JP6759100B2 - 治療用阻害化合物 - Google Patents
治療用阻害化合物 Download PDFInfo
- Publication number
- JP6759100B2 JP6759100B2 JP2016544593A JP2016544593A JP6759100B2 JP 6759100 B2 JP6759100 B2 JP 6759100B2 JP 2016544593 A JP2016544593 A JP 2016544593A JP 2016544593 A JP2016544593 A JP 2016544593A JP 6759100 B2 JP6759100 B2 JP 6759100B2
- Authority
- JP
- Japan
- Prior art keywords
- methyl
- isonicotinamide
- chloro
- amino
- fluoro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 150000001875 compounds Chemical class 0.000 title claims description 110
- 229940124788 therapeutic inhibitor Drugs 0.000 title 1
- -1 quinoline-6-yl Chemical group 0.000 claims description 419
- VFQXVTODMYMSMJ-UHFFFAOYSA-N isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 claims description 393
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 347
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 128
- 125000006706 (C3-C6) carbocyclyl group Chemical group 0.000 claims description 92
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 78
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 74
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 71
- 125000005862 (C1-C6)alkanoyl group Chemical group 0.000 claims description 69
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 67
- 125000004423 acyloxy group Chemical group 0.000 claims description 67
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 66
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 66
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 62
- 125000004043 oxo group Chemical group O=* 0.000 claims description 45
- 150000003839 salts Chemical class 0.000 claims description 41
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 38
- 125000001072 heteroaryl group Chemical group 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 201000010099 disease Diseases 0.000 claims description 33
- 108090000113 Plasma Kallikrein Proteins 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 125000004452 carbocyclyl group Chemical group 0.000 claims description 17
- 102000003827 Plasma Kallikrein Human genes 0.000 claims description 16
- 125000001589 carboacyl group Chemical group 0.000 claims description 14
- 125000002619 bicyclic group Chemical group 0.000 claims description 12
- 125000001475 halogen functional group Chemical group 0.000 claims description 11
- 238000011282 treatment Methods 0.000 claims description 11
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 claims description 10
- 150000001345 alkine derivatives Chemical class 0.000 claims description 10
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 9
- 230000005764 inhibitory process Effects 0.000 claims description 8
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 8
- 241001465754 Metazoa Species 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 229940079593 drug Drugs 0.000 claims description 4
- BLTDCIWCFCUQCB-UHFFFAOYSA-N quinoline-3-carboxamide Chemical compound C1=CC=CC2=CC(C(=O)N)=CN=C21 BLTDCIWCFCUQCB-UHFFFAOYSA-N 0.000 claims description 4
- 230000001225 therapeutic effect Effects 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 230000000069 prophylactic effect Effects 0.000 claims description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- MMCJLYCJFRWDCV-UHFFFAOYSA-N 6-[[4-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyridin-2-yl]methyl]-2-methylquinoline-8-carboxylic acid Chemical compound NC1=NC=CC2=CC(=CC=C12)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=CC(=NC2=C(C1)C(=O)O)C MMCJLYCJFRWDCV-UHFFFAOYSA-N 0.000 claims description 2
- SZHNXIGFJHGJPV-UHFFFAOYSA-N 6-[[4-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-fluoroquinoline-8-carboxylic acid Chemical compound NC1=NC=CC2=CC(=CC=C12)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C1)C(=O)O)F SZHNXIGFJHGJPV-UHFFFAOYSA-N 0.000 claims description 2
- DGYIVJWJOOTDHH-UHFFFAOYSA-N 6-[[4-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-methylisoquinoline-8-carboxylic acid Chemical compound NC1=NC=CC2=CC(=CC=C12)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(N=CC2=C(C=1)C(=O)O)C DGYIVJWJOOTDHH-UHFFFAOYSA-N 0.000 claims description 2
- YURLJGUCQVFTFB-UHFFFAOYSA-N 6-[[4-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-methylquinoline-8-carboxylic acid Chemical compound NC1=NC=CC2=CC(=CC=C12)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)O)C YURLJGUCQVFTFB-UHFFFAOYSA-N 0.000 claims description 2
- 238000013160 medical therapy Methods 0.000 claims description 2
- YMNAJWHTELQUJU-UHFFFAOYSA-N quinoline-6-carboxamide Chemical compound N1=CC=CC2=CC(C(=O)N)=CC=C21 YMNAJWHTELQUJU-UHFFFAOYSA-N 0.000 claims description 2
- MXZANEWAFZMPKW-UHFFFAOYSA-N imidazol-1-amine Chemical compound NN1C=CN=C1 MXZANEWAFZMPKW-UHFFFAOYSA-N 0.000 claims 5
- HPQRQAOVNXWEEQ-UHFFFAOYSA-N quinoline-8-carboxamide Chemical compound C1=CN=C2C(C(=O)N)=CC=CC2=C1 HPQRQAOVNXWEEQ-UHFFFAOYSA-N 0.000 claims 5
- AMXUVPYSCZKFNM-UHFFFAOYSA-N 3-methyl-2h-imidazol-1-amine Chemical compound CN1CN(N)C=C1 AMXUVPYSCZKFNM-UHFFFAOYSA-N 0.000 claims 4
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 claims 3
- ZEXKKIXCRDTKBF-UHFFFAOYSA-N quinoline-2-carboxamide Chemical compound C1=CC=CC2=NC(C(=O)N)=CC=C21 ZEXKKIXCRDTKBF-UHFFFAOYSA-N 0.000 claims 3
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims 2
- KEJFADGISRFLFO-UHFFFAOYSA-N 1H-indazol-6-amine Chemical compound NC1=CC=C2C=NNC2=C1 KEJFADGISRFLFO-UHFFFAOYSA-N 0.000 claims 1
- ZEVNHPCICZZSBU-UHFFFAOYSA-N 6-[[4-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-chloroquinoline-8-carboxamide Chemical compound NC1=NC=CC2=CC(=CC=C12)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)Cl ZEVNHPCICZZSBU-UHFFFAOYSA-N 0.000 claims 1
- AVMNYBKKWARJKT-UHFFFAOYSA-N 6-[[4-[(1-aminoisoquinolin-6-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-methylquinoline-8-carboxamide Chemical compound NC1=NC=CC2=CC(=CC=C12)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)C AVMNYBKKWARJKT-UHFFFAOYSA-N 0.000 claims 1
- CFJXZEDRAADQFI-UHFFFAOYSA-N 6-[[4-[(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-methylquinoline-8-carboxamide Chemical compound ClC1=CNC2=NC=C(C=C21)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)C CFJXZEDRAADQFI-UHFFFAOYSA-N 0.000 claims 1
- LJDMUPONZYUBTQ-UHFFFAOYSA-N 6-[[4-[(3-chloro-4-fluoro-1H-indol-5-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-methylquinoline-8-carboxamide Chemical compound ClC1=CNC2=CC=C(C(=C12)F)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)C LJDMUPONZYUBTQ-UHFFFAOYSA-N 0.000 claims 1
- WETFPOPVXHIHFG-UHFFFAOYSA-N 6-[[4-[(3-chloro-6-fluoro-1H-indol-5-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-methylquinoline-8-carboxamide Chemical compound ClC1=CNC2=CC(=C(C=C12)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)C)F WETFPOPVXHIHFG-UHFFFAOYSA-N 0.000 claims 1
- KIVLLFJSACGLHN-UHFFFAOYSA-N 6-[[4-[(5-chloro-2H-indazol-3-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-methylquinoline-8-carboxamide Chemical compound ClC=1C=C2C(=NNC2=CC=1)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)C KIVLLFJSACGLHN-UHFFFAOYSA-N 0.000 claims 1
- INWUNFFPSCFXCA-UHFFFAOYSA-N 6-[[4-[(6-amino-2,4-dimethylpyridin-3-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-chloroquinoline-8-carboxamide Chemical compound NC1=CC(=C(C(=N1)C)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)Cl)C INWUNFFPSCFXCA-UHFFFAOYSA-N 0.000 claims 1
- BVAYWMZNSZGAMT-UHFFFAOYSA-N 6-[[4-[(6-amino-2,4-dimethylpyridin-3-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-chloroquinoline-8-carboxylic acid Chemical compound NC1=CC(=C(C(=N1)C)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)O)Cl)C BVAYWMZNSZGAMT-UHFFFAOYSA-N 0.000 claims 1
- WTBBASBLRSFZPD-UHFFFAOYSA-N 6-[[4-[(6-amino-2-methylpyridin-3-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-chloroquinoline-8-carboxamide Chemical compound NC1=CC=C(C(=N1)C)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)Cl WTBBASBLRSFZPD-UHFFFAOYSA-N 0.000 claims 1
- OWMRLFMYSUGJHS-UHFFFAOYSA-N 6-[[4-[(6-amino-2-methylpyridin-3-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-chloroquinoline-8-carboxylic acid Chemical compound NC1=CC=C(C(=N1)C)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)O)Cl OWMRLFMYSUGJHS-UHFFFAOYSA-N 0.000 claims 1
- ZAZOBWBMBQVKFV-UHFFFAOYSA-N 6-[[4-[(6-amino-4-methylpyridin-3-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-chloroquinoline-8-carboxamide Chemical compound NC1=CC(=C(C=N1)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)Cl)C ZAZOBWBMBQVKFV-UHFFFAOYSA-N 0.000 claims 1
- UZTOCULVDVRYTA-UHFFFAOYSA-N 6-[[4-[(6-fluoro-1H-indol-5-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-methylquinoline-8-carboxamide Chemical compound FC1=C(C=C2C=CNC2=C1)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)N)C UZTOCULVDVRYTA-UHFFFAOYSA-N 0.000 claims 1
- XRSVMKZHXCTYQX-UHFFFAOYSA-N N-[(6-amino-2,4-dimethylpyridin-3-yl)methyl]-2-[(3-chloro-1-oxidoquinolin-1-ium-6-yl)methyl]pyridine-4-carboxamide Chemical compound NC1=CC(=C(C(=N1)C)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=[N+](C2=CC=1)[O-])Cl)C XRSVMKZHXCTYQX-UHFFFAOYSA-N 0.000 claims 1
- WDMJJASBQUYWJX-UHFFFAOYSA-N N-[(6-amino-2,4-dimethylpyridin-3-yl)methyl]-2-[(3-chloroquinolin-6-yl)methyl]-6-methylpyridine-4-carboxamide Chemical compound NC1=CC(=C(C(=N1)C)CNC(C1=CC(=NC(=C1)C)CC=1C=C2C=C(C=NC2=CC=1)Cl)=O)C WDMJJASBQUYWJX-UHFFFAOYSA-N 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- YFEQLRSQCAMBNR-UHFFFAOYSA-N methyl 6-[[4-[(6-amino-2,4-dimethylpyridin-3-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-chloroquinoline-8-carboxylate Chemical compound NC1=CC(=C(C(=N1)C)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)OC)Cl)C YFEQLRSQCAMBNR-UHFFFAOYSA-N 0.000 claims 1
- JHWMKRJZPWMJLH-UHFFFAOYSA-N methyl 6-[[4-[(6-amino-2-methylpyridin-3-yl)methylcarbamoyl]pyridin-2-yl]methyl]-3-chloroquinoline-8-carboxylate Chemical compound NC1=CC=C(C(=N1)C)CNC(=O)C1=CC(=NC=C1)CC=1C=C2C=C(C=NC2=C(C=1)C(=O)OC)Cl JHWMKRJZPWMJLH-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 433
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 414
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 245
- 239000007787 solid Substances 0.000 description 205
- 239000000243 solution Substances 0.000 description 188
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 180
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 158
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 122
- 235000005152 nicotinamide Nutrition 0.000 description 121
- 239000011570 nicotinamide Substances 0.000 description 121
- 229960003966 nicotinamide Drugs 0.000 description 116
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 101
- 238000003818 flash chromatography Methods 0.000 description 93
- 125000005843 halogen group Chemical group 0.000 description 86
- 239000012044 organic layer Substances 0.000 description 86
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 84
- 239000011734 sodium Substances 0.000 description 82
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 81
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 80
- 239000012267 brine Substances 0.000 description 79
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 75
