KR20010042463A - 퀴놀론카본산 유도체 또는 그 염 - Google Patents
퀴놀론카본산 유도체 또는 그 염 Download PDFInfo
- Publication number
- KR20010042463A KR20010042463A KR1020007011078A KR20007011078A KR20010042463A KR 20010042463 A KR20010042463 A KR 20010042463A KR 1020007011078 A KR1020007011078 A KR 1020007011078A KR 20007011078 A KR20007011078 A KR 20007011078A KR 20010042463 A KR20010042463 A KR 20010042463A
- Authority
- KR
- South Korea
- Prior art keywords
- pyridyl
- methyl
- group
- cyclopropyl
- compound
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims abstract description 38
- XOQQVKDBGLYPGH-UHFFFAOYSA-N 2-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=CC=C2NC(=O)C(C(=O)O)=CC2=C1 XOQQVKDBGLYPGH-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims abstract description 52
- 125000003277 amino group Chemical group 0.000 claims abstract description 26
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 22
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 14
- 125000005843 halogen group Chemical group 0.000 claims abstract description 12
- 125000006239 protecting group Chemical group 0.000 claims abstract description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 11
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 9
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 172
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 106
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 31
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 14
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 13
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 8
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 6
- FVIIAPXSUWXQKF-UHFFFAOYSA-N 1-cyclopropyl-7-(2,6-dimethylpyridin-4-yl)-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=NC(C)=CC(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=CC=2)C)=C1 FVIIAPXSUWXQKF-UHFFFAOYSA-N 0.000 claims description 3
- IEZPBCYYTFXZIJ-UHFFFAOYSA-N 7-(6-amino-5-methylpyridin-3-yl)-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylic acid Chemical compound COC1=C(C=2C=C(C)C(N)=NC=2)C=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 IEZPBCYYTFXZIJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- XPIJWUTXQAGSLK-UHFFFAOYSA-N ozenoxacin Chemical compound C1=C(C)C(NC)=NC=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C XPIJWUTXQAGSLK-UHFFFAOYSA-N 0.000 claims description 3
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical class C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 claims 3
- -1 pyridine- 3-yl group Chemical group 0.000 abstract description 149
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract description 7
- 241000186427 Cutibacterium acnes Species 0.000 abstract description 6
- 230000000845 anti-microbial effect Effects 0.000 abstract description 6
- 241000192125 Firmicutes Species 0.000 abstract description 5
- 229940055019 propionibacterium acne Drugs 0.000 abstract description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 97
- 238000006243 chemical reaction Methods 0.000 description 92
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 76
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 75
- 239000002904 solvent Substances 0.000 description 68
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 63
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 55
- 239000013078 crystal Substances 0.000 description 52
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 48
- 239000012044 organic layer Substances 0.000 description 46
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 44
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 39
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- 229910052763 palladium Inorganic materials 0.000 description 38
- 239000011541 reaction mixture Substances 0.000 description 38
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 36
- 239000000243 solution Substances 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 27
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 27
- 238000002844 melting Methods 0.000 description 27
- 230000008018 melting Effects 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- 239000003054 catalyst Substances 0.000 description 25
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 24
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 239000002253 acid Substances 0.000 description 21
- 239000012046 mixed solvent Substances 0.000 description 21
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 20
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 19
- 230000002411 adverse Effects 0.000 description 19
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 18
- 239000002585 base Substances 0.000 description 17
- 238000007142 ring opening reaction Methods 0.000 description 17
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 16
- 238000004440 column chromatography Methods 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 239000003795 chemical substances by application Substances 0.000 description 15
- 238000000034 method Methods 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 239000003480 eluent Substances 0.000 description 14
- 235000011054 acetic acid Nutrition 0.000 description 13
- 150000001408 amides Chemical class 0.000 description 13
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- 150000002940 palladium Chemical class 0.000 description 13
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 13
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 150000002170 ethers Chemical class 0.000 description 12
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 12
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- 238000005859 coupling reaction Methods 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 11
- 150000003462 sulfoxides Chemical class 0.000 description 11
- 239000008096 xylene Substances 0.000 description 11
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 10
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 10
- 239000012267 brine Substances 0.000 description 10
- 239000003638 chemical reducing agent Substances 0.000 description 10
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 10
