JPH0749597B2 - 漂白剤触媒及びこれを含有する組成物 - Google Patents
漂白剤触媒及びこれを含有する組成物Info
- Publication number
- JPH0749597B2 JPH0749597B2 JP3128845A JP12884591A JPH0749597B2 JP H0749597 B2 JPH0749597 B2 JP H0749597B2 JP 3128845 A JP3128845 A JP 3128845A JP 12884591 A JP12884591 A JP 12884591A JP H0749597 B2 JPH0749597 B2 JP H0749597B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- acid
- alkyl
- composition
- composition according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 title claims description 46
- 239000003054 catalyst Substances 0.000 title description 8
- 239000007844 bleaching agent Substances 0.000 title description 7
- -1 peroxy compound Chemical class 0.000 claims description 43
- 238000004061 bleaching Methods 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 239000003599 detergent Substances 0.000 claims description 19
- 229910052760 oxygen Inorganic materials 0.000 claims description 18
- 239000001301 oxygen Substances 0.000 claims description 18
- 125000003118 aryl group Chemical group 0.000 claims description 17
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 17
- 125000000623 heterocyclic group Chemical group 0.000 claims description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- 125000000524 functional group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical class [O-][N+](*)=O 0.000 claims description 8
- 125000000864 peroxy group Chemical group O(O*)* 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 239000004094 surface-active agent Substances 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 150000004967 organic peroxy acids Chemical class 0.000 claims description 5
- MPNRJEPBAYEQBY-SDNWHVSQSA-N (ne)-n-benzylidenebenzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)\N=C\C1=CC=CC=C1 MPNRJEPBAYEQBY-SDNWHVSQSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 229930194542 Keto Natural products 0.000 claims description 3
- 235000018936 Vitellaria paradoxa Nutrition 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000001475 halogen functional group Chemical group 0.000 claims description 3
- 125000000468 ketone group Chemical group 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- DZQDTTFEIWJCEJ-UHFFFAOYSA-N 4-[(4-carboxyphenyl)sulfonyliminomethyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C=NS(=O)(=O)C1=CC=C(C(O)=O)C=C1 DZQDTTFEIWJCEJ-UHFFFAOYSA-N 0.000 claims description 2
- 102000013142 Amylases Human genes 0.000 claims description 2
- 108010065511 Amylases Proteins 0.000 claims description 2
- 102000005575 Cellulases Human genes 0.000 claims description 2
- 108010084185 Cellulases Proteins 0.000 claims description 2
- 102000004190 Enzymes Human genes 0.000 claims description 2
- 108090000790 Enzymes Proteins 0.000 claims description 2
- 102000004882 Lipase Human genes 0.000 claims description 2
- 108090001060 Lipase Proteins 0.000 claims description 2
- 239000004367 Lipase Substances 0.000 claims description 2
- 102000035195 Peptidases Human genes 0.000 claims description 2
- 108091005804 Peptidases Proteins 0.000 claims description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims description 2
- 239000004365 Protease Substances 0.000 claims description 2
- 125000005210 alkyl ammonium group Chemical group 0.000 claims description 2
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 2
- 235000019418 amylase Nutrition 0.000 claims description 2
- 229940025131 amylases Drugs 0.000 claims description 2
- 229940088598 enzyme Drugs 0.000 claims description 2
- 235000019421 lipase Nutrition 0.000 claims description 2
- VFQWDCJQHDDKGJ-UHFFFAOYSA-N n-(pyridin-3-ylmethylidene)benzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)N=CC1=CC=CN=C1 VFQWDCJQHDDKGJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000005342 perphosphate group Chemical group 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000004001 thioalkyl group Chemical group 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims 2
- BTNAZHHYONIOIV-UHFFFAOYSA-N 1,2-benzothiazole 1,1-dioxide Chemical compound C1=CC=C2S(=O)(=O)N=CC2=C1 BTNAZHHYONIOIV-UHFFFAOYSA-N 0.000 claims 1
- WJCNUIDVUAOPNU-UHFFFAOYSA-N 4-(benzenesulfonyliminomethyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C=NS(=O)(=O)C1=CC=CC=C1 WJCNUIDVUAOPNU-UHFFFAOYSA-N 0.000 claims 1
- BMCQFIOBGXDBJI-UHFFFAOYSA-N 4-(benzylideneamino)sulfonylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1S(=O)(=O)N=CC1=CC=CC=C1 BMCQFIOBGXDBJI-UHFFFAOYSA-N 0.000 claims 1
- LLZOOJHBHHYBSY-UHFFFAOYSA-N 4-[(3-nitrophenyl)sulfonyliminomethyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C=NS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 LLZOOJHBHHYBSY-UHFFFAOYSA-N 0.000 claims 1
- RFBYOMYNHRQPKU-UHFFFAOYSA-N 4-[(4-chlorophenyl)sulfonyliminomethyl]benzoic acid Chemical group C1=CC(C(=O)O)=CC=C1C=NS(=O)(=O)C1=CC=C(Cl)C=C1 RFBYOMYNHRQPKU-UHFFFAOYSA-N 0.000 claims 1
