KR101944314B1 - 쌀가루를 이용한 과실 와플 및 이의 제조방법 - Google Patents
쌀가루를 이용한 과실 와플 및 이의 제조방법 Download PDFInfo
- Publication number
- KR101944314B1 KR101944314B1 KR1020160168342A KR20160168342A KR101944314B1 KR 101944314 B1 KR101944314 B1 KR 101944314B1 KR 1020160168342 A KR1020160168342 A KR 1020160168342A KR 20160168342 A KR20160168342 A KR 20160168342A KR 101944314 B1 KR101944314 B1 KR 101944314B1
- Authority
- KR
- South Korea
- Prior art keywords
- weight
- parts
- waffle
- rice flour
- fruit
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 235000012773 waffles Nutrition 0.000 title claims abstract description 124
- 235000007164 Oryza sativa Nutrition 0.000 title claims abstract description 94
- 235000013312 flour Nutrition 0.000 title claims abstract description 94
- 235000009566 rice Nutrition 0.000 title claims abstract description 94
- 235000013399 edible fruits Nutrition 0.000 title claims abstract description 60
- 240000007594 Oryza sativa Species 0.000 title claims description 89
- 238000004519 manufacturing process Methods 0.000 title abstract description 14
- 235000000346 sugar Nutrition 0.000 claims abstract description 18
- 239000000843 powder Substances 0.000 claims abstract description 17
- 238000000034 method Methods 0.000 claims abstract description 12
- 235000013336 milk Nutrition 0.000 claims abstract description 10
- 239000008267 milk Substances 0.000 claims abstract description 10
- 210000004080 milk Anatomy 0.000 claims abstract description 10
- 150000003839 salts Chemical class 0.000 claims abstract description 8
- 235000006040 Prunus persica var persica Nutrition 0.000 claims description 43
- 235000003095 Vaccinium corymbosum Nutrition 0.000 claims description 34
- 235000017537 Vaccinium myrtillus Nutrition 0.000 claims description 34
- 235000021014 blueberries Nutrition 0.000 claims description 34
- 240000000851 Vaccinium corymbosum Species 0.000 claims description 21
- 244000144730 Amygdalus persica Species 0.000 claims description 18
- 239000000463 material Substances 0.000 claims description 9
- 239000006071 cream Substances 0.000 claims description 8
- 235000013601 eggs Nutrition 0.000 claims description 7
- 235000002639 sodium chloride Nutrition 0.000 claims description 7
- 238000004898 kneading Methods 0.000 claims description 6
- -1 preserves Chemical class 0.000 claims description 3
- 235000013599 spices Nutrition 0.000 claims description 2
- 239000003205 fragrance Substances 0.000 abstract description 3
- 241000209094 Oryza Species 0.000 abstract 5
- 239000000796 flavoring agent Substances 0.000 description 47
- 235000019634 flavors Nutrition 0.000 description 47
- 235000011511 Diospyros Nutrition 0.000 description 29
- 235000019640 taste Nutrition 0.000 description 27
- 244000236655 Diospyros kaki Species 0.000 description 26
- 240000005809 Prunus persica Species 0.000 description 25
- 244000077233 Vaccinium uliginosum Species 0.000 description 13
- 238000002474 experimental method Methods 0.000 description 13
- 230000000704 physical effect Effects 0.000 description 12
- 230000001953 sensory effect Effects 0.000 description 12
- 238000011156 evaluation Methods 0.000 description 8
- 230000001965 increasing effect Effects 0.000 description 8
- 235000014571 nuts Nutrition 0.000 description 8
- 108010068370 Glutens Proteins 0.000 description 7
- 235000021312 gluten Nutrition 0.000 description 7
- 241000628997 Flos Species 0.000 description 5
- 230000001055 chewing effect Effects 0.000 description 5
- 230000003247 decreasing effect Effects 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 3
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 3
- 235000009508 confectionery Nutrition 0.000 description 3
- 230000006866 deterioration Effects 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 230000037406 food intake Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 235000019605 sweet taste sensations Nutrition 0.000 description 3
- 241000723267 Diospyros Species 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 235000019658 bitter taste Nutrition 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- 235000021185 dessert Nutrition 0.000 description 2