- 239000012299 nitrogen atmosphere Substances 0.000 description 10
- 238000006722 reduction reaction Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 9
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 9
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 238000002156 mixing Methods 0.000 description 9
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 9
- 229920000137 polyphosphoric acid Polymers 0.000 description 9
- 239000012279 sodium borohydride Substances 0.000 description 9
- 229910000033 sodium borohydride Inorganic materials 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 8
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 8
- 125000001309 chloro group Chemical group Cl* 0.000 description 8
- 150000002825 nitriles Chemical class 0.000 description 8
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 8
- 230000000704 physical effect Effects 0.000 description 8
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 8
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 8
- RRQYJINTUHWNHW-UHFFFAOYSA-N 1-ethoxy-2-(2-ethoxyethoxy)ethane Chemical class CCOCCOCCOCC RRQYJINTUHWNHW-UHFFFAOYSA-N 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 7
- 239000012298 atmosphere Substances 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- 239000011261 inert gas Substances 0.000 description 7
- VUYVXCJTTQJVKJ-UHFFFAOYSA-L palladium(2+);tricyclohexylphosphane;dichloride Chemical compound Cl[Pd]Cl.C1CCCCC1P(C1CCCCC1)C1CCCCC1.C1CCCCC1P(C1CCCCC1)C1CCCCC1 VUYVXCJTTQJVKJ-UHFFFAOYSA-L 0.000 description 7
- 125000004076 pyridyl group Chemical group 0.000 description 7
- 238000010898 silica gel chromatography Methods 0.000 description 7
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- 241000894006 Bacteria Species 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 230000000844 anti-bacterial effect Effects 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000004305 biphenyl Substances 0.000 description 6
- 235000010290 biphenyl Nutrition 0.000 description 6
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 6
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 6
- 229940019778 diethylene glycol diethyl ether Drugs 0.000 description 6
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 6
- 235000019798 tripotassium phosphate Nutrition 0.000 description 6
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 5
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 5
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 238000010998 test method Methods 0.000 description 5
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 4
- QYHKJMQBGVFZGH-UHFFFAOYSA-N 3-bromo-n-cyclopropyl-2-methylaniline Chemical compound CC1=C(Br)C=CC=C1NC1CC1 QYHKJMQBGVFZGH-UHFFFAOYSA-N 0.000 description 4
- ZUVPLKVDZNDZCM-UHFFFAOYSA-N 3-chloro-2-methylaniline Chemical compound CC1=C(N)C=CC=C1Cl ZUVPLKVDZNDZCM-UHFFFAOYSA-N 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 4
- 229910015900 BF3 Inorganic materials 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 241000191967 Staphylococcus aureus Species 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 125000006267 biphenyl group Chemical group 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 4
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 4
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 150000008282 halocarbons Chemical class 0.000 description 4
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 4
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 4
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011698 potassium fluoride Substances 0.000 description 4
- 235000003270 potassium fluoride Nutrition 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 235000017550 sodium carbonate Nutrition 0.000 description 4
- 239000011775 sodium fluoride Substances 0.000 description 4
- 235000013024 sodium fluoride Nutrition 0.000 description 4
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 4
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 125000005389 trialkylsiloxy group Chemical group 0.000 description 4
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 3
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- QTBNIBCNVQMGPP-UHFFFAOYSA-N 5-bromo-n,3-dimethylpyridin-2-amine Chemical compound CNC1=NC=C(Br)C=C1C QTBNIBCNVQMGPP-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 3
- 125000003282 alkyl amino group Chemical group 0.000 description 3
- 239000004599 antimicrobial Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 3
- 229940092714 benzenesulfonic acid Drugs 0.000 description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 238000002512 chemotherapy Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 3
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- QJPQVXSHYBGQGM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QJPQVXSHYBGQGM-UHFFFAOYSA-N 0.000 description 3
- FVZVCSNXTFCBQU-UHFFFAOYSA-N phosphanyl Chemical group [PH2] FVZVCSNXTFCBQU-UHFFFAOYSA-N 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 229910001923 silver oxide Inorganic materials 0.000 description 3
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- BZMMRNKDONDVIB-UHFFFAOYSA-N (1-ethoxycyclopropyl)oxy-trimethylsilane Chemical compound CCOC1(O[Si](C)(C)C)CC1 BZMMRNKDONDVIB-UHFFFAOYSA-N 0.000 description 2
- FVMSGXSGQKWTHM-UHFFFAOYSA-N (5-bromo-3-methylpyridin-2-yl)methanol Chemical compound CC1=CC(Br)=CN=C1CO FVMSGXSGQKWTHM-UHFFFAOYSA-N 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- HTILQOYEWJEMOY-UHFFFAOYSA-N 1-(5-bromo-3-methylpyridin-2-yl)-n-methylmethanamine Chemical compound CNCC1=NC=C(Br)C=C1C HTILQOYEWJEMOY-UHFFFAOYSA-N 0.000 description 2
- RWPIGHPGQPGXHQ-UHFFFAOYSA-N 1-cyclopropyl-7-(2,6-dimethylpyridin-4-yl)-5,8-dimethyl-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=NC(C)=CC(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=C(C)C=2)C)=C1 RWPIGHPGQPGXHQ-UHFFFAOYSA-N 0.000 description 2
- VSFTVHZRYKKFHW-UHFFFAOYSA-N 1-cyclopropyl-8-methyl-7-(6-methylpyridin-3-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1=NC(C)=CC=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C VSFTVHZRYKKFHW-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 2
