DE2551094C2 - - Google Patents
Info
- Publication number
- DE2551094C2 DE2551094C2 DE2551094A DE2551094A DE2551094C2 DE 2551094 C2 DE2551094 C2 DE 2551094C2 DE 2551094 A DE2551094 A DE 2551094A DE 2551094 A DE2551094 A DE 2551094A DE 2551094 C2 DE2551094 C2 DE 2551094C2
- Authority
- DE
- Germany
- Prior art keywords
- groups
- isocyanate
- parts
- polyurethane
- oxide units
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000006185 dispersion Substances 0.000 claims description 91
- 229920002635 polyurethane Polymers 0.000 claims description 80
- 239000004814 polyurethane Substances 0.000 claims description 80
- 238000000034 method Methods 0.000 claims description 45
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 36
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 28
- 150000002009 diols Chemical class 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 22
- 125000003010 ionic group Chemical group 0.000 claims description 22
- 125000005442 diisocyanate group Chemical group 0.000 claims description 19
- 239000012948 isocyanate Substances 0.000 claims description 15
- 150000002513 isocyanates Chemical class 0.000 claims description 15
- 239000004970 Chain extender Substances 0.000 claims description 13
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 238000006386 neutralization reaction Methods 0.000 claims description 7
- 238000005956 quaternization reaction Methods 0.000 claims description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 238000007259 addition reaction Methods 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 4
- 150000004985 diamines Chemical class 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 229920000233 poly(alkylene oxides) Polymers 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical group C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 3
- 150000002894 organic compounds Chemical group 0.000 claims 2
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims 1
- 239000007787 solid Substances 0.000 description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- 239000000203 mixture Substances 0.000 description 21
- 239000002245 particle Substances 0.000 description 19
- 229920000570 polyether Polymers 0.000 description 19
- 239000004721 Polyphenylene oxide Substances 0.000 description 17
- 229920000728 polyester Polymers 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 15
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 14
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- 238000002474 experimental method Methods 0.000 description 12
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 11
- -1 ammonium ions Chemical class 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- 229920003009 polyurethane dispersion Polymers 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- DTXBWQWOKXFEPI-UHFFFAOYSA-N 1,4-diaminobutane-2-sulfonic acid;sodium Chemical compound [Na].NCCC(CN)S(O)(=O)=O DTXBWQWOKXFEPI-UHFFFAOYSA-N 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 7
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 5
- 238000007792 addition Methods 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 239000013049 sediment Substances 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000003792 electrolyte Substances 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 229920000554 ionomer Polymers 0.000 description 4
- 229920003226 polyurethane urea Polymers 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000012546 transfer Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000001361 adipic acid Substances 0.000 description 3
- 235000011037 adipic acid Nutrition 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000000149 argon plasma sintering Methods 0.000 description 3
- 239000010425 asbestos Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000011888 foil Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000003365 glass fiber Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000010985 leather Substances 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000123 paper Substances 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 229910052895 riebeckite Inorganic materials 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- 229920001169 thermoplastic Polymers 0.000 description 3