- 230000029087 digestion Effects 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 230000002522 swelling effect Effects 0.000 description 2
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- HHCLNZBCCQDVOQ-UHFFFAOYSA-N 1-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]pyrazol-3-yl]methyl]piperazin-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(N1CC2=C(CC1)NN=N2)=O)CN1C(CNCC1)=O HHCLNZBCCQDVOQ-UHFFFAOYSA-N 0.000 description 1
- ZYPDJSJJXZWZJJ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-piperidin-4-yloxypyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)OC1CCNCC1 ZYPDJSJJXZWZJJ-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 244000226021 Anacardium occidentale Species 0.000 description 1
- 240000003291 Armoracia rusticana Species 0.000 description 1
- 235000011330 Armoracia rusticana Nutrition 0.000 description 1
- 235000017166 Bambusa arundinacea Nutrition 0.000 description 1
- 235000017491 Bambusa tulda Nutrition 0.000 description 1
- 244000055850 Diospyros virginiana Species 0.000 description 1
- 241000758791 Juglandaceae Species 0.000 description 1
- 244000082204 Phyllostachys viridis Species 0.000 description 1
- 235000015334 Phyllostachys viridis Nutrition 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 235000019789 appetite Nutrition 0.000 description 1
- 235000015173 baked goods and baking mixes Nutrition 0.000 description 1
- 239000011425 bamboo Substances 0.000 description 1
- 235000021152 breakfast Nutrition 0.000 description 1
- 235000021329 brown rice Nutrition 0.000 description 1
- 235000020226 cashew nut Nutrition 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 230000001079 digestive effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 238000003958 fumigation Methods 0.000 description 1
- 239000008169 grapeseed oil Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 235000011157 hong shi Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 235000021577 malt beverage Nutrition 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000014594 pastries Nutrition 0.000 description 1
- 235000013944 peach juice Nutrition 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 235000019614 sour taste Nutrition 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 235000018553 tannin Nutrition 0.000 description 1
- 229920001864 tannin Polymers 0.000 description 1
- 239000001648 tannin Substances 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 239000008256 whipped cream Substances 0.000 description 1
- 230000037303 wrinkles Effects 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A21—BAKING; EDIBLE DOUGHS
- A21D—TREATMENT OF FLOUR OR DOUGH FOR BAKING, e.g. BY ADDITION OF MATERIALS; BAKING; BAKERY PRODUCTS
- A21D13/00—Finished or partly finished bakery products
- A21D13/40—Products characterised by the type, form or use
- A21D13/45—Wafers
-
- A—HUMAN NECESSITIES
- A21—BAKING; EDIBLE DOUGHS
- A21D—TREATMENT OF FLOUR OR DOUGH FOR BAKING, e.g. BY ADDITION OF MATERIALS; BAKING; BAKERY PRODUCTS
- A21D13/00—Finished or partly finished bakery products
- A21D13/04—Products made from materials other than rye or wheat flour
- A21D13/047—Products made from materials other than rye or wheat flour from cereals other than rye or wheat, e.g. rice
-
- A—HUMAN NECESSITIES
- A21—BAKING; EDIBLE DOUGHS
- A21D—TREATMENT OF FLOUR OR DOUGH FOR BAKING, e.g. BY ADDITION OF MATERIALS; BAKING; BAKERY PRODUCTS
- A21D13/00—Finished or partly finished bakery products
- A21D13/20—Partially or completely coated products
- A21D13/24—Partially or completely coated products coated after baking
-
- A—HUMAN NECESSITIES
- A21—BAKING; EDIBLE DOUGHS
- A21D—TREATMENT OF FLOUR OR DOUGH FOR BAKING, e.g. BY ADDITION OF MATERIALS; BAKING; BAKERY PRODUCTS
- A21D2/00—Treatment of flour or dough by adding materials thereto before or during baking
- A21D2/08—Treatment of flour or dough by adding materials thereto before or during baking by adding organic substances
- A21D2/36—Vegetable material
- A21D2/364—Nuts, e.g. cocoa
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Bakery Products And Manufacturing Methods Therefor (AREA)
Abstract
Description
도 2는 본 발명의 실시 예에 따른 쌀가루 감 와플의 사진.