- WILBUGCJSCWHPL-UHFFFAOYSA-N 4-[(4-cyanophenyl)methylideneamino]sulfonylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1S(=O)(=O)N=CC1=CC=C(C#N)C=C1 WILBUGCJSCWHPL-UHFFFAOYSA-N 0.000 claims 1
- AJTWBLJEKIJAOK-UHFFFAOYSA-N 4-[(4-methoxyphenyl)methylideneamino]sulfonylbenzoic acid Chemical compound C1=CC(OC)=CC=C1C=NS(=O)(=O)C1=CC=C(C(O)=O)C=C1 AJTWBLJEKIJAOK-UHFFFAOYSA-N 0.000 claims 1
- DMRDFYBKCKMESL-UHFFFAOYSA-N 4-chloro-n-[(3-hydroxyphenyl)methylidene]benzenesulfonamide Chemical compound OC1=CC=CC(C=NS(=O)(=O)C=2C=CC(Cl)=CC=2)=C1 DMRDFYBKCKMESL-UHFFFAOYSA-N 0.000 claims 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 229910010272 inorganic material Inorganic materials 0.000 claims 1
- 239000011147 inorganic material Substances 0.000 claims 1
- 125000005208 trialkylammonium group Chemical group 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- UCAGLBKTLXCODC-UHFFFAOYSA-N carzenide Chemical compound NS(=O)(=O)C1=CC=C(C(O)=O)C=C1 UCAGLBKTLXCODC-UHFFFAOYSA-N 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 229910052708 sodium Inorganic materials 0.000 description 12
- 239000011734 sodium Substances 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- 239000012190 activator Substances 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 8
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 8
- 238000005481 NMR spectroscopy Methods 0.000 description 8
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 239000004744 fabric Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- 238000000034 method Methods 0.000 description 7
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 6
- 239000000344 soap Substances 0.000 description 6
- 229940124530 sulfonamide Drugs 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 102100021655 Extracellular sulfatase Sulf-1 Human genes 0.000 description 5
- 101000820630 Homo sapiens Extracellular sulfatase Sulf-1 Proteins 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 125000000129 anionic group Chemical group 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 150000004965 peroxy acids Chemical class 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 239000004753 textile Substances 0.000 description 4
- HHHDJHHNEURCNV-UHFFFAOYSA-N 4-chlorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(Cl)C=C1 HHHDJHHNEURCNV-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- 229920000305 Nylon 6,10 Polymers 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 229920002125 Sokalan® Polymers 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- OWCDMRFUFMERMZ-UHFFFAOYSA-N benzenesulfonamide;hydrochloride Chemical compound Cl.NS(=O)(=O)C1=CC=CC=C1 OWCDMRFUFMERMZ-UHFFFAOYSA-N 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- IAVREABSGIHHMO-UHFFFAOYSA-N 3-hydroxybenzaldehyde Chemical compound OC1=CC=CC(C=O)=C1 IAVREABSGIHHMO-UHFFFAOYSA-N 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 150000003841 chloride salts Chemical class 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000010979 ruby Substances 0.000 description 2
- 229910001750 ruby Inorganic materials 0.000 description 2
- 235000015067 sauces Nutrition 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 229940035721 sulf-10 Drugs 0.000 description 2
- SKIVFJLNDNKQPD-UHFFFAOYSA-N sulfacetamide Chemical compound CC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 SKIVFJLNDNKQPD-UHFFFAOYSA-N 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- PPAUIYUSMOBUNO-UHFFFAOYSA-N 2-(benzenesulfonylimino)acetic acid Chemical compound OC(=O)C=NS(=O)(=O)C1=CC=CC=C1 PPAUIYUSMOBUNO-UHFFFAOYSA-N 0.000 description 1
- WKVMOQXBMPYPGK-UHFFFAOYSA-N 2-[bis(carboxymethyl)amino]acetic acid;sodium Chemical compound [Na].OC(=O)CN(CC(O)=O)CC(O)=O WKVMOQXBMPYPGK-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- WREFNFTVBQKRGZ-UHFFFAOYSA-N 2-decylbutanediperoxoic acid Chemical compound CCCCCCCCCCC(C(=O)OO)CC(=O)OO WREFNFTVBQKRGZ-UHFFFAOYSA-N 0.000 description 1
- OXOHMAPRQAJJIR-UHFFFAOYSA-N 3-(2,3-dihydroxypropoxy)propane-1,2-diol;sulfuric acid Chemical compound OS(O)(=O)=O.OCC(O)COCC(O)CO OXOHMAPRQAJJIR-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- QDDADYIRBDHPRY-UHFFFAOYSA-N 3-(carboxymethoxy)-3-oxopropanoic acid Chemical compound OC(=O)COC(=O)CC(O)=O QDDADYIRBDHPRY-UHFFFAOYSA-N 0.000 description 1
- KBNUKJSZKJGXGU-UHFFFAOYSA-N 3-methyl-1,2-benzothiazole 1,1-dioxide Chemical compound C1=CC=C2C(C)=NS(=O)(=O)C2=C1 KBNUKJSZKJGXGU-UHFFFAOYSA-N 0.000 description 1
- TXTQURPQLVHJRE-UHFFFAOYSA-N 3-nitrobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 TXTQURPQLVHJRE-UHFFFAOYSA-N 0.000 description 1
- BTLSKPZHRKKBDD-UHFFFAOYSA-N 3-sulfonyloxaziridine Chemical compound O=S(=O)=C1NO1 BTLSKPZHRKKBDD-UHFFFAOYSA-N 0.000 description 1