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 75
- 238000002360 preparation method Methods 0.000 description 70
- 238000005481 NMR spectroscopy Methods 0.000 description 63
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 61
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 53
- 230000002829 reductive effect Effects 0.000 description 50
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 49
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 48
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 45
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 44
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 44
- 239000007821 HATU Substances 0.000 description 40
- 235000019439 ethyl acetate Nutrition 0.000 description 36
- 239000000706 filtrate Substances 0.000 description 35
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 34
- 229920006395 saturated elastomer Polymers 0.000 description 34
- 239000000741 silica gel Substances 0.000 description 34
- 229910002027 silica gel Inorganic materials 0.000 description 34
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 32
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 31
- 239000003921 oil Substances 0.000 description 31
- 235000019198 oils Nutrition 0.000 description 31
- 125000000623 heterocyclic group Chemical group 0.000 description 30
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 28
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 26
- 238000012746 preparative thin layer chromatography Methods 0.000 description 25
- 239000011541 reaction mixture Substances 0.000 description 25
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 24
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 24
- 125000003118 aryl group Chemical group 0.000 description 24
- 239000002244 precipitate Substances 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- WFFSCKVEIPZZQX-UHFFFAOYSA-N [5-chloro-1-(oxan-2-yl)indazol-3-yl]methanamine Chemical compound ClC=1C=C2C(=NN(C2=CC1)C1OCCCC1)CN WFFSCKVEIPZZQX-UHFFFAOYSA-N 0.000 description 20
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 20
- 229910052717 sulfur Inorganic materials 0.000 description 20
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 17
- 238000001816 cooling Methods 0.000 description 17
- 125000001424 substituent group Chemical group 0.000 description 17
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 15
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 239000005457 ice water Substances 0.000 description 14
- 125000004076 pyridyl group Chemical group 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 13
- 238000000034 method Methods 0.000 description 13
- CAKMJEWKVRFHFN-UHFFFAOYSA-N 1-[[4-(bromomethyl)phenyl]methyl]pyridin-2-one Chemical compound BrCC1=CC=C(CN2C=CC=CC2=O)C=C1 CAKMJEWKVRFHFN-UHFFFAOYSA-N 0.000 description 12
- 206010019860 Hereditary angioedema Diseases 0.000 description 12
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 12
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 12
- 229910052760 oxygen Inorganic materials 0.000 description 12
- 238000002953 preparative HPLC Methods 0.000 description 12
- 238000000746 purification Methods 0.000 description 12
- 230000008728 vascular permeability Effects 0.000 description 12
- 239000007788 liquid Substances 0.000 description 11
- 235000001968 nicotinic acid Nutrition 0.000 description 11
- 239000011664 nicotinic acid Substances 0.000 description 11
- 239000003960 organic solvent Substances 0.000 description 11
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 10
- 150000003840 hydrochlorides Chemical class 0.000 description 10
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- 108700040183 Complement C1 Inhibitor Proteins 0.000 description 9
- 102000001399 Kallikrein Human genes 0.000 description 9
- 108060005987 Kallikrein Proteins 0.000 description 9
- 206010030113 Oedema Diseases 0.000 description 9
- 239000012230 colorless oil Substances 0.000 description 9
- BVOCPVIXARZNQN-UHFFFAOYSA-N nipecotamide Chemical compound NC(=O)C1CCCNC1 BVOCPVIXARZNQN-UHFFFAOYSA-N 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 8
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- 102000055157 Complement C1 Inhibitor Human genes 0.000 description 8
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 150000003857 carboxamides Chemical class 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- NKFLEFWUYAUDJV-UHFFFAOYSA-N pyridine-3-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CN=C1 NKFLEFWUYAUDJV-UHFFFAOYSA-N 0.000 description 8
- 125000006413 ring segment Chemical group 0.000 description 8
- 208000028185 Angioedema Diseases 0.000 description 7
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 7
- 101800004538 Bradykinin Proteins 0.000 description 7
- 108010071241 Factor XIIa Proteins 0.000 description 7
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 7
- 239000002552 dosage form Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 125000005842 heteroatom Chemical group 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 125000002950 monocyclic group Chemical group 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- 239000011593 sulfur Substances 0.000 description 7
- KTYCNUGSMBTSNM-UHFFFAOYSA-N 1-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyrazole-4-carboxamide Chemical compound NC(=O)C1=CN(CC2=CC=C(CN3C=CC=CC3=O)C=C2)N=C1 KTYCNUGSMBTSNM-UHFFFAOYSA-N 0.000 description 6
- JXTRIVPVXWEYTR-UHFFFAOYSA-N 5-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyridine-3-carboxylic acid Chemical compound O=C1N(C=CC=C1)CC1=CC=C(CC=2C=NC=C(C(=O)O)C2)C=C1 JXTRIVPVXWEYTR-UHFFFAOYSA-N 0.000 description 6
- 102400000967 Bradykinin Human genes 0.000 description 6
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 6
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 210000004369 blood Anatomy 0.000 description 6
- 239000008280 blood Substances 0.000 description 6
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 6
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 6
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 230000037361 pathway Effects 0.000 description 6
- JAEIBKXSIXOLOL-UHFFFAOYSA-N pyrrolidin-1-ium-3-carboxylate Chemical compound OC(=O)C1CCNC1 JAEIBKXSIXOLOL-UHFFFAOYSA-N 0.000 description 6
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 239000000377 silicon dioxide Substances 0.000 description 6
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 5
- FVNCILPDWNBPLK-UHFFFAOYSA-N 5-chloro-1h-indazole Chemical compound ClC1=CC=C2NN=CC2=C1 FVNCILPDWNBPLK-UHFFFAOYSA-N 0.000 description 5
- PFTJVNMNBGTQEO-UHFFFAOYSA-N ClC=1C=C2C=NN(C2=CC=1)C1OCCCC1 Chemical compound ClC=1C=C2C=NN(C2=CC=1)C1OCCCC1 PFTJVNMNBGTQEO-UHFFFAOYSA-N 0.000 description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 5
- 208000006011 Stroke Diseases 0.000 description 5
- 125000006193 alkinyl group Chemical group 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 208000006752 brain edema Diseases 0.000 description 5
- 239000000872 buffer Substances 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- PCPIANOJERKFJI-UHFFFAOYSA-N ethyl 5-bromopyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=CC(Br)=C1 PCPIANOJERKFJI-UHFFFAOYSA-N 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- IVXQBCUBSIPQGU-UHFFFAOYSA-N piperazine-1-carboxamide Chemical compound NC(=O)N1CCNCC1 IVXQBCUBSIPQGU-UHFFFAOYSA-N 0.000 description 5
- 235000019260 propionic acid Nutrition 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 210000001519 tissue Anatomy 0.000 description 5
- BMWLNIGDPPZVER-UHFFFAOYSA-N 5-chloro-1-(oxan-2-yl)indazole-3-carbaldehyde Chemical compound ClC=1C=C2C(=NN(C2=CC1)C1OCCCC1)C=O BMWLNIGDPPZVER-UHFFFAOYSA-N 0.000 description 4
- GVCADJPWQQFPRC-UHFFFAOYSA-N 5-chloro-1-(oxan-2-yl)indazole-3-carboxamide Chemical compound ClC=1C=C2C(=NN(C2=CC=1)C1OCCCC1)C(=O)N GVCADJPWQQFPRC-UHFFFAOYSA-N 0.000 description 4
- 239000005711 Benzoic acid Substances 0.000 description 4
- 206010048962 Brain oedema Diseases 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 4
- 235000010233 benzoic acid Nutrition 0.000 description 4
- 210000004204 blood vessel Anatomy 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 4
- 229920001577 copolymer Chemical group 0.000 description 4
- 206010012601 diabetes mellitus Diseases 0.000 description 4
- 125000005959 diazepanyl group Chemical group 0.000 description 4
- 208000014674 injury Diseases 0.000 description 4
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 4
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 4
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 230000002265 prevention Effects 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 125000003226 pyrazolyl group Chemical group 0.000 description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 description 4
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 4
- IQHXABCGSFAKPN-UHFFFAOYSA-N pyrrolidine-3-carboxamide Chemical compound NC(=O)C1CCNC1 IQHXABCGSFAKPN-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 4
- 238000001356 surgical procedure Methods 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 4
- QBPISWMTLKTKMK-UHFFFAOYSA-N 1-[(4-aminophenyl)methyl]pyridin-2-one Chemical compound C1=CC(N)=CC=C1CN1C(=O)C=CC=C1 QBPISWMTLKTKMK-UHFFFAOYSA-N 0.000 description 3
- FLKPMUGQSVUXQX-UHFFFAOYSA-N 1-[[4-(bromomethyl)-2,5-difluorophenyl]methyl]pyridin-2-one Chemical compound FC1=CC(CN2C=CC=CC2=O)=C(F)C=C1CBr FLKPMUGQSVUXQX-UHFFFAOYSA-N 0.000 description 3
- FXYWGUBGJNTING-UHFFFAOYSA-N 2,2,2-trifluoro-1-(1H-pyrazol-4-yl)ethanamine Chemical compound FC(C(N)C=1C=NNC1)(F)F FXYWGUBGJNTING-UHFFFAOYSA-N 0.000 description 3
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 3
- HCIPPBTZCOKQJJ-UHFFFAOYSA-N 5-chloro-1-(oxan-2-yl)indazole-3-carboxylic acid Chemical compound ClC=1C=C2C(=NN(C2=CC1)C1OCCCC1)C(=O)O HCIPPBTZCOKQJJ-UHFFFAOYSA-N 0.000 description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- 108010080805 Factor XIa Proteins 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- 206010061218 Inflammation Diseases 0.000 description 3
- 229940127379 Kallikrein Inhibitors Drugs 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 3
- 102000035195 Peptidases Human genes 0.000 description 3
- 108091005804 Peptidases Proteins 0.000 description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000004365 Protease Substances 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- 208000017442 Retinal disease Diseases 0.000 description 3
- 206010038923 Retinopathy Diseases 0.000 description 3
- 102000012479 Serine Proteases Human genes 0.000 description 3
- 108010022999 Serine Proteases Proteins 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 125000005997 bromomethyl group Chemical group 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 125000002883 imidazolyl group Chemical group 0.000 description 3
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 230000004054 inflammatory process Effects 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 description 3
- 230000035772 mutation Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Chemical compound CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 3