도 3은 본 발명의 실시 예에 따른 쌀가루 복숭아 와플의 사진.
도 4는 본 발명의 실시 예에 따른 쌀가루 블루베리 와플의 사진.
구 분 | 재료명 | 함량 |
반죽 |
강력 쌀가루 | 120~140 중량부 |
박력 쌀가루 | 60~80 중량부 | |
과실 | 100~250 중량부 | |
우유 | 0~100 중량부 | |
베이킹 파우더 | 1~5 중량부 | |
설탕 | 20~30 중량부 | |
소금 | 1~5 중량부 | |
계란 | 50~150 중량부 | |
유지 | 40~50 중량부 | |
향료 | 1~8 중량부 | |
견과류 | 40~50 중량부 | |
토핑 |
생크림 | 100~130 중량부 |
슈가 파우더 | 50~70 중량부 | |
과실 | 60~100 중량부 |
구 분 | 강력쌀가루 | 박력쌀가루 | 탄력성 | 씹음성 | 응집성 | 강도 | 깨짐성 |
실험예1 | 200g | - | 9 | 9 | 9 | 9 | 1 |
실험예2 | 180g | 20g | 8 | 8 | 8 | 8 | 2 |
실험예3 | 160g | 40g | 7 | 7 | 7 | 7 | 3 |
실험예4 | 140g | 60g | 6 | 6 | 6 | 6 | 4 |
실험예5 | 120g | 80g | 6 | 6 | 6 | 6 | 4 |
실험예6 | 100g | 100g | 5 | 5 | 5 | 5 | 5 |
실험예7 | 80g | 120g | 4 | 4 | 4 | 4 | 6 |
실험예8 | 60g | 140g | 4 | 4 | 4 | 4 | 6 |
실험예9 | 40g | 160g | 3 | 3 | 3 | 3 | 7 |
실험예10 | 20g | 180g | 2 | 2 | 2 | 2 | 8 |
실험예11 | - | 200g | 1 | 1 | 1 | 1 | 9 |
구 분 | 강력쌀가루 | 박력쌀가루 | 탄력성 | 씹음성 | 응집성 | 강도 | 깨짐성 |
실험예12 | 200g | - | 9 | 9 | 9 | 9 | 1 |
실험예13 | 180g | 20g | 8 | 8 | 8 | 8 | 2 |
실험예14 | 160g | 40g | 7 | 7 | 7 | 7 | 3 |
실험예15 | 140g | 60g | 6 | 6 | 6 | 6 | 4 |
실험예16 | 120g | 80g | 6 | 6 | 6 | 6 | 4 |
실험예17 | 100g | 100g | 5 | 5 | 5 | 5 | 5 |
실험예18 | 80g | 120g | 4 | 4 | 4 | 4 | 6 |
실험예19 | 60g | 140g | 4 | 4 | 4 | 4 | 6 |
실험예20 | 40g | 160g | 3 | 3 | 3 | 3 | 7 |
실험예21 | 20g | 180g | 2 | 2 | 2 | 2 | 8 |
실험예22 | - | 200g | 1 | 1 | 1 | 1 | 9 |
구 분 | 강력쌀가루 | 박력쌀가루 | 탄력성 | 씹음성 | 응집성 | 강도 | 깨짐성 |
실험예23 | 200g | - | 9 | 9 | 9 | 9 | 1 |
실험예24 | 180g | 20g | 8 | 8 | 8 | 8 | 2 |
실험예25 | 160g | 40g | 7 | 7 | 7 | 7 | 3 |
실험예26 | 140g | 60g | 6 | 6 | 6 | 6 | 4 |
실험예27 | 120g | 80g | 6 | 6 | 6 | 6 | 4 |
실험예28 | 100g | 100g | 5 | 5 | 5 | 5 | 5 |
실험예29 | 80g | 120g | 4 | 4 | 4 | 4 | 6 |
실험예30 | 60g | 140g | 4 | 4 | 4 | 4 | 6 |
실험예31 | 40g | 160g | 3 | 3 | 3 | 3 | 7 |
실험예32 | 20g | 180g | 2 | 2 | 2 | 2 | 8 |
실험예33 | - | 200g | 1 | 1 | 1 | 1 | 9 |
구 분 | 외관 | 색 | 향 | 맛 | 질감 | 1일차기호도 | 2일차기호도 |
실험예1 | 9 | 1 | 구수한향 | 홍시맛 | 9 | 5 | 3 |
실험예2 | 9 | 2 | 구수한향 | 홍시맛 | 8 | 5 | 3 |
실험예3 | 9 | 3 | 구수한향 | 홍시맛 | 7 | 5 | 3 |
실험예4 | 9 | 4 | 구수한향 | 홍시맛 | 6 | 8 | 8 |
실험예5 | 9 | 4 | 구수한향 | 홍시맛 | 6 | 9 | 9 |
실험예6 | 9 | 5 | 구수한향 | 홍시맛 | 5 | 8 | 8 |
실험예7 | 9 | 6 | 구수한향 | 홍시맛 | 4 | 8 | 5 |
