JPS6314006B2 - - Google Patents
Info
- Publication number
- JPS6314006B2 JPS6314006B2 JP51135495A JP13549576A JPS6314006B2 JP S6314006 B2 JPS6314006 B2 JP S6314006B2 JP 51135495 A JP51135495 A JP 51135495A JP 13549576 A JP13549576 A JP 13549576A JP S6314006 B2 JPS6314006 B2 JP S6314006B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- polyurethane
- parts
- dispersion
- groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920002635 polyurethane Polymers 0.000 claims description 83
- 239000004814 polyurethane Substances 0.000 claims description 83
- 238000000034 method Methods 0.000 claims description 44
- 125000003010 ionic group Chemical group 0.000 claims description 34
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 33
- 150000002009 diols Chemical class 0.000 claims description 30
- 150000001875 compounds Chemical class 0.000 claims description 27
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 125000005442 diisocyanate group Chemical group 0.000 claims description 18
- 230000008569 process Effects 0.000 claims description 17
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 claims description 15
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 12
- 238000006386 neutralization reaction Methods 0.000 claims description 11
- 239000004970 Chain extender Substances 0.000 claims description 10
- 230000001588 bifunctional effect Effects 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 238000005956 quaternization reaction Methods 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical group C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 claims description 5
- 229920000233 poly(alkylene oxides) Polymers 0.000 claims description 5
- 239000000654 additive Substances 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 150000002430 hydrocarbons Chemical class 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 150000004985 diamines Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims 1
- 239000006185 dispersion Substances 0.000 description 98
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 47
- 239000007787 solid Substances 0.000 description 39
- 239000000203 mixture Substances 0.000 description 34
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 28
- 229920000570 polyether Polymers 0.000 description 26
- 239000004721 Polyphenylene oxide Substances 0.000 description 24
- 239000002245 particle Substances 0.000 description 23
- 238000003756 stirring Methods 0.000 description 22
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 19
- 239000000243 solution Substances 0.000 description 19
- 229920000728 polyester Polymers 0.000 description 18
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 16
- 229920003009 polyurethane dispersion Polymers 0.000 description 15
- 239000002904 solvent Substances 0.000 description 14
- 230000000052 comparative effect Effects 0.000 description 13
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 13
- 239000007858 starting material Substances 0.000 description 12
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 11
- 239000012948 isocyanate Substances 0.000 description 10
- 239000007788 liquid Substances 0.000 description 10
- OJGMJJSTLJEDHF-UHFFFAOYSA-N NCCOS(=O)(=O)CCN.[Na] Chemical compound NCCOS(=O)(=O)CCN.[Na] OJGMJJSTLJEDHF-UHFFFAOYSA-N 0.000 description 9
- 150000002513 isocyanates Chemical class 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- -1 ammonium ions Chemical class 0.000 description 8
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 description 8
- 229920003225 polyurethane elastomer Polymers 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- XLLIQLLCWZCATF-UHFFFAOYSA-N ethylene glycol monomethyl ether acetate Natural products COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 6
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 6