- RZWLDRPGTMVOND-UHFFFAOYSA-N 4-[(4-phenoxycarbonylphenyl)methylideneamino]sulfonylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1S(=O)(=O)N=CC1=CC=C(C(=O)OC=2C=CC=CC=2)C=C1 RZWLDRPGTMVOND-UHFFFAOYSA-N 0.000 description 1
- POBQREGGXMKCQY-UHFFFAOYSA-N 4-chloro-n-(pyridin-3-ylmethylidene)benzenesulfonamide Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)N=CC1=CC=CN=C1 POBQREGGXMKCQY-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 125000003860 C1-C20 alkoxy group Chemical group 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- SHBUUTHKGIVMJT-UHFFFAOYSA-N Hydroxystearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OO SHBUUTHKGIVMJT-UHFFFAOYSA-N 0.000 description 1
- NVGBPTNZLWRQSY-UWVGGRQHSA-N Lys-Lys Chemical compound NCCCC[C@H](N)C(=O)N[C@H](C(O)=O)CCCCN NVGBPTNZLWRQSY-UWVGGRQHSA-N 0.000 description 1
- 239000012901 Milli-Q water Substances 0.000 description 1
- SUZRRICLUFMAQD-UHFFFAOYSA-N N-Methyltaurine Chemical compound CNCCS(O)(=O)=O SUZRRICLUFMAQD-UHFFFAOYSA-N 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 235000006468 Thea sinensis Nutrition 0.000 description 1
- IRVOFWCSYYIMOU-UHFFFAOYSA-M [4-(benzylideneamino)sulfonylphenyl]-trimethylazanium;chloride Chemical compound [Cl-].C1=CC([N+](C)(C)C)=CC=C1S(=O)(=O)N=CC1=CC=CC=C1 IRVOFWCSYYIMOU-UHFFFAOYSA-M 0.000 description 1
- YWGNFOZBGVQOKF-UHFFFAOYSA-N [Na+].[Na+].C1(=CC=CC=C1)S(=O)(=O)[NH-].C1(=CC=CC=C1)S(=O)(=O)[NH-] Chemical compound [Na+].[Na+].C1(=CC=CC=C1)S(=O)(=O)[NH-].C1(=CC=CC=C1)S(=O)(=O)[NH-] YWGNFOZBGVQOKF-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000004973 alkali metal peroxides Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229920013820 alkyl cellulose Polymers 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000002519 antifouling agent Substances 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 235000020279 black tea Nutrition 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- UNWDCFHEVIWFCW-UHFFFAOYSA-N decanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCC(=O)OO UNWDCFHEVIWFCW-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- MAQMEXSLUSZDQM-UHFFFAOYSA-N diethoxymethylbenzene Chemical compound CCOC(OCC)C1=CC=CC=C1 MAQMEXSLUSZDQM-UHFFFAOYSA-N 0.000 description 1
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 description 1
- 238000004851 dishwashing Methods 0.000 description 1
- BRDYCNFHFWUBCZ-UHFFFAOYSA-N dodecaneperoxoic acid Chemical compound CCCCCCCCCCCC(=O)OO BRDYCNFHFWUBCZ-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical class CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000000118 hair dye Substances 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000002608 ionic liquid Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 108010054155 lysyllysine Proteins 0.000 description 1
- FODOUIXGKGNSMR-UHFFFAOYSA-L magnesium;2-oxidooxycarbonylbenzoate;hexahydrate Chemical compound O.O.O.O.O.O.[Mg+2].[O-]OC(=O)C1=CC=CC=C1C([O-])=O FODOUIXGKGNSMR-UHFFFAOYSA-L 0.000 description 1
- FBDWCTWJJMORIU-UHFFFAOYSA-N magnesium;hexahydrate Chemical compound O.O.O.O.O.O.[Mg] FBDWCTWJJMORIU-UHFFFAOYSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- QBBWUISOUODBKA-UHFFFAOYSA-N n-(2,2,3,3,4,4,4-heptafluorobutylidene)benzenesulfonamide Chemical compound FC(F)(F)C(F)(F)C(F)(F)C=NS(=O)(=O)C1=CC=CC=C1 QBBWUISOUODBKA-UHFFFAOYSA-N 0.000 description 1
- HOIIJYASMSHRKX-UHFFFAOYSA-N n-(pyridin-2-ylmethylidene)benzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)N=CC1=CC=CC=N1 HOIIJYASMSHRKX-UHFFFAOYSA-N 0.000 description 1
- SSEOGPYUPJJJHO-UHFFFAOYSA-N n-benzylidene-1,1,1-trifluoromethanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N=CC1=CC=CC=C1 SSEOGPYUPJJJHO-UHFFFAOYSA-N 0.000 description 1
- XZEJJOSUAHELJJ-UHFFFAOYSA-N n-benzylidenemethanesulfonamide Chemical compound CS(=O)(=O)N=CC1=CC=CC=C1 XZEJJOSUAHELJJ-UHFFFAOYSA-N 0.000 description 1
- CYGSALWUTZDSAX-UHFFFAOYSA-N n-benzylidenepyridine-3-sulfonamide Chemical compound C=1C=CN=CC=1S(=O)(=O)N=CC1=CC=CC=C1 CYGSALWUTZDSAX-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- SJGALSBBFTYSBA-UHFFFAOYSA-N oxaziridine Chemical compound C1NO1 SJGALSBBFTYSBA-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- XCRBXWCUXJNEFX-UHFFFAOYSA-N peroxybenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1 XCRBXWCUXJNEFX-UHFFFAOYSA-N 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229940044652 phenolsulfonate Drugs 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 150000003007 phosphonic acid derivatives Chemical class 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- QSKQNALVHFTOQX-UHFFFAOYSA-M sodium nonanoyloxybenzenesulfonate Chemical compound [Na+].CCCCCCCCC(=O)OC1=CC=CC=C1S([O-])(=O)=O QSKQNALVHFTOQX-UHFFFAOYSA-M 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- PTMQOXHDUDYMHB-UHFFFAOYSA-N sodium;benzenesulfonylazanide Chemical compound [Na+].[NH-]S(=O)(=O)C1=CC=CC=C1 PTMQOXHDUDYMHB-UHFFFAOYSA-N 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000005156 substituted alkylene group Chemical group 0.000 description 1