실험예8 | 9 | 6 | 구수한향 | 홍시맛 | 4 | 8 | 5 |
실험예9 | 9 | 7 | 구수한향 | 홍시맛 | 3 | 8 | 5 |
실험예10 | 9 | 8 | 구수한향 | 홍시맛 | 2 | 8 | 5 |
실험예11 | 9 | 9 | 구수한향 | 홍시맛 | 1 | 9 | 5 |
구 분 | 외관 | 색 | 향 | 맛 | 질감 | 1일차기호도 | 2일차기호도 |
실험예12 | 9 | 1 | 복숭아향 | 복숭아맛 | 9 | 5 | 3 |
실험예13 | 9 | 2 | 복숭아향 | 복숭아맛 | 8 | 5 | 3 |
실험예14 | 9 | 3 | 복숭아향 | 복숭아맛 | 7 | 5 | 3 |
실험예15 | 9 | 4 | 복숭아향 | 복숭아맛 | 6 | 8 | 8 |
실험예16 | 9 | 4 | 복숭아향 | 복숭아맛 | 6 | 9 | 9 |
실험예17 | 9 | 5 | 복숭아향 | 복숭아맛 | 5 | 8 | 5 |
실험예18 | 9 | 6 | 복숭아향 | 복숭아맛 | 4 | 8 | 5 |
실험예19 | 9 | 6 | 복숭아향 | 복숭아맛 | 4 | 8 | 5 |
실험예20 | 9 | 7 | 복숭아향 | 복숭아맛 | 3 | 8 | 5 |
실험예21 | 9 | 8 | 복숭아향 | 복숭아맛 | 2 | 8 | 5 |
실험예22 | 9 | 9 | 복숭아향 | 복숭아맛 | 1 | 9 | 5 |
구 분 | 외관 | 색 | 향 | 맛 | 질감 | 1일차기호도 | 2일차기호도 |
실험예23 | 9 | 2 | 구수한향 | 블루베리맛 | 9 | 5 | 3 |
실험예24 | 9 | 2 | 구수한향 | 블루베리맛 | 8 | 5 | 3 |
실험예25 | 9 | 2 | 구수한향 | 블루베리맛 | 7 | 5 | 3 |
실험예26 | 9 | 2 | 구수한향 | 블루베리맛 | 6 | 8 | 8 |
실험예27 | 9 | 2 | 구수한향 | 블루베리맛 | 6 | 9 | 9 |
실험예28 | 9 | 2 | 구수한향 | 블루베리맛 | 5 | 8 | 5 |
실험예29 | 9 | 2 | 구수한향 | 블루베리맛 | 4 | 8 | 5 |
실험예30 | 9 | 2 | 구수한향 | 블루베리맛 | 4 | 8 | 5 |
실험예31 | 9 | 2 | 구수한향 | 블루베리맛 | 3 | 8 | 5 |
실험예32 | 9 | 2 | 구수한향 | 블루베리맛 | 2 | 8 | 5 |
실험예33 | 9 | 2 | 구수한향 | 블루베리맛 | 1 | 9 | 5 |
Claims (6)
- 삭제
- 삭제
- 삭제
- 강력 쌀가루, 박력 쌀가루, 과실, 우유, 베이킹 파우더, 설탕, 소금, 계란, 유지, 향료, 견과류를 포함하는 반죽 재료를 준비하는 단계(S1);
상기 S1에서 준비된 강력 쌀가루 120~140중량부와 박력 쌀가루 60~80중량부를 혼합한 후, 설탕 20~30중량부, 소금 1~5중량부, 계란 50~150중량부, 우유 0~100중량부, 베이킹파우더 1~5중량부를 첨가하고, 22℃~26℃에서 3분~5분동안 1차 반죽하여 상기 반죽 재료들이 절반가량 뭉치는 픽업단계에서 즉시 반죽을 중단하고, 유지를 40~50중량부 첨가한 후에 3분~5분 동안 2차 반죽하는 기본 반죽 제조단계(S2);
상기 S2에서 제조된 기본 반죽에 S1에서 준비된 과실과 견과류를 첨가하여 골고루 혼합되도록 3차 반죽하는 과실 첨가 단계(S3);
상기 S3에서 과실과 견과류가 첨가된 반죽 40~80g을 와플기에 넣고 4분~5분정도 굽는 단계(S4)를 포함하여 이루어지는 것을 특징으로 하는 쌀가루를 이용한 과실 와플의 제조 방법. - 제 4항에 있어서,
상기 과실은 홍시, 감말랭이, 복숭아, 블루베리 중 어느 하나 이상을 선택하여 적용하는 것을 특징으로 하는 쌀가루를 이용한 과실 와플의 제조 방법. - 제 4항에 있어서,
상기 S1에서 생크림, 슈가파우더, 과실을 포함하는 토핑 재료를 추가로 준비한 후;
상기 S4에서 구워진 와플에 생크림 100~130중량부를 바르고, 50~70중량부의 슈가파우더와 준비된 과실 60~100중량부를 토핑하는 단계(S5)를 더 포함하여 이루어지는 것을 특징으로 하는 쌀가루를 이용한 과실 와플의 제조 방법.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020160168342A KR101944314B1 (ko) | 2016-12-12 | 2016-12-12 | 쌀가루를 이용한 과실 와플 및 이의 제조방법 |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020160168342A KR101944314B1 (ko) | 2016-12-12 | 2016-12-12 | 쌀가루를 이용한 과실 와플 및 이의 제조방법 |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20180067048A KR20180067048A (ko) | 2018-06-20 |
