTWHPMSVAFDA-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- CUXKNQDOYULMKG-UHFFFAOYSA-N 2,3-dihydropyrazolo[5,1-b][1,3]oxazol-6-ylmethanol Chemical compound O1CCN2N=C(CO)C=C21 CUXKNQDOYULMKG-UHFFFAOYSA-N 0.000 description 1
- BBSSEVYJISPIML-UHFFFAOYSA-N 2,3-dihydropyrazolo[5,1-b][1,3]oxazole Chemical compound N1=CC=C2OCCN21 BBSSEVYJISPIML-UHFFFAOYSA-N 0.000 description 1
- HRWUBJRFWUWTLF-UHFFFAOYSA-N 2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carbaldehyde Chemical compound O1CCN2N=C(C=O)C=C21 HRWUBJRFWUWTLF-UHFFFAOYSA-N 0.000 description 1
- DZNNDDKAXSAFMC-JRSYVHTFSA-N 2-[acetyloxy-[(5r)-6-bromo-2-[(4-nitrophenyl)methoxycarbonyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-en-6-yl]methyl]-6,7-dihydro-4h-pyrazolo[1,5-a]pyrazine-5-carboxylic acid Chemical compound S([C@@H]1C(C(N11)=O)(Br)C(C2=NN3CCN(CC3=C2)C(O)=O)OC(=O)C)C=C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 DZNNDDKAXSAFMC-JRSYVHTFSA-N 0.000 description 1
- ALXSWAZLPDAZEG-UHFFFAOYSA-N 2-bromo-3-propan-2-yloxyprop-1-ene Chemical compound CC(C)OCC(Br)=C ALXSWAZLPDAZEG-UHFFFAOYSA-N 0.000 description 1
- JBKINHFZTVLNEM-UHFFFAOYSA-N 2-bromoethoxy-tert-butyl-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)OCCBr JBKINHFZTVLNEM-UHFFFAOYSA-N 0.000 description 1
- OFHGTJWFDWHIES-UHFFFAOYSA-N 2-formyl-6,7-dihydro-4h-pyrazolo[1,5-a]pyrazine-5-carboxylic acid Chemical compound C1N(C(=O)O)CCN2N=C(C=O)C=C21 OFHGTJWFDWHIES-UHFFFAOYSA-N 0.000 description 1
- VZJNKVGIYUCNQK-UHFFFAOYSA-N 2-formyl-6,7-dihydro-4h-thieno[3,2-c]pyridine-5-carboxylic acid Chemical compound C1N(C(=O)O)CCC2=C1C=C(C=O)S2 VZJNKVGIYUCNQK-UHFFFAOYSA-N 0.000 description 1
- QFGRBBWYHIYNIB-UHFFFAOYSA-N 2-methylsulfanyl-4,5-dihydro-1,3-thiazole Chemical compound CSC1=NCCS1 QFGRBBWYHIYNIB-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YDLAHBBJAGGIJZ-UHFFFAOYSA-N 2-sulfanylethyl acetate Chemical compound CC(=O)OCCS YDLAHBBJAGGIJZ-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- KMLDLJBRTNKVDM-UHFFFAOYSA-N 2H-thiazine-3-carbaldehyde Chemical compound S1NC(=CC=C1)C=O KMLDLJBRTNKVDM-UHFFFAOYSA-N 0.000 description 1
- SOFPIAMTOZWXKT-UHFFFAOYSA-N 2h-1,2,4-triazine-3-thione Chemical compound SC1=NC=CN=N1 SOFPIAMTOZWXKT-UHFFFAOYSA-N 0.000 description 1
- WVPWIAJQKYPRFM-UHFFFAOYSA-N 2h-1,3-oxazine-2-carboxylic acid Chemical compound OC(=O)C1OC=CC=N1 WVPWIAJQKYPRFM-UHFFFAOYSA-N 0.000 description 1
- ZBNCLEVJVZQAIC-UHFFFAOYSA-N 2h-1,4-thiazine-2-carboxylic acid Chemical compound OC(=O)C1SC=CN=C1 ZBNCLEVJVZQAIC-UHFFFAOYSA-N 0.000 description 1
- GXIYZFCXPRPHLO-UHFFFAOYSA-N 2h-1,4-thiazine-3-carbaldehyde Chemical compound O=CC1=NC=CSC1 GXIYZFCXPRPHLO-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- WXWQJUNPKFWAEX-UHFFFAOYSA-N 2h-pyran-2-carbaldehyde Chemical compound O=CC1OC=CC=C1 WXWQJUNPKFWAEX-UHFFFAOYSA-N 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- BNNNRTHFDVJELR-UHFFFAOYSA-N 2h-thiazine-3-carboxylic acid Chemical compound OC(=O)C1=CC=CSN1 BNNNRTHFDVJELR-UHFFFAOYSA-N 0.000 description 1
- FUPUHHKZWMWIBB-UHFFFAOYSA-N 2h-thiopyran-2-carbaldehyde Chemical compound O=CC1SC=CC=C1 FUPUHHKZWMWIBB-UHFFFAOYSA-N 0.000 description 1
- JEBHLIYFPKISBI-UHFFFAOYSA-N 3,4-dihydro-2h-pyrrol-5-amine;hydrochloride Chemical compound Cl.NC1=NCCC1 JEBHLIYFPKISBI-UHFFFAOYSA-N 0.000 description 1
- QTAAKTRBARVAQY-UHFFFAOYSA-N 3,6-dihydro-2h-1,4-thiazine Chemical compound C1CN=CCS1 QTAAKTRBARVAQY-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- VFCRDXGXUQGTHT-UHFFFAOYSA-N 3-nitroso-1,3-thiazolidine-2-carboxylic acid Chemical compound OC(=O)C1SCCN1N=O VFCRDXGXUQGTHT-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BDNWSJQJILLEBS-UHFFFAOYSA-N 4,4-dimethylpyrrolidine-2-carboxylic acid Chemical compound CC1(C)CNC(C(O)=O)C1 BDNWSJQJILLEBS-UHFFFAOYSA-N 0.000 description 1
- ZHAXPVWSJMLLDM-UHFFFAOYSA-N 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethanol Chemical compound C1CCCN2N=C(CO)C=C21 ZHAXPVWSJMLLDM-UHFFFAOYSA-N 0.000 description 1
- XCQQWVWOKJBFCQ-UHFFFAOYSA-N 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carbaldehyde Chemical compound C1CCCN2N=C(C=O)C=C21 XCQQWVWOKJBFCQ-UHFFFAOYSA-N 0.000 description 1
- OGUWOLDNYOTRBO-UHFFFAOYSA-N 4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1NCCC2=C1C=CS2 OGUWOLDNYOTRBO-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- NFSOPDQHRACHRD-UHFFFAOYSA-N 4-methylsulfanyl-2,5-dihydro-1,3-thiazole Chemical compound CSC1=NCSC1 NFSOPDQHRACHRD-UHFFFAOYSA-N 0.000 description 1
