JPS5576875A - Benzo ij quinolizine-2-carboxylic acid derivative and its preparation - Google Patents
Benzo ij quinolizine-2-carboxylic acid derivative and its preparationInfo
- Publication number
- JPS5576875A JPS5576875A JP10738778A JP10738778A JPS5576875A JP S5576875 A JPS5576875 A JP S5576875A JP 10738778 A JP10738778 A JP 10738778A JP 10738778 A JP10738778 A JP 10738778A JP S5576875 A JPS5576875 A JP S5576875A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- formula
- halogen
- quinolizine
- benzo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- IAKNLKLKKBPMHN-UHFFFAOYSA-N 4h-quinolizine-2-carboxylic acid Chemical class C1=CC=CC2=CC(C(=O)O)=CCN21 IAKNLKLKKBPMHN-UHFFFAOYSA-N 0.000 title 1
- 125000005605 benzo group Chemical group 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 6
- 229910052736 halogen Inorganic materials 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 150000002367 halogens Chemical class 0.000 abstract 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 2
- RQCXFWRVUJHEFD-UHFFFAOYSA-N 8-(1-piperazinyl)-6,7-dihydro-1-oxo-1h,5h-benzo[ij]-quinolizine-2-carboxylic acid Chemical compound C1=CC(=C23)C(=O)C(C(=O)O)=CN2CCCC3=C1N1CCNCC1 RQCXFWRVUJHEFD-UHFFFAOYSA-N 0.000 abstract 1
- 241000894006 Bacteria Species 0.000 abstract 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 abstract 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract 1
- 229940088710 antibiotic agent Drugs 0.000 abstract 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 239000007795 chemical reaction product Substances 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 230000002949 hemolytic effect Effects 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Priority Applications (25)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10738778A JPS5576875A (en) | 1978-08-31 | 1978-08-31 | Benzo ij quinolizine-2-carboxylic acid derivative and its preparation |
| DE2953974A DE2953974C2 (enExample) | 1978-04-12 | 1979-04-09 | |
| DE19792914258 DE2914258A1 (de) | 1978-04-12 | 1979-04-09 | Piperazinylbenzoheterozyklische verbindungen, verfahren zu deren herstellung und mittel, welche diese enthalten |
| DE2953973A DE2953973C2 (enExample) | 1978-04-12 | 1979-04-09 | |
| DK149379A DK160306C (da) | 1978-08-31 | 1979-04-10 | Analogifremgangsmaade til fremstilling af piperazinylbenzoheterocycliske forbindelser eller farmaceutisk acceptable salte deraf |
| ZA791714A ZA791714B (en) | 1978-08-31 | 1979-04-10 | Piperazinylbenzoheterocyclic compounds |
| NO791224A NO152788C (no) | 1978-08-31 | 1979-04-10 | Analogifremgangsmaate for fremstilling av terapeutisk aktive piperazinylbenzoheterocykliske forbindelser. |
| IT48690/79A IT1196531B (it) | 1978-04-12 | 1979-04-10 | Composti piperazinil-benzoeterociclici procedimento per produrli e preparato farmaceutico che li contiene |
| MX786779U MX6158E (es) | 1978-08-31 | 1979-04-11 | Procedimiento para la preparacion de derivados piperazinilbenzoheterociclicos |
| AT269179A AT376673B (de) | 1978-08-31 | 1979-04-11 | Verfahren zur herstellung von neuen piperazinylbenzoheterozyklischen verbindungen und ihren pharmazeutisch annehmbaren salzen |
| ES480274A ES480274A1 (es) | 1978-08-31 | 1979-04-11 | Metodo de preparar compuestos piperacinilbenzoheterociclicos e intermedios. |
| AU46037/79A AU529330B2 (en) | 1978-04-12 | 1979-04-11 | Piperazinylbenzoheterocyclic compounds |
| PT6947479A PT69474A (pt) | 1978-08-31 | 1979-04-11 | Process for preparing piperazinylbenzoheterocyclic compounds |
| CH343379A CH640853A5 (de) | 1978-04-12 | 1979-04-11 | Piperazinylbenzoheterozyklische verbindungen und bakteriostatische zubereitung welche diese enthaelt. |
| CA000325376A CA1153374A (en) | 1978-04-12 | 1979-04-11 | Piperazinylbenzoheterocyclic compounds |
| FI791191A FI66612C (fi) | 1978-08-31 | 1979-04-11 | Foerfarande foer framstaellning av nya saosom antimicrobica anaendbara piperazinylbensoheterocykliska foereningar |
| SU792751555A SU993818A3 (ru) | 1978-08-31 | 1979-04-11 | Способ получени производных пиперазинилбензогетероциклических соединений или их кислотно-аддитивных солей |
| NLAANVRAGE7902905,A NL180664C (nl) | 1978-04-12 | 1979-04-12 | 1,8-alkyleen-3-carboxy-4-oxo-7-piperazinochinolinederivaten, werkwijze voor de bereiding daarvan en anti-microbiele preparaten die een dergelijke verbinding als werkzame stof bevatten. |
| GB7913040A GB2020279B (en) | 1978-04-12 | 1979-04-12 | Piperazinylbenzoheterocyclic compounds |
| FR7909338A FR2422658A1 (fr) | 1978-04-12 | 1979-04-12 | Composes piperazinyl-benzoheterocycliques, leur preparation et leurs utilisations therapeutiques |