- 229960003512 nicotinic acid Drugs 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 125000005961 oxazepanyl group Chemical group 0.000 description 3
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 125000003373 pyrazinyl group Chemical group 0.000 description 3
- 230000002441 reversible effect Effects 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 125000003831 tetrazolyl group Chemical group 0.000 description 3
- 125000000335 thiazolyl group Chemical group 0.000 description 3
- 230000008733 trauma Effects 0.000 description 3
- 125000001425 triazolyl group Chemical group 0.000 description 3
- 230000002792 vascular Effects 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- RBZMSGOBSOCYHR-UHFFFAOYSA-N 1,4-bis(bromomethyl)benzene Chemical compound BrCC1=CC=C(CBr)C=C1 RBZMSGOBSOCYHR-UHFFFAOYSA-N 0.000 description 2
- 125000005960 1,4-diazepanyl group Chemical group 0.000 description 2
- GZSQZAUUUAKIAV-UHFFFAOYSA-N 1-(2-amino-5-chlorophenyl)-2-chloroethanone Chemical compound NC1=CC=C(Cl)C=C1C(=O)CCl GZSQZAUUUAKIAV-UHFFFAOYSA-N 0.000 description 2
- MSZPGLFCFZTVOE-UHFFFAOYSA-N 1-[5-chloro-1-(oxan-2-yl)indazol-3-yl]ethanamine Chemical compound CC(N)C1=NN(C2CCCCO2)C2=C1C=C(Cl)C=C2 MSZPGLFCFZTVOE-UHFFFAOYSA-N 0.000 description 2
- RSJYPHNEVVPLOI-UHFFFAOYSA-N 1-[[2,5-difluoro-4-(hydroxymethyl)phenyl]methyl]pyridin-2-one Chemical compound OCC1=CC(F)=C(CN2C=CC=CC2=O)C=C1F RSJYPHNEVVPLOI-UHFFFAOYSA-N 0.000 description 2
- HJUWCRFHZWYDCU-UHFFFAOYSA-N 1-[[2-chloro-4-(chloromethyl)phenyl]methyl]pyridin-2-one Chemical compound ClCC1=CC(Cl)=C(CN2C=CC=CC2=O)C=C1 HJUWCRFHZWYDCU-UHFFFAOYSA-N 0.000 description 2
- KEPRUIOBTMBCTL-UHFFFAOYSA-N 1-[[2-chloro-4-(hydroxymethyl)phenyl]methyl]pyridin-2-one Chemical compound OCC1=CC(Cl)=C(CN2C=CC=CC2=O)C=C1 KEPRUIOBTMBCTL-UHFFFAOYSA-N 0.000 description 2
- ODQFZFBMRZOZOP-UHFFFAOYSA-N 1-[[4-(bromomethyl)-2-fluorophenyl]methyl]pyridin-2-one Chemical compound FC1=C(CN2C=CC=CC2=O)C=CC(CBr)=C1 ODQFZFBMRZOZOP-UHFFFAOYSA-N 0.000 description 2
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 2
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 2
- MVXVYAKCVDQRLW-UHFFFAOYSA-N 1h-pyrrolo[2,3-b]pyridine Chemical compound C1=CN=C2NC=CC2=C1 MVXVYAKCVDQRLW-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- JVEFAEVNIJRYLS-UHFFFAOYSA-N 2-[(5-chloro-1-methylindazol-3-yl)methyl]isoindole-1,3-dione Chemical compound CN1N=C(CN2C(=O)C3=C(C=CC=C3)C2=O)C2=C1C=CC(Cl)=C2 JVEFAEVNIJRYLS-UHFFFAOYSA-N 0.000 description 2
- IPOOTYCEECTTMN-UHFFFAOYSA-N 2-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyridine-4-carboxylic acid Chemical compound O=C1N(C=CC=C1)CC1=CC=C(CC=2C=C(C(=O)O)C=CN=2)C=C1 IPOOTYCEECTTMN-UHFFFAOYSA-N 0.000 description 2
- GHPKOOQUYUPSPB-UHFFFAOYSA-N 2-amino-2-[5-chloro-1-(oxan-2-yl)indazol-3-yl]acetonitrile Chemical compound NC(C#N)C1=NN(C2=CC=C(C=C12)Cl)C1OCCCC1 GHPKOOQUYUPSPB-UHFFFAOYSA-N 0.000 description 2
- 125000000979 2-amino-2-oxoethyl group Chemical group [H]C([*])([H])C(=O)N([H])[H] 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 125000004398 2-methyl-2-butyl group Chemical group CC(C)(CC)* 0.000 description 2
- 125000004918 2-methyl-2-pentyl group Chemical group CC(C)(CCC)* 0.000 description 2
- 125000004922 2-methyl-3-pentyl group Chemical group CC(C)C(CC)* 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- 125000004326 2H-pyran-2-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])(*)O1 0.000 description 2
- NNPPMZMOXNGEEC-UHFFFAOYSA-N 3-(4-formylphenyl)sulfanylbenzoic acid Chemical compound C(=O)C1=CC=C(C=C1)SC=1C=C(C(=O)O)C=CC1 NNPPMZMOXNGEEC-UHFFFAOYSA-N 0.000 description 2
- CMHVKEINVLWJIC-UHFFFAOYSA-N 3-[4-[(2-oxopyridin-1-yl)methyl]phenoxy]benzoic acid Chemical compound OC(=O)C1=CC(OC2=CC=C(CN3C=CC=CC3=O)C=C2)=CC=C1 CMHVKEINVLWJIC-UHFFFAOYSA-N 0.000 description 2
- FTCRIWKONFSXGO-UHFFFAOYSA-N 3-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]benzoic acid Chemical compound OC(=O)C1=CC(CC2=CC=C(CN3C=CC=CC3=O)C=C2)=CC=C1 FTCRIWKONFSXGO-UHFFFAOYSA-N 0.000 description 2
- 125000000981 3-amino-3-oxopropyl group Chemical group [H]C([*])([H])C([H])([H])C(=O)N([H])[H] 0.000 description 2
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 2
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 2
- 125000004917 3-methyl-2-butyl group Chemical group CC(C(C)*)C 0.000 description 2
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 2
- QHSOULMKCRQKHR-UHFFFAOYSA-N 5-[4-[(2-oxopyridin-1-yl)methyl]phenoxy]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(OC2=CC=C(CN3C=CC=CC3=O)C=C2)=CN=C1 QHSOULMKCRQKHR-UHFFFAOYSA-N 0.000 description 2
- BTJVOWSYVIIEGL-UHFFFAOYSA-N 5-[[2,5-difluoro-4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(CC2=C(F)C=C(CN3C=CC=CC3=O)C(F)=C2)=CN=C1 BTJVOWSYVIIEGL-UHFFFAOYSA-N 0.000 description 2
- QRXMUCSWCMTJGU-UHFFFAOYSA-N 5-bromo-4-chloro-3-indolyl phosphate Chemical compound C1=C(Br)C(Cl)=C2C(OP(O)(=O)O)=CNC2=C1 QRXMUCSWCMTJGU-UHFFFAOYSA-N 0.000 description 2
- LDYDVRNVSHVIBN-UHFFFAOYSA-N 5-chloro-1h-indazole-3-carboxamide Chemical compound C1=C(Cl)C=C2C(C(=O)N)=NNC2=C1 LDYDVRNVSHVIBN-UHFFFAOYSA-N 0.000 description 2
- WHAJIAULUPQHHZ-UHFFFAOYSA-N 5-chloro-1h-indazole-3-carboxylic acid Chemical compound C1=C(Cl)C=C2C(C(=O)O)=NNC2=C1 WHAJIAULUPQHHZ-UHFFFAOYSA-N 0.000 description 2
- USFRWHBPXGUKFJ-UHFFFAOYSA-N 5-chloro-3-(chloromethyl)-2h-indazole Chemical compound C1=CC(Cl)=CC2=C(CCl)NN=C21 USFRWHBPXGUKFJ-UHFFFAOYSA-N 0.000 description 2
- QRQSPXDYDXCXDB-UHFFFAOYSA-N 6-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyridine-2-carboxylic acid Chemical compound O=C1N(C=CC=C1)CC1=CC=C(CC2=CC=CC(=N2)C(=O)O)C=C1 QRQSPXDYDXCXDB-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 2
- 208000000884 Airway Obstruction Diseases 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- 241000167854 Bourreria succulenta Species 0.000 description 2
- 229940122155 Bradykinin receptor antagonist Drugs 0.000 description 2
- 201000006474 Brain Ischemia Diseases 0.000 description 2
- 238000007125 Buchwald synthesis reaction Methods 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 208000002177 Cataract Diseases 0.000 description 2
- 206010008111 Cerebral haemorrhage Diseases 0.000 description 2
- 206010008120 Cerebral ischaemia Diseases 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 206010051055 Deep vein thrombosis Diseases 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- 206010012689 Diabetic retinopathy Diseases 0.000 description 2
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 108010054265 Factor VIIa Proteins 0.000 description 2
- 229930091371 Fructose Natural products 0.000 description 2
- 239000005715 Fructose Substances 0.000 description 2
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 208000001344 Macular Edema Diseases 0.000 description 2
- 206010025415 Macular oedema Diseases 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- WAWLKWWMWLWFSO-UHFFFAOYSA-N OC(=O)C1=CC(=CC=C1)C(F)(F)C1=CC=C(CN2C=CC=CC2=O)C=C1 Chemical compound OC(=O)C1=CC(=CC=C1)C(F)(F)C1=CC=C(CN2C=CC=CC2=O)C=C1 WAWLKWWMWLWFSO-UHFFFAOYSA-N 0.000 description 2
- AYWXAUACGJPKNH-UHFFFAOYSA-N OC(=O)C1=CC(CC2=CC(F)=C(CN3C=CC=CC3=O)C=C2)=CN=C1 Chemical compound OC(=O)C1=CC(CC2=CC(F)=C(CN3C=CC=CC3=O)C=C2)=CN=C1 AYWXAUACGJPKNH-UHFFFAOYSA-N 0.000 description 2
- 208000002193 Pain Diseases 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 206010063837 Reperfusion injury Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 238000006069 Suzuki reaction reaction Methods 0.000 description 2
- 238000006887 Ullmann reaction Methods 0.000 description 2
- 206010047249 Venous thrombosis Diseases 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 206010064930 age-related macular degeneration Diseases 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 239000012131 assay buffer Substances 0.000 description 2
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- IPWKHHSGDUIRAH-UHFFFAOYSA-N bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 2
- 230000023555 blood coagulation Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 230000002612 cardiopulmonary effect Effects 0.000 description 2
- 206010008118 cerebral infarction Diseases 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000019693 cherries Nutrition 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 210000002889 endothelial cell Anatomy 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- 206010015037 epilepsy Diseases 0.000 description 2
- QAUASTLEZAPQTB-UHFFFAOYSA-N ethyl 3-bromobenzoate Chemical compound CCOC(=O)C1=CC=CC(Br)=C1 QAUASTLEZAPQTB-UHFFFAOYSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 229940012414 factor viia Drugs 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 235000011194 food seasoning agent Nutrition 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 210000001035 gastrointestinal tract Anatomy 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 230000002757 inflammatory effect Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- 125000005956 isoquinolyl group Chemical group 0.000 description 2
- 239000002502 liposome Substances 0.000 description 2
- 208000002780 macular degeneration Diseases 0.000 description 2
- 201000010230 macular retinal edema Diseases 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- QABLOFMHHSOFRJ-UHFFFAOYSA-N methyl 2-chloroacetate Chemical compound COC(=O)CCl QABLOFMHHSOFRJ-UHFFFAOYSA-N 0.000 description 2
- YTBAESLKZPSLGU-UHFFFAOYSA-N methyl 3-(4-formylphenoxy)benzoate Chemical compound COC(=O)C1=CC=CC(OC=2C=CC(C=O)=CC=2)=C1 YTBAESLKZPSLGU-UHFFFAOYSA-N 0.000 description 2
- AZNMCOGAOIESFG-UHFFFAOYSA-N methyl 3-[4-(chloromethyl)phenoxy]benzoate Chemical compound ClCC1=CC=C(OC=2C=C(C(=O)OC)C=CC2)C=C1 AZNMCOGAOIESFG-UHFFFAOYSA-N 0.000 description 2
- WNCXRHJBWRBLCK-UHFFFAOYSA-N methyl 3-[4-(hydroxymethyl)phenoxy]benzoate Chemical compound COC(=O)C1=CC=CC(OC=2C=CC(CO)=CC=2)=C1 WNCXRHJBWRBLCK-UHFFFAOYSA-N 0.000 description 2
- YKUCHDXIBAQWSF-UHFFFAOYSA-N methyl 3-hydroxybenzoate Chemical compound COC(=O)C1=CC=CC(O)=C1 YKUCHDXIBAQWSF-UHFFFAOYSA-N 0.000 description 2
- JYJHLRUIPXMXCQ-UHFFFAOYSA-N methyl 4-(bromomethyl)-3-cyanobenzoate Chemical compound COC(=O)C1=CC=C(CBr)C(C#N)=C1 JYJHLRUIPXMXCQ-UHFFFAOYSA-N 0.000 description 2
- OJBQAHZJVDWSFD-UHFFFAOYSA-N methyl 4-(bromomethyl)-3-fluorobenzoate Chemical compound COC(=O)C1=CC=C(CBr)C(F)=C1 OJBQAHZJVDWSFD-UHFFFAOYSA-N 0.000 description 2
- MTLQAXZRPCIFKO-UHFFFAOYSA-N methyl 5-(4-formylphenoxy)pyridine-3-carboxylate Chemical compound C(=O)C1=CC=C(OC=2C=NC=C(C(=O)OC)C2)C=C1 MTLQAXZRPCIFKO-UHFFFAOYSA-N 0.000 description 2
- XMZXUQZALSBSID-UHFFFAOYSA-N methyl 5-[4-(hydroxymethyl)phenoxy]pyridine-3-carboxylate Chemical compound OCC1=CC=C(OC=2C=NC=C(C(=O)OC)C2)C=C1 XMZXUQZALSBSID-UHFFFAOYSA-N 0.000 description 2
- OFHGAYNAKIWVOL-UHFFFAOYSA-N methyl 5-chloro-1h-indazole-3-carboxylate Chemical compound C1=C(Cl)C=C2C(C(=O)OC)=NNC2=C1 OFHGAYNAKIWVOL-UHFFFAOYSA-N 0.000 description 2
- KJJSHOHQQHACLE-UHFFFAOYSA-N methyl 5-hydroxypyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(O)=C1 KJJSHOHQQHACLE-UHFFFAOYSA-N 0.000 description 2
- JTVVPKLHKMKWNN-UHFFFAOYSA-N methyl 6-oxo-1h-pyridine-3-carboxylate Chemical compound COC(=O)C=1C=CC(=O)NC=1 JTVVPKLHKMKWNN-UHFFFAOYSA-N 0.000 description 2