- QJNLUNBGDFUULX-UHFFFAOYSA-N 4-n,4-n'-dimethyl-3h-pyridine-4,4-diamine Chemical compound CNC1(NC)CC=NC=C1 QJNLUNBGDFUULX-UHFFFAOYSA-N 0.000 description 1
- KUEDVGNDBLCOED-UHFFFAOYSA-N 4-oxo-6,7-dihydropyrazolo[5,1-c][1,4]oxazine-2-carbaldehyde Chemical compound O=C1OCCN2N=C(C=O)C=C21 KUEDVGNDBLCOED-UHFFFAOYSA-N 0.000 description 1
- CSOYACNIOQHFQZ-UHFFFAOYSA-N 5,6-dihydro-4h-pyrrolo[1,2-b]pyrazole-2-carboxylic acid Chemical compound C1CCN2N=C(C(=O)O)C=C21 CSOYACNIOQHFQZ-UHFFFAOYSA-N 0.000 description 1
- GDCOWMWYQRGIRF-UHFFFAOYSA-N 5,7-dihydroimidazo[1,2-c][1,3]thiazole-2-carbaldehyde Chemical compound C1SCC2=NC(C=O)=CN21 GDCOWMWYQRGIRF-UHFFFAOYSA-N 0.000 description 1
- FLKMCBMBGCLPCO-UHFFFAOYSA-N 5-(4,5-dihydro-1,3-thiazol-2-yl)-6,7-dihydro-4h-pyrazolo[1,5-a]pyrazine-2-carbaldehyde Chemical compound C1CN2N=C(C=O)C=C2CN1C1=NCCS1 FLKMCBMBGCLPCO-UHFFFAOYSA-N 0.000 description 1
- GUPPGBJHJWFJCP-UHFFFAOYSA-N 5-benzyl-6,7-dihydro-4h-thieno[3,2-c]pyridine Chemical compound C1CC=2SC=CC=2CN1CC1=CC=CC=C1 GUPPGBJHJWFJCP-UHFFFAOYSA-N 0.000 description 1
- MEUJRSFWOVYXNW-UHFFFAOYSA-N 5-ethoxycarbonylpyrazine-2-carboxylic acid Chemical compound CCOC(=O)C1=CN=C(C(O)=O)C=N1 MEUJRSFWOVYXNW-UHFFFAOYSA-N 0.000 description 1
- MJEXDNFPJWMVNZ-UHFFFAOYSA-N 5-methyl-6,7-dihydro-4h-thieno[3,2-c]pyridine-2-carbaldehyde Chemical compound C1N(C)CCC2=C1C=C(C=O)S2 MJEXDNFPJWMVNZ-UHFFFAOYSA-N 0.000 description 1
- HELXKSLPDNIOAQ-UHFFFAOYSA-N 6,6-dimethyl-7,8-dihydro-5h-imidazo[1,2-a]pyridine-3-carbaldehyde Chemical compound C1C(C)(C)CCC2=NC=C(C=O)N21 HELXKSLPDNIOAQ-UHFFFAOYSA-N 0.000 description 1
- MBVCARRYXQUTLF-UHFFFAOYSA-N 6,7,8,9-tetrahydro-5h-imidazo[1,2-a]azepine Chemical compound C1CCCCC2=NC=CN21 MBVCARRYXQUTLF-UHFFFAOYSA-N 0.000 description 1
- ZBNYOGOKWUZRKI-UHFFFAOYSA-N 6,7-dihydro-4h-pyrazolo[5,1-c][1,4]oxazine Chemical compound C1OCCN2N=CC=C21 ZBNYOGOKWUZRKI-UHFFFAOYSA-N 0.000 description 1
- DONVCZPIYCTGFE-UHFFFAOYSA-N 6,7-dihydro-4h-thieno[3,2-c]pyran-2-carbaldehyde Chemical compound C1OCCC2=C1C=C(C=O)S2 DONVCZPIYCTGFE-UHFFFAOYSA-N 0.000 description 1
- DOHDEBNRWREKDJ-UHFFFAOYSA-N 6,7-dihydro-4h-thieno[3,2-c]thiopyran Chemical compound C1SCCC2=C1C=CS2 DOHDEBNRWREKDJ-UHFFFAOYSA-N 0.000 description 1
- YWBIDCRPUQBUBQ-UHFFFAOYSA-N 6,7-dihydro-4h-thieno[3,2-c]thiopyran-2-carbaldehyde Chemical compound C1SCCC2=C1C=C(C=O)S2 YWBIDCRPUQBUBQ-UHFFFAOYSA-N 0.000 description 1
- WHPNSFZQTFODCZ-UHFFFAOYSA-N 6,8-dihydro-5h-imidazo[2,1-c][1,4]oxazine-3-carbaldehyde Chemical compound C1OCCN2C(C=O)=CN=C21 WHPNSFZQTFODCZ-UHFFFAOYSA-N 0.000 description 1
- RKHPMFNLYOWIRY-UHFFFAOYSA-N 6,8-dihydro-5h-imidazo[2,1-c][1,4]thiazine-3-carbaldehyde Chemical compound C1SCCN2C(C=O)=CN=C21 RKHPMFNLYOWIRY-UHFFFAOYSA-N 0.000 description 1
- VAEBCNPDQMGFNE-UHFFFAOYSA-N 6-(6,7-dihydro-4h-thieno[3,2-c]pyran-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1OCCC(S2)=C1C=C2C=C1C(=O)N2C1SC=C2C(=O)O VAEBCNPDQMGFNE-UHFFFAOYSA-N 0.000 description 1
- YKGCKZGARDHVBE-UHFFFAOYSA-N 6-(6,7-dihydro-4h-thieno[3,2-c]thiopyran-2-ylmethylidene)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C1SCCC(S2)=C1C=C2C=C1C(=O)N2C1SC=C2C(=O)O YKGCKZGARDHVBE-UHFFFAOYSA-N 0.000 description 1
- BPFBPFRIVNHIHS-UHFFFAOYSA-N 6-amino-4-methyl-2,5-dihydropyrazin-3-one Chemical compound CN1CC(N)=NCC1=O BPFBPFRIVNHIHS-UHFFFAOYSA-N 0.000 description 1
- ABWQHWRGXRBYHL-UHFFFAOYSA-N 6-methoxy-3,3-dimethyl-4,5-dihydro-2h-pyridine Chemical compound COC1=NCC(C)(C)CC1 ABWQHWRGXRBYHL-UHFFFAOYSA-N 0.000 description 1
- XFSYYHJOKSQNIA-UHFFFAOYSA-N 6-methoxy-4-methyl-2,5-dihydropyrazin-3-one Chemical compound COC1=NCC(=O)N(C)C1 XFSYYHJOKSQNIA-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- WZPBZJONDBGPKJ-UHFFFAOYSA-N Antibiotic SQ 26917 Natural products O=C1N(S(O)(=O)=O)C(C)C1NC(=O)C(=NOC(C)(C)C(O)=O)C1=CSC(N)=N1 WZPBZJONDBGPKJ-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000606124 Bacteroides fragilis Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- MIUADTSUYRLGBL-UHFFFAOYSA-N CCC1=NN(CCCC2)C2=C1C(OCC)=O Chemical compound CCC1=NN(CCCC2)C2=C1C(OCC)=O MIUADTSUYRLGBL-UHFFFAOYSA-N 0.000 description 1
- 241000588919 Citrobacter freundii Species 0.000 description 1