- 125000003821 2-(trimethylsilyl)ethoxymethyl group Chemical group [H]C([H])([H])[Si](C([H])([H])[H])(C([H])([H])[H])C([H])([H])C(OC([H])([H])[*])([H])[H] 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- ZXKFDJWKTGBQED-UHFFFAOYSA-N 3-diphenylphosphanylbutan-2-yl(diphenyl)phosphane nickel Chemical compound [Ni].CC(C(P(C1=CC=CC=C1)C1=CC=CC=C1)C)P(C1=CC=CC=C1)C1=CC=CC=C1 ZXKFDJWKTGBQED-UHFFFAOYSA-N 0.000 description 2
- ILNJBIQQAIIMEY-UHFFFAOYSA-N 4-oxo-1h-quinoline-3-carboxylic acid Chemical group C1=CC=CC2=C(O)C(C(=O)O)=CN=C21 ILNJBIQQAIIMEY-UHFFFAOYSA-N 0.000 description 2
- IBLYJHZFXKWRHU-UHFFFAOYSA-N 5-amino-1-cyclopropyl-7-(5,6-dimethylpyridin-3-yl)-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound N1=C(C)C(C)=CC(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=C(N)C=2)C)=C1 IBLYJHZFXKWRHU-UHFFFAOYSA-N 0.000 description 2
- FYCJIQRMKLXWAJ-UHFFFAOYSA-N 7-(6-amino-5-methylpyridin-3-yl)-1-cyclopropyl-8-(difluoromethoxy)-4-oxoquinoline-3-carboxylic acid Chemical compound N1=C(N)C(C)=CC(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=CC=2)OC(F)F)=C1 FYCJIQRMKLXWAJ-UHFFFAOYSA-N 0.000 description 2
- FSGBCPYLSFIBKW-UHFFFAOYSA-N 7-(6-amino-5-methylpyridin-3-yl)-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound N1=C(N)C(C)=CC(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=CC=2)C)=C1 FSGBCPYLSFIBKW-UHFFFAOYSA-N 0.000 description 2
- WPOWROOOABWCSY-UHFFFAOYSA-N 7-(6-aminopyridin-3-yl)-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=C(C=2C=NC(N)=CC=2)C=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 WPOWROOOABWCSY-UHFFFAOYSA-N 0.000 description 2
- WAFIRHWSVCXZGJ-UHFFFAOYSA-N 7-[6-[acetyl(methyl)amino]-5-methylpyridin-3-yl]-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(C)C(N(C(C)=O)C)=NC=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C WAFIRHWSVCXZGJ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 241000125205 Anethum Species 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical group [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 2
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 2
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical compound C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- GROYGRZSTCDMEM-UHFFFAOYSA-L dichloronickel 2-diphenylphosphanylpropan-2-yl(diphenyl)phosphane Chemical compound [Ni](Cl)Cl.C1(=CC=CC=C1)P(C1=CC=CC=C1)C(C)(C)P(C1=CC=CC=C1)C1=CC=CC=C1 GROYGRZSTCDMEM-UHFFFAOYSA-L 0.000 description 2
- WDQZIRSDNFWMAE-UHFFFAOYSA-L dichloronickel;1-diphenylphosphanylethyl(diphenyl)phosphane Chemical compound Cl[Ni]Cl.C=1C=CC=CC=1P(C=1C=CC=CC=1)C(C)P(C=1C=CC=CC=1)C1=CC=CC=C1 WDQZIRSDNFWMAE-UHFFFAOYSA-L 0.000 description 2
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- CQQMQKZGZFTJOF-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(2,6-dimethylpyridin-4-yl)-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)N=C(C)C=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 CQQMQKZGZFTJOF-UHFFFAOYSA-N 0.000 description 2
- YOPIUPKEKAKVIM-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(5,6-dimethylpyridin-3-yl)-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)C(C)=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 YOPIUPKEKAKVIM-UHFFFAOYSA-N 0.000 description 2
- YBEOYBKKSWUSBR-UHFFFAOYSA-N ethyl 4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1 YBEOYBKKSWUSBR-UHFFFAOYSA-N 0.000 description 2
- MUQYAFBHOLSOCY-UHFFFAOYSA-N ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(Cl)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 MUQYAFBHOLSOCY-UHFFFAOYSA-N 0.000 description 2
- 125000005343 heterocyclic alkyl group Chemical group 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 2
- 239000011654 magnesium acetate Substances 0.000 description 2
- 235000011285 magnesium acetate Nutrition 0.000 description 2
- 229940069446 magnesium acetate Drugs 0.000 description 2
- 229910001507 metal halide Inorganic materials 0.000 description 2
- 150000005309 metal halides Chemical class 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 230000000813 microbial effect Effects 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000007886 mutagenicity Effects 0.000 description 2
- 231100000299 mutagenicity Toxicity 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 150000002815 nickel Chemical class 0.000 description 2
- ZBRJXVVKPBZPAN-UHFFFAOYSA-L nickel(2+);triphenylphosphane;dichloride Chemical compound [Cl-].[Cl-].[Ni+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 ZBRJXVVKPBZPAN-UHFFFAOYSA-L 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000002905 orthoesters Chemical class 0.000 description 2
- CHNLPLHJUPMEOI-UHFFFAOYSA-N oxolane;trifluoroborane Chemical compound FB(F)F.C1CCOC1 CHNLPLHJUPMEOI-UHFFFAOYSA-N 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 208000007578 phototoxic dermatitis Diseases 0.000 description 2
- 231100000018 phototoxicity Toxicity 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- SPIZFQGNDSRKCB-UHFFFAOYSA-N tert-butyl 3-bromo-5-(cyclopropylamino)-4-methylbenzoate Chemical compound CC1=C(Br)C=C(C(=O)OC(C)(C)C)C=C1NC1CC1 SPIZFQGNDSRKCB-UHFFFAOYSA-N 0.000 description 2
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000000037 tert-butyldiphenylsilyl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1[Si]([H])([*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 1
- NFRYVRNCDXULEX-UHFFFAOYSA-N (2-diphenylphosphanylphenyl)-diphenylphosphane Chemical compound C1=CC=CC=C1P(C=1C(=CC=CC=1)P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 NFRYVRNCDXULEX-UHFFFAOYSA-N 0.000 description 1
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- 125000006033 1,1-dimethyl-2-propenyl group Chemical group 0.000 description 1
- QFMZQPDHXULLKC-UHFFFAOYSA-N 1,2-bis(diphenylphosphino)ethane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCP(C=1C=CC=CC=1)C1=CC=CC=C1 QFMZQPDHXULLKC-UHFFFAOYSA-N 0.000 description 1
- ITJXBYICYDZWJA-UHFFFAOYSA-N 1,3,2$l^{2}-dioxaborinane Chemical group [B]1OCCCO1 ITJXBYICYDZWJA-UHFFFAOYSA-N 0.000 description 1
- WUYQAYADHXKJTF-UHFFFAOYSA-N 1,3,2-dioxaborinane Chemical compound B1OCCCO1 WUYQAYADHXKJTF-UHFFFAOYSA-N 0.000 description 1