- 239000004416 thermosoftening plastic Substances 0.000 description 3
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000806 elastomer Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 2
- 150000002429 hydrazines Chemical class 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 238000009434 installation Methods 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000003475 lamination Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920003225 polyurethane elastomer Polymers 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 238000010257 thawing Methods 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- PALQTQJKAPQMCL-UHFFFAOYSA-N (5-isocyanato-1,3,3-trimethylcyclohexyl)methanamine Chemical compound CC1(C)CC(N=C=O)CC(C)(CN)C1 PALQTQJKAPQMCL-UHFFFAOYSA-N 0.000 description 1
- GFNDFCFPJQPVQL-UHFFFAOYSA-N 1,12-diisocyanatododecane Chemical compound O=C=NCCCCCCCCCCCCN=C=O GFNDFCFPJQPVQL-UHFFFAOYSA-N 0.000 description 1
- OVBFMUAFNIIQAL-UHFFFAOYSA-N 1,4-diisocyanatobutane Chemical compound O=C=NCCCCN=C=O OVBFMUAFNIIQAL-UHFFFAOYSA-N 0.000 description 1
- XIIHTVOIRWYVJC-UHFFFAOYSA-N 1,5-diisocyanato-1,3,3-trimethylcyclohexane Chemical compound CC1(C)CC(N=C=O)CC(C)(N=C=O)C1 XIIHTVOIRWYVJC-UHFFFAOYSA-N 0.000 description 1
- JUZPKXSWFBRSFL-UHFFFAOYSA-N 1-isocyanato-3-(isocyanatomethyl)-3,5,5-trimethylhexane Chemical compound O=C=NCC(C)(CC(C)(C)C)CCN=C=O JUZPKXSWFBRSFL-UHFFFAOYSA-N 0.000 description 1
- NSMWYRLQHIXVAP-UHFFFAOYSA-N 2,5-dimethylpiperazine Chemical compound CC1CNC(C)CN1 NSMWYRLQHIXVAP-UHFFFAOYSA-N 0.000 description 1
- MDMBYMJYFDDMMO-UHFFFAOYSA-N 2-aminoethanesulfonic acid;sodium Chemical compound [Na].NCCS(O)(=O)=O MDMBYMJYFDDMMO-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229920001870 copolymer plastic Polymers 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 1
- JXCHMDATRWUOAP-UHFFFAOYSA-N diisocyanatomethylbenzene Chemical compound O=C=NC(N=C=O)C1=CC=CC=C1 JXCHMDATRWUOAP-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 229940082150 encore Drugs 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 229940117969 neopentyl glycol Drugs 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 238000010915 one-step procedure Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical class OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920006295 polythiol Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 150000003839 salts Chemical group 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000007762 w/o emulsion Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- NHXVNEDMKGDNPR-UHFFFAOYSA-N zinc;pentane-2,4-dione Chemical compound [Zn+2].CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O NHXVNEDMKGDNPR-UHFFFAOYSA-N 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/0804—Manufacture of polymers containing ionic or ionogenic groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/40—High-molecular-weight compounds
- C08G18/48—Polyethers
- C08G18/50—Polyethers having heteroatoms other than oxygen
- C08G18/5021—Polyethers having heteroatoms other than oxygen having nitrogen
- C08G18/5036—Polyethers having heteroatoms other than oxygen having nitrogen containing -N-C=O groups
- C08G18/5042—Polyethers having heteroatoms other than oxygen having nitrogen containing -N-C=O groups containing ureum groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S260/00—Chemistry of carbon compounds
- Y10S260/15—Antistatic agents not otherwise provided for
- Y10S260/17—High polymeric, resinous, antistatic agents
- Y10S260/18—High polymeric, resinous, antistatic agents containing pentavalent nitrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Polyurethanes Or Polyureas (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752551094 DE2551094A1 (de) | 1975-11-14 | 1975-11-14 | Verfahren zur herstellung von in wasser dispergierbaren polyurethanen |
| CH1416476A CH622813A5 (enFirst) | 1975-11-14 | 1976-11-10 | |
| AU19486/76A AU504084B2 (en) | 1975-11-14 | 1976-11-10 | Water-dispersible polyurethane |
| GB46750/76A GB1503299A (en) | 1975-11-14 | 1976-11-10 | Process for the production of water-dispersible polyurethanes |