- QXAUTQFAWKKNLM-UHFFFAOYSA-N methyl indole-3-carboxylate Chemical compound C1=CC=C2C(C(=O)OC)=CNC2=C1 QXAUTQFAWKKNLM-UHFFFAOYSA-N 0.000 description 2
- VVWWZOKQKXPVIV-UHFFFAOYSA-N methyl pyrrolidine-3-carboxylate Chemical compound COC(=O)C1CCNC1 VVWWZOKQKXPVIV-UHFFFAOYSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- LSNOAQQZECGQNS-UHFFFAOYSA-N morpholine-2-carboxamide Chemical compound NC(=O)C1CNCCO1 LSNOAQQZECGQNS-UHFFFAOYSA-N 0.000 description 2
- 201000006417 multiple sclerosis Diseases 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 230000001717 pathogenic effect Effects 0.000 description 2
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- BRYCUMKDWMEGMK-UHFFFAOYSA-N piperazine-2-carboxamide Chemical compound NC(=O)C1CNCCN1 BRYCUMKDWMEGMK-UHFFFAOYSA-N 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- OBLVPWTUALCMGD-UHFFFAOYSA-N pyridin-1-ium-3-carboxamide;chloride Chemical class Cl.NC(=O)C1=CC=CN=C1 OBLVPWTUALCMGD-UHFFFAOYSA-N 0.000 description 2
- DWJMBQYORXLGAE-UHFFFAOYSA-N pyridine-2-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=N1 DWJMBQYORXLGAE-UHFFFAOYSA-N 0.000 description 2
- XFIUZEAHIJGTTB-UHFFFAOYSA-N pyridine-4-sulfonamide Chemical compound NS(=O)(=O)C1=CC=NC=C1 XFIUZEAHIJGTTB-UHFFFAOYSA-N 0.000 description 2
- HKSQZEGSMBFHGC-UHFFFAOYSA-N pyrimidine-4-carboxamide Chemical compound NC(=O)C1=CC=NC=N1 HKSQZEGSMBFHGC-UHFFFAOYSA-N 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 125000005493 quinolyl group Chemical group 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000009256 replacement therapy Methods 0.000 description 2
- 230000002207 retinal effect Effects 0.000 description 2
- 208000004644 retinal vein occlusion Diseases 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 150000003384 small molecules Chemical class 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 125000003003 spiro group Chemical group 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 2
- 125000004306 triazinyl group Chemical group 0.000 description 2
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- ZNANCENIUZCFCA-UHFFFAOYSA-N (5-chloro-1-methylindazol-3-yl)methanamine Chemical compound ClC1=CC=C2N(C)N=C(CN)C2=C1 ZNANCENIUZCFCA-UHFFFAOYSA-N 0.000 description 1
- ANWGKOKCTGJGCD-UHFFFAOYSA-N (5-ethoxycarbonylpyridin-3-yl)boronic acid Chemical compound CCOC(=O)C1=CN=CC(B(O)O)=C1 ANWGKOKCTGJGCD-UHFFFAOYSA-N 0.000 description 1
- XJLSEXAGTJCILF-RXMQYKEDSA-N (R)-nipecotic acid zwitterion Chemical compound OC(=O)[C@@H]1CCCNC1 XJLSEXAGTJCILF-RXMQYKEDSA-N 0.000 description 1
- KZKRRZFCAYOXQE-UHFFFAOYSA-N 1$l^{2}-azinane Chemical group C1CC[N]CC1 KZKRRZFCAYOXQE-UHFFFAOYSA-N 0.000 description 1
- FIARMZDBEGVMLV-UHFFFAOYSA-N 1,1,2,2,2-pentafluoroethanolate Chemical group [O-]C(F)(F)C(F)(F)F FIARMZDBEGVMLV-UHFFFAOYSA-N 0.000 description 1
- 125000005988 1,1-dioxo-thiomorpholinyl group Chemical group 0.000 description 1
- SLLFVLKNXABYGI-UHFFFAOYSA-N 1,2,3-benzoxadiazole Chemical compound C1=CC=C2ON=NC2=C1 SLLFVLKNXABYGI-UHFFFAOYSA-N 0.000 description 1
- NOPBBMMJSHZGIQ-UHFFFAOYSA-N 1,2-dihydropyridine-5-carboxylic acid Chemical compound OC(=O)C1=CNCC=C1 NOPBBMMJSHZGIQ-UHFFFAOYSA-N 0.000 description 1
- VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical compound SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 1
- FOCOZKMFTFOPCZ-UHFFFAOYSA-N 1,3-oxazolidine-5-carboxamide Chemical compound NC(=O)C1CNCO1 FOCOZKMFTFOPCZ-UHFFFAOYSA-N 0.000 description 1
- RDWRGYBUKDEFLB-UHFFFAOYSA-N 1,3-oxazolidine-5-sulfonamide Chemical compound O1CNCC1S(=O)(=O)N RDWRGYBUKDEFLB-UHFFFAOYSA-N 0.000 description 1
- WBOABZOPYZNWCX-UHFFFAOYSA-N 1-(3-bromophenyl)-2,2,2-trifluoroethanamine Chemical compound FC(F)(F)C(N)C1=CC=CC(Br)=C1 WBOABZOPYZNWCX-UHFFFAOYSA-N 0.000 description 1
- VMEFMOPAQPETOC-UHFFFAOYSA-N 1-(oxan-2-yl)indazole-3-carboxamide Chemical compound O1C(CCCC1)N1N=C(C2=CC=CC=C12)C(=O)N VMEFMOPAQPETOC-UHFFFAOYSA-N 0.000 description 1
- HZINPSOLRNSYSO-UHFFFAOYSA-N 1-[(4-nitrophenyl)methyl]pyridin-2-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1CN1C(=O)C=CC=C1 HZINPSOLRNSYSO-UHFFFAOYSA-N 0.000 description 1
- KZVBSVSFRIZRSF-UHFFFAOYSA-N 1-[2,2,2-trifluoro-1-[1-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyrazol-4-yl]ethyl]indazole-3-carboxamide Chemical compound FC(C(C=1C=NN(C1)CC1=CC=C(C=C1)CN1C(C=CC=C1)=O)N1N=C(C2=CC=CC=C12)C(=O)N)(F)F KZVBSVSFRIZRSF-UHFFFAOYSA-N 0.000 description 1
- YFGHFNZQVNIQNP-UHFFFAOYSA-N 1-[5-chloro-1-(oxan-2-yl)indazol-3-yl]ethanol Chemical compound CC(O)C1=NN(C2CCCCO2)C2=C1C=C(Cl)C=C2 YFGHFNZQVNIQNP-UHFFFAOYSA-N 0.000 description 1
- BLZZABJZEOJOQK-UHFFFAOYSA-N 1-[[2-fluoro-4-(hydroxymethyl)phenyl]methyl]pyridin-2-one Chemical compound FC1=C(CN2C(C=CC=C2)=O)C=CC(=C1)CO BLZZABJZEOJOQK-UHFFFAOYSA-N 0.000 description 1
- GBICOISGPUROBJ-UHFFFAOYSA-N 1-[[4-(chloromethyl)phenyl]methyl]pyridin-2-one Chemical compound ClCC1=CC=C(CN2C=CC=CC2=O)C=C1 GBICOISGPUROBJ-UHFFFAOYSA-N 0.000 description 1
- YXOHTSSAYFNUEG-UHFFFAOYSA-N 1-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]indole-3-carboxylic acid Chemical compound OC(=O)C1=CN(CC2=CC=C(CN3C=CC=CC3=O)C=C2)C2=CC=CC=C12 YXOHTSSAYFNUEG-UHFFFAOYSA-N 0.000 description 1
- FFRZONHEXNFMQJ-UHFFFAOYSA-N 1-[[4-[[1-[(5-chloro-2H-indazol-3-yl)methyl]-2H-pyridin-5-yl]amino]phenyl]methyl]pyridin-2-one Chemical compound ClC=1C=C2C(=NNC2=CC=1)CN1CC=CC(=C1)NC1=CC=C(C=C1)CN1C(C=CC=C1)=O FFRZONHEXNFMQJ-UHFFFAOYSA-N 0.000 description 1
- ZXOGFQVSULDYCZ-UHFFFAOYSA-N 1-[[4-[[3-(1-amino-2,2,2-trifluoroethyl)phenyl]methyl]phenyl]methyl]pyridin-2-one Chemical compound NC(C1=CC=CC(CC2=CC=C(CN3C=CC=CC3=O)C=C2)=C1)C(F)(F)F ZXOGFQVSULDYCZ-UHFFFAOYSA-N 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- GAJBWMUZVXJIBO-UHFFFAOYSA-N 1-oxidopyridazin-1-ium Chemical compound [O-][N+]1=CC=CC=N1 GAJBWMUZVXJIBO-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- BHXVYTQDWMQVBI-UHFFFAOYSA-N 1h-indazole-3-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=NNC2=C1 BHXVYTQDWMQVBI-UHFFFAOYSA-N 0.000 description 1
- KIPSRYDSZQRPEA-UHFFFAOYSA-N 2,2,2-trifluoroethanamine Chemical compound NCC(F)(F)F KIPSRYDSZQRPEA-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- SURCGQGDUADKBL-UHFFFAOYSA-N 2-(2-hydroxyethylamino)-5-nitrobenzo[de]isoquinoline-1,3-dione Chemical compound [O-][N+](=O)C1=CC(C(N(NCCO)C2=O)=O)=C3C2=CC=CC3=C1 SURCGQGDUADKBL-UHFFFAOYSA-N 0.000 description 1
- VKEBWCZVWZDPKV-UHFFFAOYSA-N 2-(4-methylphenyl)-1,3-dithiolane Chemical compound C1=CC(C)=CC=C1C1SCCS1 VKEBWCZVWZDPKV-UHFFFAOYSA-N 0.000 description 1
- BPXKZEMBEZGUAH-UHFFFAOYSA-N 2-(chloromethoxy)ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCCl BPXKZEMBEZGUAH-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 1
- YJDGPUCAPUOFQD-UHFFFAOYSA-N 2-[(4-iodopyrazol-1-yl)methoxy]ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCN1C=C(I)C=N1 YJDGPUCAPUOFQD-UHFFFAOYSA-N 0.000 description 1
- UFNPRKGVBLBVTO-UHFFFAOYSA-N 2-[(5-chloro-2H-indazol-3-yl)methyl]isoindole-1,3-dione Chemical compound ClC1=CC2=C(NN=C2CN2C(=O)C3=C(C=CC=C3)C2=O)C=C1 UFNPRKGVBLBVTO-UHFFFAOYSA-N 0.000 description 1
- HSYVXQYTWUSFIY-UHFFFAOYSA-N 2-[(5-chloro-2H-indazol-3-yl)methylamino]-2-[3-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]phenyl]acetic acid Chemical compound OC(=O)C(NCC1=NNC2=C1C=C(Cl)C=C2)C1=CC(CC2=CC=C(CN3C=CC=CC3=O)C=C2)=CC=C1 HSYVXQYTWUSFIY-UHFFFAOYSA-N 0.000 description 1
- LKCHOYJKNAZFNU-UHFFFAOYSA-N 2-[1-[5-chloro-1-(oxan-2-yl)indazol-3-yl]ethyl]isoindole-1,3-dione Chemical compound CC(N1C(=O)C2=C(C=CC=C2)C1=O)C1=NN(C2CCCCO2)C2=C1C=C(Cl)C=C2 LKCHOYJKNAZFNU-UHFFFAOYSA-N 0.000 description 1
- STVWPMBYITVUGS-UHFFFAOYSA-N 2-amino-2-(5-bromopyridin-3-yl)acetonitrile Chemical compound NC(C#N)C=1C=NC=C(C1)Br STVWPMBYITVUGS-UHFFFAOYSA-N 0.000 description 1
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- VFPWGZNNRSQPBT-UHFFFAOYSA-N 2-bromobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1Br VFPWGZNNRSQPBT-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- GAWAYYRQGQZKCR-UHFFFAOYSA-N 2-chloropropionic acid Chemical class CC(Cl)C(O)=O GAWAYYRQGQZKCR-UHFFFAOYSA-N 0.000 description 1
- IAYVFXZTRHWOIX-UHFFFAOYSA-N 2-fluoro-1-piperidin-1-ylethanone Chemical compound FCC(=O)N1CCCCC1 IAYVFXZTRHWOIX-UHFFFAOYSA-N 0.000 description 1
- LIOLIMKSCNQPLV-UHFFFAOYSA-N 2-fluoro-n-methyl-4-[7-(quinolin-6-ylmethyl)imidazo[1,2-b][1,2,4]triazin-2-yl]benzamide Chemical class C1=C(F)C(C(=O)NC)=CC=C1C1=NN2C(CC=3C=C4C=CC=NC4=CC=3)=CN=C2N=C1 LIOLIMKSCNQPLV-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical class OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000001698 2H-pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- QISAXNVBRDCYEM-UHFFFAOYSA-N 3-[4-[(2-oxopyridin-1-yl)methyl]anilino]benzoic acid Chemical compound OC(=O)C1=CC(NC2=CC=C(CN3C=CC=CC3=O)C=C2)=CC=C1 QISAXNVBRDCYEM-UHFFFAOYSA-N 0.000 description 1
- CJFRXWVWPUKGMW-UHFFFAOYSA-N 3-[4-[(2-oxopyridin-1-yl)methyl]phenyl]sulfanylbenzoic acid Chemical compound OC(=O)C1=CC(SC2=CC=C(CN3C=CC=CC3=O)C=C2)=CC=C1 CJFRXWVWPUKGMW-UHFFFAOYSA-N 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- 125000004919 3-methyl-2-pentyl group Chemical group CC(C(C)*)CC 0.000 description 1
- 125000004921 3-methyl-3-pentyl group Chemical group CC(CC)(CC)* 0.000 description 1
- 125000004364 3-pyrrolinyl group Chemical group [H]C1=C([H])C([H])([H])N(*)C1([H])[H] 0.000 description 1
- RSFDFESMVAIVKO-UHFFFAOYSA-N 3-sulfanylbenzoic acid Chemical compound OC(=O)C1=CC=CC(S)=C1 RSFDFESMVAIVKO-UHFFFAOYSA-N 0.000 description 1
- QCXJEYYXVJIFCE-UHFFFAOYSA-N 4-acetamidobenzoic acid Chemical compound CC(=O)NC1=CC=C(C(O)=O)C=C1 QCXJEYYXVJIFCE-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 1
- 125000001826 4H-pyranyl group Chemical group O1C(=CCC=C1)* 0.000 description 1
- FLIAZYQTDQATLS-UHFFFAOYSA-N 5-(chloromethyl)-2-[(2-oxopyridin-1-yl)methyl]benzonitrile Chemical compound ClCC1=CC(C#N)=C(CN2C=CC=CC2=O)C=C1 FLIAZYQTDQATLS-UHFFFAOYSA-N 0.000 description 1
- KXKIADIJIGKECJ-UHFFFAOYSA-N 5-(hydroxymethyl)-2-[(2-oxopyridin-1-yl)methyl]benzonitrile Chemical compound OCC1=CC(C#N)=C(CN2C=CC=CC2=O)C=C1 KXKIADIJIGKECJ-UHFFFAOYSA-N 0.000 description 1
- XHDJYQWGFIBCEP-UHFFFAOYSA-N 5-Chloro-1H-indole-2,3-dione Chemical compound ClC1=CC=C2NC(=O)C(=O)C2=C1 XHDJYQWGFIBCEP-UHFFFAOYSA-N 0.000 description 1
- ATTDCVLRGFEHEO-UHFFFAOYSA-N 5-Hydroxynicotinic acid Chemical compound OC(=O)C1=CN=CC(O)=C1 ATTDCVLRGFEHEO-UHFFFAOYSA-N 0.000 description 1
- LSJDLDYXQGBTKH-UHFFFAOYSA-N 5-[(2-fluoro-4-methoxycarbonylphenyl)methyl]pyridine-3-carboxylic acid Chemical compound FC1=C(CC=2C=NC=C(C(=O)O)C2)C=CC(=C1)C(=O)OC LSJDLDYXQGBTKH-UHFFFAOYSA-N 0.000 description 1
- JKFIMJZBYORBOV-UHFFFAOYSA-N 5-[4-[(2-oxopyridin-1-yl)methyl]anilino]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(NC2=CC=C(CN3C=CC=CC3=O)C=C2)=CN=C1 JKFIMJZBYORBOV-UHFFFAOYSA-N 0.000 description 1
- IKZDZXCADVHDKS-UHFFFAOYSA-N 5-[[3-chloro-4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(CC2=CC(Cl)=C(CN3C=CC=CC3=O)C=C2)=CN=C1 IKZDZXCADVHDKS-UHFFFAOYSA-N 0.000 description 1
- NGUVGKAEOFPLDT-UHFFFAOYSA-N 5-bromopyridine-3-carbaldehyde Chemical compound BrC1=CN=CC(C=O)=C1 NGUVGKAEOFPLDT-UHFFFAOYSA-N 0.000 description 1