KR101944314B1 true KR101944314B1 (ko) | 2019-01-31 |
Family
ID=62769998
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020160168342A Active KR101944314B1 (ko) | 2016-12-12 | 2016-12-12 | 쌀가루를 이용한 과실 와플 및 이의 제조방법 |
Country Status (1)
Country | Link |
---|---|
KR (1) | KR101944314B1 (ko) |
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR20220042525A (ko) | 2020-09-28 | 2022-04-05 | 이명호 | 벌집구조를 갖는 원통형 와플롤 제조장치 및 그 제조방법 |
KR20240002736A (ko) | 2022-06-30 | 2024-01-08 | 우석대학교 산학협력단 | 곡물을 이용한 기능성 와플 및 그의 제조 방법 |
Families Citing this family (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR102701969B1 (ko) * | 2021-12-24 | 2024-09-05 | 경상남도 | 단감 쌀 케이크 및 이의 제조방법 |
Citations (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR101626340B1 (ko) * | 2014-05-28 | 2016-06-02 | 공주대학교 산학협력단 | 와플 제조용 쌀가루 반죽조성물 및 이를 이용한 와플의 제조방법 |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR20110103017A (ko) * | 2010-03-12 | 2011-09-20 | 배화여자대학 산학협력단 | 찰보리를 첨가한 찹쌀와플 및 그 제조방법 |
-
2016
- 2016-12-12 KR KR1020160168342A patent/KR101944314B1/ko active Active
Patent Citations (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR101626340B1 (ko) * | 2014-05-28 | 2016-06-02 | 공주대학교 산학협력단 | 와플 제조용 쌀가루 반죽조성물 및 이를 이용한 와플의 제조방법 |
Non-Patent Citations (1)
Title |
---|
강화도까페!! 분위기 좋고 직접볶은 커피도 맛있는 로뎀트리, 네이버 블로그(2014.12.04), 인터넷(URL:https://blog.naver.com/ujink96/220200242599)* |
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR20220042525A (ko) | 2020-09-28 | 2022-04-05 | 이명호 | 벌집구조를 갖는 원통형 와플롤 제조장치 및 그 제조방법 |
KR20240002736A (ko) | 2022-06-30 | 2024-01-08 | 우석대학교 산학협력단 | 곡물을 이용한 기능성 와플 및 그의 제조 방법 |
Also Published As
Publication number | Publication date |
---|---|
KR20180067048A (ko) | 2018-06-20 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR101944314B1 (ko) | 쌀가루를 이용한 과실 와플 및 이의 제조방법 | |
KR20200145141A (ko) | 빵 제조방법 및 그 방법에 의해 제조된 빵 | |
KR101094761B1 (ko) | 쌀호떡 제조방법 | |
KR20170132926A (ko) | 쑥부쟁이분말을 함유하는 쑥부쟁이 쿠키 제조방법 및 상기 방법으로 제조한 쑥부쟁이 쿠키 | |