- 125000005650 substituted phenylene group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 230000019635 sulfation Effects 0.000 description 1
- 238000005670 sulfation reaction Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- KUCOHFSKRZZVRO-UHFFFAOYSA-N terephthalaldehyde Chemical compound O=CC1=CC=C(C=O)C=C1 KUCOHFSKRZZVRO-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- CMQCNTNASCDNGR-UHFFFAOYSA-N toluene;hydrate Chemical compound O.CC1=CC=CC=C1 CMQCNTNASCDNGR-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D7/00—Compositions of detergents based essentially on non-surface-active compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
- C11D3/3917—Nitrogen-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
- C11D3/3917—Nitrogen-containing compounds
- C11D3/392—Heterocyclic compounds, e.g. cyclic imides or lactames
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/494,713 US5041232A (en) | 1990-03-16 | 1990-03-16 | Sulfonimines as bleach catalysts |
| US494713 | 1990-03-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPH04227697A JPH04227697A (ja) | 1992-08-17 |
| JPH0749597B2 true JPH0749597B2 (ja) | 1995-05-31 |
Family
ID=23965661
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP3128845A Expired - Lifetime JPH0749597B2 (ja) | 1990-03-16 | 1991-03-15 | 漂白剤触媒及びこれを含有する組成物 |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US5041232A (member.php) |
| EP (1) | EP0453003B1 (member.php) |
| JP (1) | JPH0749597B2 (member.php) |
| KR (1) | KR950002353B1 (member.php) |
| AU (1) | AU636724B2 (member.php) |
| BR (1) | BR9101036A (member.php) |
| CA (1) | CA2037800C (member.php) |
| DE (1) | DE69104405T2 (member.php) |
| ES (1) | ES2061156T3 (member.php) |
| IN (1) | IN171767B (member.php) |
| MY (1) | MY105354A (member.php) |
| NO (1) | NO177431C (member.php) |
| TW (1) | TW277072B (member.php) |
| ZA (1) | ZA911936B (member.php) |
Families Citing this family (132)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5045223A (en) * | 1990-03-16 | 1991-09-03 | Lever Brothers Company, Division Of Conopco, Inc. | N-sulfonyloxaziridines as bleaching compounds |
| US5047163A (en) * | 1990-03-16 | 1991-09-10 | Lever Brothers Company, Division Of Conopco, Inc. | Activation of bleach precursors with sulfonimines |
| US5559089A (en) * | 1992-03-12 | 1996-09-24 | The Procter & Gamble Company | Low-dosage automatic dishwashing detergent with monopersulfate and enzymes |
| US5429769A (en) * | 1993-07-26 | 1995-07-04 | Lever Brothers Company, Division Of Conopco, Inc. | Peroxycarboxylic acids and manganese complex catalysts |
| US5413733A (en) * | 1993-07-26 | 1995-05-09 | Lever Brothers Company, Division Of Conopco, Inc. | Amidooxy peroxycarboxylic acids and sulfonimine complex catalysts |
| EP0728182B1 (en) * | 1993-11-12 | 1997-09-03 | Unilever N.V. | Imine salts as bleach catalysts |
| AU8106694A (en) * | 1993-11-12 | 1995-05-29 | Unilever Plc | Activation of bleach precursors with imine quaternary salts |
| US5360568A (en) * | 1993-11-12 | 1994-11-01 | Lever Brothers Company, Division Of Conopco, Inc. | Imine quaternary salts as bleach catalysts |
| US5360569A (en) * | 1993-11-12 | 1994-11-01 | Lever Brothers Company, Division Of Conopco, Inc. | Activation of bleach precursors with catalytic imine quaternary salts |
| US5370826A (en) * | 1993-11-12 | 1994-12-06 | Lever Brothers Company, Division Of Conopco, Inc. | Quaternay oxaziridinium salts as bleaching compounds |
| US5374738A (en) * | 1993-11-22 | 1994-12-20 | Lever Brothers Company, Division Of Conopco, Inc. | Synthesis of 1,2-benzisothiazole-1,1-dioxides |
| EP0766726B1 (en) * | 1994-06-23 | 1999-07-28 | Unilever N.V. | Dishwashing compositions |
| AU2925495A (en) * | 1994-07-04 | 1996-01-25 | Unilever Plc | Washing process and composition |
| EP0691398A1 (en) | 1994-07-08 | 1996-01-10 | Unilever N.V. | Process for making polymer capsules |
| US5599781A (en) * | 1995-07-27 | 1997-02-04 | Haeggberg; Donna J. | Automatic dishwashing detergent having bleach system comprising monopersulfate, cationic bleach activator and perborate or percarbonate |
| FI973347A7 (fi) * | 1995-02-17 | 1997-08-15 | Johnson Diversey Inc | Kiinteä pesuainekappale |
| US5663132A (en) * | 1995-03-01 | 1997-09-02 | Charvid Limited Liability Company | Non-caustic composition comprising peroxygen compound and metasilicate and cleaning methods for using same |
| US6194367B1 (en) | 1995-03-01 | 2001-02-27 | Charvid Limited Liability Co. | Non-caustic cleaning composition comprising peroxygen compound and specific silicate and method of making the same in free-flowing, particulate form |
| US6034048A (en) * | 1995-03-01 | 2000-03-07 | Charvid Limited Liability Co. | Non-caustic cleaning composition using an alkali salt |