- NCWDBNBNYVVARF-UHFFFAOYSA-N 1,3,2-dioxaborolane Chemical compound B1OCCO1 NCWDBNBNYVVARF-UHFFFAOYSA-N 0.000 description 1
- OCSKCBIGEMSDIS-UHFFFAOYSA-N 1,3-dibromo-2-methylbenzene Chemical compound CC1=C(Br)C=CC=C1Br OCSKCBIGEMSDIS-UHFFFAOYSA-N 0.000 description 1
- NRSMEGPGASIQDV-UHFFFAOYSA-N 1-cyclopropyl-7-(4,6-dimethylpyridin-3-yl)-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=NC(C)=CC(C)=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C NRSMEGPGASIQDV-UHFFFAOYSA-N 0.000 description 1
- AMODPOCKMXXTII-UHFFFAOYSA-N 1-cyclopropyl-7-(5,6-diaminopyridin-3-yl)-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=C(C=2C=C(N)C(N)=NC=2)C=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 AMODPOCKMXXTII-UHFFFAOYSA-N 0.000 description 1
- KSFMKKZDZZMEAP-UHFFFAOYSA-N 1-cyclopropyl-7-(5,6-dimethylpyridin-3-yl)-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound N1=C(C)C(C)=CC(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=CC=2)C)=C1 KSFMKKZDZZMEAP-UHFFFAOYSA-N 0.000 description 1
- CCMSAHBFKDLWKI-UHFFFAOYSA-N 1-cyclopropyl-7-(6-methoxypyridin-3-yl)-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=NC(OC)=CC=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C CCMSAHBFKDLWKI-UHFFFAOYSA-N 0.000 description 1
- KJCCXOVHNORLHG-UHFFFAOYSA-N 1-cyclopropyl-7-[2-(hydroxymethyl)-6-methylpyridin-4-yl]-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound OCC1=NC(C)=CC(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=CC=2)C)=C1 KJCCXOVHNORLHG-UHFFFAOYSA-N 0.000 description 1
- RFXLWZDSFCJTCB-UHFFFAOYSA-N 1-cyclopropyl-7-[5-(hydroxymethyl)pyridin-3-yl]-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=C(C=2C=C(CO)C=NC=2)C=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 RFXLWZDSFCJTCB-UHFFFAOYSA-N 0.000 description 1
- OGSWLSVVHQQFLW-UHFFFAOYSA-N 1-cyclopropyl-7-[6-(dimethylamino)pyridin-3-yl]-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=NC(N(C)C)=CC=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C OGSWLSVVHQQFLW-UHFFFAOYSA-N 0.000 description 1
- OJXLIYZZRYWECO-UHFFFAOYSA-N 1-cyclopropyl-7-[6-(hydroxymethyl)-5-methylpyridin-3-yl]-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound N1=C(CO)C(C)=CC(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=CC=2)C)=C1 OJXLIYZZRYWECO-UHFFFAOYSA-N 0.000 description 1
- WEEUARNDZFANEH-UHFFFAOYSA-N 1-cyclopropyl-7-[6-[2,2-dimethylpropanoyl(methyl)amino]-5-methylpyridin-3-yl]-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(C)C(N(C(=O)C(C)(C)C)C)=NC=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C WEEUARNDZFANEH-UHFFFAOYSA-N 0.000 description 1
- NVUZHVQJDVQUGE-UHFFFAOYSA-N 1-cyclopropyl-8-methyl-4-oxo-7-(4,5,6-trimethylpyridin-3-yl)quinoline-3-carboxylic acid Chemical compound CC1=C(C)C(C)=NC=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C NVUZHVQJDVQUGE-UHFFFAOYSA-N 0.000 description 1
- CFAVWOZVDBCLNF-UHFFFAOYSA-N 1-cyclopropyl-8-methyl-4-oxo-7-pyridin-4-ylquinoline-3-carboxylic acid Chemical compound CC1=C(C=2C=CN=CC=2)C=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 CFAVWOZVDBCLNF-UHFFFAOYSA-N 0.000 description 1
- IHGRSSRYXDVQEL-UHFFFAOYSA-N 1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=CC=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 IHGRSSRYXDVQEL-UHFFFAOYSA-N 0.000 description 1
- MPTSNJGPSIRQJP-UHFFFAOYSA-N 1-cyclopropyl-8-methyl-7-(5-methylpyridin-3-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=CN=CC(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=CC=2)C)=C1 MPTSNJGPSIRQJP-UHFFFAOYSA-N 0.000 description 1
- QOEMSCPYPKGRCI-UHFFFAOYSA-N 1-cyclopropyl-8-methyl-7-[5-methyl-6-[[methyl(phenylmethoxycarbonyl)amino]methyl]pyridin-3-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C=1C=CC=CC=1COC(=O)N(C)CC(C(=C1)C)=NC=C1C(C=1C)=CC=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 QOEMSCPYPKGRCI-UHFFFAOYSA-N 0.000 description 1
- OPVMSBRSMARLEL-UHFFFAOYSA-N 1-cyclopropyl-8-methyl-7-[6-(methylamino)pyridin-3-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1=NC(NC)=CC=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C OPVMSBRSMARLEL-UHFFFAOYSA-N 0.000 description 1
- WGOBPPNNYVSJTE-UHFFFAOYSA-N 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)C(C)CP(C=1C=CC=CC=1)C1=CC=CC=C1 WGOBPPNNYVSJTE-UHFFFAOYSA-N 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- LXFQSRIDYRFTJW-UHFFFAOYSA-N 2,4,6-trimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(S(O)(=O)=O)C(C)=C1 LXFQSRIDYRFTJW-UHFFFAOYSA-N 0.000 description 1
- ZHXUWDPHUQHFOV-UHFFFAOYSA-N 2,5-dibromopyridine Chemical compound BrC1=CC=C(Br)N=C1 ZHXUWDPHUQHFOV-UHFFFAOYSA-N 0.000 description 1
- LINZZISWCNKFEM-UHFFFAOYSA-N 3,3-dimethylbutanamide Chemical compound CC(C)(C)CC(N)=O LINZZISWCNKFEM-UHFFFAOYSA-N 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- IILVSKMKMOJHMA-UHFFFAOYSA-N 3-bromo-2-methylaniline Chemical compound CC1=C(N)C=CC=C1Br IILVSKMKMOJHMA-UHFFFAOYSA-N 0.000 description 1
- WSMVCGFWAFZMGS-UHFFFAOYSA-N 3-bromo-5-[cyclopropyl-(3-ethoxy-2-ethoxycarbonyl-3-oxoprop-1-enyl)amino]-4-methylbenzoic acid Chemical compound C=1C(C(O)=O)=CC(Br)=C(C)C=1N(C=C(C(=O)OCC)C(=O)OCC)C1CC1 WSMVCGFWAFZMGS-UHFFFAOYSA-N 0.000 description 1
- OEWNGVSKDJNWTK-UHFFFAOYSA-N 3-bromo-n-cyclopropyl-2,5-dimethylaniline Chemical compound CC1=CC(Br)=C(C)C(NC2CC2)=C1 OEWNGVSKDJNWTK-UHFFFAOYSA-N 0.000 description 1
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 125000006032 3-methyl-3-butenyl group Chemical group 0.000 description 1
- SHMUDFSOGIXHAB-UHFFFAOYSA-N 5-bromo-2,3,4-trimethylpyridine Chemical compound CC1=NC=C(Br)C(C)=C1C SHMUDFSOGIXHAB-UHFFFAOYSA-N 0.000 description 1
- YTSKHJMMNFPBBZ-UHFFFAOYSA-N 5-bromo-2-chloro-3-methylpyridine Chemical compound CC1=CC(Br)=CN=C1Cl YTSKHJMMNFPBBZ-UHFFFAOYSA-N 0.000 description 1
- VWIQEXZPUGUNLV-UHFFFAOYSA-N 5-bromo-n,n,3-trimethylpyridin-2-amine Chemical compound CN(C)C1=NC=C(Br)C=C1C VWIQEXZPUGUNLV-UHFFFAOYSA-N 0.000 description 1
- LSKFUJPFKYVOCT-UHFFFAOYSA-N 7-[6-[acetyl(methyl)amino]pyridin-3-yl]-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=NC(N(C(C)=O)C)=CC=C1C1=CC=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C LSKFUJPFKYVOCT-UHFFFAOYSA-N 0.000 description 1