- HZZVJAQRINQKSD-UHFFFAOYSA-N Clavulanic acid Natural products OC(=O)C1C(=CCO)OC2CC(=O)N21 HZZVJAQRINQKSD-UHFFFAOYSA-N 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- JWCSIUVGFCSJCK-CAVRMKNVSA-N Disodium Moxalactam Chemical compound N([C@]1(OC)C(N2C(=C(CSC=3N(N=NN=3)C)CO[C@@H]21)C(O)=O)=O)C(=O)C(C(O)=O)C1=CC=C(O)C=C1 JWCSIUVGFCSJCK-CAVRMKNVSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 241000588697 Enterobacter cloacae Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 102000009338 Gastric Mucins Human genes 0.000 description 1
- 108010009066 Gastric Mucins Proteins 0.000 description 1
- 238000007164 Haack reaction Methods 0.000 description 1
- 102000001554 Hemoglobins Human genes 0.000 description 1
- 108010054147 Hemoglobins Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000575946 Ione Species 0.000 description 1
- LTXREWYXXSTFRX-QGZVFWFLSA-N Linagliptin Chemical compound N=1C=2N(C)C(=O)N(CC=3N=C4C=CC=CC4=C(C)N=3)C(=O)C=2N(CC#CC)C=1N1CCC[C@@H](N)C1 LTXREWYXXSTFRX-QGZVFWFLSA-N 0.000 description 1
- PQMWYJDJHJQZDE-UHFFFAOYSA-M Methantheline bromide Chemical compound [Br-].C1=CC=C2C(C(=O)OCC[N+](C)(CC)CC)C3=CC=CC=C3OC2=C1 PQMWYJDJHJQZDE-UHFFFAOYSA-M 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- 241000588772 Morganella morganii Species 0.000 description 1
- UQFQONCQIQEYPJ-UHFFFAOYSA-N N-methylpyrazole Chemical compound CN1C=CC=N1 UQFQONCQIQEYPJ-UHFFFAOYSA-N 0.000 description 1
- 150000004008 N-nitroso compounds Chemical class 0.000 description 1
- LUPJVGBBANKSLL-UHFFFAOYSA-N N1=CC=C2N1CCCC2.N2N=CC=C2 Chemical compound N1=CC=C2N1CCCC2.N2N=CC=C2 LUPJVGBBANKSLL-UHFFFAOYSA-N 0.000 description 1
- QRIRTAMFMKJIQG-UHFFFAOYSA-N N1C(COCC1)=O.N1C(COCC1)=O Chemical compound N1C(COCC1)=O.N1C(COCC1)=O QRIRTAMFMKJIQG-UHFFFAOYSA-N 0.000 description 1
- QLZSNEORLGODLW-UHFFFAOYSA-N N1CCCC=C1.N1C=NC=C1 Chemical class N1CCCC=C1.N1C=NC=C1 QLZSNEORLGODLW-UHFFFAOYSA-N 0.000 description 1
- LHKNXZVUCSBQGY-UHFFFAOYSA-N N=C1COCCN1Cl Chemical compound N=C1COCCN1Cl LHKNXZVUCSBQGY-UHFFFAOYSA-N 0.000 description 1
- SZHGYQXSBHVOSI-UHFFFAOYSA-N N=C1CSCCN1Cl Chemical compound N=C1CSCCN1Cl SZHGYQXSBHVOSI-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- KJNMRQXERCMYHN-UHFFFAOYSA-N O1C(N=CC=C1)CO Chemical compound O1C(N=CC=C1)CO KJNMRQXERCMYHN-UHFFFAOYSA-N 0.000 description 1
- 229910019213 POCl3 Inorganic materials 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- CVQUWLDCFXOXEN-UHFFFAOYSA-N Pyran-4-one Chemical compound O=C1C=COC=C1 CVQUWLDCFXOXEN-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- NDFAXICIZBPKOG-UHFFFAOYSA-N S1N(C=CC=C1)C(=O)OCC Chemical compound S1N(C=CC=C1)C(=O)OCC NDFAXICIZBPKOG-UHFFFAOYSA-N 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- OEYGCDBNOJGMCS-UHFFFAOYSA-N [2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(hydroxymethyl)pyrazol-3-yl]methanol Chemical compound CC(C)(C)[Si](C)(C)OCCN1N=C(CO)C=C1CO OEYGCDBNOJGMCS-UHFFFAOYSA-N 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000004062 acenaphthenyl group Chemical group C1(CC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- UGAPHEBNTGUMBB-UHFFFAOYSA-N acetic acid;ethyl acetate Chemical compound CC(O)=O.CCOC(C)=O UGAPHEBNTGUMBB-UHFFFAOYSA-N 0.000 description 1
- PHENPABYBHPABM-UHFFFAOYSA-N acetic acid;octane Chemical compound CC(O)=O.CCCCCCCC PHENPABYBHPABM-UHFFFAOYSA-N 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000003418 alkyl amino alkoxy group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 239000012080 ambient air Substances 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000005324 aryloxy alkyloxy group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- WZPBZJONDBGPKJ-VEHQQRBSSA-N aztreonam Chemical compound O=C1N(S([O-])(=O)=O)[C@@H](C)[C@@H]1NC(=O)C(=N/OC(C)(C)C(O)=O)\C1=CSC([NH3+])=N1 WZPBZJONDBGPKJ-VEHQQRBSSA-N 0.000 description 1
- 229960003644 aztreonam Drugs 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- CZTQZXZIADLWOZ-CRAIPNDOSA-N cefaloridine Chemical compound O=C([C@@H](NC(=O)CC=1SC=CC=1)[C@H]1SC2)N1C(C(=O)[O-])=C2C[N+]1=CC=CC=C1 CZTQZXZIADLWOZ-CRAIPNDOSA-N 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical compound S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 1
- 229960002420 cefatrizine Drugs 0.000 description 1
- 229960001139 cefazolin Drugs 0.000 description 1
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 1
- 229960002588 cefradine Drugs 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- VUFGUVLLDPOSBC-XRZFDKQNSA-M cephalothin sodium Chemical compound [Na+].N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C([O-])=O)C(=O)CC1=CC=CS1 VUFGUVLLDPOSBC-XRZFDKQNSA-M 0.000 description 1