| US5898024A (en) * | 1995-03-01 | 1999-04-27 | Charvid Limited Liability | Non-caustic cleaning composition comprising peroxygen compound and specific silicate, and method of making the same in free-flowing, particulate form |
| US5653910A (en) * | 1995-06-07 | 1997-08-05 | Lever Brothers Company, Division Of Conopco Inc. | Bleaching compositions containing imine, hydrogen peroxide and a transition metal catalyst |
| DE19532717A1 (de) | 1995-09-05 | 1997-03-06 | Basf Ag | Verwendung von modifizierten Polyasparaginsäuren in Waschmitteln |
| EP0778340A3 (en) * | 1995-12-06 | 1999-10-27 | Basf Corporation | Improved non-phosphate machine dishwashing compositions containing copolymers of alkylene oxide adducts of allyl alcohol and acrylic acid |
| DE19545729A1 (de) | 1995-12-08 | 1997-06-12 | Henkel Kgaa | Bleich- und Waschmittel mit enzymatischem Bleichsystem |
| US5693603A (en) * | 1996-04-30 | 1997-12-02 | Lever Brothers Company, Division Of Conopco, Inc. | Sulfanimines as bleach catalysts |
| US5652207A (en) * | 1996-08-12 | 1997-07-29 | Lever Brothers Company, Division Of Conopco, Inc. | Phosphinoyl imines for use as oxygen transfer agents |
| DE19633305A1 (de) * | 1996-08-19 | 1998-02-26 | Clariant Gmbh | Sulphonylimin-Derivate als Bleichkatalysatoren |
| US5858949A (en) * | 1996-08-23 | 1999-01-12 | Lever Brothers Company, Division Of Conopco, Inc. | N-acylimines as bleach catalysts |
| DE19649375A1 (de) | 1996-11-29 | 1998-06-04 | Henkel Kgaa | Acetonitril-Derivate als Bleichaktivatoren in Reinigungsmitteln |
| US5753599A (en) * | 1996-12-03 | 1998-05-19 | Lever Brothers Company, Division Of Conopco, Inc. | Thiadiazole dioxides as bleach enhancers |
| US5760222A (en) * | 1996-12-03 | 1998-06-02 | Lever Brothers Company, Division Of Conopco, Inc. | Thiadiazole dioxide derived oxaziridines as bleaching compounds |
| DE19709411A1 (de) | 1997-03-07 | 1998-09-10 | Henkel Kgaa | Waschmittelformkörper |
| US5755991A (en) * | 1997-04-03 | 1998-05-26 | Lever Brothers Company, Division Of Conopco, Inc. | N-acyl oxaziridines as bleach agents |
| DE19732749A1 (de) | 1997-07-30 | 1999-02-04 | Henkel Kgaa | Glucanasehaltiges Waschmittel |
| DE19732751A1 (de) | 1997-07-30 | 1999-02-04 | Henkel Kgaa | Neue Beta-Glucanase aus Bacillus |
| DE19732750A1 (de) | 1997-07-30 | 1999-02-04 | Henkel Kgaa | Glucanasehaltiges Reinigungsmittel für harte Oberflächen |
| US6992056B1 (en) | 1997-12-30 | 2006-01-31 | Henkel Kgaa | Process for preparing detergent tablets having two or more regions |
| US6410500B1 (en) | 1997-12-30 | 2002-06-25 | Henkel Kommanditgesellschaft Auf Aktien | Moulded body dishwasher detergents with soil release polymers |
| DE19758262A1 (de) | 1997-12-31 | 1999-07-08 | Henkel Kgaa | Alkylaminotriazolhaltige, granulare Komponente für den Einsatz in Maschinengeschirrspülmitteln (MGSM) und Verfahren zu dessen Herstellung |
| DE19819187A1 (de) | 1998-04-30 | 1999-11-11 | Henkel Kgaa | Festes maschinelles Geschirrspülmittel mit Phosphat und kristallinen schichtförmigen Silikaten |
| DE19824705A1 (de) | 1998-06-03 | 1999-12-09 | Henkel Kgaa | Amylase und Protease enthaltende Wasch- und Reinigungsmittel |
| US6034047A (en) * | 1998-09-04 | 2000-03-07 | Au; Van | Bleach detergent compositions comprising nitrones and nitroso spin traps |
| DE19850100A1 (de) | 1998-10-29 | 2000-05-04 | Henkel Kgaa | Polymer-Granulate durch Wirbelschichtgranulation |
| AU2110500A (en) | 1999-02-05 | 2000-08-25 | Unilever Plc | Dish washing process and compositions relating thereto |
| DE19908051A1 (de) | 1999-02-25 | 2000-08-31 | Henkel Kgaa | Verfahren zur Herstellung compoundierter Acetonitril-Derivate |
| DE19914811A1 (de) | 1999-03-31 | 2000-10-05 | Henkel Kgaa | Enzym- und bleichaktivatorhaltige Wasch- und Reinigungsmittel |
| AU5403500A (en) | 1999-06-23 | 2001-01-31 | Breel, Greta J. | Bleaching detergent compositions |
| EP1187899A1 (en) * | 1999-06-23 | 2002-03-20 | Unilever N.V. | Method and composition for enhancing the activity of an enzyme |
| US7109156B1 (en) | 1999-08-27 | 2006-09-19 | Procter & Gamble Company | Controlled availability of formulation components, compositions and laundry methods employing same |
| US6821935B1 (en) | 1999-08-27 | 2004-11-23 | Procter & Gamble Company | Color safe laundry methods employing zwitterionic formulation components |
| JP2003508586A (ja) * | 1999-08-27 | 2003-03-04 | ザ、プロクター、エンド、ギャンブル、カンパニー | 迅速に作用する処方成分、それらの成分を使用する組成物および洗濯方法 |
| EP1206516A1 (en) | 1999-08-27 | 2002-05-22 | The Procter & Gamble Company | Stability enhancing formulation components, compositions and laundry methods employing same |
| US6825160B1 (en) | 1999-08-27 | 2004-11-30 | Procter & Gamble Company | Color safe laundry methods employing cationic formulation components |