- QTZLDNIAPHSZEX-UHFFFAOYSA-N B1OCCOCCO1 Chemical compound B1OCCOCCO1 QTZLDNIAPHSZEX-UHFFFAOYSA-N 0.000 description 1
- KOZVADYLQZQVPP-UHFFFAOYSA-N C(C)OC(=O)C1=CN(C2=C(C(=CC=C2C1=O)C=1C=NC(=CC=1)N(C)C(C)=O)C)C1CC1 Chemical compound C(C)OC(=O)C1=CN(C2=C(C(=CC=C2C1=O)C=1C=NC(=CC=1)N(C)C(C)=O)C)C1CC1 KOZVADYLQZQVPP-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 229910052772 Samarium Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 101100482220 Sulfurisphaera tokodaii (strain DSM 16993 / JCM 10545 / NBRC 100140 / 7) triC gene Proteins 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- NCKJIJSEWKIXAT-DQRAZIAOSA-N [(z)-2-diphenylphosphanylethenyl]-diphenylphosphane Chemical group C=1C=CC=CC=1P(C=1C=CC=CC=1)/C=C\P(C=1C=CC=CC=1)C1=CC=CC=C1 NCKJIJSEWKIXAT-DQRAZIAOSA-N 0.000 description 1
- CYMNOBKYOKLHLY-UHFFFAOYSA-N [6-[2,2-dimethylpropanoyl(methyl)amino]-5-methylpyridin-3-yl]oxyboronic acid Chemical compound CC(C)(C)C(=O)N(C)C1=NC=C(OB(O)O)C=C1C CYMNOBKYOKLHLY-UHFFFAOYSA-N 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000005354 acylalkyl group Chemical group 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000001980 alanyl group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940124350 antibacterial drug Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000005164 aryl thioalkyl group Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 238000005885 boration reaction Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical group C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229960003405 ciprofloxacin Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- YOXHCYXIAVIFCZ-UHFFFAOYSA-N cyclopropanol Chemical compound OC1CC1 YOXHCYXIAVIFCZ-UHFFFAOYSA-N 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003221 ear drop Substances 0.000 description 1
- 229940047652 ear drops Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- GHBUOTIRANXFEE-UHFFFAOYSA-N ethyl 1,4-dihydroquinoline-3-carboxylate Chemical compound C1=CC=C2CC(C(=O)OCC)=CNC2=C1 GHBUOTIRANXFEE-UHFFFAOYSA-N 0.000 description 1
- WOUUGYNHJMCKPI-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(2,6-dimethylpyridin-4-yl)-5,8-dimethyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)N=C(C)C=3)=CC(C)=C2C(=O)C(C(=O)OCC)=CN1C1CC1 WOUUGYNHJMCKPI-UHFFFAOYSA-N 0.000 description 1
- AOYBBFSZASRUFB-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(2,6-dimethylpyridin-4-yl)-8-methyl-4-oxo-5-(phenylmethoxycarbonylamino)quinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)N=C(C)C=3)=CC(NC(=O)OCC=3C=CC=CC=3)=C2C(=O)C(C(=O)OCC)=CN1C1CC1 AOYBBFSZASRUFB-UHFFFAOYSA-N 0.000 description 1
- UHUKBKILRNOANF-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(4,6-dimethylpyridin-3-yl)-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C(=CC(C)=NC=3)C)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 UHUKBKILRNOANF-UHFFFAOYSA-N 0.000 description 1
- UEJKBYJEAHZYOQ-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(5,6-diacetamidopyridin-3-yl)-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(NC(C)=O)C(NC(C)=O)=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 UEJKBYJEAHZYOQ-UHFFFAOYSA-N 0.000 description 1
- BCNHQDWDYMKYHX-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(5,6-dimethylpyridin-3-yl)-8-methyl-4-oxo-5-(phenylmethoxycarbonylamino)quinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)C(C)=NC=3)=CC(NC(=O)OCC=3C=CC=CC=3)=C2C(=O)C(C(=O)OCC)=CN1C1CC1 BCNHQDWDYMKYHX-UHFFFAOYSA-N 0.000 description 1
- PIQVCYUTPKTCNX-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(6-methoxypyridin-3-yl)-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=NC(OC)=CC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 PIQVCYUTPKTCNX-UHFFFAOYSA-N 0.000 description 1
- HNAQHTROBNWFQJ-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-[2-(hydroxymethyl)-6-methylpyridin-4-yl]-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(CO)N=C(C)C=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 HNAQHTROBNWFQJ-UHFFFAOYSA-N 0.000 description 1
- RQSFZVNTJUWXJM-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-[6-(dimethylamino)-5-methylpyridin-3-yl]-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)C(N(C)C)=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 RQSFZVNTJUWXJM-UHFFFAOYSA-N 0.000 description 1
- GMIFKGASQFZQAV-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-[6-(dimethylamino)pyridin-3-yl]-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=NC(=CC=3)N(C)C)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 GMIFKGASQFZQAV-UHFFFAOYSA-N 0.000 description 1
- OPJBPZGILDHTBU-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-[6-[2,2-dimethylpropanoyl(methyl)amino]-5-methylpyridin-3-yl]-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)C(N(C)C(=O)C(C)(C)C)=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 OPJBPZGILDHTBU-UHFFFAOYSA-N 0.000 description 1
- CNTNUZJKBYFTSY-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-(difluoromethoxy)-7-(2,6-dimethylpyridin-4-yl)-4-oxoquinoline-3-carboxylate Chemical compound C12=C(OC(F)F)C(C=3C=C(C)N=C(C)C=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 CNTNUZJKBYFTSY-UHFFFAOYSA-N 0.000 description 1
- ZMRLGVJMVCWIBW-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-methyl-4-oxo-7-[5-(phenylmethoxycarbonylamino)pyridin-3-yl]quinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(NC(=O)OCC=4C=CC=CC=4)C=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 ZMRLGVJMVCWIBW-UHFFFAOYSA-N 0.000 description 1
- BVOLTNHSSMTYMR-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-methyl-4-oxo-7-pyridin-3-ylquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=NC=CC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 BVOLTNHSSMTYMR-UHFFFAOYSA-N 0.000 description 1
- LOSWKYCXDHNWAG-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-methyl-4-oxo-7-pyridin-4-ylquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=CN=CC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 LOSWKYCXDHNWAG-UHFFFAOYSA-N 0.000 description 1
- GSTAPILCRHKDCX-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-methyl-7-(5-methylpyridin-3-yl)-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)C=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 GSTAPILCRHKDCX-UHFFFAOYSA-N 0.000 description 1