- 230000008901 benefit Effects 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- 239000012467 final product Substances 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000123 paper Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- 239000003365 glass fiber Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229920000554 ionomer Polymers 0.000 description 4
- 229920003226 polyurethane urea Polymers 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- ORTVZLZNOYNASJ-UPHRSURJSA-N (z)-but-2-ene-1,4-diol Chemical compound OC\C=C/CO ORTVZLZNOYNASJ-UPHRSURJSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- 239000001361 adipic acid Substances 0.000 description 3
- 235000011037 adipic acid Nutrition 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000010425 asbestos Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000000806 elastomer Substances 0.000 description 3
- 239000003792 electrolyte Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000010985 leather Substances 0.000 description 3
- 239000004745 nonwoven fabric Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 229910052895 riebeckite Inorganic materials 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KYIMHWNKQXQBDG-UHFFFAOYSA-N N=C=O.N=C=O.CCCCCC Chemical compound N=C=O.N=C=O.CCCCCC KYIMHWNKQXQBDG-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229910010293 ceramic material Inorganic materials 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000007710 freezing Methods 0.000 description 2
- 230000008014 freezing Effects 0.000 description 2
- 235000019589 hardness Nutrition 0.000 description 2
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000004922 lacquer Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 229920006324 polyoxymethylene Polymers 0.000 description 2
- 229920006295 polythiol Polymers 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- GFNDFCFPJQPVQL-UHFFFAOYSA-N 1,12-diisocyanatododecane Chemical compound O=C=NCCCCCCCCCCCCN=C=O GFNDFCFPJQPVQL-UHFFFAOYSA-N 0.000 description 1
- BJQAPWAEPRRBOZ-UHFFFAOYSA-N 1,4-diaminobutane-2-sulfonic acid Chemical compound NCCC(CN)S(O)(=O)=O BJQAPWAEPRRBOZ-UHFFFAOYSA-N 0.000 description 1
- OVBFMUAFNIIQAL-UHFFFAOYSA-N 1,4-diisocyanatobutane Chemical compound O=C=NCCCCN=C=O OVBFMUAFNIIQAL-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- NSMWYRLQHIXVAP-UHFFFAOYSA-N 2,5-dimethylpiperazine Chemical compound CC1CNC(C)CN1 NSMWYRLQHIXVAP-UHFFFAOYSA-N 0.000 description 1
- QWGRWMMWNDWRQN-UHFFFAOYSA-N 2-methylpropane-1,3-diol Chemical compound OCC(C)CO QWGRWMMWNDWRQN-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical class OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000003373 anti-fouling effect Effects 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 230000003542 behavioural effect Effects 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000012939 laminating adhesive Substances 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- HAERDWTUYGZBLH-UHFFFAOYSA-N n'-(3,3,5-trimethylcyclohexyl)methanediamine Chemical compound CC1CC(NCN)CC(C)(C)C1 HAERDWTUYGZBLH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- OEIJHBUUFURJLI-UHFFFAOYSA-N octane-1,8-diol Chemical compound OCCCCCCCCO OEIJHBUUFURJLI-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000011087 paperboard Substances 0.000 description 1
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical compound OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 description 1
- 238000010257 thawing Methods 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- 238000002604 ultrasonography Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000007762 w/o emulsion Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
- NHXVNEDMKGDNPR-UHFFFAOYSA-N zinc;pentane-2,4-dione Chemical compound [Zn+2].CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O NHXVNEDMKGDNPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/0804—Manufacture of polymers containing ionic or ionogenic groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/40—High-molecular-weight compounds
- C08G18/48—Polyethers