- RDLPVSKMFDYCOR-UEKVPHQBSA-N cephradine Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CCC=CC1 RDLPVSKMFDYCOR-UEKVPHQBSA-N 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- HZZVJAQRINQKSD-PBFISZAISA-N clavulanic acid Chemical compound OC(=O)[C@H]1C(=C/CO)/O[C@@H]2CC(=O)N21 HZZVJAQRINQKSD-PBFISZAISA-N 0.000 description 1
- 229960003324 clavulanic acid Drugs 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229910000009 copper(II) carbonate Inorganic materials 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 101150084411 crn1 gene Proteins 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000010612 desalination reaction Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical class ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- 125000000723 dihydrobenzofuranyl group Chemical group O1C(CC2=C1C=CC=C2)* 0.000 description 1
- 125000004582 dihydrobenzothienyl group Chemical group S1C(CC2=C1C=CC=C2)* 0.000 description 1
- 125000005435 dihydrobenzoxazolyl group Chemical group O1C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000001070 dihydroindolyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000005049 dihydrooxadiazolyl group Chemical group O1N(NC=C1)* 0.000 description 1
- 125000005052 dihydropyrazolyl group Chemical group N1(NCC=C1)* 0.000 description 1
- 125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 125000005053 dihydropyrimidinyl group Chemical group N1(CN=CC=C1)* 0.000 description 1
- 125000005054 dihydropyrrolyl group Chemical group [H]C1=C([H])C([H])([H])C([H])([H])N1* 0.000 description 1
- 125000005044 dihydroquinolinyl group Chemical group N1(CC=CC2=CC=CC=C12)* 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- PGBPMGLDQFJPCG-UHFFFAOYSA-N ethyl 1-hydroxypyrazole-3-carboxylate Chemical compound CCOC(=O)C=1C=CN(O)N=1 PGBPMGLDQFJPCG-UHFFFAOYSA-N 0.000 description 1
- MSPOSRHJXMILNK-UHFFFAOYSA-N ethyl 1h-pyrazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=NN1 MSPOSRHJXMILNK-UHFFFAOYSA-N 0.000 description 1
- VICYTAYPKBLQFB-UHFFFAOYSA-N ethyl 3-bromo-2-oxopropanoate Chemical compound CCOC(=O)C(=O)CBr VICYTAYPKBLQFB-UHFFFAOYSA-N 0.000 description 1
- RLYRMESNENRMHE-UHFFFAOYSA-N ethyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxylate Chemical compound C1CCCN2N=C(C(=O)OCC)C=C21 RLYRMESNENRMHE-UHFFFAOYSA-N 0.000 description 1
- LHPDOGQJGFQFFQ-UHFFFAOYSA-N ethyl 4,6-dihydropyrazolo[1,5-c][1,3]thiazole-2-carboxylate Chemical compound C1SCN2N=C(C(=O)OCC)C=C21 LHPDOGQJGFQFFQ-UHFFFAOYSA-N 0.000 description 1
- OUXQIBFTSBUPKU-UHFFFAOYSA-N ethyl 5,5-dimethyl-4,6-dihydropyrrolo[1,2-b]pyrazole-2-carboxylate Chemical compound C1C(C)(C)CN2N=C(C(=O)OCC)C=C21 OUXQIBFTSBUPKU-UHFFFAOYSA-N 0.000 description 1
- QXVVXFZKXXPMCZ-UHFFFAOYSA-N ethyl 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate;hydrochloride Chemical compound Cl.C1CNCC2=NC(C(=O)OCC)=CN21 QXVVXFZKXXPMCZ-UHFFFAOYSA-N 0.000 description 1
- TTXMGIMDAFVKPD-UHFFFAOYSA-N ethyl 5-benzoyl-6,7-dihydro-4h-thieno[3,2-c]pyridine-2-carboxylate Chemical compound C1CC=2SC(C(=O)OCC)=CC=2CN1C(=O)C1=CC=CC=C1 TTXMGIMDAFVKPD-UHFFFAOYSA-N 0.000 description 1
- FGCPAXRNQIOISG-UHFFFAOYSA-N ethyl 5-oxo-1,2-dihydropyrazole-3-carboxylate Chemical compound CCOC(=O)C=1C=C(O)NN=1 FGCPAXRNQIOISG-UHFFFAOYSA-N 0.000 description 1
- MFJQBPOGFVVDAN-UHFFFAOYSA-N ethyl 6,7-dihydro-5h-pyrazolo[5,1-b][1,3]oxazine-2-carboxylate Chemical compound O1CCCN2N=C(C(=O)OCC)C=C21 MFJQBPOGFVVDAN-UHFFFAOYSA-N 0.000 description 1
- CROSMWVINWQWCP-UHFFFAOYSA-N ethyl 7-benzyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-2-carboxylate Chemical compound C1C2=NC(C(=O)OCC)=CN2CCN1CC1=CC=CC=C1 CROSMWVINWQWCP-UHFFFAOYSA-N 0.000 description 1
- DEQZHPHBXYMRRM-UHFFFAOYSA-N ethyl 7-methyl-6,8-dihydro-5h-imidazo[1,2-a]pyrazine-2-carboxylate Chemical compound C1CN(C)CC2=NC(C(=O)OCC)=CN21 DEQZHPHBXYMRRM-UHFFFAOYSA-N 0.000 description 1
- SWABYVXORFBBAT-UHFFFAOYSA-N ethyl imidazo[1,2-a]pyrazine-2-carboxylate Chemical compound C1=CN=CC2=NC(C(=O)OCC)=CN21 SWABYVXORFBBAT-UHFFFAOYSA-N 0.000 description 1
- YSSPHKVAXGJLRK-UHFFFAOYSA-N ethyl oxazine-2-carboxylate Chemical compound CCOC(=O)N1OC=CC=C1 YSSPHKVAXGJLRK-UHFFFAOYSA-N 0.000 description 1
- SZYQPTAROQANMV-UHFFFAOYSA-N ethyl pyrazine-2-carboxylate Chemical compound CCOC(=O)C1=CN=CC=N1 SZYQPTAROQANMV-UHFFFAOYSA-N 0.000 description 1
- JOGZTNKUYDJSDD-UHFFFAOYSA-N ethyl pyrazole-1-carboxylate Chemical compound CCOC(=O)N1C=CC=N1 JOGZTNKUYDJSDD-UHFFFAOYSA-N 0.000 description 1