- QITKHYCOCSWRPT-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-methyl-7-(6-methylpyridin-3-yl)-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=NC(C)=CC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 QITKHYCOCSWRPT-UHFFFAOYSA-N 0.000 description 1
- QWEVDMPDXHOFPB-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-methyl-7-[5-methyl-6-(methylamino)pyridin-3-yl]-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)C(NC)=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 QWEVDMPDXHOFPB-UHFFFAOYSA-N 0.000 description 1
- QJBRCTGYCRHZKP-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-methyl-7-[5-methyl-6-[[methyl(phenylmethoxycarbonyl)amino]methyl]pyridin-3-yl]-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)C(CN(C)C(=O)OCC=4C=CC=CC=4)=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 QJBRCTGYCRHZKP-UHFFFAOYSA-N 0.000 description 1
- LXQSOISRAIVBQU-UHFFFAOYSA-N ethyl 7-(6-acetamido-5-methylpyridin-3-yl)-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylate Chemical compound C12=C(OC)C(C=3C=C(C)C(NC(C)=O)=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 LXQSOISRAIVBQU-UHFFFAOYSA-N 0.000 description 1
- DUOXVAFYJHYJAX-UHFFFAOYSA-N ethyl 7-(6-acetamido-5-methylpyridin-3-yl)-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)C(NC(C)=O)=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 DUOXVAFYJHYJAX-UHFFFAOYSA-N 0.000 description 1
- FDNNFRUTLTVVTJ-UHFFFAOYSA-N ethyl 7-(6-acetamidopyridin-3-yl)-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=NC(NC(C)=O)=CC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 FDNNFRUTLTVVTJ-UHFFFAOYSA-N 0.000 description 1
- XMLRXGGOTJAWPA-UHFFFAOYSA-N ethyl 7-[2-(chloromethyl)-6-methylpyridin-4-yl]-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(CCl)N=C(C)C=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 XMLRXGGOTJAWPA-UHFFFAOYSA-N 0.000 description 1
- HGIOUVHNITVUDC-UHFFFAOYSA-N ethyl 7-[5-(acetyloxymethyl)pyridin-3-yl]-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(COC(C)=O)C=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 HGIOUVHNITVUDC-UHFFFAOYSA-N 0.000 description 1
- ACUNPXHAARWOIY-UHFFFAOYSA-N ethyl 7-[6-[acetyl(methyl)amino]-5-methylpyridin-3-yl]-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(C=3C=C(C)C(N(C)C(C)=O)=NC=3)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 ACUNPXHAARWOIY-UHFFFAOYSA-N 0.000 description 1
- NSAIANPWRHILKT-UHFFFAOYSA-N ethyl 7-bromo-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(Br)=CC=C2C(=O)C(C(=O)OCC)=CN1C1CC1 NSAIANPWRHILKT-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- LFETXMWECUPHJA-UHFFFAOYSA-N methanamine;hydrate Chemical compound O.NC LFETXMWECUPHJA-UHFFFAOYSA-N 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 231100000150 mutagenicity / genotoxicity testing Toxicity 0.000 description 1
- WNKRQVDUCURNCC-UHFFFAOYSA-N n-(5-bromo-3-methylpyridin-2-yl)-n-methylacetamide Chemical compound CC(=O)N(C)C1=NC=C(Br)C=C1C WNKRQVDUCURNCC-UHFFFAOYSA-N 0.000 description 1
- QKEOFUANYGHFDY-UHFFFAOYSA-N n-(5-bromopyridin-2-yl)-n-methylacetamide Chemical compound CC(=O)N(C)C1=CC=C(Br)C=N1 QKEOFUANYGHFDY-UHFFFAOYSA-N 0.000 description 1
- IUAQULKAMMYNNQ-UHFFFAOYSA-N n-[5-(3-amino-2-methylphenyl)-3-methylpyridin-2-yl]-n,2,2-trimethylpropanamide Chemical compound C1=C(C)C(N(C(=O)C(C)(C)C)C)=NC=C1C1=CC=CC(N)=C1C IUAQULKAMMYNNQ-UHFFFAOYSA-N 0.000 description 1
- VCUYUDRWWZILBU-UHFFFAOYSA-N n-[5-[3-(cyclopropylamino)-2-methylphenyl]-3-methylpyridin-2-yl]-n,2,2-trimethylpropanamide Chemical compound C1=C(C)C(N(C(=O)C(C)(C)C)C)=NC=C1C1=CC=CC(NC2CC2)=C1C VCUYUDRWWZILBU-UHFFFAOYSA-N 0.000 description 1
- JNEHUOOIJZDSEV-UHFFFAOYSA-N n-[5-[3-[(1-methoxycyclopropyl)amino]-2-methylphenyl]-3-methylpyridin-2-yl]-n,2,2-trimethylpropanamide Chemical compound C=1C=CC(C=2C=C(C)C(N(C)C(=O)C(C)(C)C)=NC=2)=C(C)C=1NC1(OC)CC1 JNEHUOOIJZDSEV-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 239000007923 nasal drop Substances 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- CLSUSRZJUQMOHH-UHFFFAOYSA-L platinum dichloride Chemical compound Cl[Pt]Cl CLSUSRZJUQMOHH-UHFFFAOYSA-L 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- BJOZZALWYMMWNF-UHFFFAOYSA-N potassium;zinc Chemical compound [K+].[Zn+2] BJOZZALWYMMWNF-UHFFFAOYSA-N 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- XJYYTJSLGQZIJU-UHFFFAOYSA-N pyridin-3-yloxyboronic acid Chemical compound OB(O)OC1=CC=CN=C1 XJYYTJSLGQZIJU-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 1
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 206010040872 skin infection Diseases 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- XHFLOLLMZOTPSM-UHFFFAOYSA-M sodium;hydrogen carbonate;hydrate Chemical class [OH-].[Na+].OC(O)=O XHFLOLLMZOTPSM-UHFFFAOYSA-M 0.000 description 1
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical class [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 1
- 229940071182 stannate Drugs 0.000 description 1
- 125000005402 stannate group Chemical group 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 231100000820 toxicity test Toxicity 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000005271 tributylamino group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oncology (AREA)
- Communicable Diseases (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Abstract
Description
a | b | c | d | e | f | g | h | i | j | k |
0.0156 | 0.0313 | 0.0313 | 0.0313 | 0.0625 | 0.0313 | 0.0078 | 0.0156 | 0.0313 | 0.0156 | 0.25 |
a | b | c | d | e | f | g | h | i | j | k |
0.2 | 0.39 | 0.39 | 0.2 | 0.78 | 0.39 | 0.1 | 0.1 | 0.2 | 0.39 | 1.56 |
Claims (7)
- 하기 일반식으로 표시되는 신규한 퀴놀론카본산 유도체 또는 그의 염:식중, R1은 수소원자 또는 카보실보호기를; R2는 선택적으로 치환된 시클로알킬기를; R3은 수소원자, 할로겐원자, 선택적으로 치환된 알킬, 알콕시 또는 알킬티오기, 선택적으로 보호된 히드록실나 아미노기 또는 니트로기를; R4는 선택적으로 치환된 알킬 또는 알콕시기를; Z는 할로겐원자, 선택적으로 치환된 알킬, 알케닐, 시클로알킬, 알콕시, 알킬티오나 아미노기 및 선택적으로 보호된 히드록실이나 아미노기로부터 선택되어진 하나 이상의 기이며 선택적으로 치환된 피리딘-4-일 또는 피리딘-3-일기를 각각 나타낸다.
- 제 1항에 있어서, R3가, 수소원자, 선택적으로 치환된 알킬기 또는 보호되어진 아미노기; Z가 선택적으로 치환된 알킬, 알콕시이거나 아미노기로 치환된 피리딘-4-일 또는 피리딘-3-일기인 것을 특징으로 하는 퀴놀린카본산 유도체 또는 그의 염.