- C08G18/50—Polyethers having heteroatoms other than oxygen
- C08G18/5021—Polyethers having heteroatoms other than oxygen having nitrogen
- C08G18/5036—Polyethers having heteroatoms other than oxygen having nitrogen containing -N-C=O groups
- C08G18/5042—Polyethers having heteroatoms other than oxygen having nitrogen containing -N-C=O groups containing ureum groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S260/00—Chemistry of carbon compounds
- Y10S260/15—Antistatic agents not otherwise provided for
- Y10S260/17—High polymeric, resinous, antistatic agents
- Y10S260/18—High polymeric, resinous, antistatic agents containing pentavalent nitrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Polyurethanes Or Polyureas (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752551094 DE2551094A1 (de) | 1975-11-14 | 1975-11-14 | Verfahren zur herstellung von in wasser dispergierbaren polyurethanen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5262400A JPS5262400A (en) | 1977-05-23 |
| JPS6314006B2 true JPS6314006B2 (enFirst) | 1988-03-29 |
Family
ID=5961708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP51135495A Granted JPS5262400A (en) | 1975-11-14 | 1976-11-12 | Process for producing waterrdispersible polyurethane |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4092286A (enFirst) |
| JP (1) | JPS5262400A (enFirst) |
| AT (1) | AT350267B (enFirst) |
| AU (1) | AU504084B2 (enFirst) |
| BE (1) | BE848259A (enFirst) |
| BR (1) | BR7607539A (enFirst) |
| CH (1) | CH622813A5 (enFirst) |
| DE (1) | DE2551094A1 (enFirst) |
| ES (1) | ES453259A1 (enFirst) |
| FR (1) | FR2331581A1 (enFirst) |
| GB (1) | GB1503299A (enFirst) |
| IT (1) | IT1066657B (enFirst) |
| NL (1) | NL182647C (enFirst) |
| PL (1) | PL105479B1 (enFirst) |
| SE (1) | SE432599B (enFirst) |
Families Citing this family (114)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2651505A1 (de) * | 1976-11-11 | 1978-05-24 | Bayer Ag | Kationische elektrolytstabile dispersionen |
| DE2651506C2 (de) * | 1976-11-11 | 1986-04-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen |
| DE2659617A1 (de) * | 1976-12-30 | 1978-07-06 | Bayer Ag | Elektrolyte enthaltende ionomer- dispersionen |
| DE2730514A1 (de) * | 1977-07-06 | 1979-01-18 | Bayer Ag | Verfahren zur herstellung von in wasser loeslichen polyurethanen |
| CH636235B (de) * | 1977-09-06 | 1900-01-01 | Sandoz Ag | Verfahren zur herstellung von polyurethanen und deren verwendung in binderdispersionen zum verkleben von fasern in vliesstoffen. |
| JPS5468498A (en) * | 1977-11-08 | 1979-06-01 | Teijin Ltd | Leather like sheet article and production thereof |
| DE2807479A1 (de) * | 1978-02-22 | 1979-08-23 | Bayer Ag | Ueberzugsmittel |
| DE2816815A1 (de) | 1978-04-18 | 1979-10-31 | Bayer Ag | In wasser dispergierbare oder loesliche polyurethane, sowie ein verfahren zu ihrer herstellung |
| US4554308A (en) * | 1978-10-02 | 1985-11-19 | Wilmington Chemical Corporation | Crosslinked polyurethane dispersions |
| DE2900574A1 (de) * | 1979-01-09 | 1980-07-17 | Bayer Ag | Verwendung von wasserloeslichen elektrolyten als zusatzmittel in waessrigen kunststoffdispersionen und eine, einen wasserloeslichen elektrolyten enthaltende, waessrige kunststoffdispersion |
| US4280970A (en) * | 1979-01-19 | 1981-07-28 | Puropore Inc. | Polyoxyethylene grafted membrane materials with grafting links derived from a diisocyanate |
| DE3048085A1 (de) * | 1980-12-19 | 1982-07-22 | Bayer Ag, 5090 Leverkusen | Dispersionen von sulfonatgruppen aufweisenden polymeren, ein verfahren zu ihrer herstellung, sowie ihre verwendung als beschichtungsmittel |
| US4408008A (en) * | 1981-07-24 | 1983-10-04 | Mobay Chemical Corporation | Stable, colloidal, aqueous dispersions of cross-linked urea-urethane polymers and their method of production |
| DE3210051A1 (de) * | 1982-03-19 | 1983-09-29 | Basf Farben + Fasern Ag, 2000 Hamburg | Wasserverduennbares ueberzugsmittel zur herstellung der basisschicht eines mehrschichtueberzuges |