| IT52124/76A IT1066657B (it) | 1975-11-14 | 1976-11-11 | Procedimento per produrre poliuretani disperdibili in acqua |
| SE7612595A SE432599B (sv) | 1975-11-14 | 1976-11-11 | Sett att framstella i vatten dispergerbara polyuretaner med i huvudsak linjer molekyluppbyggnad |
| BR7607539A BR7607539A (pt) | 1975-11-14 | 1976-11-11 | Poliuretanas dispersaveis na agua e processo para sua preparacao |
| BE172285A BE848259A (fr) | 1975-11-14 | 1976-11-12 | Polyurethannes a structure moleculaire essentiellement lineaire dispersables dans l'eau et leur preparation, |
| FR7634201A FR2331581A1 (fr) | 1975-11-14 | 1976-11-12 | Polyurethannes a structure moleculaire essentiellement lineaire dispersables dans l'eau et leur preparation |
| JP51135495A JPS5262400A (en) | 1975-11-14 | 1976-11-12 | Process for producing waterrdispersible polyurethane |
| ES453259A ES453259A1 (es) | 1975-11-14 | 1976-11-12 | Procedimiento para la obtencion de poliuretanos dispersablesen agua. |
| PL1976193675A PL105479B1 (pl) | 1975-11-14 | 1976-11-12 | Sposob wytwarzania poliuretanow dajacych sie dyspergowac w wodzie |
| NLAANVRAGE7612627,A NL182647C (nl) | 1975-11-14 | 1976-11-12 | Werkwijze ter bereiding van in water dispergeerbare polyurethanen met een lineaire molecuulstructuur. |
| AT844076A AT350267B (de) | 1975-11-14 | 1976-11-12 | Verfahren zur herstellung von neuen in wasser dispergierbaren polyurethanen |
| US05/741,818 US4092286A (en) | 1975-11-14 | 1976-11-15 | Production of water-dispersible polyurethanes having ionic groups and hydrophilic side chains |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752551094 DE2551094A1 (de) | 1975-11-14 | 1975-11-14 | Verfahren zur herstellung von in wasser dispergierbaren polyurethanen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2551094A1 DE2551094A1 (de) | 1977-05-26 |
| DE2551094C2 true DE2551094C2 (enFirst) | 1987-05-21 |
Family
ID=5961708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752551094 Granted DE2551094A1 (de) | 1975-11-14 | 1975-11-14 | Verfahren zur herstellung von in wasser dispergierbaren polyurethanen |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4092286A (enFirst) |
| JP (1) | JPS5262400A (enFirst) |
| AT (1) | AT350267B (enFirst) |
| AU (1) | AU504084B2 (enFirst) |
| BE (1) | BE848259A (enFirst) |
| BR (1) | BR7607539A (enFirst) |
| CH (1) | CH622813A5 (enFirst) |
| DE (1) | DE2551094A1 (enFirst) |
| ES (1) | ES453259A1 (enFirst) |
| FR (1) | FR2331581A1 (enFirst) |
| GB (1) | GB1503299A (enFirst) |
| IT (1) | IT1066657B (enFirst) |
| NL (1) | NL182647C (enFirst) |
| PL (1) | PL105479B1 (enFirst) |
| SE (1) | SE432599B (enFirst) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10315175A1 (de) * | 2003-04-03 | 2004-10-14 | Degussa Construction Chemicals Gmbh | Elektrosterisch stabilisierte wässrige Polyurethan-Harze, Verfahren zu ihrer Herstellung und deren Verwendung |
Families Citing this family (113)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2651505A1 (de) * | 1976-11-11 | 1978-05-24 | Bayer Ag | Kationische elektrolytstabile dispersionen |
| DE2651506C2 (de) * | 1976-11-11 | 1986-04-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen |
| DE2659617A1 (de) * | 1976-12-30 | 1978-07-06 | Bayer Ag | Elektrolyte enthaltende ionomer- dispersionen |
| DE2730514A1 (de) * | 1977-07-06 | 1979-01-18 | Bayer Ag | Verfahren zur herstellung von in wasser loeslichen polyurethanen |
| CH636235B (de) * | 1977-09-06 | 1900-01-01 | Sandoz Ag | Verfahren zur herstellung von polyurethanen und deren verwendung in binderdispersionen zum verkleben von fasern in vliesstoffen. |
| JPS5468498A (en) * | 1977-11-08 | 1979-06-01 | Teijin Ltd | Leather like sheet article and production thereof |
| DE2807479A1 (de) * | 1978-02-22 | 1979-08-23 | Bayer Ag | Ueberzugsmittel |
| DE2816815A1 (de) | 1978-04-18 | 1979-10-31 | Bayer Ag | In wasser dispergierbare oder loesliche polyurethane, sowie ein verfahren zu ihrer herstellung |
| US4554308A (en) * | 1978-10-02 | 1985-11-19 | Wilmington Chemical Corporation | Crosslinked polyurethane dispersions |
| DE2900574A1 (de) * | 1979-01-09 | 1980-07-17 | Bayer Ag | Verwendung von wasserloeslichen elektrolyten als zusatzmittel in waessrigen kunststoffdispersionen und eine, einen wasserloeslichen elektrolyten enthaltende, waessrige kunststoffdispersion |