KR102384686B1 (ko) | 약과 쿠키 및 그 제조방법 | |
KR102364270B1 (ko) | 볼형 구운 단감유과 | |
KR100560176B1 (ko) | 시리얼 바의 제조 방법 및 이에 의해 제조된 시리얼 바 | |
CN108013102A (zh) | 一种苹果馅酥性点心及其制备方法 | |
KR100451057B1 (ko) | 찰보리빵 및 그 제조방법 | |
US20210235718A1 (en) | Laver fried snack in three-dimensional shape and preparation method therefor | |
KR101903851B1 (ko) | 한과도넛의 제조방법 | |
KR102481803B1 (ko) | 옥수수 식빵의 제조방법 및 이에 따라 제조된 옥수수 식빵 | |
CN104757042A (zh) | 一种苦荞蛋糕预拌粉、苦荞蛋糕及其制备方法 | |
KR102517264B1 (ko) | 초코파이 및 그 제조방법 | |
KR101753853B1 (ko) | 구운 떡 빵 및 그 제조방법 | |
JP3707058B1 (ja) | ビルベリーピューレによる小麦粉加工食品の着色方法 | |
KR102080326B1 (ko) | 오디 누룽지 과자의 제조방법 및 상기 방법으로 제조된 오디 누룽지 과자 | |
KR20220108688A (ko) | 쑥 페스트리의 제조방법 | |
KR20180045190A (ko) | 발아귀리를 이용한 과일떡의 제조 방법 및 이에 의해 제조되는 과일떡 | |
CN111742957A (zh) | 一种无麸质苦荞黑米胚芽曲奇饼干及其制备方法 | |
CN113040198A (zh) | 一种红豆麻薯饼及其制备方法 | |
KR20210015004A (ko) | 다양한 종류의 필링을 사용한 한과의 제조 방법 | |
JP2021097621A (ja) | ベーカリー用上掛け生地 | |
KR20190114159A (ko) | 꽃게과자 및 그 제조방법 | |
KR20150112323A (ko) | 올벼 쌀 씨리얼 과자 제조방법 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
A201 | Request for examination | ||
PA0109 | Patent application |
Patent event code: PA01091R01D Comment text: Patent Application Patent event date: 20161212 |
|
PA0201 | Request for examination | ||
E902 | Notification of reason for refusal | ||
PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20180504 Patent event code: PE09021S01D |
|
PG1501 | Laying open of application | ||
E701 | Decision to grant or registration of patent right | ||
PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 20181123 |
|
PR0701 | Registration of establishment |
Comment text: Registration of Establishment Patent event date: 20190125 Patent event code: PR07011E01D |
|
PR1002 | Payment of registration fee |
Payment date: 20190125 End annual number: 3 Start annual number: 1 |
|
PG1601 | Publication of registration | ||
PR1001 | Payment of annual fee |
Payment date: 20211115 Start annual number: 4 End annual number: 4 |
|
PR1001 | Payment of annual fee |
Payment date: 20221117 Start annual number: 5 End annual number: 5 |
|
PR1001 | Payment of annual fee |
Payment date: 20231115 Start annual number: 6 End annual number: 6 |