| DE3316550C2 (de) * | 1983-05-03 | 1985-07-25 | Chemulack Chemische- Und Lackfabrik Gmbh & Co Kg, 1000 Berlin | Verfahren zum Grundieren von Kunststoffen |
| US4501852A (en) * | 1983-06-20 | 1985-02-26 | Mobay Chemical Corporation | Stable, aqueous dispersions of polyurethane-ureas |
| DE3344693A1 (de) * | 1983-12-10 | 1985-06-20 | Bayer Ag, 5090 Leverkusen | Waessrige loesungen oder dispersionen von polyisocyanat-polyadditionsprodukten, ein verfahren zu ihrer herstellung, sowie ihre verwendung als bzw. zur herstellung von klebemittel |
| US4542065A (en) * | 1984-05-21 | 1985-09-17 | Ppg Industries, Inc. | Chemically treated glass fibers and strands and dispersed products thereof |
| US4567228A (en) * | 1984-05-21 | 1986-01-28 | Ppg Industries, Inc. | Aqueous dispersion, internally silylated and dispersed polyurethane resins, and surfaces containing same |
| US4582873A (en) * | 1984-05-21 | 1986-04-15 | Ppg Industries, Inc. | Process for producing aqueous dispersions, internally silylated and dispersed polyurethane resins, and surfaces containing same |
| NL8401784A (nl) * | 1984-06-04 | 1986-01-02 | Stahl Chemical Ind | Werkwijze voor het vervaardigen van een coagule. |
| US4742095A (en) * | 1985-07-25 | 1988-05-03 | Mobay Corporation | Continuous process for the production of aqueous polyurethane-urea dispersions |
| US4701480A (en) * | 1985-09-23 | 1987-10-20 | Mobay Corporation | Stable, aqueous dispersions of polyurethane-ureas |
| US4950423A (en) * | 1986-01-22 | 1990-08-21 | The B. F. Goodrich Company | Coating of EMI shielding and method therefor |
| CA1304869C (en) * | 1986-10-21 | 1992-07-07 | Peter H. Markusch | Continuous process for the production of aqueous polyurethane-urea dispersions |
| DE3641494A1 (de) * | 1986-12-04 | 1988-06-09 | Bayer Ag | In wasser loesliche oder dispergierbare poylurethane, ein verfahren zu ihrer herstellung und ihre verwendung zur beschichtung beliebiger substrate |
| US4826894A (en) * | 1987-05-19 | 1989-05-02 | Mobay Corporation | Aqueous polyurethane-ureas dispersions and their use for the production of coatings having improved humidity resistance |
| GB2209758B (en) * | 1987-09-14 | 1990-12-12 | Ici America Inc | Aqueous dispersions |
| US5104737A (en) * | 1988-12-30 | 1992-04-14 | The Sherwin-Williams Company | Water-dispersable air-drying coatings |
| US5039732A (en) * | 1988-12-30 | 1991-08-13 | The Sherwin-Williams Company | Water-dispersable air-drying coatings |
| US4912154A (en) * | 1988-12-30 | 1990-03-27 | The Sherwin-Williams Company | Water-dispersible air-drying coatings containing 2-oxazoline groups |
| US4956438A (en) * | 1989-02-08 | 1990-09-11 | The Dow Chemical Company | Bulk polyurethane ionomers |
| DE3922493A1 (de) * | 1989-07-08 | 1991-01-17 | Bayer Ag | Verfahren zur herstellung von waessrigen dispersionen von polyurethanen und ihre verwendung als beschichtungsmittel fuer beliebige substrate |
| US5137967A (en) * | 1990-07-06 | 1992-08-11 | Reichhold Chemicals, Inc. | Hydrazine extended aqueous polyurethane |
| EP0552420A3 (en) * | 1992-01-24 | 1993-09-15 | H.B. Fuller Licensing & Financing, Inc. | Water dispersed polyurethane polymer for improved coatings and adhesives |
| US5358997A (en) * | 1992-05-07 | 1994-10-25 | Miles Inc. | Reactive aqueous polyurea dispersions prepared by an emulsion polymerization process |
| US5770264A (en) * | 1992-07-31 | 1998-06-23 | Bayer Aktiengesellschaft | Anionically modified polyurethane ureas having reduced tackiness for the coating of leather |
| US5747582A (en) * | 1992-10-29 | 1998-05-05 | Bayer Aktiengesellschaft | Aqueous coating compositions and their use for the preparation of coatings that are permeable to water vapor |
| US5610224A (en) * | 1992-10-30 | 1997-03-11 | Basf Corporation | Water dispersible ionic and nonionic polyamide modified polyurethane resins for use in coating composition |