| US4280970A (en) * | 1979-01-19 | 1981-07-28 | Puropore Inc. | Polyoxyethylene grafted membrane materials with grafting links derived from a diisocyanate |
| DE3048085A1 (de) * | 1980-12-19 | 1982-07-22 | Bayer Ag, 5090 Leverkusen | Dispersionen von sulfonatgruppen aufweisenden polymeren, ein verfahren zu ihrer herstellung, sowie ihre verwendung als beschichtungsmittel |
| US4408008A (en) * | 1981-07-24 | 1983-10-04 | Mobay Chemical Corporation | Stable, colloidal, aqueous dispersions of cross-linked urea-urethane polymers and their method of production |
| DE3210051A1 (de) * | 1982-03-19 | 1983-09-29 | Basf Farben + Fasern Ag, 2000 Hamburg | Wasserverduennbares ueberzugsmittel zur herstellung der basisschicht eines mehrschichtueberzuges |
| DE3316550C2 (de) * | 1983-05-03 | 1985-07-25 | Chemulack Chemische- Und Lackfabrik Gmbh & Co Kg, 1000 Berlin | Verfahren zum Grundieren von Kunststoffen |
| US4501852A (en) * | 1983-06-20 | 1985-02-26 | Mobay Chemical Corporation | Stable, aqueous dispersions of polyurethane-ureas |
| DE3344693A1 (de) * | 1983-12-10 | 1985-06-20 | Bayer Ag, 5090 Leverkusen | Waessrige loesungen oder dispersionen von polyisocyanat-polyadditionsprodukten, ein verfahren zu ihrer herstellung, sowie ihre verwendung als bzw. zur herstellung von klebemittel |
| US4542065A (en) * | 1984-05-21 | 1985-09-17 | Ppg Industries, Inc. | Chemically treated glass fibers and strands and dispersed products thereof |
| US4567228A (en) * | 1984-05-21 | 1986-01-28 | Ppg Industries, Inc. | Aqueous dispersion, internally silylated and dispersed polyurethane resins, and surfaces containing same |
| US4582873A (en) * | 1984-05-21 | 1986-04-15 | Ppg Industries, Inc. | Process for producing aqueous dispersions, internally silylated and dispersed polyurethane resins, and surfaces containing same |
| NL8401784A (nl) * | 1984-06-04 | 1986-01-02 | Stahl Chemical Ind | Werkwijze voor het vervaardigen van een coagule. |
| US4742095A (en) * | 1985-07-25 | 1988-05-03 | Mobay Corporation | Continuous process for the production of aqueous polyurethane-urea dispersions |
| US4701480A (en) * | 1985-09-23 | 1987-10-20 | Mobay Corporation | Stable, aqueous dispersions of polyurethane-ureas |
| US4950423A (en) * | 1986-01-22 | 1990-08-21 | The B. F. Goodrich Company | Coating of EMI shielding and method therefor |
| CA1304869C (en) * | 1986-10-21 | 1992-07-07 | Peter H. Markusch | Continuous process for the production of aqueous polyurethane-urea dispersions |
| DE3641494A1 (de) * | 1986-12-04 | 1988-06-09 | Bayer Ag | In wasser loesliche oder dispergierbare poylurethane, ein verfahren zu ihrer herstellung und ihre verwendung zur beschichtung beliebiger substrate |
| US4826894A (en) * | 1987-05-19 | 1989-05-02 | Mobay Corporation | Aqueous polyurethane-ureas dispersions and their use for the production of coatings having improved humidity resistance |
| GB2209758B (en) * | 1987-09-14 | 1990-12-12 | Ici America Inc | Aqueous dispersions |
| US5104737A (en) * | 1988-12-30 | 1992-04-14 | The Sherwin-Williams Company | Water-dispersable air-drying coatings |
| US5039732A (en) * | 1988-12-30 | 1991-08-13 | The Sherwin-Williams Company | Water-dispersable air-drying coatings |
| US4912154A (en) * | 1988-12-30 | 1990-03-27 | The Sherwin-Williams Company | Water-dispersible air-drying coatings containing 2-oxazoline groups |
| US4956438A (en) * | 1989-02-08 | 1990-09-11 | The Dow Chemical Company | Bulk polyurethane ionomers |
| DE3922493A1 (de) * | 1989-07-08 | 1991-01-17 | Bayer Ag | Verfahren zur herstellung von waessrigen dispersionen von polyurethanen und ihre verwendung als beschichtungsmittel fuer beliebige substrate |
| US5137967A (en) * | 1990-07-06 | 1992-08-11 | Reichhold Chemicals, Inc. | Hydrazine extended aqueous polyurethane |
| EP0552420A3 (en) * | 1992-01-24 | 1993-09-15 | H.B. Fuller Licensing & Financing, Inc. | Water dispersed polyurethane polymer for improved coatings and adhesives |
| US5358997A (en) * | 1992-05-07 | 1994-10-25 | Miles Inc. | Reactive aqueous polyurea dispersions prepared by an emulsion polymerization process |