- FQYYIPZPELSLDK-UHFFFAOYSA-N ethyl pyridine-2-carboxylate Chemical compound CCOC(=O)C1=CC=CC=N1 FQYYIPZPELSLDK-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 244000000058 gram-negative pathogen Species 0.000 description 1
- 244000000059 gram-positive pathogen Species 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 1
- 125000005367 heteroarylalkylthio group Chemical group 0.000 description 1
- 125000005368 heteroarylthio group Chemical group 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- CVVIJWRCGSYCMB-UHFFFAOYSA-N hydron;piperazine;dichloride Chemical compound Cl.Cl.C1CNCCN1 CVVIJWRCGSYCMB-UHFFFAOYSA-N 0.000 description 1
- MSYBLBLAMDYKKZ-UHFFFAOYSA-N hydron;pyridine-3-carbonyl chloride;chloride Chemical compound Cl.ClC(=O)C1=CC=CN=C1 MSYBLBLAMDYKKZ-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- LVPMIMZXDYBCDF-UHFFFAOYSA-N isocinchomeronic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)N=C1 LVPMIMZXDYBCDF-UHFFFAOYSA-N 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 229960000433 latamoxef Drugs 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- VSEAAEQOQBMPQF-UHFFFAOYSA-N morpholin-3-one Chemical compound O=C1COCCN1 VSEAAEQOQBMPQF-UHFFFAOYSA-N 0.000 description 1
- JUNOWSHJELIDQP-UHFFFAOYSA-N morpholin-4-ium-3-carboxylate Chemical compound OC(=O)C1COCCN1 JUNOWSHJELIDQP-UHFFFAOYSA-N 0.000 description 1
- LTAFRIZVOKDEMU-UHFFFAOYSA-N morpholine-3-thione Chemical compound S=C1COCCN1 LTAFRIZVOKDEMU-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- JMJRYTGVHCAYCT-UHFFFAOYSA-N oxan-4-one Chemical compound O=C1CCOCC1 JMJRYTGVHCAYCT-UHFFFAOYSA-N 0.000 description 1
- AUNFUDYEFLJJKP-UHFFFAOYSA-N oxazine-2-carbaldehyde Chemical compound O=CN1OC=CC=C1 AUNFUDYEFLJJKP-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 150000002961 penems Chemical class 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 description 1
- HXEACLLIILLPRG-UHFFFAOYSA-N pipecolic acid Chemical compound OC(=O)C1CCCCN1 HXEACLLIILLPRG-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- WHYQCQRHPQBZHM-UHFFFAOYSA-N pyrazole-1-carboxylic acid Chemical compound OC(=O)N1C=CC=N1 WHYQCQRHPQBZHM-UHFFFAOYSA-N 0.000 description 1
- NRTTUJLILQPENP-UHFFFAOYSA-N pyridine-2-carbaldehyde;hydrochloride Chemical compound Cl.O=CC1=CC=CC=N1 NRTTUJLILQPENP-UHFFFAOYSA-N 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- MJECQFMGPFJWIJ-WENINEFDSA-M sodium;(6z)-6-[(7-methyl-6-oxo-5,8-dihydroimidazo[1,2-a]pyrazin-2-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].C1C(=O)N(C)CC2=NC(\C=C/3C(N4C(=CSC4\3)C([O-])=O)=O)=CN21 MJECQFMGPFJWIJ-WENINEFDSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000004426 substituted alkynyl group Chemical group 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 229960004932 sulbenicillin Drugs 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- BMOTXRXGRCFOTP-UHFFFAOYSA-N tetrabutylazanium;tetrapropylazanium Chemical compound CCC[N+](CCC)(CCC)CCC.CCCC[N+](CCCC)(CCCC)CCCC BMOTXRXGRCFOTP-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- DRWRVYYFKKNYRK-UHFFFAOYSA-N thiazine-2-carbaldehyde Chemical compound O=CN1SC=CC=C1 DRWRVYYFKKNYRK-UHFFFAOYSA-N 0.000 description 1
- ULSZVNJBVJWEJE-UHFFFAOYSA-N thiazolidine-2-carboxylic acid Chemical compound OC(=O)C1NCCS1 ULSZVNJBVJWEJE-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000035899 viability Effects 0.000 description 1
- 230000001018 virulence Effects 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/88—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D499/881—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with a hydrogen atom or an unsubstituted hydrocarbon radical, attached in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D519/00—Heterocyclic compounds containing more than one system of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring system not provided for in groups C07D453/00 or C07D455/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/86—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring with only atoms other than nitrogen atoms directly attached in position 6 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D499/861—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring with only atoms other than nitrogen atoms directly attached in position 6 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with a hydrocarbon radical or a substituted hydrocarbon radical, directly attached in position 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/88—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D503/00—Heterocyclic compounds containing 4-oxa-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. oxapenicillins, clavulanic acid derivatives; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US37705202P | 2002-05-01 | 2002-05-01 | |