| US5703158A (en) * | 1993-09-24 | 1997-12-30 | H.B. Fuller Licensing & Financing, Inc. | Aqueous anionic poly (urethane/urea) dispersions |
| US5608000A (en) * | 1993-09-24 | 1997-03-04 | H. B. Fuller Licensing & Financing, Inc. | Aqueous polyurethane dispersion adhesive compositions with improved heat resistance |
| US5610232A (en) * | 1993-09-24 | 1997-03-11 | H.B. Fuller Licensing & Financing, Inc. | Aqueous non-gelling, anionic polyurethane dispersions and process for their manufacture |
| US5763529A (en) * | 1994-03-31 | 1998-06-09 | Cytec Technology Corp. | Interpenetrating polymer network compositions |
| US5872182A (en) * | 1994-09-09 | 1999-02-16 | H. B. Fuller Licensing & Financing, Inc. | Water-based polyurethanes for footwear |
| US5569706A (en) * | 1995-06-02 | 1996-10-29 | Bayer Corporation | Aqueous polyurea dispersions with improved hardness and solvent resistance |
| US6084001A (en) | 1996-04-25 | 2000-07-04 | Lockheed Martin Corporation | High build polyurethane coating |
| US5652301A (en) * | 1996-08-20 | 1997-07-29 | Bayer Corporation | Aqueous polyurea dispersions and their use for preparing coatings with excellent hydrolytic and thermal stability |
| US5733967A (en) * | 1996-08-20 | 1998-03-31 | Bayer Corporation | Aqueous polyurethane dispersions and their use for preparing coatings with excellent hydrolytic and thermal stability |
| US5714561A (en) * | 1996-09-23 | 1998-02-03 | Uniroyal Chemical Company, Inc. | Water-dispersable polyurethanes |
| US5747630A (en) * | 1997-03-13 | 1998-05-05 | Morton International, Inc. | Polyurethane binder for a magnetic recording medium |
| ZA981836B (en) * | 1997-03-17 | 1999-09-06 | Dow Chemical Co | Continuous process for preparing a polyurethane latex. |
| US20020197443A1 (en) * | 1997-03-17 | 2002-12-26 | Schrock Alan K. | Process for preparing carpets having polyurethane backings obtained from polyurethane latex formulations |
| US5932652A (en) * | 1997-12-17 | 1999-08-03 | Bayer Corporation | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| US5919860A (en) * | 1997-12-17 | 1999-07-06 | Bayer Corporation | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| US5968494A (en) * | 1998-02-24 | 1999-10-19 | National Starch And Chemical Investment Holding Corporation | Polyurethanes with carboxylate functionality for hair fixative applications |
| US6743844B1 (en) | 1998-08-17 | 2004-06-01 | Dow Global Technologies Inc. | Spill resistant carpet backing |
| WO2000037525A1 (en) | 1998-12-18 | 2000-06-29 | The Dow Chemical Company | Aqueous polyurethane dispersions useful for preparing polymers with improved moisture resistance properties |
| ATE236941T1 (de) | 1998-12-29 | 2003-04-15 | Dow Global Technologies Inc | Polyurethanschäume hergestellt aus mechanisch aufgeschaumten polyurethandispersionen |
| US6077901A (en) * | 1999-05-06 | 2000-06-20 | Bayer Corporation | Aqueous compositions containing mixtures of silane-functional resins |
| US6147155A (en) * | 1999-06-08 | 2000-11-14 | Bayer Corporation | Aqueous polyurethane dispersions containing non-cyclic diisocyanates and a process for their preparation |
| US6518348B1 (en) | 1999-12-14 | 2003-02-11 | Dow Global Technologies Inc. | Carpet backing compounds thickened by hydrophobically-modified ethylene-oxide-based urethane block copolymers |
| US6455631B1 (en) | 2000-12-01 | 2002-09-24 | Bayer Corporation | Aqueous polyurethane dispersions containing modified hydrazide groups and their use in one-component thermoset compositions |
| DE10122444A1 (de) * | 2001-05-09 | 2002-11-14 | Bayer Ag | Polyurethan-Polyharnstoff Dispersionen als Beschichtungsmittel |
| US7253228B2 (en) * | 2002-03-28 | 2007-08-07 | Dainippon Ink And Chemicals, Inc. | Method for producing polyurethane emulsion |
| US6897281B2 (en) * | 2002-04-05 | 2005-05-24 | Noveon Ip Holdings Corp. | Breathable polyurethanes, blends, and articles |
| US7358295B2 (en) * | 2002-04-05 | 2008-04-15 | Lubrizol Advanced Materials, Inc. | Hybrid polymer composition, and article therefrom |