- ANWQWNSLIXJXOF-UHFFFAOYSA-N 5-chloro-1-methylindazole Chemical compound ClC1=CC=C2N(C)N=CC2=C1 ANWQWNSLIXJXOF-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- VNHRGODLJWTFJB-UHFFFAOYSA-N 5-chloro-3-(1,3-dihydroisoindol-2-ylmethyl)-1-(oxan-2-yl)indazole Chemical compound ClC=1C=C2C(=NN(C2=CC=1)C1OCCCC1)CN1CC2=CC=CC=C2C1 VNHRGODLJWTFJB-UHFFFAOYSA-N 0.000 description 1
- FMERBZWNHKNJIC-UHFFFAOYSA-N 5-chloro-3-(chloromethyl)-1-(oxan-2-yl)indazole Chemical compound ClC=1C=C2C(=NN(C2=CC1)C1OCCCC1)CCl FMERBZWNHKNJIC-UHFFFAOYSA-N 0.000 description 1
- WCQHNVMUODWBTE-UHFFFAOYSA-N 5-chloro-N-methyl-1-(oxan-2-yl)indazol-3-amine Chemical compound ClC=1C=C2C(=NN(C2=CC=1)C1OCCCC1)NC WCQHNVMUODWBTE-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- OTDXCXJNLIBDCR-UHFFFAOYSA-N 5-thia-2-azaspiro[3.4]octane Chemical compound C1NCC12SCCC2 OTDXCXJNLIBDCR-UHFFFAOYSA-N 0.000 description 1
- YPWFNLSXQIGJCK-UHFFFAOYSA-N 7-oxabicyclo[2.2.1]heptane Chemical compound C1CC2CCC1O2 YPWFNLSXQIGJCK-UHFFFAOYSA-N 0.000 description 1
- 239000005541 ACE inhibitor Substances 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- 206010001580 Albuminuria Diseases 0.000 description 1
- 208000031345 Allergic Perennial Rhinitis Diseases 0.000 description 1
- 206010060934 Allergic oedema Diseases 0.000 description 1
- 206010049153 Allergic sinusitis Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 208000031295 Animal disease Diseases 0.000 description 1
- 208000022211 Arteriovenous Malformations Diseases 0.000 description 1
- 108010011485 Aspartame Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 208000019838 Blood disease Diseases 0.000 description 1
- IBLFNMPUPYPRJE-UHFFFAOYSA-N C(C)C1N(CCCC1)CC1=CC=C(C=C1)CN1C(C=CC=C1)=O Chemical compound C(C)C1N(CCCC1)CC1=CC=C(C=C1)CN1C(C=CC=C1)=O IBLFNMPUPYPRJE-UHFFFAOYSA-N 0.000 description 1
- PFLMSWATCWRWRT-UHFFFAOYSA-N C(CC)(=O)O.O=C1N(C=CC=C1)CC1=CC=C(CC=2C=NC=C(C(=O)N)C2)C=C1 Chemical compound C(CC)(=O)O.O=C1N(C=CC=C1)CC1=CC=C(CC=2C=NC=C(C(=O)N)C2)C=C1 PFLMSWATCWRWRT-UHFFFAOYSA-N 0.000 description 1
- JWPIPFWQXBIZPX-UHFFFAOYSA-N CC(C)(C)OC(=O)N1CCN(CC2=CC=C(CN3C=CC=CC3=O)C=C2)CC1C(O)=O Chemical compound CC(C)(C)OC(=O)N1CCN(CC2=CC=C(CN3C=CC=CC3=O)C=C2)CC1C(O)=O JWPIPFWQXBIZPX-UHFFFAOYSA-N 0.000 description 1
- KCSTXONWSKEIKF-UHFFFAOYSA-N CC1(C)OB(CC2=CC=C(CN3C=CC=CC3=O)C=C2)OC1(C)C Chemical compound CC1(C)OB(CC2=CC=C(CN3C=CC=CC3=O)C=C2)OC1(C)C KCSTXONWSKEIKF-UHFFFAOYSA-N 0.000 description 1
- IIUWWAKKBFPDEJ-UHFFFAOYSA-N CC1=C(C(=O)O)C=CN=C1CC1=CC=C(C=C1)CN1C(C=CC=C1)=O Chemical compound CC1=C(C(=O)O)C=CN=C1CC1=CC=C(C=C1)CN1C(C=CC=C1)=O IIUWWAKKBFPDEJ-UHFFFAOYSA-N 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- OISMZTOFORKASW-UHFFFAOYSA-N COC(=O)c1ccc(=O)n(Cc2ccc(Cn3ccccc3=O)cc2)c1 Chemical compound COC(=O)c1ccc(=O)n(Cc2ccc(Cn3ccccc3=O)cc2)c1 OISMZTOFORKASW-UHFFFAOYSA-N 0.000 description 1
- 208000022306 Cerebral injury Diseases 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 208000002249 Diabetes Complications Diseases 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 208000007590 Disorders of Excessive Somnolence Diseases 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000004278 EU approved seasoning Substances 0.000 description 1
- 108010062466 Enzyme Precursors Proteins 0.000 description 1
- 102000010911 Enzyme Precursors Human genes 0.000 description 1
- 208000007530 Essential hypertension Diseases 0.000 description 1
- IPKJTKZOAUOSDG-UHFFFAOYSA-N FC(C(N)C=1C=NN(C1)COCC[Si](C)(C)C)(F)F Chemical compound FC(C(N)C=1C=NN(C1)COCC[Si](C)(C)C)(F)F IPKJTKZOAUOSDG-UHFFFAOYSA-N 0.000 description 1
- 108010080865 Factor XII Proteins 0.000 description 1
- 102000000429 Factor XII Human genes 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 206010018338 Glioma Diseases 0.000 description 1
- 201000005569 Gout Diseases 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101001091365 Homo sapiens Plasma kallikrein Proteins 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 208000031226 Hyperlipidaemia Diseases 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000004575 Infectious Arthritis Diseases 0.000 description 1
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 1
- 201000008450 Intracranial aneurysm Diseases 0.000 description 1
- 150000000994 L-ascorbates Chemical class 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 208000009481 Laryngeal Edema Diseases 0.000 description 1
- 206010023845 Laryngeal oedema Diseases 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 206010025282 Lymphoedema Diseases 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 206010027525 Microalbuminuria Diseases 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000238367 Mya arenaria Species 0.000 description 1
- OSRZTHYJOXDIPC-UHFFFAOYSA-N N-[(5-chloro-2H-indazol-3-yl)methyl]-1-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]indole-3-carboxamide Chemical compound ClC1=CC2=C(NN=C2CNC(=O)C2=CN(CC3=CC=C(CN4C=CC=CC4=O)C=C3)C3=CC=CC=C23)C=C1 OSRZTHYJOXDIPC-UHFFFAOYSA-N 0.000 description 1
- FUEAHPPFMQJPNI-UHFFFAOYSA-N N-[(5-chloro-2H-indazol-3-yl)methyl]-2,2,2-trifluoro-1-(1H-pyrazol-4-yl)ethanamine Chemical compound ClC=1C=C2C(=NNC2=CC1)CNC(C(F)(F)F)C=1C=NNC1 FUEAHPPFMQJPNI-UHFFFAOYSA-N 0.000 description 1
- NEQPTHVWUAUONG-UHFFFAOYSA-N N-[(5-chloro-2H-indazol-3-yl)methyl]-2-oxo-1-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyrimidine-5-carboxamide Chemical compound ClC1=CC2=C(NN=C2CNC(=O)C2=CN(CC3=CC=C(CN4C=CC=CC4=O)C=C3)C(=O)N=C2)C=C1 NEQPTHVWUAUONG-UHFFFAOYSA-N 0.000 description 1
- QDXUGXCWONXNFD-UHFFFAOYSA-N N-[(5-chloro-2H-indazol-3-yl)methyl]-3-[4-[(2-oxopyridin-1-yl)methyl]phenoxy]benzenesulfonamide Chemical compound ClC1=CC2=C(NN=C2CNS(=O)(=O)C2=CC(OC3=CC=C(CN4C=CC=CC4=O)C=C3)=CC=C2)C=C1 QDXUGXCWONXNFD-UHFFFAOYSA-N 0.000 description 1
- KSUMMSOAYYLVLL-UHFFFAOYSA-N N-[(5-chloro-2H-indazol-3-yl)methyl]-3-[N-methyl-4-[(2-oxopyridin-1-yl)methyl]anilino]benzenesulfonamide Chemical compound CN(C1=CC=C(CN2C=CC=CC2=O)C=C1)C1=CC=CC(=C1)S(=O)(=O)NCC1=NNC2=C1C=C(Cl)C=C2 KSUMMSOAYYLVLL-UHFFFAOYSA-N 0.000 description 1
- RPOOMVVKBRILKN-UHFFFAOYSA-N N-[(5-chloro-2H-indazol-3-yl)methyl]-5,5-dioxo-2-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]-5lambda6-thia-2-azaspiro[3.4]octane-8-carboxamide Chemical compound ClC=1C=C2C(=NNC2=CC=1)CNC(=O)C1CCS(C11CN(C1)CC1=CC=C(C=C1)CN1C(C=CC=C1)=O)(=O)=O RPOOMVVKBRILKN-UHFFFAOYSA-N 0.000 description 1
- PBLDCWAPFXGNKG-UHFFFAOYSA-N N-[(5-chloro-2H-indazol-3-yl)methyl]-5-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]-5-azaspiro[3.4]octane-2-carboxamide Chemical compound ClC1=CC2=C(NN=C2CNC(=O)C2CC3(C2)CCCN3CC2=CC=C(CN3C=CC=CC3=O)C=C2)C=C1 PBLDCWAPFXGNKG-UHFFFAOYSA-N 0.000 description 1
- HHQBWNMXVTUOCT-UHFFFAOYSA-N N-[(5-chloro-2H-indazol-3-yl)methyl]-5-oxo-4-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyrazine-2-carboxamide Chemical compound ClC1=CC2=C(NN=C2CNC(=O)C2=CN(CC3=CC=C(CN4C=CC=CC4=O)C=C3)C(=O)C=N2)C=C1 HHQBWNMXVTUOCT-UHFFFAOYSA-N 0.000 description 1
- SHKXDTMEVKDOES-UHFFFAOYSA-N N-[(5-chloro-2H-indazol-3-yl)methyl]-6-oxo-1-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyridine-3-carboxamide Chemical compound ClC1=CC2=C(NN=C2CNC(=O)C2=CN(CC3=CC=C(CN4C=CC=CC4=O)C=C3)C(=O)C=C2)C=C1 SHKXDTMEVKDOES-UHFFFAOYSA-N 0.000 description 1
- HBMKQBUMTDUUOZ-UHFFFAOYSA-N N-[1-(3-bromophenyl)-2,2,2-trifluoroethyl]-2,2,2-trifluoroacetamide Chemical compound BrC=1C=C(C=CC1)C(C(F)(F)F)NC(C(F)(F)F)=O HBMKQBUMTDUUOZ-UHFFFAOYSA-N 0.000 description 1
- YGKOMROZLMGKSX-UHFFFAOYSA-N N-[2-amino-1-(5-chloro-2H-indazol-3-yl)-2-oxoethyl]-1-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyrazole-4-carboxamide Chemical compound NC(C(C1=NNC2=CC=C(C=C12)Cl)NC(=O)C=1C=NN(C1)CC1=CC=C(C=C1)CN1C(C=CC=C1)=O)=O YGKOMROZLMGKSX-UHFFFAOYSA-N 0.000 description 1
- DYEWDRDFVWTVHM-UHFFFAOYSA-N N-[3-amino-1-(5-chloro-2H-indazol-3-yl)-3-oxopropyl]-1-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyrazole-4-carboxamide Chemical compound NC(CC(C1=NNC2=CC=C(C=C12)Cl)NC(=O)C=1C=NN(C1)CC1=CC=C(C=C1)CN1C(C=CC=C1)=O)=O DYEWDRDFVWTVHM-UHFFFAOYSA-N 0.000 description 1
- ZULBBRUEOYWGNC-UHFFFAOYSA-N N-[4-[(2-oxopyridin-1-yl)methyl]phenoxy]benzamide Chemical compound C(C1=CC=CC=C1)(=O)NOC1=CC=C(C=C1)CN1C(C=CC=C1)=O ZULBBRUEOYWGNC-UHFFFAOYSA-N 0.000 description 1
- IBMJHYKYQRSKGT-UHFFFAOYSA-N N-[[3-chloro-4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyridine-3-carboxamide Chemical compound C(C1=CN=CC=C1)(=O)NCC1=CC(=C(C=C1)CN1C(C=CC=C1)=O)Cl IBMJHYKYQRSKGT-UHFFFAOYSA-N 0.000 description 1
- ILNIWEHGKYJIDE-UHFFFAOYSA-N N-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]benzamide Chemical compound C(C1=CC=CC=C1)(=O)NCC1=CC=C(C=C1)CN1C(C=CC=C1)=O ILNIWEHGKYJIDE-UHFFFAOYSA-N 0.000 description 1
- AWFUEBWOTJCXGA-UHFFFAOYSA-N N-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyridine-4-carboxamide Chemical compound C(C1=CC=NC=C1)(=O)NCC1=CC=C(C=C1)CN1C(C=CC=C1)=O AWFUEBWOTJCXGA-UHFFFAOYSA-N 0.000 description 1
- UGRWPYVMYKPRKH-UHFFFAOYSA-N O=C1C=CC(=CN1CC1=CC=C(C=C1)CN1C(C=CC=C1)=O)C(=O)N Chemical compound O=C1C=CC(=CN1CC1=CC=C(C=C1)CN1C(C=CC=C1)=O)C(=O)N UGRWPYVMYKPRKH-UHFFFAOYSA-N 0.000 description 1
- RNUAXZOVINZKPH-UHFFFAOYSA-N O=C1N(C=C(N=C1)C(=O)N)CC1=CC=C(C=C1)CN1C(C=CC=C1)=O Chemical compound O=C1N(C=C(N=C1)C(=O)N)CC1=CC=C(C=C1)CN1C(C=CC=C1)=O RNUAXZOVINZKPH-UHFFFAOYSA-N 0.000 description 1
- VXKKKKYIOPHLHQ-UHFFFAOYSA-N O=C1N(C=CC=C1)CC1=CC=C(CN2N=C(C3=CC=CC=C23)C(=O)N)C=C1 Chemical compound O=C1N(C=CC=C1)CC1=CC=C(CN2N=C(C3=CC=CC=C23)C(=O)N)C=C1 VXKKKKYIOPHLHQ-UHFFFAOYSA-N 0.000 description 1
- GANLONVBQOQLPA-UHFFFAOYSA-N OC(=O)C1=CC(=CC=C1)S(=O)(=O)C1=CC=C(CN2C=CC=CC2=O)C=C1 Chemical compound OC(=O)C1=CC(=CC=C1)S(=O)(=O)C1=CC=C(CN2C=CC=CC2=O)C=C1 GANLONVBQOQLPA-UHFFFAOYSA-N 0.000 description 1
- MQKXFMQTFZDZMT-UHFFFAOYSA-N OC(=O)C1=CC(CC2=CC(C#N)=C(CN3C=CC=CC3=O)C=C2)=CN=C1 Chemical compound OC(=O)C1=CC(CC2=CC(C#N)=C(CN3C=CC=CC3=O)C=C2)=CN=C1 MQKXFMQTFZDZMT-UHFFFAOYSA-N 0.000 description 1
- IOKDFIPEPOWWCV-UHFFFAOYSA-N OC(=O)C1=CC(CC2=CC=C(CN3C=CC=CC3=O)N=C2)=CN=C1 Chemical compound OC(=O)C1=CC(CC2=CC=C(CN3C=CC=CC3=O)N=C2)=CN=C1 IOKDFIPEPOWWCV-UHFFFAOYSA-N 0.000 description 1
- PQIZRDJQBYSOKR-UHFFFAOYSA-N OC(=O)C1=CN(CC2=C(F)C=C(CN3C=CC=CC3=O)C(F)=C2)C(=O)C=C1 Chemical compound OC(=O)C1=CN(CC2=C(F)C=C(CN3C=CC=CC3=O)C(F)=C2)C(=O)C=C1 PQIZRDJQBYSOKR-UHFFFAOYSA-N 0.000 description 1
- MFOLEQRZQOEFHT-UHFFFAOYSA-N OC(=O)C1=CN(CC2=CC=C(CN3C=CC=CC3=O)C=C2)C(=O)C=N1 Chemical compound OC(=O)C1=CN(CC2=CC=C(CN3C=CC=CC3=O)C=C2)C(=O)C=N1 MFOLEQRZQOEFHT-UHFFFAOYSA-N 0.000 description 1
- HDNWYBSLKAVYKM-UHFFFAOYSA-N OC(=O)C1CCC(=O)N(CC2=CC=C(CN3C=CC=CC3=O)C=C2)C1 Chemical compound OC(=O)C1CCC(=O)N(CC2=CC=C(CN3C=CC=CC3=O)C=C2)C1 HDNWYBSLKAVYKM-UHFFFAOYSA-N 0.000 description 1
- CIUHDEIXYNYQOU-UHFFFAOYSA-N OC(=O)C1CCCN(CC2=CC=C(CN3C=CC=CC3=O)C=C2)C1 Chemical compound OC(=O)C1CCCN(CC2=CC=C(CN3C=CC=CC3=O)C=C2)C1 CIUHDEIXYNYQOU-UHFFFAOYSA-N 0.000 description 1
- GCJFHUGHEROQBJ-UHFFFAOYSA-N OC(=O)C1CCN(C1)S(=O)(=O)C1=CC=C(CN2C=CC=CC2=O)C=C1 Chemical compound OC(=O)C1CCN(C1)S(=O)(=O)C1=CC=C(CN2C=CC=CC2=O)C=C1 GCJFHUGHEROQBJ-UHFFFAOYSA-N 0.000 description 1
- TZFATUVNBMNLSP-UHFFFAOYSA-N OC(=O)c1ccc(=O)n(Cc2ccc(Cn3ccccc3=O)cc2)c1 Chemical compound OC(=O)c1ccc(=O)n(Cc2ccc(Cn3ccccc3=O)cc2)c1 TZFATUVNBMNLSP-UHFFFAOYSA-N 0.000 description 1