| US5770264A (en) * | 1992-07-31 | 1998-06-23 | Bayer Aktiengesellschaft | Anionically modified polyurethane ureas having reduced tackiness for the coating of leather |
| US5747582A (en) * | 1992-10-29 | 1998-05-05 | Bayer Aktiengesellschaft | Aqueous coating compositions and their use for the preparation of coatings that are permeable to water vapor |
| US5610224A (en) * | 1992-10-30 | 1997-03-11 | Basf Corporation | Water dispersible ionic and nonionic polyamide modified polyurethane resins for use in coating composition |
| US5703158A (en) * | 1993-09-24 | 1997-12-30 | H.B. Fuller Licensing & Financing, Inc. | Aqueous anionic poly (urethane/urea) dispersions |
| US5608000A (en) * | 1993-09-24 | 1997-03-04 | H. B. Fuller Licensing & Financing, Inc. | Aqueous polyurethane dispersion adhesive compositions with improved heat resistance |
| US5610232A (en) * | 1993-09-24 | 1997-03-11 | H.B. Fuller Licensing & Financing, Inc. | Aqueous non-gelling, anionic polyurethane dispersions and process for their manufacture |
| US5763529A (en) * | 1994-03-31 | 1998-06-09 | Cytec Technology Corp. | Interpenetrating polymer network compositions |
| US5872182A (en) * | 1994-09-09 | 1999-02-16 | H. B. Fuller Licensing & Financing, Inc. | Water-based polyurethanes for footwear |
| US5569706A (en) * | 1995-06-02 | 1996-10-29 | Bayer Corporation | Aqueous polyurea dispersions with improved hardness and solvent resistance |
| US6084001A (en) | 1996-04-25 | 2000-07-04 | Lockheed Martin Corporation | High build polyurethane coating |
| US5652301A (en) * | 1996-08-20 | 1997-07-29 | Bayer Corporation | Aqueous polyurea dispersions and their use for preparing coatings with excellent hydrolytic and thermal stability |
| US5733967A (en) * | 1996-08-20 | 1998-03-31 | Bayer Corporation | Aqueous polyurethane dispersions and their use for preparing coatings with excellent hydrolytic and thermal stability |
| US5714561A (en) * | 1996-09-23 | 1998-02-03 | Uniroyal Chemical Company, Inc. | Water-dispersable polyurethanes |
| US5747630A (en) * | 1997-03-13 | 1998-05-05 | Morton International, Inc. | Polyurethane binder for a magnetic recording medium |
| ZA981836B (en) * | 1997-03-17 | 1999-09-06 | Dow Chemical Co | Continuous process for preparing a polyurethane latex. |
| US20020197443A1 (en) * | 1997-03-17 | 2002-12-26 | Schrock Alan K. | Process for preparing carpets having polyurethane backings obtained from polyurethane latex formulations |
| US5932652A (en) * | 1997-12-17 | 1999-08-03 | Bayer Corporation | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| US5919860A (en) * | 1997-12-17 | 1999-07-06 | Bayer Corporation | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| US5968494A (en) * | 1998-02-24 | 1999-10-19 | National Starch And Chemical Investment Holding Corporation | Polyurethanes with carboxylate functionality for hair fixative applications |
| US6743844B1 (en) | 1998-08-17 | 2004-06-01 | Dow Global Technologies Inc. | Spill resistant carpet backing |
| WO2000037525A1 (en) | 1998-12-18 | 2000-06-29 | The Dow Chemical Company | Aqueous polyurethane dispersions useful for preparing polymers with improved moisture resistance properties |
| ATE236941T1 (de) | 1998-12-29 | 2003-04-15 | Dow Global Technologies Inc | Polyurethanschäume hergestellt aus mechanisch aufgeschaumten polyurethandispersionen |
| US6077901A (en) * | 1999-05-06 | 2000-06-20 | Bayer Corporation | Aqueous compositions containing mixtures of silane-functional resins |
| US6147155A (en) * | 1999-06-08 | 2000-11-14 | Bayer Corporation | Aqueous polyurethane dispersions containing non-cyclic diisocyanates and a process for their preparation |
| US6518348B1 (en) | 1999-12-14 | 2003-02-11 | Dow Global Technologies Inc. | Carpet backing compounds thickened by hydrophobically-modified ethylene-oxide-based urethane block copolymers |
| US6455631B1 (en) | 2000-12-01 | 2002-09-24 | Bayer Corporation | Aqueous polyurethane dispersions containing modified hydrazide groups and their use in one-component thermoset compositions |
| DE10122444A1 (de) * | 2001-05-09 | 2002-11-14 | Bayer Ag | Polyurethan-Polyharnstoff Dispersionen als Beschichtungsmittel |
| US7253228B2 (en) * | 2002-03-28 | 2007-08-07 | Dainippon Ink And Chemicals, Inc. | Method for producing polyurethane emulsion |