| PCT/US2003/013428 WO2003093279A1 (en) | 2002-05-01 | 2003-04-30 | BICYCLIC 6-ALKYLIDENE-PENEMS AS ß-LACTAMASES INHIBITORS |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MXPA04010663A true MXPA04010663A (es) | 2005-04-20 |
Family
ID=29401437
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MXPA04010663A MXPA04010663A (es) | 2002-05-01 | 2003-04-30 | 6-alquiliden-penems biciclicos como inhibidores de beta-lactamasas. |
Country Status (21)
| Country | Link |
|---|---|
| US (3) | US7112582B2 (enExample) |
| EP (2) | EP1988093A1 (enExample) |
| JP (2) | JP4602759B2 (enExample) |
| KR (1) | KR20050007368A (enExample) |
| CN (2) | CN1649883B (enExample) |
| AR (1) | AR039774A1 (enExample) |
| AU (1) | AU2003231205A1 (enExample) |
| BR (1) | BR0309757A (enExample) |
| CA (1) | CA2483538A1 (enExample) |
| CR (3) | CR7508A (enExample) |
| EC (1) | ECSP045397A (enExample) |
| IL (1) | IL164899A0 (enExample) |
| MX (1) | MXPA04010663A (enExample) |
| NO (1) | NO20044549L (enExample) |
| NZ (1) | NZ536182A (enExample) |
| RU (1) | RU2339640C2 (enExample) |
| SG (1) | SG162614A1 (enExample) |
| TW (1) | TW200307687A (enExample) |
| UA (1) | UA79117C2 (enExample) |
| WO (1) | WO2003093279A1 (enExample) |
| ZA (1) | ZA200409686B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20040132708A1 (en) * | 2002-05-01 | 2004-07-08 | Wyeth | Process for preparing 6-alkylidene penem derivatives |
| AR039475A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | 6-alquiliden-penems triciclicos como inhibidores de beta-lactamasa |
| AR039476A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | Proceso para preparar derivados de 6-alquiliden penem |
| AR039774A1 (es) * | 2002-05-01 | 2005-03-02 | Wyeth Corp | 6-alquiliden-penems biciclicos como inhibidores de beta-lactamasas |
| EP1660506A4 (en) * | 2003-08-25 | 2009-02-25 | Revaax Pharmaceuticals Llc | ORAL NEUROTHERAPEUTIC CEFAZOLINE COMPOSITIONS |
| TW200716102A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Bicyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| TW200716104A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Tricyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| AU2006285308A1 (en) * | 2005-07-27 | 2007-03-08 | Wyeth | Tricyclic 6-alkylidene-penem beta-lactamase inhibitors and beta-lactam antibiotic combination: a broad spectrum antibiotic |
| RU2008102912A (ru) * | 2005-07-27 | 2009-09-10 | Вайет (Us) | Сочетание ингибиторов бетта-лактазмы бициклического 6-алкилиденпенема с бетта-лактанным антибиотиком: антибиотик широкого спектра |
| GT200600380A (es) * | 2005-08-24 | 2007-03-29 | Proceso para la preparacion de inhibidores de beta-lactamasa | |
| US20090018332A1 (en) * | 2007-06-28 | 2009-01-15 | Wyeth | Processes For Preparing Bicyclic Oxazine Carboxaldehyde and Beta-Lactamase Inhibitors |
| CN104119858A (zh) * | 2013-04-27 | 2014-10-29 | 海洋王照明科技股份有限公司 | 一种铱金属配合物有机电致磷光材料及其制备方法和有机电致发光器件 |
| CN104119857A (zh) * | 2013-04-27 | 2014-10-29 | 海洋王照明科技股份有限公司 | 一种铱金属配合物有机电致磷光材料及其制备方法和有机电致发光器件 |
| BR112018015191B1 (pt) | 2016-02-23 | 2023-10-17 | Pfizer Inc | Compostos de 6,7-di-hidro-5h-pirazolo[5,1-b][1,3]oxazina-2-carboxamida, seu uso e composição farmacêutica que os compreende |
| CN108473510B (zh) * | 2016-04-28 | 2021-10-29 | 豪夫迈·罗氏有限公司 | 制备2-吡唑并[1,5-a]吡嗪-2-基吡啶并[1,2-a]嘧啶-4-酮的方法 |
| RU2019107162A (ru) | 2016-08-15 | 2020-09-15 | Байер Кропсайенс Акциенгезельшафт | Конденсированные бициклические гетероциклические производные в качестве средств для борьбы с вредителями |
| CN114957258A (zh) * | 2021-02-25 | 2022-08-30 | 华东理工大学 | 基于碳青霉烯结构的广谱丝氨酸β-内酰胺酶抑制剂的合成及其在耐药细菌抑制中的应用 |
| BR112023023866A2 (pt) * | 2021-05-21 | 2024-02-06 | Chengdu Baiyu Pharmaceutical Co Ltd | Derivado de piperazina e seu uso na medicina |
Family Cites Families (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2004A (en) * | 1841-03-12 | Improvement in the manner of constructing and propelling steam-vessels | ||
| US4206067A (en) * | 1978-10-02 | 1980-06-03 | Chevron Research Company | Thermally stabilized erosion-inhibited functional fluids containing perhalometal compounds and an organic base |