- 229910020667 PBr3 Inorganic materials 0.000 description 1
- 201000010183 Papilledema Diseases 0.000 description 1
- 208000018737 Parkinson disease Diseases 0.000 description 1
- 229940122344 Peptidase inhibitor Drugs 0.000 description 1
- 102100027637 Plasma protease C1 inhibitor Human genes 0.000 description 1
- 108050007539 Plasma protease C1 inhibitor Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910052777 Praseodymium Inorganic materials 0.000 description 1
- 240000000037 Prosopis spicigera Species 0.000 description 1
- 235000006629 Prosopis spicigera Nutrition 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 208000001647 Renal Insufficiency Diseases 0.000 description 1
- 206010038886 Retinal oedema Diseases 0.000 description 1
- 206010038926 Retinopathy hypertensive Diseases 0.000 description 1
- 206010038934 Retinopathy proliferative Diseases 0.000 description 1
- 241000219061 Rheum Species 0.000 description 1
- NPHLMUBDUKIJAB-UHFFFAOYSA-N S1N=NC=C1.S1C=NN=C1 Chemical compound S1N=NC=C1.S1C=NN=C1 NPHLMUBDUKIJAB-UHFFFAOYSA-N 0.000 description 1
- 229910006124 SOCl2 Inorganic materials 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- 102000008847 Serpin Human genes 0.000 description 1
- 108050000761 Serpin Proteins 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 206010041349 Somnolence Diseases 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 208000030886 Traumatic Brain injury Diseases 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 239000013504 Triton X-100 Substances 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- 206010046914 Vaginal infection Diseases 0.000 description 1
- 201000008100 Vaginitis Diseases 0.000 description 1
- 206010058990 Venous occlusion Diseases 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- AOYSTZRSXVCEEU-UHFFFAOYSA-N [1-(oxan-2-yl)indazol-3-yl] propanoate Chemical compound O1C(CCCC1)N1N=C(C2=CC=CC=C12)OC(CC)=O AOYSTZRSXVCEEU-UHFFFAOYSA-N 0.000 description 1
- PLCSAPDKEOUEGJ-UHFFFAOYSA-N [5-chloro-1-(oxan-2-yl)indazol-3-yl] propanoate Chemical compound C(CC)(=O)OC1=NN(C2=CC=C(C=C12)Cl)C1OCCCC1 PLCSAPDKEOUEGJ-UHFFFAOYSA-N 0.000 description 1
- OOHBNLDDEVWSEB-UHFFFAOYSA-N [5-chloro-1-(oxan-2-yl)indazol-3-yl]methanol Chemical compound ClC=1C=C2C(=NN(C2=CC1)C1OCCCC1)CO OOHBNLDDEVWSEB-UHFFFAOYSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 229950011180 acedoben Drugs 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 208000024716 acute asthma Diseases 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 229920002892 amber Polymers 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 210000003423 ankle Anatomy 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- 230000005744 arteriovenous malformation Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- IAOZJIPTCAWIRG-QWRGUYRKSA-N aspartame Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(=O)OC)CC1=CC=CC=C1 IAOZJIPTCAWIRG-QWRGUYRKSA-N 0.000 description 1
- 239000000605 aspartame Substances 0.000 description 1
- 235000010357 aspartame Nutrition 0.000 description 1
- 229960003438 aspartame Drugs 0.000 description 1
- 125000003725 azepanyl group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- IKWQWOFXRCUIFT-UHFFFAOYSA-N benzene-1,2-dicarbohydrazide Chemical compound NNC(=O)C1=CC=CC=C1C(=O)NN IKWQWOFXRCUIFT-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- BNHZBWZNPRVCSE-UHFFFAOYSA-N benzyl 5-bromopyridine-3-carboxylate Chemical compound BrC1=CN=CC(C(=O)OCC=2C=CC=CC=2)=C1 BNHZBWZNPRVCSE-UHFFFAOYSA-N 0.000 description 1
- GPRLTFBKWDERLU-UHFFFAOYSA-N bicyclo[2.2.2]octane Chemical compound C1CC2CCC1CC2 GPRLTFBKWDERLU-UHFFFAOYSA-N 0.000 description 1
- GNTFBMAGLFYMMZ-UHFFFAOYSA-N bicyclo[3.2.2]nonane Chemical compound C1CC2CCC1CCC2 GNTFBMAGLFYMMZ-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 208000034158 bleeding Diseases 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 210000000601 blood cell Anatomy 0.000 description 1
- 208000015294 blood coagulation disease Diseases 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 239000003152 bradykinin antagonist Substances 0.000 description 1
- 208000029028 brain injury Diseases 0.000 description 1
- 239000006189 buccal tablet Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940009550 c1 esterase inhibitor Drugs 0.000 description 1
- 150000001669 calcium Chemical class 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000013132 cardiothoracic surgery Methods 0.000 description 1
- 230000020411 cell activation Effects 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 201000005667 central retinal vein occlusion Diseases 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 208000020832 chronic kidney disease Diseases 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000001149 cognitive effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000315 cryotherapy Methods 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000131 cyclopropyloxy group Chemical group C1(CC1)O* 0.000 description 1
- 208000031513 cyst Diseases 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 239000003405 delayed action preparation Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- UGMCXQCYOVCMTB-UHFFFAOYSA-K dihydroxy(stearato)aluminium Chemical compound CCCCCCCCCCCCCCCCCC(=O)O[Al](O)O UGMCXQCYOVCMTB-UHFFFAOYSA-K 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- UFJGNEVQYHKAKE-UHFFFAOYSA-N dithian-3-ol Chemical compound OC1CCCSS1 UFJGNEVQYHKAKE-UHFFFAOYSA-N 0.000 description 1
- 125000005411 dithiolanyl group Chemical group S1SC(CC1)* 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000011143 downstream manufacturing Methods 0.000 description 1
- 229940000406 drug candidate Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 206010014599 encephalitis Diseases 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- OONBOXSIWCBAHZ-UHFFFAOYSA-N ethyl 6-bromopyridine-2-carboxylate Chemical compound CCOC(=O)C1=CC=CC(Br)=N1 OONBOXSIWCBAHZ-UHFFFAOYSA-N 0.000 description 1
- XIWBSOUNZWSFKU-UHFFFAOYSA-N ethyl piperidine-3-carboxylate Chemical compound CCOC(=O)C1CCCNC1 XIWBSOUNZWSFKU-UHFFFAOYSA-N 0.000 description 1
- 210000003414 extremity Anatomy 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003527 fibrinolytic agent Substances 0.000 description 1
- 230000003480 fibrinolytic effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 210000002683 foot Anatomy 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- FATAVLOOLIRUNA-UHFFFAOYSA-N formylmethyl Chemical group [CH2]C=O FATAVLOOLIRUNA-UHFFFAOYSA-N 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 210000004392 genitalia Anatomy 0.000 description 1
- 125000005908 glyceryl ester group Chemical group 0.000 description 1
- 239000001087 glyceryl triacetate Substances 0.000 description 1
- 235000013773 glyceryl triacetate Nutrition 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 208000014951 hematologic disease Diseases 0.000 description 1
- 208000018706 hematopoietic system disease Diseases 0.000 description 1
- 230000002008 hemorrhagic effect Effects 0.000 description 1
- 210000003494 hepatocyte Anatomy 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 208000003906 hydrocephalus Diseases 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 201000001948 hypertensive retinopathy Diseases 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 150000002473 indoazoles Chemical group 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- KMAKOBLIOCQGJP-UHFFFAOYSA-N indole-3-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CNC2=C1 KMAKOBLIOCQGJP-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 208000020658 intracerebral hemorrhage Diseases 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 208000028867 ischemia Diseases 0.000 description 1
- 208000012947 ischemia reperfusion injury Diseases 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- XVQUOJBERHHONY-UHFFFAOYSA-N isometheptene Chemical compound CNC(C)CCC=C(C)C XVQUOJBERHHONY-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 150000002537 isoquinolines Chemical class 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 239000007951 isotonicity adjuster Substances 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 230000007803 itching Effects 0.000 description 1
- 230000001689 kallikreinlike Effects 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 201000006370 kidney failure Diseases 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 201000010901 lateral sclerosis Diseases 0.000 description 1
- 210000002414 leg Anatomy 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 208000002502 lymphedema Diseases 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- BVUQKCCKUOSAEV-UHFFFAOYSA-M magnesium;methylbenzene;bromide Chemical compound [Mg+2].[Br-].CC1=CC=[C-]C=C1 BVUQKCCKUOSAEV-UHFFFAOYSA-M 0.000 description 1
- LVKCSZQWLOVUGB-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].C[CH-]C LVKCSZQWLOVUGB-UHFFFAOYSA-M 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- WKAXSWISPMNJIU-UHFFFAOYSA-N methyl 1-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]indole-3-carboxylate Chemical compound O=C1N(C=CC=C1)CC1=CC=C(CN2C=C(C3=CC=CC=C23)C(=O)OC)C=C1 WKAXSWISPMNJIU-UHFFFAOYSA-N 0.000 description 1
- HVWWFBNUSAOKSH-UHFFFAOYSA-N methyl 2-amino-2-(5-bromopyridin-3-yl)acetate Chemical compound NC(C(=O)OC)C=1C=NC=C(C1)Br HVWWFBNUSAOKSH-UHFFFAOYSA-N 0.000 description 1
- MULLTHQTADMZDM-UHFFFAOYSA-N methyl 2-bromopyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(Br)=C1 MULLTHQTADMZDM-UHFFFAOYSA-N 0.000 description 1
- MRALJVAXZMPUKP-UHFFFAOYSA-N methyl 3-(4-methylbenzoyl)benzoate Chemical compound COC(=O)C1=CC=CC(C(=O)C=2C=CC(C)=CC=2)=C1 MRALJVAXZMPUKP-UHFFFAOYSA-N 0.000 description 1
- FMGZZESSTSMHLO-UHFFFAOYSA-N methyl 3-[[4-(bromomethyl)phenyl]-difluoromethyl]benzoate Chemical compound BrCC1=CC=C(C=C1)C(C=1C=C(C(=O)OC)C=CC1)(F)F FMGZZESSTSMHLO-UHFFFAOYSA-N 0.000 description 1
- 229940120152 methyl 3-hydroxybenzoate Drugs 0.000 description 1
- BUGNGBVWYRKVFF-UHFFFAOYSA-N methyl 4-(bromomethyl)-2,5-difluorobenzoate Chemical compound COC(=O)C1=CC(F)=C(CBr)C=C1F BUGNGBVWYRKVFF-UHFFFAOYSA-N 0.000 description 1
- XTZCVWDSGCVDFI-UHFFFAOYSA-N methyl 4-(bromomethyl)-3-chlorobenzoate Chemical compound COC(=O)C1=CC=C(CBr)C(Cl)=C1 XTZCVWDSGCVDFI-UHFFFAOYSA-N 0.000 description 1
- VKCJUIQEFVDCAL-UHFFFAOYSA-N methyl 5-chloro-1-(oxan-2-yl)indazole-3-carboxylate Chemical compound ClC=1C=C2C(=NN(C2=CC1)C1OCCCC1)C(=O)OC VKCJUIQEFVDCAL-UHFFFAOYSA-N 0.000 description 1
- FWYJOGWYZRXEBL-UHFFFAOYSA-N methyl 5-oxo-4-[[4-[(2-oxopyridin-1-yl)methyl]phenyl]methyl]pyrazine-2-carboxylate Chemical compound COC(=O)C1=CN(CC2=CC=C(CN3C=CC=CC3=O)C=C2)C(=O)C=N1 FWYJOGWYZRXEBL-UHFFFAOYSA-N 0.000 description 1
- MVVYUJFEXRODQA-UHFFFAOYSA-N methyl 6-chloropyrazine-2-carboxylate Chemical compound COC(=O)C1=CN=CC(Cl)=N1 MVVYUJFEXRODQA-UHFFFAOYSA-N 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000001620 monocyclic carbocycle group Chemical group 0.000 description 1