| US6897281B2 (en) * | 2002-04-05 | 2005-05-24 | Noveon Ip Holdings Corp. | Breathable polyurethanes, blends, and articles |
| US7358295B2 (en) * | 2002-04-05 | 2008-04-15 | Lubrizol Advanced Materials, Inc. | Hybrid polymer composition, and article therefrom |
| CN100526358C (zh) * | 2002-05-24 | 2009-08-12 | 克鲁普顿公司 | 聚氨酯分散体 |
| US20050209428A1 (en) * | 2002-06-19 | 2005-09-22 | Krishnan Tamareselvy | Breathable polyurethanes, blends, and articles |
| DE10238146A1 (de) * | 2002-08-15 | 2004-02-26 | Basf Ag | Wasseremulgierbare Isocyanate mit verbesserten Eigenschaften |
| US20040116594A1 (en) * | 2002-12-11 | 2004-06-17 | Debkumar Bhattacharjee | Polyurethane prepolymer, stable aqueous dispersions with high solids containing the same and method of using and preparing the aqueous dispersions |
| US7066801B2 (en) * | 2003-02-21 | 2006-06-27 | Dow Global Technologies, Inc. | Method of manufacturing a fixed abrasive material |
| US6910951B2 (en) | 2003-02-24 | 2005-06-28 | Dow Global Technologies, Inc. | Materials and methods for chemical-mechanical planarization |
| DE10322266A1 (de) † | 2003-05-16 | 2004-12-02 | Basf Ag | Selbstemulgierende wäßrige Polyurethandispersion |
| AU2004251165A1 (en) * | 2003-06-13 | 2005-01-06 | Dow Global Technologies Inc | High performance polyurethane carpet backings containing modified vegetable oil polyols |
| CA2534285C (en) * | 2003-08-06 | 2010-10-12 | The Procter & Gamble Company | Coated water-swellable material |
| US7049000B2 (en) | 2003-08-06 | 2006-05-23 | The Procter & Gamble Company | Water-swellable material comprising coated water-swellable polymers |
| CA2534647A1 (en) * | 2003-08-06 | 2005-02-17 | The Procter & Gamble Company | Absorbent article comprising coated water-swellable material |
| EP1518567B1 (en) * | 2003-09-25 | 2017-06-28 | The Procter & Gamble Company | Absorbent articles comprising fluid acquisition zones with coated superabsorbent particles |
| US7238745B2 (en) * | 2003-12-15 | 2007-07-03 | Bayer Materialscience Llc | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| DE102004002525A1 (de) * | 2004-01-16 | 2005-08-04 | Bayer Materialscience Ag | Beschichtungsmittelzusammensetzung |
| DE102004026118A1 (de) * | 2004-05-28 | 2005-12-15 | Bayer Materialscience Ag | Klebstoffe |
| US20050287349A1 (en) * | 2004-06-23 | 2005-12-29 | Yu Poli C | Method for coating coils |
| TWI415637B (zh) * | 2005-02-04 | 2013-11-21 | Basf Ag | 具有彈性成膜聚合物塗層之吸水材料 |
| CN101133100A (zh) * | 2005-02-04 | 2008-02-27 | 巴斯福股份公司 | 水溶胀性材料 |
| DE602006015422D1 (de) * | 2005-02-04 | 2010-08-26 | Basf Se | Verfahren zur herstellung eines wasserabsorbierenden materials mit einem überzug aus elastischen filmbildenden polymeren |
| CN101115509A (zh) * | 2005-02-04 | 2008-01-30 | 宝洁公司 | 具有改进的吸水材料的吸收结构 |
| EP1843797B1 (en) * | 2005-02-04 | 2014-01-22 | The Procter and Gamble Company | Absorbent structure with improved water-absorbing material |
| WO2006097389A2 (en) * | 2005-02-04 | 2006-09-21 | Basf Aktiengesellschaft | A process for producing a water-absorbing material having a coating of elastic filmforming polymers |
| WO2006083583A2 (en) * | 2005-02-04 | 2006-08-10 | The Procter & Gamble Company | Absorbent structure with improved water-swellable material |
| DE102006036220A1 (de) | 2006-08-03 | 2008-02-07 | Clariant International Limited | Polyetheramin-Makromonomere mit zwei benachbarten Hydroxylgruppen und ihre Verwendung zur Herstellung von Polyurethanen |
| US20080081160A1 (en) * | 2006-09-28 | 2008-04-03 | Lubrizol Advanced Materials, Inc. | Ink Receptive Coatings For Woven and Nonwoven Substrates |
| US20100184886A1 (en) * | 2007-07-12 | 2010-07-22 | Huiguang Kou | Nitrocellulose based dispersant |
| DE102008038899A1 (de) | 2008-08-13 | 2010-02-18 | Bayer Materialscience Ag | Dispersionsklebstoffe (II) |
| CL2008003124A1 (es) | 2007-11-07 | 2009-11-27 | Bayer Materialscience Ag | Dispersiones acuosas de poliuretano-urea acuosa de; poliol(es) difuncional (es) o funcionalidad superior, compuestos(s) monofuncional (es) con la menos 50% p/p de óxido de etileno, componente(s)di o poliiocianato; y mezcla de compuestos monoamina primarios y/o secundarios; procedimiento; uso; composición; y compuesto adhesivo. |