| GB7913039A GB2019844B (en) | 1978-04-12 | 1979-04-12 | Lactam series compound |
| SE7903298A SE436280B (sv) | 1978-04-12 | 1979-04-12 | Piperazinylbensoheterocykliska foreningar av antimikrobiellt preparat derav |
| US06/195,691 US4416884A (en) | 1978-04-12 | 1980-10-09 | Piperazinylbenzoheterocyclic compounds |
| SU823375813A SU1407399A3 (ru) | 1978-08-31 | 1982-01-18 | Способ получени производных пиперазинилбензогетероциклических соединений или их фармацевтически приемлемых солей |
| AT290183A AT377986B (de) | 1978-08-31 | 1983-08-11 | Verfahren zur herstellung von neuen piperazinylbenzoheterozyklischen verbindungen und ihren pharmazeutisch annehmbaren salzen |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10738778A JPS5576875A (en) | 1978-08-31 | 1978-08-31 | Benzo ij quinolizine-2-carboxylic acid derivative and its preparation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5576875A true JPS5576875A (en) | 1980-06-10 |
| JPS622598B2 JPS622598B2 (enExample) | 1987-01-20 |
Family
ID=14457832
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP10738778A Granted JPS5576875A (en) | 1978-04-12 | 1978-08-31 | Benzo ij quinolizine-2-carboxylic acid derivative and its preparation |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS5576875A (enExample) |
| SU (1) | SU1407399A3 (enExample) |
| ZA (1) | ZA791714B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55149284A (en) * | 1980-05-02 | 1980-11-20 | Otsuka Pharmaceut Co Ltd | Piperazinylbenzo heterocyclic derivative |
| JPS5788183A (en) * | 1980-11-21 | 1982-06-01 | Dai Ichi Seiyaku Co Ltd | Pyridobenzoxazine derivative |
| JPS63154621A (ja) * | 1986-12-18 | 1988-06-27 | Dai Ichi Seiyaku Co Ltd | 外用剤 |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS63123592U (enExample) * | 1987-02-04 | 1988-08-11 |
-
1978
- 1978-08-31 JP JP10738778A patent/JPS5576875A/ja active Granted
-
1979
- 1979-04-10 ZA ZA791714A patent/ZA791714B/xx unknown
-
1982
- 1982-01-18 SU SU823375813A patent/SU1407399A3/ru active
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55149284A (en) * | 1980-05-02 | 1980-11-20 | Otsuka Pharmaceut Co Ltd | Piperazinylbenzo heterocyclic derivative |
| JPS5788183A (en) * | 1980-11-21 | 1982-06-01 | Dai Ichi Seiyaku Co Ltd | Pyridobenzoxazine derivative |
| JPS63154621A (ja) * | 1986-12-18 | 1988-06-27 | Dai Ichi Seiyaku Co Ltd | 外用剤 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS622598B2 (enExample) | 1987-01-20 |
| SU1407399A3 (ru) | 1988-06-30 |
| ZA791714B (en) | 1980-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5543011A (en) | 7-halothiazolylalkoxyiminoacetamido-3-cephem compound | |
| JPS5655389A (en) | Benzo ij quinolidine-2-carboxylic acid derivative, and its preparation | |
| JPS5576875A (en) | Benzo ij quinolizine-2-carboxylic acid derivative and its preparation | |
| JPS5653656A (en) | Quinoline derivative and its preparation | |
| JPS5573686A (en) | Novel penicillin | |
| DE2963729D1 (en) | New intermediates and their use for the preparation of new oxadiazolo-pyrimidine derivatives | |
| JPS55149284A (en) | Piperazinylbenzo heterocyclic derivative | |
| JPS5746990A (en) | Novel cephalexin derivative and its preparation | |
| JPS5643288A (en) | Cephalosporin derivative and its preparation | |
| JPS55118485A (en) | Benzo ij quinolizine-2-carboxylic acid derivative | |
| JPS5655388A (en) | Benzo ij quinolidine-2-carboxylic acid derivative, and its preparation | |
| JPS57203067A (en) | Novel quinolinecarboxylic acid derivatives, their preparations, and antibacterial agent comprising them as active ingredient | |
| JPS56142282A (en) | Penem-3-carboxylic acid derivative and its preparation | |
| JPS54154797A (en) | Benzimidazoquinolizine derivative and antibacterials comprising it | |
| JPS54135767A (en) | Penicillanic acid derivative | |
| JPS5540656A (en) | Substituted quinoline-carboxylic acid derivative | |
| JPS5536449A (en) | Penicillanic acid derivative | |
| JPS5564588A (en) | Pyrrolo (3, 2, 1-ij) quinoline-5-carboxylic acid derivative and its preparation | |
| JPS5569583A (en) | Pyrido 3,2,1-jk carbazole derivative | |
| JPS5572196A (en) | Penicillanic acid derivative | |
| JPS5549378A (en) | Imidazo 4,5,1-ij quinoline-5-carboxylic acid derivative | |
| JPS5569592A (en) | Penicillanic acid derivative | |
| JPS54144392A (en) | Cephalosporin derivative | |
| JPS55136287A (en) | Novel penicillin, cephalosporin, and their preparation | |
| JPS55145612A (en) | Anti-bacterial agent |