| DE3176517D1 (en) | 1980-04-24 | 1987-12-17 | Beecham Group Plc | Beta-lactam compounds, their preparation and use |
| EP0120613A1 (en) | 1983-03-02 | 1984-10-03 | Beecham Group Plc | Penem derivatives and precursors |
| GB8402086D0 (en) | 1984-01-26 | 1984-02-29 | Beecham Group Plc | Compounds |
| FI82471C (fi) | 1984-01-26 | 1991-03-11 | Beecham Group Plc | Foerfarande foer framstaellning av farmakologiskt aktiva 6-metylenpenemderivater. |
| EP0150984B1 (en) | 1984-01-30 | 1991-09-11 | Pfizer Inc. | 6-(substituted) methylenepenicillanic and 6-(substituted) hydroxymethylpenicillanic acids and derivatives thereof |
| EP0167050A1 (en) * | 1984-06-21 | 1986-01-08 | Beecham Group Plc | Clavulanate compounds, their preparation and use and intermediates thereof |
| GB8518416D0 (en) * | 1985-07-22 | 1985-08-29 | Beecham Group Plc | Compounds |
| GB8518422D0 (en) | 1985-07-22 | 1985-08-29 | Beecham Group Plc | Compounds |
| GB8518421D0 (en) | 1985-07-22 | 1985-08-29 | Beecham Group Plc | Compounds |
| ATE159021T1 (de) | 1986-01-17 | 1997-10-15 | Beecham Group Plc | Verfahren zur herstellung von penem derivaten und zwischenprodukte zu dieser herstellung |
| US4891369A (en) * | 1986-12-03 | 1990-01-02 | Taiho Pharmaceutical Company, Limited | 2β-Substituted-methylpenicillanic acid derivatives, and salts and esters thereof |
| DE3725375A1 (de) * | 1987-07-31 | 1989-02-09 | Bayer Ag | Stabile oxapenem-3-carbonsaeuren |
| GB8724566D0 (en) | 1987-10-20 | 1987-11-25 | Roussel Lab Ltd | Chemical compounds |
| GB8729614D0 (en) | 1987-12-18 | 1988-02-03 | Beecham Group Plc | Novel compounds |
| GB8729613D0 (en) | 1987-12-18 | 1988-02-03 | Beecham Group Plc | Novel compounds |
| NZ237202A (en) | 1990-02-23 | 1994-01-26 | Bristol Myers Squibb Co | Composition containing beta-lactam antibiotic and cationic oligopeptide |
| EP0447704A1 (en) | 1990-03-21 | 1991-09-25 | Smithkline Beecham Farmaceutici S.p.A. | N-Acylated azacyclic compounds, processes for their preparations and their use as medications |
| GB9116236D0 (en) | 1991-07-27 | 1991-09-11 | Smithkline Beecham Plc | Novel compounds |
| GB9222700D0 (en) * | 1992-10-29 | 1992-12-09 | Smithkline Beecham Plc | Chemical compounds |
| US5349045A (en) | 1993-01-26 | 1994-09-20 | United States Surgical Corporation | Polymer derived from cyclic amide and medical devices manufactured therefrom |
| GB9326248D0 (en) * | 1993-12-23 | 1994-02-23 | Smithkline Beecham Plc | Pharmaceutical formulations |
| ES2206502T3 (es) | 1994-04-25 | 2004-05-16 | Smithkline Beecham Plc | Formulaciones farmaceuticas que contienen un penem inhibidor de beta-lactamasa en combinacion con un antibiotico de beta-lactama y su uso en el tratamiento de infecciones bacterianas. |
| US5629322A (en) | 1994-11-15 | 1997-05-13 | Merck & Co., Inc. | Cyclic amidine analogs as inhibitors of nitric oxide synthase |
| OA11666A (en) * | 1998-10-15 | 2004-12-08 | Sarawak Medichem Pharmaceuticals Inc | Method and composition for treating and preventingtuberculosis. |
| GB9928290D0 (en) * | 1999-12-01 | 2000-01-26 | Univ Belfast | Process for preparing ambient temperature ionic liquids |
| EP1199077A1 (en) * | 2000-10-19 | 2002-04-24 | Amura Limited | Stable compositions of oxapenem-3-carboxylic acids by Co-lyophilisation with pharmaceutical carriers |
| GB0106428D0 (en) * | 2001-03-15 | 2001-05-02 | Amura Ltd | Antibacterial composition |
| US20040132708A1 (en) * | 2002-05-01 | 2004-07-08 | Wyeth | Process for preparing 6-alkylidene penem derivatives |
| AR039774A1 (es) * | 2002-05-01 | 2005-03-02 | Wyeth Corp | 6-alquiliden-penems biciclicos como inhibidores de beta-lactamasas |
| AR039476A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | Proceso para preparar derivados de 6-alquiliden penem |
| AR039475A1 (es) * | 2002-05-01 | 2005-02-23 | Wyeth Corp | 6-alquiliden-penems triciclicos como inhibidores de beta-lactamasa |
| AR046041A1 (es) * | 2003-10-03 | 2005-11-23 | Aventis Pharma Inc | Procedimiento para la preparacion de compuestos heterociclicos n-amino sustituidos |
| TW200716104A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Tricyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| TW200716102A (en) * | 2005-06-01 | 2007-05-01 | Wyeth Corp | Bicyclic 6-alkylidene-penems as class-D β -lactamases inhibitors |