| EP2271685B1 (en) * | 2007-12-26 | 2018-01-03 | Dow Global Technologies LLC | Polyurethane dispersions and coatings produced therefrom |
| US8617662B2 (en) * | 2008-06-05 | 2013-12-31 | Lande Braid Industry (Wenzhou) Co., LTD. | Textile blind slat |
| EP2244489A1 (de) | 2009-04-24 | 2010-10-27 | Bayer MaterialScience AG | Verfahren zur Herstellung eines elektromechanischen Wandlers |
| EP2284919A1 (de) | 2009-08-07 | 2011-02-16 | Bayer MaterialScience AG | Verfahren zur Herstellung eines elektromechanischen Wandlers |
| US20110045219A1 (en) * | 2009-08-18 | 2011-02-24 | Bayer Materialscience Llc | Coating compositions for glass substrates |
| EP2319876A1 (de) * | 2009-10-16 | 2011-05-11 | Bayer MaterialScience AG | Aromatsiche Polyurethanharnstoffdispersionen |
| EP2368928B1 (de) | 2010-03-24 | 2013-10-30 | Basf Se | Wasseremulgierbare Isocyanate mit verbesserten Eigenschaften |
| EP2368926B1 (de) | 2010-03-25 | 2013-05-22 | Basf Se | Wasseremulgierbare Isocyanate mit verbesserten Eigenschaften |
| WO2011153296A1 (en) | 2010-06-02 | 2011-12-08 | Lubrizol Advanced Materials, Inc. | Ink/dye receptive films, papers, and fabrics |
| US8664151B2 (en) | 2011-06-01 | 2014-03-04 | The Procter & Gamble Company | Articles comprising reinforced polyurethane coating agent |
| EP2714775A1 (en) | 2011-06-01 | 2014-04-09 | Basf Se | Fast water-absorbing material having a coating of elastic film-forming polyurethane with high wicking |
| US8999884B2 (en) | 2011-06-01 | 2015-04-07 | The Procter & Gamble Company | Absorbent structures with coated water-absorbing material |
| EP2714776A1 (en) | 2011-06-01 | 2014-04-09 | Basf Se | Water-absorbing material having a coating of elastic film-forming polyurethane with high wicking and high permeability |
| DE102011107873B4 (de) | 2011-07-19 | 2015-12-03 | Stahl International Bv | Verfahren zur Herstellung von Seitenketten enthaltenden Polyurethan-Polyharnstoffen und deren wässrigen Dispersionen |
| JP2015532314A (ja) | 2012-09-28 | 2015-11-09 | ビーエーエスエフ ソシエタス・ヨーロピアBasf Se | 改善された光沢を有する水乳化性イソシアネート |
| US9902871B2 (en) | 2013-05-02 | 2018-02-27 | Basf Se | Water-emulsifiable isocyanates for coatings having an improved gloss |
| EP3555164B1 (de) | 2016-12-14 | 2021-06-02 | Basf Se | Wasseremulgierbare isocyanate mit verbesserten eigenschaften |
| WO2020260133A1 (de) | 2019-06-24 | 2020-12-30 | Basf Se | Wasseremulgierbare isocyanate mit verbesserten eigenschaften |
| JP7289975B1 (ja) * | 2022-08-08 | 2023-06-12 | 第一工業製薬株式会社 | 繊維集束剤 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1495745C3 (de) * | 1963-09-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung wäßriger, emulgatorfreier Polyurethan-Latices |
| US3988278A (en) * | 1970-08-17 | 1976-10-26 | Minnesota Mining And Manufacturing Company | Stable polymer latex and process for making same |
| DE2224304A1 (de) * | 1972-05-18 | 1973-11-29 | Bayer Ag | Salze der 3-hydroxy-2-hydroxymethylpropan-sulfonsaeure-1 |
| DE2314513C3 (de) * | 1973-03-23 | 1980-08-28 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von wäßrigen Polyurethandispersionen |
| DE2314512C3 (de) * | 1973-03-23 | 1980-10-09 | Bayer Ag, 5090 Leverkusen | Thermoplastische, nichtionische, in Wasser despergierbare im wesentlichen lineare Polyurethanelastomere |
| DE2412217A1 (de) * | 1974-03-14 | 1975-10-09 | Bayer Ag | Polyalkylenoxidhaltige urethanpolyole mit sulfonsaeuregruppe(n) |
| US3971764A (en) * | 1974-12-26 | 1976-07-27 | Akzona Incorporated | Process for producing a cationic polyurethane |
-
1975
- 1975-11-14 DE DE19752551094 patent/DE2551094A1/de active Granted
-
1976
- 1976-11-10 CH CH1416476A patent/CH622813A5/de not_active IP Right Cessation
- 1976-11-10 AU AU19486/76A patent/AU504084B2/en not_active Expired
- 1976-11-10 GB GB46750/76A patent/GB1503299A/en not_active Expired
- 1976-11-11 SE SE7612595A patent/SE432599B/xx not_active IP Right Cessation
- 1976-11-11 IT IT52124/76A patent/IT1066657B/it active
- 1976-11-11 BR BR7607539A patent/BR7607539A/pt unknown
- 1976-11-12 FR FR7634201A patent/FR2331581A1/fr active Granted
- 1976-11-12 AT AT844076A patent/AT350267B/de not_active IP Right Cessation