| US6903060B1 (en) | 1999-08-27 | 2005-06-07 | Procter & Gamble Company | Stable formulation components, compositions and laundry methods employing same |
| US6818607B1 (en) * | 1999-08-27 | 2004-11-16 | Procter & Gamble Company | Bleach boosting components, compositions and laundry methods |
| DE19944218A1 (de) | 1999-09-15 | 2001-03-29 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| US6610752B1 (en) | 1999-10-09 | 2003-08-26 | Cognis Deutschland Gmbh | Defoamer granules and processes for producing the same |
| US6686327B1 (en) | 1999-10-09 | 2004-02-03 | Cognis Deutschland Gmbh & Co. Kg | Shaped bodies with improved solubility in water |
| DE19953792A1 (de) | 1999-11-09 | 2001-05-17 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19956802A1 (de) | 1999-11-25 | 2001-06-13 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19956803A1 (de) | 1999-11-25 | 2001-06-13 | Cognis Deutschland Gmbh | Tensidgranulate mit verbesserter Auflösegeschwindigkeit |
| DE19961273A1 (de) * | 1999-12-18 | 2001-07-12 | Wella Ag | Mittel und Verfahren zum Bleichen von Keratinfasern |
| DE19962883A1 (de) | 1999-12-24 | 2001-07-12 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19962886A1 (de) | 1999-12-24 | 2001-07-05 | Cognis Deutschland Gmbh | Tensidgranulate mit verbesserter Auflösegeschwindigkeit |
| DE10003124A1 (de) | 2000-01-26 | 2001-08-09 | Cognis Deutschland Gmbh | Verfahren zur Herstellung von Tensidgranulaten |
| DE10019344A1 (de) | 2000-04-18 | 2001-11-08 | Cognis Deutschland Gmbh | Wasch- und Reinigungsmittel |
| DE10019405A1 (de) | 2000-04-19 | 2001-10-25 | Cognis Deutschland Gmbh | Verfahren zur Herstellung von Waschmittelgranulaten |
| CN1192085C (zh) | 2000-06-16 | 2005-03-09 | 巴斯福股份公司 | 基于羰基合成醇的洗涤剂 |
| DE10031620A1 (de) | 2000-06-29 | 2002-01-10 | Cognis Deutschland Gmbh | Flüssigwaschmittel |
| DE10044472A1 (de) | 2000-09-08 | 2002-03-21 | Cognis Deutschland Gmbh | Waschmittel |
| DE10044471A1 (de) | 2000-09-08 | 2002-03-21 | Cognis Deutschland Gmbh | Waschmittel |
| DE10046251A1 (de) | 2000-09-19 | 2002-03-28 | Cognis Deutschland Gmbh | Wasch- und Reinigungsmittel auf Basis von Alkyl- und/oder Alkenyloligoglycosiden und Fettalkoholen |
| RU2273629C2 (ru) * | 2000-10-18 | 2006-04-10 | Адзиномото Ко., Инк. | Способы получения кристаллов натеглинида |
| BR0114896A (pt) * | 2000-10-24 | 2003-08-12 | Ajinomoto Kk | Preparação contendo nateglinida, e, método para produzir a mesma |
| DE10161766A1 (de) * | 2001-12-15 | 2003-06-26 | Clariant Gmbh | Bleichaktivator-Co-Granulate |
| DE10163856A1 (de) | 2001-12-22 | 2003-07-10 | Cognis Deutschland Gmbh | Hydroxymischether und Polymere in Form von festen Mitteln als Vorcompound für Wasch-, Spül- und Reinigungsmittel |
| US7557076B2 (en) * | 2002-06-06 | 2009-07-07 | The Procter & Gamble Company | Organic catalyst with enhanced enzyme compatibility |
| US7169744B2 (en) * | 2002-06-06 | 2007-01-30 | Procter & Gamble Company | Organic catalyst with enhanced solubility |
| DE10226521A1 (de) * | 2002-06-14 | 2003-12-24 | Degussa | Verwendung von Bleichkatalysatorkombinationen und sie enthaltende Bleichmittelzusammensetzungen |
| US7610050B2 (en) * | 2002-08-14 | 2009-10-27 | Tadaaki Chigusa | System for mobile broadband networking using dynamic quality of service provisioning |
| DE10257279A1 (de) * | 2002-12-07 | 2004-06-24 | Clariant Gmbh | Flüssige Bleichmittelkomponenten enthaltend amphiphile Polymere |
| WO2004069979A2 (en) | 2003-02-03 | 2004-08-19 | Unilever Plc | Laundry cleansing and conditioning compositions |
| US20050113246A1 (en) * | 2003-11-06 | 2005-05-26 | The Procter & Gamble Company | Process of producing an organic catalyst |
| GB2416539A (en) | 2004-07-24 | 2006-02-01 | Reckitt Benckiser | Liquid cleaning composition, catalyst therefor and methods of cleaning |
| AR051659A1 (es) * | 2005-06-17 | 2007-01-31 | Procter & Gamble | Una composicion que comprende un catalizador organico con compatibilidada enzimatica mejorada |
| DE102005039580A1 (de) | 2005-08-19 | 2007-02-22 | Henkel Kgaa | Farbschützendes Waschmittel |
| DE102008000029A1 (de) | 2008-01-10 | 2009-07-16 | Lanxess Deutschland Gmbh | Geschirrreinigungsmittel |
| DE102007003885A1 (de) | 2007-01-19 | 2008-07-24 | Lanxess Deutschland Gmbh | Geschirrreinigungsmittel |
| DE102007016391A1 (de) | 2007-04-03 | 2008-10-09 | Henkel Ag & Co. Kgaa | Farbschützendes Wasch- oder Reinigungsmittel |
| US8262804B2 (en) | 2007-10-12 | 2012-09-11 | Basf Se | Dishwasher detergent formulations comprising a mixture of hydrophobically modified polycarboxylates and hydrophilically modified polycarboxylates |
| WO2010025452A1 (en) * | 2008-08-29 | 2010-03-04 | Micro Pure Solutions, Llc | Method for treating hydrogen sulfide-containing fluids |
| TW201031743A (en) | 2008-12-18 | 2010-09-01 | Basf Se | Surfactant mixture comprising branched short-chain and branched long-chain components |