- ZKWFSTHEYLJLEL-UHFFFAOYSA-N morpholine-4-carboxamide Chemical compound NC(=O)N1CCOCC1 ZKWFSTHEYLJLEL-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 208000005264 motor neuron disease Diseases 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 230000003387 muscular Effects 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 210000004498 neuroglial cell Anatomy 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMRZSTCPUPJPOJ-KNVOCYPGSA-N norbornane Chemical compound C1C[C@H]2CC[C@@H]1C2 UMRZSTCPUPJPOJ-KNVOCYPGSA-N 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 201000011107 obstructive hydrocephalus Diseases 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 238000012261 overproduction Methods 0.000 description 1
- 125000003551 oxepanyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 description 1
- JSSXHAMIXJGYCS-UHFFFAOYSA-N piperazin-4-ium-2-carboxylate Chemical compound OC(=O)C1CNCCN1 JSSXHAMIXJGYCS-UHFFFAOYSA-N 0.000 description 1
- IEYMNLYRGAFFMR-UHFFFAOYSA-N piperazine-1,2-dicarboxylic acid Chemical compound OC(=O)C1CNCCN1C(O)=O IEYMNLYRGAFFMR-UHFFFAOYSA-N 0.000 description 1
- RFIOZSIHFNEKFF-UHFFFAOYSA-M piperazine-1-carboxylate Chemical compound [O-]C(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-M 0.000 description 1
- RFIOZSIHFNEKFF-UHFFFAOYSA-N piperazine-1-carboxylic acid Chemical compound OC(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-N 0.000 description 1
- JSPCTNUQYWIIOT-UHFFFAOYSA-N piperidine-1-carboxamide Chemical compound NC(=O)N1CCCCC1 JSPCTNUQYWIIOT-UHFFFAOYSA-N 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 230000009024 positive feedback mechanism Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 201000001474 proteinuria Diseases 0.000 description 1
- IPEHBUMCGVEMRF-UHFFFAOYSA-N pyrazinecarboxamide Chemical compound NC(=O)C1=CN=CC=N1 IPEHBUMCGVEMRF-UHFFFAOYSA-N 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- GRJJQCWNZGRKAU-UHFFFAOYSA-N pyridin-1-ium;fluoride Chemical compound F.C1=CC=NC=C1 GRJJQCWNZGRKAU-UHFFFAOYSA-N 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- FUXJMHXHGDAHPD-UHFFFAOYSA-N pyrimidine-2-carboxamide Chemical compound NC(=O)C1=NC=CC=N1 FUXJMHXHGDAHPD-UHFFFAOYSA-N 0.000 description 1
- LCDCPQHFCOBUEF-UHFFFAOYSA-N pyrrolidine-1-carboxamide Chemical compound NC(=O)N1CCCC1 LCDCPQHFCOBUEF-UHFFFAOYSA-N 0.000 description 1
- LPPOVVJDAVMOET-UHFFFAOYSA-N pyrrolidine-1-sulfonamide Chemical compound NS(=O)(=O)N1CCCC1 LPPOVVJDAVMOET-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000019705 regulation of vascular permeability Effects 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 210000001525 retina Anatomy 0.000 description 1
- 201000011195 retinal edema Diseases 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 201000001223 septic arthritis Diseases 0.000 description 1
- 208000013223 septicemia Diseases 0.000 description 1
- 239000003001 serine protease inhibitor Substances 0.000 description 1
- 125000003607 serino group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007892 solid unit dosage form Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 208000020431 spinal cord injury Diseases 0.000 description 1
- FYGUBWKMMCWIKB-UHFFFAOYSA-N spiro[2.3]hexane Chemical compound C1CC11CCC1 FYGUBWKMMCWIKB-UHFFFAOYSA-N 0.000 description 1
- HEMCGZPSGYRIOL-UHFFFAOYSA-N spiro[2.4]heptane Chemical compound C1CC11CCCC1 HEMCGZPSGYRIOL-UHFFFAOYSA-N 0.000 description 1
- FOEYMRPOKBCNCR-UHFFFAOYSA-N spiro[2.5]octane Chemical compound C1CC11CCCCC1 FOEYMRPOKBCNCR-UHFFFAOYSA-N 0.000 description 1
- CTDQAGUNKPRERK-UHFFFAOYSA-N spirodecane Chemical compound C1CCCC21CCCCC2 CTDQAGUNKPRERK-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 210000004500 stellate cell Anatomy 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003899 tartaric acid esters Chemical class 0.000 description 1
- 125000001935 tetracenyl group Chemical group C1(=CC=CC2=CC3=CC4=CC=CC=C4C=C3C=C12)* 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000004525 thiadiazinyl group Chemical group S1NN=C(C=C1)* 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical group C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 1
- 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001583 thiepanyl group Chemical group 0.000 description 1
- 125000002053 thietanyl group Chemical group 0.000 description 1
- RTKIYNMVFMVABJ-UHFFFAOYSA-L thimerosal Chemical compound [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O RTKIYNMVFMVABJ-UHFFFAOYSA-L 0.000 description 1
- 229940033663 thimerosal Drugs 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 238000002054 transplantation Methods 0.000 description 1
- 230000009529 traumatic brain injury Effects 0.000 description 1
- 229960002622 triacetin Drugs 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 125000000165 tricyclic carbocycle group Chemical group 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000009637 wintergreen oil Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/40—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil
- A61K31/403—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil condensed with carbocyclic rings, e.g. carbazole
- A61K31/4035—Isoindoles, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/415—1,2-Diazoles
- A61K31/416—1,2-Diazoles condensed with carbocyclic ring systems, e.g. indazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
- A61K31/4439—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems containing a five-membered ring with nitrogen as a ring hetero atom, e.g. omeprazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/4709—Non-condensed quinolines and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/472—Non-condensed isoquinolines, e.g. papaverine
- A61K31/4725—Non-condensed isoquinolines, e.g. papaverine containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Epidemiology (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201361921995P | 2013-12-30 | 2013-12-30 | |
| US61/921,995 | 2013-12-30 | ||
| US201462025203P | 2014-07-16 | 2014-07-16 | |
| US62/025,203 | 2014-07-16 | ||
| PCT/US2014/072851 WO2015103317A1 (en) | 2013-12-30 | 2014-12-30 | Therapeutic inhibitory compounds |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2017501205A JP2017501205A (ja) | 2017-01-12 |
| JP2017501205A5 JP2017501205A5 (enExample) | 2018-02-08 |
| JP6759100B2 true JP6759100B2 (ja) | 2020-09-23 |
Family
ID=53493998
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2016544593A Expired - Fee Related JP6759100B2 (ja) | 2013-12-30 | 2014-12-30 | 治療用阻害化合物 |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US10266515B2 (enExample) |
| EP (1) | EP3089746A4 (enExample) |
| JP (1) | JP6759100B2 (enExample) |
| KR (1) | KR20160106627A (enExample) |
| CN (1) | CN106061480B (enExample) |
| AU (2) | AU2014373735B2 (enExample) |
| BR (1) | BR112016015449A8 (enExample) |
| CA (1) | CA2935683A1 (enExample) |
| EA (1) | EA032713B1 (enExample) |
| MX (1) | MX2016008688A (enExample) |
| WO (1) | WO2015103317A1 (enExample) |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8563573B2 (en) | 2007-11-02 | 2013-10-22 | Vertex Pharmaceuticals Incorporated | Azaindole derivatives as CFTR modulators |
| US8802868B2 (en) | 2010-03-25 | 2014-08-12 | Vertex Pharmaceuticals Incorporated | Solid forms of (R)-1(2,2-difluorobenzo[D][1,3]dioxo1-5-yl)-N-(1-(2,3-dihydroxypropyl-6-fluoro-2-(1-hydroxy-2-methylpropan2-yl)-1H-Indol-5-yl)-Cyclopropanecarboxamide |
| RU2745977C2 (ru) | 2010-04-22 | 2021-04-05 | Вертекс Фармасьютикалз Инкорпорейтед | Способ получения циклоалкилкарбоксамидо-индольных соединений |
| HUE14755117T2 (hu) | 2013-08-14 | 2018-12-28 | Kalvista Pharmaceuticals Ltd | Plazma-kallikrein inhibitorok |
| TWI636047B (zh) | 2013-08-14 | 2018-09-21 | 英商卡爾維斯塔製藥有限公司 | 雜環衍生物 |
| US9611252B2 (en) * | 2013-12-30 | 2017-04-04 | Lifesci Pharmaceuticals, Inc. | Therapeutic inhibitory compounds |
| WO2015103317A1 (en) | 2013-12-30 | 2015-07-09 | Lifesci Pharmaceuticals, Inc. | Therapeutic inhibitory compounds |
| SG10201913575VA (en) | 2014-04-15 | 2020-02-27 | Vertex Pharma | Pharmaceutical compositions for the treatment of cystic fibrosis transmembrane conductance regulator mediated diseases |
| MX381342B (es) * | 2014-07-16 | 2025-03-12 | Lifesci Pharmaceuticals Inc | Compuestos terapeuticos inhibidores. |
| GB201421083D0 (en) | 2014-11-27 | 2015-01-14 | Kalvista Pharmaceuticals Ltd | Enzyme inhibitors |
| GB201421085D0 (en) | 2014-11-27 | 2015-01-14 | Kalvista Pharmaceuticals Ltd | New enzyme inhibitors |
| WO2017087885A1 (en) | 2015-11-19 | 2017-05-26 | Dana-Farber Cancer Institute, Inc. | Methods of identifying compounds that interfere with erg-driven misguidance of baf complexes in tmprss2-erg driven prostate cancers |
| WO2017122754A1 (ja) | 2016-01-12 | 2017-07-20 | 日本ケミファ株式会社 | 電位依存性t型カルシウムチャネル阻害剤 |
| RS60600B1 (sr) | 2016-05-31 | 2020-08-31 | Kalvista Pharmaceuticals Ltd | Derivati pirazola kao inhibitori kalikreina plazme |
| GB201609603D0 (en) | 2016-06-01 | 2016-07-13 | Kalvista Pharmaceuticals Ltd | Polymorphs of N-[(6-cyano-2-fluoro-3-methoxyphenyl)Methyl]-3-(methoxymethyl)-1-({4-[(2-ox opyridin-1-YL)Methyl]phenyl}methyl)pyrazole-4-carboxamide |
| GB201609607D0 (en) | 2016-06-01 | 2016-07-13 | Kalvista Pharmaceuticals Ltd | Polymorphs of N-(3-Fluoro-4-methoxypyridin-2-yl)methyl)-3-(methoxymethyl)-1-({4-((2-oxopy ridin-1-yl)methyl)phenyl}methyl)pyrazole-4-carboxamide and salts |
| WO2018011628A1 (en) | 2016-07-11 | 2018-01-18 | Lifesci Pharmaceuticals, Inc. | Therapeutic inhibitory compounds |
| CN107033015B (zh) * | 2017-06-02 | 2019-04-30 | 南京欧信医药技术有限公司 | 一种药物中间体的合成方法 |
| GB201719881D0 (en) | 2017-11-29 | 2018-01-10 | Kalvista Pharmaceuticals Ltd | Solid forms of plasma kallikrein inhibitor and salts thereof |
| IL274557B2 (en) | 2017-11-29 | 2024-09-01 | Kalvista Pharmaceuticals Ltd | Dosage forms comprising a plasma kallikrein inhibitor |
| CN112153984A (zh) | 2018-01-30 | 2020-12-29 | 福宏治疗公司 | 化合物及其用途 |
| JP2021515761A (ja) * | 2018-02-28 | 2021-06-24 | ライフサイ ファーマシューティカルズ,インク. | 遺伝性血管浮腫の治療 |
| TWI903299B (zh) | 2018-03-08 | 2025-11-01 | 美商英塞特公司 | 作為PI3K-γ抑制劑之胺基吡嗪二醇化合物 |
| KR20200143376A (ko) | 2018-03-13 | 2020-12-23 | 샤이어 휴먼 지네틱 테라피즈 인크. | 혈장 칼리크레인 억제제로서의 치환된 이미다조피리딘 및 이의 용도 |
| KR20210016545A (ko) | 2018-05-29 | 2021-02-16 | 오메로스 코포레이션 | Masp-2 억제제 및 사용 방법 |
| US11584714B2 (en) | 2018-05-29 | 2023-02-21 | Omeros Corporation | MASP-2 inhibitors and methods of use |
| WO2020010003A1 (en) | 2018-07-02 | 2020-01-09 | Incyte Corporation | AMINOPYRAZINE DERIVATIVES AS PI3K-γ INHIBITORS |
| WO2020081588A1 (en) | 2018-10-17 | 2020-04-23 | Dana-Farber Cancer Institute, Inc. | Swi/snf family chromatin remodeling complexes and uses thereof |
| US12384776B2 (en) | 2019-01-29 | 2025-08-12 | Foghorn Therapeutics Inc. | Compounds and uses thereof |
| WO2020160100A1 (en) | 2019-01-29 | 2020-08-06 | Foghorn Therapeutics Inc. | Compounds and uses thereof |
| CN110256342B (zh) * | 2019-07-16 | 2022-06-07 | 河南省科学院化学研究所有限公司 | 一种2-氰基喹啉衍生物的合成方法 |
| CN114206852A (zh) | 2019-08-09 | 2022-03-18 | 卡尔维斯塔制药有限公司 | 血浆激肽释放酶抑制剂 |
| ES2987744T3 (es) | 2019-09-18 | 2024-11-18 | Takeda Pharmaceuticals Co | Inhibidores de calicreína plasmática y usos de los mismos |
| WO2021055589A1 (en) | 2019-09-18 | 2021-03-25 | Shire Human Genetic Therapies, Inc. | Heteroaryl plasma kallikrein inhibitors |