- 제 1항 또는 제 2항에 있어서, R2가 시클로프로필기; R3가 수소원자, 알킬기 또는 아미노기; Z가 선택적으로 치환된 알킬, 알콕시이거나 아미노기로 치환된 피리딘-3-일기인 것을 특징으로 하는 퀴놀린카본산 유도체 또는 그의 염.
- 제 1항 내지 제 3항중 어느 한항에 있어서, R3가 수소원자; R4가 메틸 또는 메톡시기; Z가 메틸기, 히드록시메틸기, 아미노기, 메틸아미노기이거나 디메틸아미노기로부터 선택된 하나 이상의 기로 치환된 피리딘-3-일기인 것을 특징으로 하는 퀴놀린카본산 유도체 또는 그의 염.
- 1-시클로프로필-7-(2,6-디메틸-4-피리딜)-8-메틸-4-옥소-1,4-디히드로-3-퀴놀린카본산 또는 그의 염.
- 1-시클로프로필-8-메틸-7-[5-메틸-6-(메틸아미노)-3-피리딜]-4-옥소-1,4-디히드로-3-퀴놀린카본산 또는 그의 염.
- 7-(6-아미노-5-메틸-3-피리딜)-1-시클로프로필-8-메톡시-4-옥소-1,4-디히드로-3-퀴놀린카본산 또는 그의 염.
Applications Claiming Priority (4)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP?10-110146 | 1998-04-06 | ||
JP11014698 | 1998-04-06 | ||
JP34021798 | 1998-11-30 | ||
JP?10-340217 | 1998-11-30 |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20010042463A true KR20010042463A (ko) | 2001-05-25 |
KR100550078B1 KR100550078B1 (ko) | 2006-02-08 |
Family
ID=26449822
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020007011078A KR100550078B1 (ko) | 1998-04-06 | 1999-04-06 | 퀴놀론카본산 유도체 또는 그 염 |
Country Status (15)
Country | Link |
---|---|
US (1) | US6335447B1 (ko) |
EP (1) | EP1070713B1 (ko) |
JP (1) | JP3346766B2 (ko) |
KR (1) | KR100550078B1 (ko) |
CN (1) | CN1152029C (ko) |
AT (1) | ATE342897T1 (ko) |
BR (1) | BRPI9909456B8 (ko) |
CA (1) | CA2327328C (ko) |
CY (1) | CY1105845T1 (ko) |
DE (1) | DE69933660T2 (ko) |
DK (1) | DK1070713T3 (ko) |
ES (1) | ES2273479T3 (ko) |
HK (1) | HK1039484A1 (ko) |
PT (1) | PT1070713E (ko) |
WO (1) | WO1999051588A1 (ko) |
Families Citing this family (18)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2002062805A1 (fr) * | 2001-02-08 | 2002-08-15 | Toyama Chemical Co., Ltd. | Derive d'acide 6-substitue alkylamino-3-pyridylborique ou d'un sel de celui-ci et leurs procedes de fabrication |
EP1698336A1 (en) * | 2005-03-01 | 2006-09-06 | Ferrer Internacional, S.A. | Antifungal compositions comprising Sertaconazole and either Hydrocortisone or an antibacterial agent |
CA2615912C (en) * | 2005-08-01 | 2013-10-01 | Maruho Co., Ltd. | Lotion preparation containing pyridonecarboxylic acid derivative |
EP2177208A1 (en) | 2008-10-17 | 2010-04-21 | Ferrer Internacional, S.A. | Pharmaceutical topical compositions |
EP2177209A1 (en) | 2008-10-17 | 2010-04-21 | Ferrer Internacional, S.A. | Intravenous solutions and uses |
EP2177214A1 (en) | 2008-10-17 | 2010-04-21 | Ferrer Internacional, S.A. | Solid Oral Dosage Forms and Uses |
TWI513688B (zh) * | 2010-04-06 | 2015-12-21 | Ferrer Int | 1-環丙基-8-甲基-7-〔5-甲基-6-(甲胺基)-3-吡啶基〕-4-側氧基-1,4-二氫-3-喹啉羧酸鹽 |
HUE026460T2 (en) * | 2010-04-06 | 2016-05-30 | Ferrer Int | 1-Cyclopropyl-8-methyl-7- [5-methyl-6- (methylamino) -3-pyridyl] -4-oxo-1,4-dihydro-3-quinoline-carboxylic acid salts |
US8962842B2 (en) * | 2010-09-27 | 2015-02-24 | Evolva Sa | 2-pyridone antimicrobial compositions |
JP6106174B2 (ja) * | 2011-08-31 | 2017-03-29 | 大塚製薬株式会社 | キノロン化合物 |
US20180021329A1 (en) * | 2015-02-13 | 2018-01-25 | Maruho Co., Ltd. | External preparation comprising pyridonecarboxylic acid derivative |
MX2018001075A (es) * | 2015-07-28 | 2019-04-15 | Vyome Therapeutics Ltd | Agentes terapeuticos y profilacticos antibacterianos. |
JP7347915B2 (ja) * | 2016-04-28 | 2023-09-20 | マルホ株式会社 | 抗菌剤 |
KR20190093562A (ko) | 2016-12-01 | 2019-08-09 | 마루호 코 엘티디 | 의료용 피부 외용제 |
CN107121506B (zh) * | 2017-04-13 | 2019-06-07 | 杭州华东医药集团新药研究院有限公司 | 奥泽沙星杂质及其用途 |
CN108299480A (zh) * | 2017-12-27 | 2018-07-20 | 山东百诺医药股份有限公司 | 一种奥泽沙星及其中间体的制备方法 |
WO2020065668A1 (en) * | 2018-09-26 | 2020-04-02 | Maithri Drugs Pvt Ltd | Crystalline form of ozenoxacin and processes for preparation thereof |
CN111675692A (zh) * | 2020-06-08 | 2020-09-18 | 浙江科技学院 | 一种奥泽沙星的合成方法 |
Family Cites Families (7)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE3441788A1 (de) * | 1984-11-15 | 1986-05-15 | Bayer Ag, 5090 Leverkusen | Alkyl-1-cyclopropyl-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
US5075319A (en) * | 1987-09-08 | 1991-12-24 | Sterling Drug Inc. | Pyridinyl-quinolone compounds, their preparation and use |
US4959363A (en) * | 1989-06-23 | 1990-09-25 | Sterling Drug Inc. | Quinolonecarboxamide compounds, their preparation and use as antivirals. |
JP3145487B2 (ja) | 1992-06-12 | 2001-03-12 | シスメックス株式会社 | 粒子分析装置 |
DE4301246A1 (de) * | 1993-01-19 | 1994-07-21 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäurederivate |
KR100417508B1 (ko) * | 1994-11-24 | 2004-03-18 | 바실리어 파마슈티카 아게 | 신규한벤질피리미딘 |
CN100395244C (zh) * | 1996-02-09 | 2008-06-18 | 富山化学工业株式会社 | 喹诺酮羧酸衍生物或它们的盐类 |
-
1999
- 1999-04-06 DK DK99912111T patent/DK1070713T3/da active
- 1999-04-06 CN CNB998059145A patent/CN1152029C/zh not_active Expired - Lifetime
- 1999-04-06 CA CA002327328A patent/CA2327328C/en not_active Expired - Lifetime
- 1999-04-06 KR KR1020007011078A patent/KR100550078B1/ko not_active IP Right Cessation
- 1999-04-06 WO PCT/JP1999/001799 patent/WO1999051588A1/ja active IP Right Grant
- 1999-04-06 EP EP99912111A patent/EP1070713B1/en not_active Expired - Lifetime
- 1999-04-06 DE DE69933660T patent/DE69933660T2/de not_active Expired - Lifetime
- 1999-04-06 JP JP2000542309A patent/JP3346766B2/ja not_active Expired - Lifetime
- 1999-04-06 US US09/647,763 patent/US6335447B1/en not_active Expired - Lifetime
- 1999-04-06 PT PT99912111T patent/PT1070713E/pt unknown
- 1999-04-06 BR BRPI9909456-8B1 patent/BRPI9909456B8/pt not_active IP Right Cessation
- 1999-04-06 AT AT99912111T patent/ATE342897T1/de active
- 1999-04-06 ES ES99912111T patent/ES2273479T3/es not_active Expired - Lifetime
-
2001
- 2001-12-08 HK HK01108624A patent/HK1039484A1/xx not_active IP Right Cessation
-
2006
- 2006-12-12 CY CY20061101789T patent/CY1105845T1/el unknown
Also Published As
Publication number | Publication date |
---|---|
US6335447B1 (en) | 2002-01-01 |
BRPI9909456A (pt) | 2001-10-02 |
JP3346766B2 (ja) | 2002-11-18 |
DK1070713T3 (da) | 2006-12-27 |
WO1999051588A1 (fr) | 1999-10-14 |
EP1070713A1 (en) | 2001-01-24 |
CA2327328A1 (en) | 1999-10-14 |
CA2327328C (en) | 2007-11-13 |
CN1299356A (zh) | 2001-06-13 |
PT1070713E (pt) | 2006-12-29 |
DE69933660D1 (de) | 2006-11-30 |
CY1105845T1 (el) | 2011-02-02 |
BRPI9909456B8 (pt) | 2021-07-06 |
EP1070713B1 (en) | 2006-10-18 |
CN1152029C (zh) | 2004-06-02 |
EP1070713A4 (en) | 2004-09-01 |
ATE342897T1 (de) | 2006-11-15 |
KR100550078B1 (ko) | 2006-02-08 |
HK1039484A1 (en) | 2002-04-26 |
DE69933660T2 (de) | 2007-08-23 |
BRPI9909456B1 (pt) | 2013-10-29 |
ES2273479T3 (es) | 2007-05-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR100550078B1 (ko) | 퀴놀론카본산 유도체 또는 그 염 | |
US5935952A (en) | Quinolone- or naphthylidone-carboxylic acid derivates or their salts | |
AU711914B2 (en) | Quinolonecarboxylic acid derivatives or their salts | |
JPH0841056A (ja) | 6員の窒素含有ヘテロアリール−オキサゾリジノン類 | |
EP0567643A1 (en) | Use of pyridine compound as selective drug and novel pyridine compound | |
US10961196B2 (en) | Compounds for use as an anti-bacterial or anti-fungal agent and as a zinc sensor | |
JP4370002B2 (ja) | キノロンカルボン酸誘導体またはその塩 | |
JPS6191183A (ja) | キノロンカルボン酸誘導体 | |
EP0207497A2 (en) | Quinolonecarboxylic acid derivative and process for its preparation | |
JPH0564955B2 (ko) | ||
JP3542165B2 (ja) | 新規なキノロンカルボン酸誘導体またはその塩 | |
KR970001159B1 (ko) | 신규 1,8-나프티리딘 유도체 및 그의 제조방법 | |
KR950005201B1 (ko) | 8-알콕시퀴놀론카복실산 유도체 | |
JP3031722B2 (ja) | キノロンカルボン酸誘導体またはその塩 | |
JP2994759B2 (ja) | 新規なキノロン−またはナフチリドン−カルボン酸誘導体もしくはそれらの塩 | |
JP2761566B2 (ja) | ピリドンカルボン酸化合物 | |
IT8322311A1 (it) | 7-(4-piridil)-1,8-naftiridin-derivati | |
US7723524B2 (en) | 8-cyanoquinolonecarboxylic acid derivative | |
JPH0616678A (ja) | キノリンカルボン酸誘導体 | |
JP2001181281A (ja) | 抗菌剤として有用なキノロン誘導体 | |
JPH0633262B2 (ja) | 1,4−ジヒドロ−4−オキソナフチリジン誘導体およびその塩 | |
KR19990011423A (ko) | 신규한 세펨 유도체, 그의 제조방법 및 그의 항균제로서의 용도 | |
JPH0242086A (ja) | (3‐ヒドロキシ‐4‐ピリドン‐1‐イル)メチル基を有する新規セファロスポリン誘導体 | |
JPH0219380A (ja) | キノロンカルボン酸化合物 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
A201 | Request for examination | ||
E902 | Notification of reason for refusal | ||
E902 | Notification of reason for refusal | ||
E701 | Decision to grant or registration of patent right | ||
GRNT | Written decision to grant | ||
FPAY | Annual fee payment |
Payment date: 20130118 Year of fee payment: 8 |
|
FPAY | Annual fee payment |
Payment date: 20140117 Year of fee payment: 9 |
|
FPAY | Annual fee payment |
Payment date: 20150119 Year of fee payment: 10 |
|
FPAY | Annual fee payment |
Payment date: 20160105 Year of fee payment: 11 |
|
FPAY | Annual fee payment |
Payment date: 20170103 Year of fee payment: 12 |
|
FPAY | Annual fee payment |
Payment date: 20180119 Year of fee payment: 13 |
|
EXPY | Expiration of term |