| WO2011003904A1 (de) | 2009-07-10 | 2011-01-13 | Basf Se | Tensidgemisch mit kurz- und langkettigen komponenten |
| DE102009047250A1 (de) | 2009-11-27 | 2011-06-01 | Henkel Ag & Co. Kgaa | Sulfonimine als Bleichaktivatoren |
| US20110237484A1 (en) | 2010-03-25 | 2011-09-29 | Basf Se | Electrochemical textile-washing process |
| CN102906325A (zh) | 2010-03-25 | 2013-01-30 | 巴斯夫欧洲公司 | 电化学纺织品洗涤方法 |
| US8951955B2 (en) | 2011-01-13 | 2015-02-10 | Basf Se | Use of optionally oxidized thioethers of alcohol alkoxylates in washing and cleaning compositions |
| JP5931920B2 (ja) | 2011-01-13 | 2016-06-08 | ビーエーエスエフ ソシエタス・ヨーロピアBasf Se | 洗剤及び清浄剤における、アルコールアルコキシレートの場合によって酸化されたチオエーテルの使用 |
| TR201910570T4 (tr) | 2011-01-13 | 2019-08-21 | Basf Se | Polialkilen oksitlerin gerektiği takdirde okside edilmiş tioeterlerinin yıkama ve temizleme maddeleri içerisinde kullanımı. |
| US8987183B2 (en) | 2011-01-13 | 2015-03-24 | Basf Se | Use of optionally oxidized thioethers of polyalkylene oxides in washing and cleaning compositions |
| PT2794836T (pt) | 2011-12-22 | 2016-07-25 | Unilever Nv | Composição de detergente compreendendo glutâmico-n,n-diacetato, água e agente de branqueamento |
| US9453191B2 (en) | 2013-06-12 | 2016-09-27 | Conopco, Inc. | Pourable detergent composition comprising aryl sulfonate suspended particles |
| US10323215B2 (en) | 2013-07-03 | 2019-06-18 | Basf Se | Solid polymer composition obtained by polymerization of an acid group containing monomer in the presence of a polyether compound |
| DE102015223268A1 (de) * | 2015-11-25 | 2017-06-01 | Henkel Ag & Co. Kgaa | Enzymstabilisatoren |
| PL3423558T3 (pl) | 2016-03-02 | 2019-12-31 | Unilever N.V. | Kompozycja detergentowa w postaci zawiesiny |
| AR107753A1 (es) | 2016-03-02 | 2018-05-30 | Unilever Nv | Suspensión de detergente que se puede verter que comprende una fase fluida coloreada y partículas suspendidas |
| AR107756A1 (es) | 2016-03-02 | 2018-05-30 | Unilever Nv | Composición detergente fluida y procedimiento para prepararla |
| KR20180125162A (ko) | 2016-03-16 | 2018-11-22 | 바스프 에스이 | 세척- 및 세정-활성 중합체 필름, 이들의 제조 방법 및 이들의 사용 |
| IT201600070454A1 (it) | 2016-07-06 | 2016-10-06 | 3V Sigma Spa | Attivatori di composti perossigenati |
| CA3045738A1 (en) | 2016-12-16 | 2018-06-21 | Basf Se | Washing and cleaning multi-layer films, method for the production and use thereof |
| EP3555153B1 (de) | 2016-12-16 | 2020-12-09 | Basf Se | Mehrschichtfolien, verfahren zu ihrer herstellung und deren verwendung |
| DE102016015660A1 (de) | 2016-12-31 | 2018-07-05 | Weylchem Wiesbaden Gmbh | Granulate, deren Verwendung und Wasch- und Reinigungsmittel enthaltend diese |
| WO2018202383A1 (en) | 2017-05-04 | 2018-11-08 | Unilever N.V. | Detergent composition |
| EP3622048B1 (en) | 2017-05-12 | 2023-10-25 | Unilever Global IP Limited | Automatic dishwashing detergent composition |
| EP3622049B1 (en) | 2017-05-12 | 2023-08-16 | Unilever Global IP Limited | Phosphate-free automatic dishwashing detergent composition |
| DE102017208585A1 (de) | 2017-05-22 | 2018-11-22 | Henkel Ag & Co. Kgaa | Bleichendes Wasch- oder Reinigungsmittel mit Oxaziridin-Vorläufer |
| BR112020004368A2 (pt) | 2017-09-06 | 2020-09-08 | Basf Se | película de polímero ativa de lavagem e limpeza, processo para produção de uma película de polímero ativa de lavagem e limpeza, uso de uma película de polímero, cobertura ou revestimento para uma porção de detergente ou de limpador, e, detergente ou limpador |
| ES2901780T3 (es) | 2018-02-23 | 2022-03-23 | Unilever Ip Holdings B V | Película soluble en agua que comprende aminopolicarboxilato |
| WO2020011627A1 (de) | 2018-07-11 | 2020-01-16 | Basf Se | Verfahren zur herstellung stabiler vinylimidazol-haltiger polymere |
| US20210309947A1 (en) | 2018-08-16 | 2021-10-07 | Basf Se | Water-soluble polymer films of ethylene oxide homo- or copolymers, calendering process for the production thereof and the use thereof |
| EP4017955B1 (en) | 2019-08-21 | 2023-03-22 | Unilever IP Holdings B.V. | Detergent solid composition |
| DE102020001458A1 (de) * | 2020-03-06 | 2021-09-09 | WeylChem Performance Products GmbH | Wasch- und Reinigungsmittel, Verfahren zum Desinfizieren und deren Verwendung |
| WO2021191175A1 (en) | 2020-03-24 | 2021-09-30 | Basf Se | Detergent formulation in form of a three dimensional body |
| US11505766B2 (en) | 2020-12-15 | 2022-11-22 | Henkel Ag & Co. Kgaa | Surfactant compositions for improved transparency of DADMAC-acrylic acid co-polymers |
| US11560534B2 (en) | 2020-12-15 | 2023-01-24 | Henkel Ag & Co. Kgaa | Surfactant compositions for improved transparency of DADMAC-acrylamide co-polymers |
| CN115672389B (zh) * | 2021-07-30 | 2024-07-09 | 南京工业大学 | 一种制备蜡渣改性材料的方法及应用 |
| EP4410938A1 (en) | 2023-02-02 | 2024-08-07 | AMSilk GmbH | Automatic dishwashing composition comprising a structural polypeptide |