| WO2021113686A1 (en) | 2019-12-04 | 2021-06-10 | Omeros Corporation | Masp-2 inhibitors and methods of use |
| WO2021113682A1 (en) | 2019-12-04 | 2021-06-10 | Omeros Corporation | Masp-2 inhibitors and methods of use |
| EP4069676A1 (en) | 2019-12-04 | 2022-10-12 | Omeros Corporation | Masp-2 inhibitors and methods of use |
| DK4069691T3 (da) | 2019-12-06 | 2024-10-28 | Vertex Pharma | Substituerede tetrahydrofuraner som modulatorer af natriumkanaler |
| JP7561195B2 (ja) | 2020-01-29 | 2024-10-03 | フォグホーン セラピューティクス インコーポレイテッド | 化合物及びその使用 |
| US20230121497A1 (en) * | 2020-01-29 | 2023-04-20 | Foghorn Therapeutics Inc. | Compounds and uses thereof |
| US12383555B2 (en) | 2020-05-20 | 2025-08-12 | Foghorn Therapeutics Inc. | Methods of treating cancers |
| MA64853B1 (fr) | 2021-06-04 | 2025-11-28 | Vertex Pharmaceuticals Incorporated | N-(hydroxyalkyl (hétéro)aryl) tétrahydrofuran carboxamides utilisés en tant que modulateurs de canaux sodiques |
| CA3240263A1 (en) | 2021-12-09 | 2023-06-15 | Daniel L. Flynn | Raf kinase inhibitors and methods of use thereof |
| JP2025531207A (ja) * | 2022-09-15 | 2025-09-19 | 武田薬品工業株式会社 | 遺伝性血管性浮腫の処置のための血漿カリクレイン阻害剤としてのn-((イソキノリン-6イル)メチル)-1h-ピラゾール-4-カルボキサミド誘導体 |
| AU2024307587A1 (en) * | 2023-06-30 | 2026-02-19 | Longwood Pharmaceuticals (Hangzhou) Co., Ltd | Heteroaromatic formamide compounds and uses thereof in medicine |
| WO2025160190A1 (en) * | 2024-01-23 | 2025-07-31 | Retune Pharma Inc. | Therapeutic inhibitory compounds |
| WO2025247982A1 (en) * | 2024-05-29 | 2025-12-04 | Grünenthal GmbH | Piperazines which act as sstr4 modulators |
Family Cites Families (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW212792B (enExample) * | 1991-09-13 | 1993-09-11 | Shell Internat Res Schappej B V | |
| IL108459A0 (en) * | 1993-02-05 | 1994-04-12 | Opjohn Company | 4-Hydroxy-benzopyran-2-ones and 4-hydroxy-cycloalkyl [B] pyran-2-ones useful for treating infections due to hiv and other retroviruses |
| ES2293638T3 (es) | 1994-03-25 | 2008-03-16 | Isotechnika, Inc. | Mejora de la eficacia de farmacos por deuteracion. |
| US6334997B1 (en) | 1994-03-25 | 2002-01-01 | Isotechnika, Inc. | Method of using deuterated calcium channel blockers |
| TW575562B (en) * | 1998-02-19 | 2004-02-11 | Agrevo Uk Ltd | Fungicides |
| PL356487A1 (en) * | 1999-11-10 | 2004-06-28 | Takeda Chemical Industries, Ltd. | 5-membered n-heterocyclic compounds with hypoglycemic and hypolipidemic activity |
| US7071216B2 (en) * | 2002-03-29 | 2006-07-04 | Chiron Corporation | Substituted benz-azoles and methods of their use as inhibitors of Raf kinase |
| AU2004218456A1 (en) * | 2003-02-28 | 2004-09-16 | Encysive Pharmaceuticals Inc. | Pyridine, pyrimidine, quinoline, quinazoline, and naphthalene urotensin-II receptor antagonists. |
| GB0403155D0 (en) * | 2004-02-12 | 2004-03-17 | Vernalis Res Ltd | Chemical compounds |
| JP2009520811A (ja) * | 2005-12-22 | 2009-05-28 | クリスタルジェノミクス、インコーポレイテッド | プロテインキナーゼ活性を阻害するアミノピリミジン誘導体、及びその製造方法並びにこれを有効成分として含む医薬組成物 |
| US20070254894A1 (en) * | 2006-01-10 | 2007-11-01 | Kane John L Jr | Novel small molecules with selective cytotoxicity against human microvascular endothelial cell proliferation |
| WO2007098352A2 (en) | 2006-02-16 | 2007-08-30 | Boehringer Ingelheim International Gmbh | Substituted pyridineamide compounds useful as soluble epoxide hydrolase inhibitors |
| CL2007003609A1 (es) | 2006-12-14 | 2008-07-25 | Bayer Schering Pharma Ag | Compuestos derivados de dihidropiridinas sustituidas; proceso de preparacion; compuestos intermediarios; composicion farmaceutica; proceso para producir la composicion farmaceutica; y uso en el tratamiento de una enfermedad mejorada con la inhibicion |
| EP2129670A2 (en) * | 2007-02-16 | 2009-12-09 | Glaxo Group Limited | Benzofuran compounds useful in the treatment of conditions mediated by the action of pge2 at the ep1 receptor |
| EP2002834A1 (de) * | 2007-06-13 | 2008-12-17 | Bayer Schering Pharma Aktiengesellschaft | Aryl/Hetarylamide als Modulatoren des EP2-Rezeptors |
| WO2009083553A1 (en) * | 2007-12-31 | 2009-07-09 | Rheoscience A/S | Azine compounds as glucokinase activators |
| JPWO2009119088A1 (ja) * | 2008-03-25 | 2011-07-21 | 武田薬品工業株式会社 | 複素環化合物 |
| US20090270407A1 (en) * | 2008-04-25 | 2009-10-29 | E. I. Du Pont De Nemours And Company | Fungicidal isoxazolidines |
| CN102099339A (zh) | 2008-07-18 | 2011-06-15 | 武田药品工业株式会社 | 苯并氮杂衍生物及其作为组胺h3拮抗剂的用途 |
| EP2358371B1 (en) | 2008-10-31 | 2015-02-11 | Merck Sharp & Dohme Corp. | P2x3, receptor antagonists for treatment of pain |
| WO2010108733A1 (en) * | 2009-03-26 | 2010-09-30 | Syngenta Participations Ag | Insecticidal compounds |
| GB201004739D0 (en) * | 2010-03-22 | 2010-05-05 | Prosidion Ltd | Receptor modulators |
| US9290485B2 (en) * | 2010-08-04 | 2016-03-22 | Novartis Ag | N-((6-amino-pyridin-3-yl)methyl)-heteroaryl-carboxamides |
| MX344521B (es) * | 2010-11-19 | 2016-12-19 | Ligand Pharm Inc | Aminas heterociclicas y sus usos. |
| GB201021103D0 (en) * | 2010-12-13 | 2011-01-26 | Univ Leuven Kath | New compounds for the treatment of neurodegenerative diseases |
| US9321727B2 (en) * | 2011-06-10 | 2016-04-26 | Hoffmann-La Roche Inc. | Pyridine derivatives as agonists of the CB2 receptor |
| CN102904742B (zh) | 2011-07-29 | 2015-10-07 | 华为终端有限公司 | 对可执行节点的操作方法及系统 |
| WO2013040436A2 (en) * | 2011-09-16 | 2013-03-21 | The Regents Of The University Of Michgian | Esx-mediated transcription modulators and related methods |
| US9206128B2 (en) * | 2011-11-18 | 2015-12-08 | Constellation Pharmaceuticals, Inc. | Modulators of methyl modifying enzymes, compositions and uses thereof |
| WO2013111108A1 (en) | 2012-01-27 | 2013-08-01 | Novartis Ag | 5-membered heteroarylcarboxamide derivatives as plasma kallikrein inhibitors |
| EP2807156A1 (en) | 2012-01-27 | 2014-12-03 | Novartis AG | Aminopyridine derivatives as plasma kallikrein inhibitors |
| MY179412A (en) * | 2012-12-07 | 2020-11-05 | Hoffmann La Roche | Pyridine-2-amides useful as cb2 agonists |
| HUE034829T2 (en) | 2013-05-23 | 2018-03-28 | Kalvista Pharmaceuticals Ltd | Heterocyclic derivatives |
| HUE14755117T2 (hu) | 2013-08-14 | 2018-12-28 | Kalvista Pharmaceuticals Ltd | Plazma-kallikrein inhibitorok |
| US9611252B2 (en) | 2013-12-30 | 2017-04-04 | Lifesci Pharmaceuticals, Inc. | Therapeutic inhibitory compounds |
| WO2015103317A1 (en) | 2013-12-30 | 2015-07-09 | Lifesci Pharmaceuticals, Inc. | Therapeutic inhibitory compounds |
| MX381342B (es) * | 2014-07-16 | 2025-03-12 | Lifesci Pharmaceuticals Inc | Compuestos terapeuticos inhibidores. |
| GB201421088D0 (en) | 2014-11-27 | 2015-01-14 | Kalvista Pharmaceuticals Ltd | New enzyme inhibitors |
| WO2018011628A1 (en) | 2016-07-11 | 2018-01-18 | Lifesci Pharmaceuticals, Inc. | Therapeutic inhibitory compounds |
-
2014
- 2014-12-30 WO PCT/US2014/072851 patent/WO2015103317A1/en not_active Ceased
- 2014-12-30 BR BR112016015449A patent/BR112016015449A8/pt active Search and Examination
- 2014-12-30 EA EA201691354A patent/EA032713B1/ru unknown
- 2014-12-30 CN CN201480076616.5A patent/CN106061480B/zh not_active Expired - Fee Related
- 2014-12-30 EP EP14877414.4A patent/EP3089746A4/en not_active Withdrawn
- 2014-12-30 CA CA2935683A patent/CA2935683A1/en not_active Abandoned
- 2014-12-30 MX MX2016008688A patent/MX2016008688A/es unknown
- 2014-12-30 JP JP2016544593A patent/JP6759100B2/ja not_active Expired - Fee Related
- 2014-12-30 US US14/800,631 patent/US10266515B2/en not_active Expired - Fee Related
- 2014-12-30 KR KR1020167020567A patent/KR20160106627A/ko not_active Ceased
- 2014-12-30 AU AU2014373735A patent/AU2014373735B2/en not_active Ceased
-
2019
- 2019-04-02 US US16/373,391 patent/US20200031799A1/en not_active Abandoned
-
2020
- 2020-03-03 AU AU2020201550A patent/AU2020201550A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| US10266515B2 (en) | 2019-04-23 |
| MX2016008688A (es) | 2017-01-12 |
| AU2014373735A1 (en) | 2016-08-11 |
| EA201691354A1 (ru) | 2016-12-30 |
| JP2017501205A (ja) | 2017-01-12 |
| CN106061480A (zh) | 2016-10-26 |
| AU2020201550A1 (en) | 2020-03-19 |
| KR20160106627A (ko) | 2016-09-12 |
| CA2935683A1 (en) | 2015-07-09 |
| EP3089746A1 (en) | 2016-11-09 |
| AU2014373735B2 (en) | 2020-03-12 |
| US20180170906A1 (en) | 2018-06-21 |
| CN106061480B (zh) | 2020-02-28 |
| BR112016015449A8 (pt) | 2020-06-09 |
| EP3089746A4 (en) | 2017-08-30 |
| EA032713B1 (ru) | 2019-07-31 |
| US20200031799A1 (en) | 2020-01-30 |
| WO2015103317A1 (en) | 2015-07-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6759100B2 (ja) | 治療用阻害化合物 | |
| EP3033336B1 (en) | Inhibitors of plasma kallikrein | |
| US10730863B2 (en) | Bridged bicyclic compounds as farnesoid X receptor modulators | |
| KR100908176B1 (ko) | 인자 Xa 억제제로서의 락탐-함유 화합물 및 그의 유도체 | |
| US9181272B2 (en) | Aldosterone synthase inhibitors | |
| WO2005063738A1 (ja) | 新規2-へテロアリール置換ベンズイミダゾール誘導体 | |
| WO2016011390A1 (en) | Irak4 inhibiting agents | |
| JP2009517383A (ja) | 新規な3−ビシクロカルボニルアミノピリジン−2−カルボキサミド又は3−ビシクロカルボニルアミノピラジン−2−カルボキサミド | |
| JP5036316B2 (ja) | アリールオキシ置換ベンズイミダゾール誘導体 | |
| KR20090125779A (ko) | 브라디키닌 b2 수용체 조절제로서 8-옥시-퀴놀린 유도체 | |
| EA028626B1 (ru) | БЕНЗИМИДАЗОЛЫ, МОДУЛИРУЮЩИЕ TNF-α | |
| JP2014001228A (ja) | H−pgdsの阻害剤としてのマルチヘテロアリール化合物及びプロスタグランジンd2を介した疾患を治療するための該化合物の使用 | |
| TW202339734A (zh) | 用於抑制yap/taz-tead之2-吡唑苯胺及相關類似物 | |
| CN114650993B (zh) | 一种pd-1/pd-l1抑制剂及其制备方法和用途 | |
| JP2024542145A (ja) | Prmt5阻害剤としての2-アミノイミダゾール誘導体 | |
| TW202337457A (zh) | 新穎苯并咪唑吡啶衍生物 | |
| WO2022167819A1 (en) | Novel compounds | |
| WO2025059562A1 (en) | Substituted aminopyridine compounds and methods of treating disease using same | |
| US20220153724A1 (en) | Inhibitors Of Plasma Kallikrein | |
| HK1230502B (zh) | 治疗性抑制性化合物 | |
| HK1230502A1 (en) | Therapeutic inhibitory compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20160819 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20171223 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20171223 |
|
| A977 | Report on retrieval |
Free format text: JAPANESE INTERMEDIATE CODE: A971007 Effective date: 20180830 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20180910 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20181206 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20190201 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20190228 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20190318 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20190604 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20190917 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A132 Effective date: 20191002 |
|
| A601 | Written request for extension of time |
Free format text: JAPANESE INTERMEDIATE CODE: A601 Effective date: 20191220 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20200401 |
|
| TRDD | Decision of grant or rejection written | ||
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 Effective date: 20200805 |
|
| A61 | First payment of annual fees (during grant procedure) |
Free format text: JAPANESE INTERMEDIATE CODE: A61 Effective date: 20200902 |
|
| R150 | Certificate of patent or registration of utility model |
Ref document number: 6759100 Country of ref document: JP Free format text: JAPANESE INTERMEDIATE CODE: R150 |
|
| LAPS | Cancellation because of no payment of annual fees |