- 1976-11-12 ES ES453259A patent/ES453259A1/es not_active Expired
- 1976-11-12 JP JP51135495A patent/JPS5262400A/ja active Granted
- 1976-11-12 BE BE172285A patent/BE848259A/xx not_active IP Right Cessation
- 1976-11-12 PL PL1976193675A patent/PL105479B1/pl unknown
- 1976-11-12 NL NLAANVRAGE7612627,A patent/NL182647C/xx not_active IP Right Cessation
- 1976-11-15 US US05/741,818 patent/US4092286A/en not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10315175A1 (de) * | 2003-04-03 | 2004-10-14 | Degussa Construction Chemicals Gmbh | Elektrosterisch stabilisierte wässrige Polyurethan-Harze, Verfahren zu ihrer Herstellung und deren Verwendung |
| US7414092B2 (en) | 2003-04-03 | 2008-08-19 | Construction Research & Technology Gmbh | Electrosterically stabilized aqueous polyurethane resins, method for the production thereof, and use thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| AU1948676A (en) | 1978-05-18 |
| FR2331581A1 (fr) | 1977-06-10 |
| ATA844076A (de) | 1978-10-15 |
| BR7607539A (pt) | 1977-09-20 |
| PL193675A1 (pl) | 1978-03-28 |
| SE7612595L (sv) | 1977-05-15 |
| SE432599B (sv) | 1984-04-09 |
| BE848259A (fr) | 1977-05-12 |
| NL7612627A (nl) | 1977-05-17 |
| NL182647B (nl) | 1987-11-16 |
| PL105479B1 (pl) | 1979-10-31 |
| FR2331581B1 (enFirst) | 1983-07-01 |
| CH622813A5 (enFirst) | 1981-04-30 |
| GB1503299A (en) | 1978-03-08 |
| JPS5262400A (en) | 1977-05-23 |
| US4092286A (en) | 1978-05-30 |
| IT1066657B (it) | 1985-03-12 |
| AT350267B (de) | 1979-05-25 |
| ES453259A1 (es) | 1977-11-16 |
| DE2551094A1 (de) | 1977-05-26 |
| NL182647C (nl) | 1990-12-17 |
| AU504084B2 (en) | 1979-10-04 |
| JPS6314006B2 (enFirst) | 1988-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2551094C2 (enFirst) | ||
| DE2651506C2 (de) | Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen | |
| DE2651505C2 (enFirst) | ||
| DE2555534C3 (de) | In Wasser dispergierbare Polyurethane | |
| EP0004927B1 (de) | In Wasser dispergierbare oder lösliche Polyurethane sowie ein Verfahren zu ihrer Herstellung | |
| EP0269972B1 (de) | Verfahren zur Herstellung von in Wasser löslichen oder dispergierbaren Polyurethanen und ihre Verwendung zur Beschichtung beliebiger Substrate | |
| DE2314512C3 (de) | Thermoplastische, nichtionische, in Wasser despergierbare im wesentlichen lineare Polyurethanelastomere | |
| DE2314513C3 (de) | Verfahren zur Herstellung von wäßrigen Polyurethandispersionen | |
| EP0073392B1 (de) | Überzugmittel aus Polyurethan-Dispersionen und ihre Verwendung für Deckstriche und Finishs | |
| DE69412990T2 (de) | Wässrige Polyurethanzusammensetzungen | |
| EP0994136B1 (de) | Wässrige Polyurethandispersionen | |
| DE2659617C2 (enFirst) | ||
| EP0595149B2 (de) | Verwendung wässriger Beschichtungsmittel zur Erzeugung wasserdampfdurchlässiger Beschichtungen | |
| EP0003785B1 (de) | Überzugsmittel und Verfahren zur Beschichtung von PVC | |
| DE3630045A1 (de) | Klebstoff und die verwendung des klebstoffs zur herstellung von verklebungen | |
| DE2019324A1 (de) | Lichtechte Polyurethanionomere | |
| DE3735587A1 (de) | Verfahren zur herstellung von waessrigen polyurethan-polyharnstoffdispersionen | |
| DE2708442C2 (de) | Verfahren zur Herstellung von modifizierten wäßrigen Kunststoff-Dispersionen | |
| EP0000347A1 (de) | Elektrolytstabile wässrige Lösungen von Polyurethanionomeren und Verfahren zur Herstellung dieser Ionomeren | |
| DE2448133A1 (de) | Polyurethan-reaktivbeschichtungen | |
| EP0073389B1 (de) | Beschichtungs- und Zurichtmittel für Leder und Lederaustauschstoffe auf Basis von Polyurethanharnstoff-Beschichtungsmassen | |
| DE1694148C3 (de) | Verfahren zur Herstellung mikroporöser Flächengebilde oder Formkörper auf Polyurethanbasis | |
| DE1694147C3 (de) | Verfahren zur Herstellung von mikroporösen wasserdampfdurchlässigen Polyurethan (hamstofiQ-Flächengebilden | |
| DE2157203A1 (de) | Verfahren zur herstellung mikroporoeser wasserdampfdurchlaessiger flaechengebilde | |
| DE3507467A1 (de) | Pu-kunststoffe enthaltende streichpasten und verfahren zur herstellung von wasserdampfdurchlaessigen polyurethan-beschichtungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8365 | Fully valid after opposition proceedings | ||
| 8339 | Ceased/non-payment of the annual fee |