| GB2628608A (en) | 2023-03-30 | 2024-10-02 | Reckitt Benckiser Vanish Bv | Bleach catalyst with improved performance and composition comprising said catalyst |
| GB2628610A (en) | 2023-03-30 | 2024-10-02 | Reckitt Benckiser Vanish Bv | Bleach catalyst and composition comprising said catalyst |
| DE202023000933U1 (de) * | 2023-04-27 | 2023-05-08 | WeylChem Performance Products GmbH | Geschirrspülmittel sowie dessen Verwendung |
| DE202023001670U1 (de) | 2023-08-08 | 2023-08-24 | WeylChem Performance Products GmbH | Co-Granulate, Wasch- und Reinigungsmittel enthaltend diese und deren Verwendung |
| GB202407292D0 (en) | 2024-05-22 | 2024-07-03 | Reckitt Benckiser Vanish Bv | Composition for the removal of stains and malodour |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1230785B (de) * | 1962-04-28 | 1966-12-22 | Schering Ag | Verfahren zur Herstellung von eine Azomethin-Gruppe enthaltenden Verbindungen |
| US3183266A (en) * | 1962-07-18 | 1965-05-11 | Monsanto Co | Sulfonamide compouunds |
| US3245913A (en) * | 1964-09-15 | 1966-04-12 | Monsanto Co | Bleaching compositions containing acyl sulfonamides |
| US4412934A (en) * | 1982-06-30 | 1983-11-01 | The Procter & Gamble Company | Bleaching compositions |
| DE3535167A1 (de) * | 1985-10-02 | 1987-04-09 | Boehringer Mannheim Gmbh | Neue sulfonyl-phenyl(alkyl)amine, verfahren zu ihrer herstellung sowie arzneimittel |
| DE68909958D1 (de) * | 1988-01-19 | 1993-11-25 | Tanabe Seiyaku Co | Phenoxyessigsäure-Derivate, ihre Herstellung, pharmazeutische Zusammensetzungen, die sie enthalten, und deren Verwendung. |
| US5047163A (en) * | 1990-03-16 | 1991-09-10 | Lever Brothers Company, Division Of Conopco, Inc. | Activation of bleach precursors with sulfonimines |
-
1990
- 1990-03-16 US US07/494,713 patent/US5041232A/en not_active Expired - Lifetime
-
1991
- 1991-02-28 ES ES91200427T patent/ES2061156T3/es not_active Expired - Lifetime
- 1991-02-28 DE DE69104405T patent/DE69104405T2/de not_active Expired - Fee Related
- 1991-02-28 EP EP91200427A patent/EP0453003B1/en not_active Expired - Lifetime
- 1991-03-08 CA CA002037800A patent/CA2037800C/en not_active Expired - Fee Related
- 1991-03-13 NO NO910995A patent/NO177431C/no not_active IP Right Cessation
- 1991-03-13 AU AU72870/91A patent/AU636724B2/en not_active Ceased
- 1991-03-14 MY MYPI91000422A patent/MY105354A/en unknown
- 1991-03-14 IN IN72/BOM/91A patent/IN171767B/en unknown
- 1991-03-15 JP JP3128845A patent/JPH0749597B2/ja not_active Expired - Lifetime
- 1991-03-15 BR BR919101036A patent/BR9101036A/pt not_active IP Right Cessation
- 1991-03-15 ZA ZA911936A patent/ZA911936B/xx unknown
- 1991-03-16 KR KR1019910004183A patent/KR950002353B1/ko not_active Expired - Fee Related
- 1991-04-12 TW TW080102809A patent/TW277072B/zh active
- 1991-07-16 US US07/731,839 patent/US5463115A/en not_active Expired - Fee Related
Non-Patent Citations (3)
| Title |
|---|
| CHEMICALABSTRACTSVOL.80,NO.11213(1974) |
| CHEMICALABSTRACTSVOL.81,NO.37363(1974) |
| J.AMER.CHEM.SOC.VOL.102,P.2000〜2005(1980) |
Also Published As
| Publication number | Publication date |
|---|---|
| ZA911936B (en) | 1992-11-25 |
| DE69104405T2 (de) | 1995-02-09 |
| JPH04227697A (ja) | 1992-08-17 |
| AU7287091A (en) | 1991-09-19 |
| NO910995L (no) | 1991-09-17 |
| TW277072B (member.php) | 1996-06-01 |
| AU636724B2 (en) | 1993-05-06 |
| US5463115A (en) | 1995-10-31 |
| IN171767B (member.php) | 1993-01-02 |
| CA2037800C (en) | 1997-11-18 |
| DE69104405D1 (de) | 1994-11-10 |
| ES2061156T3 (es) | 1994-12-01 |
| CA2037800A1 (en) | 1991-09-17 |
| NO177431B (no) | 1995-06-06 |
| EP0453003B1 (en) | 1994-10-05 |
| KR910016910A (ko) | 1991-11-05 |
| US5041232A (en) | 1991-08-20 |
| NO177431C (no) | 1995-09-13 |
| NO910995D0 (no) | 1991-03-13 |
| KR950002353B1 (ko) | 1995-03-16 |
| BR9101036A (pt) | 1991-11-05 |
| MY105354A (en) | 1994-09-30 |
| EP0453003A2 (en) | 1991-10-23 |
| EP0453003A3 (en) | 1992-05-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5041232A (en) | Sulfonimines as bleach catalysts | |
| CA2038209C (en) | Low-temperature bleaching compositions | |
| CA2038010C (en) | N-sulfonyloxaziridines as bleaching compounds | |
| US5753599A (en) | Thiadiazole dioxides as bleach enhancers | |
| EP0728181B1 (en) | Quarternary oxaziridinium salts as bleaching compounds | |
| US5693603A (en) | Sulfanimines as bleach catalysts | |
| WO1995013352A1 (en) | Imine quaternary salts as bleach catalysts | |
| US5652207A (en) | Phosphinoyl imines for use as oxygen transfer agents | |
| US5760222A (en) | Thiadiazole dioxide derived oxaziridines as bleaching compounds | |
| US5858949A (en) | N-acylimines as bleach catalysts | |
| JPH01311199A (ja) | 漂白剤組成物 | |
| EP1038946A2 (en) | N-acylimines as bleach catalysts | |
| US5429768A (en) | Grignard reaction intermediates as bleach catalysts |