| CN100526358C (zh) * | 2002-05-24 | 2009-08-12 | 克鲁普顿公司 | 聚氨酯分散体 |
| US20050209428A1 (en) * | 2002-06-19 | 2005-09-22 | Krishnan Tamareselvy | Breathable polyurethanes, blends, and articles |
| DE10238146A1 (de) * | 2002-08-15 | 2004-02-26 | Basf Ag | Wasseremulgierbare Isocyanate mit verbesserten Eigenschaften |
| US20040116594A1 (en) * | 2002-12-11 | 2004-06-17 | Debkumar Bhattacharjee | Polyurethane prepolymer, stable aqueous dispersions with high solids containing the same and method of using and preparing the aqueous dispersions |
| US7066801B2 (en) * | 2003-02-21 | 2006-06-27 | Dow Global Technologies, Inc. | Method of manufacturing a fixed abrasive material |
| US6910951B2 (en) | 2003-02-24 | 2005-06-28 | Dow Global Technologies, Inc. | Materials and methods for chemical-mechanical planarization |
| DE10315175A1 (de) | 2003-04-03 | 2004-10-14 | Degussa Construction Chemicals Gmbh | Elektrosterisch stabilisierte wässrige Polyurethan-Harze, Verfahren zu ihrer Herstellung und deren Verwendung |
| DE10322266A1 (de) † | 2003-05-16 | 2004-12-02 | Basf Ag | Selbstemulgierende wäßrige Polyurethandispersion |
| AU2004251165A1 (en) * | 2003-06-13 | 2005-01-06 | Dow Global Technologies Inc | High performance polyurethane carpet backings containing modified vegetable oil polyols |
| CA2534285C (en) * | 2003-08-06 | 2010-10-12 | The Procter & Gamble Company | Coated water-swellable material |
| US7049000B2 (en) | 2003-08-06 | 2006-05-23 | The Procter & Gamble Company | Water-swellable material comprising coated water-swellable polymers |
| CA2534647A1 (en) * | 2003-08-06 | 2005-02-17 | The Procter & Gamble Company | Absorbent article comprising coated water-swellable material |
| EP1518567B1 (en) * | 2003-09-25 | 2017-06-28 | The Procter & Gamble Company | Absorbent articles comprising fluid acquisition zones with coated superabsorbent particles |
| US7238745B2 (en) * | 2003-12-15 | 2007-07-03 | Bayer Materialscience Llc | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| DE102004002525A1 (de) * | 2004-01-16 | 2005-08-04 | Bayer Materialscience Ag | Beschichtungsmittelzusammensetzung |
| DE102004026118A1 (de) * | 2004-05-28 | 2005-12-15 | Bayer Materialscience Ag | Klebstoffe |
| US20050287349A1 (en) * | 2004-06-23 | 2005-12-29 | Yu Poli C | Method for coating coils |
| TWI415637B (zh) * | 2005-02-04 | 2013-11-21 | Basf Ag | 具有彈性成膜聚合物塗層之吸水材料 |
| CN101133100A (zh) * | 2005-02-04 | 2008-02-27 | 巴斯福股份公司 | 水溶胀性材料 |
| DE602006015422D1 (de) * | 2005-02-04 | 2010-08-26 | Basf Se | Verfahren zur herstellung eines wasserabsorbierenden materials mit einem überzug aus elastischen filmbildenden polymeren |
| CN101115509A (zh) * | 2005-02-04 | 2008-01-30 | 宝洁公司 | 具有改进的吸水材料的吸收结构 |
| EP1843797B1 (en) * | 2005-02-04 | 2014-01-22 | The Procter and Gamble Company | Absorbent structure with improved water-absorbing material |
| WO2006097389A2 (en) * | 2005-02-04 | 2006-09-21 | Basf Aktiengesellschaft | A process for producing a water-absorbing material having a coating of elastic filmforming polymers |
| WO2006083583A2 (en) * | 2005-02-04 | 2006-08-10 | The Procter & Gamble Company | Absorbent structure with improved water-swellable material |
| DE102006036220A1 (de) | 2006-08-03 | 2008-02-07 | Clariant International Limited | Polyetheramin-Makromonomere mit zwei benachbarten Hydroxylgruppen und ihre Verwendung zur Herstellung von Polyurethanen |
| US20080081160A1 (en) * | 2006-09-28 | 2008-04-03 | Lubrizol Advanced Materials, Inc. | Ink Receptive Coatings For Woven and Nonwoven Substrates |
| US20100184886A1 (en) * | 2007-07-12 | 2010-07-22 | Huiguang Kou | Nitrocellulose based dispersant |
| DE102008038899A1 (de) | 2008-08-13 | 2010-02-18 | Bayer Materialscience Ag | Dispersionsklebstoffe (II) |