| RU2008102912A (ru) * | 2005-07-27 | 2009-09-10 | Вайет (Us) | Сочетание ингибиторов бетта-лактазмы бициклического 6-алкилиденпенема с бетта-лактанным антибиотиком: антибиотик широкого спектра |
-
2003
- 2003-04-28 AR ARP030101471A patent/AR039774A1/es unknown
- 2003-04-29 TW TW092110033A patent/TW200307687A/zh unknown
- 2003-04-30 AU AU2003231205A patent/AU2003231205A1/en not_active Abandoned
- 2003-04-30 UA UA20041109833A patent/UA79117C2/uk unknown
- 2003-04-30 BR BR0309757-9A patent/BR0309757A/pt not_active IP Right Cessation
- 2003-04-30 CA CA002483538A patent/CA2483538A1/en not_active Abandoned
- 2003-04-30 RU RU2004135082/04A patent/RU2339640C2/ru not_active IP Right Cessation
- 2003-04-30 SG SG200607462-9A patent/SG162614A1/en unknown
- 2003-04-30 EP EP08004917A patent/EP1988093A1/en not_active Withdrawn
- 2003-04-30 CN CN038097338A patent/CN1649883B/zh not_active Expired - Fee Related
- 2003-04-30 NZ NZ536182A patent/NZ536182A/en not_active IP Right Cessation
- 2003-04-30 WO PCT/US2003/013428 patent/WO2003093279A1/en not_active Ceased
- 2003-04-30 KR KR10-2004-7017597A patent/KR20050007368A/ko not_active Ceased
- 2003-04-30 CN CNA2009101331547A patent/CN101570545A/zh active Pending
- 2003-04-30 MX MXPA04010663A patent/MXPA04010663A/es active IP Right Grant
- 2003-04-30 JP JP2004501418A patent/JP4602759B2/ja not_active Expired - Fee Related
- 2003-04-30 EP EP03724340A patent/EP1499621A1/en not_active Ceased
- 2003-05-01 US US10/427,380 patent/US7112582B2/en not_active Expired - Fee Related
-
2004
- 2004-10-06 CR CR7508A patent/CR7508A/es not_active Application Discontinuation
- 2004-10-22 NO NO20044549A patent/NO20044549L/no not_active Application Discontinuation
- 2004-10-28 IL IL16489904A patent/IL164899A0/xx unknown
- 2004-10-29 EC EC2004005397A patent/ECSP045397A/es unknown
- 2004-11-30 ZA ZA200409686A patent/ZA200409686B/xx unknown
-
2006
- 2006-06-06 US US11/447,814 patent/US20060217361A1/en not_active Abandoned
-
2008
- 2008-08-21 US US12/195,706 patent/US7812014B2/en not_active Expired - Fee Related
-
2009
- 2009-08-21 CR CR10986A patent/CR10986A/es not_active Application Discontinuation
- 2009-08-21 CR CR10983A patent/CR10983A/es not_active Application Discontinuation
-
2010
- 2010-06-02 JP JP2010127126A patent/JP2010215652A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| SG162614A1 (en) | 2010-07-29 |
| EP1499621A1 (en) | 2005-01-26 |
| CR10986A (es) | 2009-09-09 |
| US7112582B2 (en) | 2006-09-26 |
| NZ536182A (en) | 2006-10-27 |
| EP1988093A1 (en) | 2008-11-05 |
| JP4602759B2 (ja) | 2010-12-22 |
| AR039774A1 (es) | 2005-03-02 |
| US20060217361A1 (en) | 2006-09-28 |
| RU2004135082A (ru) | 2006-01-20 |
| KR20050007368A (ko) | 2005-01-17 |
| TW200307687A (en) | 2003-12-16 |
| NO20044549L (no) | 2005-01-25 |
| UA79117C2 (en) | 2007-05-25 |
| CN101570545A (zh) | 2009-11-04 |
| CR7508A (es) | 2005-01-05 |
| JP2010215652A (ja) | 2010-09-30 |
| RU2339640C2 (ru) | 2008-11-27 |
| CR10983A (es) | 2009-09-09 |
| US20040077622A1 (en) | 2004-04-22 |
| WO2003093279A1 (en) | 2003-11-13 |
| US7812014B2 (en) | 2010-10-12 |
| CN1649883A (zh) | 2005-08-03 |
| CA2483538A1 (en) | 2003-11-13 |
| AU2003231205A1 (en) | 2003-11-17 |
| JP2005533017A (ja) | 2005-11-04 |
| US20080312203A1 (en) | 2008-12-18 |
| BR0309757A (pt) | 2005-03-08 |
| ECSP045397A (es) | 2005-01-03 |
| ZA200409686B (en) | 2007-09-26 |
| CN1649883B (zh) | 2010-05-26 |
| IL164899A0 (en) | 2005-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7812014B2 (en) | Bicyclic 6-alkylidene-penems as β-lactamase inhibitors | |
| AU2010200930A1 (en) | Process for preparing 6-alkylidene penem derivatives | |
| US20040132708A1 (en) | Process for preparing 6-alkylidene penem derivatives | |
| MX2007015172A (es) | Penemes biciclicos de 6-alquilideno como inhibidores de beta-lactamasas clase d. | |
| JP4472515B2 (ja) | ベータ−ラクタマーゼ阻害剤としてのヘテロトリサイクリル−６−アルキリデン−ペネム | |
| JP2008542376A (ja) | クラスＤのβラクタマーゼ阻害剤としての三環系６−アルキリデンペネム類 | |
| US20070232582A1 (en) | 4-substituted or unsubtituted-7-hydro-1,4-thiazepine-7-[bicyclic or tricyclic heteroaryl] substituted-3,6-dicarboxylic acid derivatives as beta-lactamase inhibitors | |
| HK1124064A (en) | Bicyclic 6-alkylidene-penems as beta-lactamases inhibitors | |
| US7229983B2 (en) | 4-substituted or unsubstituted-7-hydro-1,4-thiazepine-7-[bicyclic or tricyclic heteroaryl] substituted-3,6-dicarboxylic acid derivatives as β-lactamase inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG | Grant or registration |