| CL2008003124A1 (es) | 2007-11-07 | 2009-11-27 | Bayer Materialscience Ag | Dispersiones acuosas de poliuretano-urea acuosa de; poliol(es) difuncional (es) o funcionalidad superior, compuestos(s) monofuncional (es) con la menos 50% p/p de óxido de etileno, componente(s)di o poliiocianato; y mezcla de compuestos monoamina primarios y/o secundarios; procedimiento; uso; composición; y compuesto adhesivo. |
| EP2271685B1 (en) * | 2007-12-26 | 2018-01-03 | Dow Global Technologies LLC | Polyurethane dispersions and coatings produced therefrom |
| US8617662B2 (en) * | 2008-06-05 | 2013-12-31 | Lande Braid Industry (Wenzhou) Co., LTD. | Textile blind slat |
| EP2244489A1 (de) | 2009-04-24 | 2010-10-27 | Bayer MaterialScience AG | Verfahren zur Herstellung eines elektromechanischen Wandlers |
| EP2284919A1 (de) | 2009-08-07 | 2011-02-16 | Bayer MaterialScience AG | Verfahren zur Herstellung eines elektromechanischen Wandlers |
| US20110045219A1 (en) * | 2009-08-18 | 2011-02-24 | Bayer Materialscience Llc | Coating compositions for glass substrates |
| EP2319876A1 (de) * | 2009-10-16 | 2011-05-11 | Bayer MaterialScience AG | Aromatsiche Polyurethanharnstoffdispersionen |
| EP2368928B1 (de) | 2010-03-24 | 2013-10-30 | Basf Se | Wasseremulgierbare Isocyanate mit verbesserten Eigenschaften |
| EP2368926B1 (de) | 2010-03-25 | 2013-05-22 | Basf Se | Wasseremulgierbare Isocyanate mit verbesserten Eigenschaften |
| WO2011153296A1 (en) | 2010-06-02 | 2011-12-08 | Lubrizol Advanced Materials, Inc. | Ink/dye receptive films, papers, and fabrics |
| US8664151B2 (en) | 2011-06-01 | 2014-03-04 | The Procter & Gamble Company | Articles comprising reinforced polyurethane coating agent |
| EP2714775A1 (en) | 2011-06-01 | 2014-04-09 | Basf Se | Fast water-absorbing material having a coating of elastic film-forming polyurethane with high wicking |
| US8999884B2 (en) | 2011-06-01 | 2015-04-07 | The Procter & Gamble Company | Absorbent structures with coated water-absorbing material |
| EP2714776A1 (en) | 2011-06-01 | 2014-04-09 | Basf Se | Water-absorbing material having a coating of elastic film-forming polyurethane with high wicking and high permeability |
| DE102011107873B4 (de) | 2011-07-19 | 2015-12-03 | Stahl International Bv | Verfahren zur Herstellung von Seitenketten enthaltenden Polyurethan-Polyharnstoffen und deren wässrigen Dispersionen |
| JP2015532314A (ja) | 2012-09-28 | 2015-11-09 | ビーエーエスエフ ソシエタス・ヨーロピアBasf Se | 改善された光沢を有する水乳化性イソシアネート |
| US9902871B2 (en) | 2013-05-02 | 2018-02-27 | Basf Se | Water-emulsifiable isocyanates for coatings having an improved gloss |
| EP3555164B1 (de) | 2016-12-14 | 2021-06-02 | Basf Se | Wasseremulgierbare isocyanate mit verbesserten eigenschaften |
| WO2020260133A1 (de) | 2019-06-24 | 2020-12-30 | Basf Se | Wasseremulgierbare isocyanate mit verbesserten eigenschaften |
| JP7289975B1 (ja) * | 2022-08-08 | 2023-06-12 | 第一工業製薬株式会社 | 繊維集束剤 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1495745C3 (de) * | 1963-09-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung wäßriger, emulgatorfreier Polyurethan-Latices |
| US3988278A (en) * | 1970-08-17 | 1976-10-26 | Minnesota Mining And Manufacturing Company | Stable polymer latex and process for making same |
| DE2224304A1 (de) * | 1972-05-18 | 1973-11-29 | Bayer Ag | Salze der 3-hydroxy-2-hydroxymethylpropan-sulfonsaeure-1 |
| DE2314513C3 (de) * | 1973-03-23 | 1980-08-28 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von wäßrigen Polyurethandispersionen |
| DE2314512C3 (de) * | 1973-03-23 | 1980-10-09 | Bayer Ag, 5090 Leverkusen | Thermoplastische, nichtionische, in Wasser despergierbare im wesentlichen lineare Polyurethanelastomere |
| DE2412217A1 (de) * | 1974-03-14 | 1975-10-09 | Bayer Ag | Polyalkylenoxidhaltige urethanpolyole mit sulfonsaeuregruppe(n) |
| US3971764A (en) * | 1974-12-26 | 1976-07-27 | Akzona Incorporated | Process for producing a cationic polyurethane |
-
1975
- 1975-11-14 DE DE19752551094 patent/DE2551094A1/de active Granted
-
1976
- 1976-11-10 CH CH1416476A patent/CH622813A5/de not_active IP Right Cessation
- 1976-11-10 AU AU19486/76A patent/AU504084B2/en not_active Expired
- 1976-11-10 GB GB46750/76A patent/GB1503299A/en not_active Expired
- 1976-11-11 SE SE7612595A patent/SE432599B/xx not_active IP Right Cessation
- 1976-11-11 IT IT52124/76A patent/IT1066657B/it active
- 1976-11-11 BR BR7607539A patent/BR7607539A/pt unknown
- 1976-11-12 FR FR7634201A patent/FR2331581A1/fr active Granted
- 1976-11-12 AT AT844076A patent/AT350267B/de not_active IP Right Cessation
- 1976-11-12 ES ES453259A patent/ES453259A1/es not_active Expired
- 1976-11-12 JP JP51135495A patent/JPS5262400A/ja active Granted
- 1976-11-12 BE BE172285A patent/BE848259A/xx not_active IP Right Cessation
- 1976-11-12 PL PL1976193675A patent/PL105479B1/pl unknown
- 1976-11-12 NL NLAANVRAGE7612627,A patent/NL182647C/xx not_active IP Right Cessation
- 1976-11-15 US US05/741,818 patent/US4092286A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU1948676A (en) | 1978-05-18 |
| FR2331581A1 (fr) | 1977-06-10 |
| ATA844076A (de) | 1978-10-15 |
| BR7607539A (pt) | 1977-09-20 |
| PL193675A1 (pl) | 1978-03-28 |
| SE7612595L (sv) | 1977-05-15 |
| SE432599B (sv) | 1984-04-09 |
| BE848259A (fr) | 1977-05-12 |
| NL7612627A (nl) | 1977-05-17 |
| NL182647B (nl) | 1987-11-16 |
| PL105479B1 (pl) | 1979-10-31 |
| FR2331581B1 (enFirst) | 1983-07-01 |
| CH622813A5 (enFirst) | 1981-04-30 |
| GB1503299A (en) | 1978-03-08 |
| JPS5262400A (en) | 1977-05-23 |
| DE2551094C2 (enFirst) | 1987-05-21 |
| US4092286A (en) | 1978-05-30 |
| IT1066657B (it) | 1985-03-12 |
| AT350267B (de) | 1979-05-25 |
| ES453259A1 (es) | 1977-11-16 |
| DE2551094A1 (de) | 1977-05-26 |
| NL182647C (nl) | 1990-12-17 |
| AU504084B2 (en) | 1979-10-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6314006B2 (enFirst) | ||
| US4237264A (en) | Process for the preparation of polyurethanes which are dispersible in water | |
| US4238378A (en) | Cationic electrolyte-stable dispersions and process for producing polyurethanes useful therein | |
| US4408008A (en) | Stable, colloidal, aqueous dispersions of cross-linked urea-urethane polymers and their method of production | |
| US4190566A (en) | Water-dispersible polyurethanes | |
| US4400498A (en) | Thermoplastic polyurethane resins | |
| US4742095A (en) | Continuous process for the production of aqueous polyurethane-urea dispersions | |
| US4303774A (en) | Polyurethanes which are dispersible or soluble in water and a process for their preparation | |
| US4745151A (en) | Process for the production of aqueous dispersions of polyurethane polyureas, the dispersions obtainable by this process and their use as coating compositions | |
| TWI382073B (zh) | 水性黏著性分散液(二) | |
| PL98032B1 (pl) | Sposob wytwarzania mikroporowatych folii poliuretanowych | |
| US3988278A (en) | Stable polymer latex and process for making same | |
| EP0219677A1 (en) | A process for the preparation of an aqueous polyurethane-urea dispersion | |
| EP0148970A2 (en) | Stable, aqueous dispersions of polyurethane-ureas and coatings and films prepared therefrom | |
| JPH10506957A (ja) | 耐熱性と耐溶媒性を改良した水性ポリウレタン分散体の調製のための低溶媒プロセス | |
| US4206255A (en) | Coating compositions based on a mixture of aqueous polyurethane dispersions | |
| JP2010516877A (ja) | ナノウレア分散体 | |
| US4690953A (en) | Method of frothing aqueous ionic polyurethane dispersions and products produced therefrom | |
| EP0296098A2 (en) | Crosslinked polyurethane emulsion, process and prepolymer for its production and process for forming coatings from said emulsion | |
| EP0507173B1 (en) | Aqueous polyurethane-urea dispersions based on bis-(4-isocyanatocyclohexyl)-methane enriched in the trans,trans-isomer and coatings or films prepared therefrom | |
| JPH072972A (ja) | 不飽和ポリウレタンおよびそれの、アルキッド樹脂の為の分散剤としての用途 | |
| JPH06508865A (ja) | ポリウレタン含有シーラント及び塗布物 | |
| TWI400258B (zh) | 含有懸垂式烷氧矽烷基團之聚胺酯/脲 | |
| US20210147607A1 (en) | Polyurethane-urea dispersions based on polycarbonate-polyols as coating compositions | |
| CA1112395A (en) | Process for the production of water-dispersible polyurethanes |