JP2002518416A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2002518416A5 JP2002518416A5 JP2000555495A JP2000555495A JP2002518416A5 JP 2002518416 A5 JP2002518416 A5 JP 2002518416A5 JP 2000555495 A JP2000555495 A JP 2000555495A JP 2000555495 A JP2000555495 A JP 2000555495A JP 2002518416 A5 JP2002518416 A5 JP 2002518416A5
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- alkoxy
- hydrogen
- group
- radicals
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 125000000217 alkyl group Chemical group 0.000 description 93
- 229910052739 hydrogen Inorganic materials 0.000 description 41
- 239000001257 hydrogen Substances 0.000 description 41
- -1 tetrahydropyran-4-yl Chemical group 0.000 description 34
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 33
- 229910052736 halogen Inorganic materials 0.000 description 32
- 150000002367 halogens Chemical class 0.000 description 32
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 26
- 125000003545 alkoxy group Chemical group 0.000 description 25
- 125000000753 cycloalkyl group Chemical group 0.000 description 22
- 125000001188 haloalkyl group Chemical group 0.000 description 19
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 18
- 125000003342 alkenyl group Chemical group 0.000 description 17
- 125000000304 alkynyl group Chemical group 0.000 description 15
- 125000004438 haloalkoxy group Chemical group 0.000 description 12
- 230000002363 herbicidal effect Effects 0.000 description 12
- 229910052760 oxygen Inorganic materials 0.000 description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 10
- 125000004414 alkyl thio group Chemical group 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 9
- 125000006648 (C1-C8) haloalkyl group Chemical group 0.000 description 8
- 239000004215 Carbon black (E152) Substances 0.000 description 8
- 125000002947 alkylene group Chemical group 0.000 description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 125000000623 heterocyclic group Chemical group 0.000 description 8
- 229930195733 hydrocarbon Natural products 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 7
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 7
- 125000004093 cyano group Chemical group *C#N 0.000 description 7
- 125000000262 haloalkenyl group Chemical group 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 7
- 229910052717 sulfur Inorganic materials 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 6
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 6
- 150000002431 hydrogen Chemical class 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 125000004430 oxygen atom Chemical group O* 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
- 125000004995 haloalkylthio group Chemical group 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 4
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 description 4
- 0 CC1(C)C(CCC*CC2)C2c2cc(C)ccc2CCC**C1 Chemical compound CC1(C)C(CCC*CC2)C2c2cc(C)ccc2CCC**C1 0.000 description 4
- 125000005103 alkyl silyl group Chemical group 0.000 description 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 3
- 125000003302 alkenyloxy group Chemical group 0.000 description 3
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 description 3
- 125000000676 alkoxyimino group Chemical group 0.000 description 3
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 3
- 125000005277 alkyl imino group Chemical group 0.000 description 3
- 125000005225 alkynyloxycarbonyl group Chemical group 0.000 description 3
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical group [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 2
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 description 2
- YIVXMZJTEQBPQO-UHFFFAOYSA-N 2,4-DB Chemical compound OC(=O)CCCOC1=CC=C(Cl)C=C1Cl YIVXMZJTEQBPQO-UHFFFAOYSA-N 0.000 description 2
- 239000002794 2,4-DB Substances 0.000 description 2
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 2
- OHXLAOJLJWLEIP-UHFFFAOYSA-N 2-(dichloromethyl)-2-methyl-1,3-dioxolane Chemical compound ClC(Cl)C1(C)OCCO1 OHXLAOJLJWLEIP-UHFFFAOYSA-N 0.000 description 2
- UKSLKNUCVPZQCQ-UHFFFAOYSA-N Fluxofenim Chemical compound C=1C=C(Cl)C=CC=1C(C(F)(F)F)=NOCC1OCCO1 UKSLKNUCVPZQCQ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000004471 alkyl aminosulfonyl group Chemical group 0.000 description 2
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 2
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 2
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 2
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 2
- MKQSWTQPLLCSOB-UHFFFAOYSA-N benzyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate Chemical compound N1=C(Cl)SC(C(=O)OCC=2C=CC=CC=2)=C1C(F)(F)F MKQSWTQPLLCSOB-UHFFFAOYSA-N 0.000 description 2
- 125000003917 carbamoyl group Chemical class [H]N([H])C(*)=O 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 125000004472 dialkylaminosulfonyl group Chemical group 0.000 description 2
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 2
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 2
- 125000004441 haloalkylsulfonyl group Chemical group 0.000 description 2
- 125000000232 haloalkynyl group Chemical group 0.000 description 2
- 125000005347 halocycloalkyl group Chemical group 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000003566 oxetanyl group Chemical group 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- SODPIMGUZLOIPE-UHFFFAOYSA-N (4-chlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=C(Cl)C=C1 SODPIMGUZLOIPE-UHFFFAOYSA-N 0.000 description 1
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 description 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- AXHCGXRBOHBEQA-UHFFFAOYSA-N 2-(5-chloro-2-methylphenoxy)acetic acid Chemical compound CC1=CC=C(Cl)C=C1OCC(O)=O AXHCGXRBOHBEQA-UHFFFAOYSA-N 0.000 description 1
- LLWADFLAOKUBDR-UHFFFAOYSA-N 2-methyl-4-chlorophenoxybutyric acid Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 1
- SIYAHZSHQIPQLY-UHFFFAOYSA-N 4-(4-chlorophenoxy)butanoic acid Chemical compound OC(=O)CCCOC1=CC=C(Cl)C=C1 SIYAHZSHQIPQLY-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 235000007558 Avena sp Nutrition 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- PYKLUAIDKVVEOS-UHFFFAOYSA-N Cyometrinil Chemical compound N#CCON=C(C#N)C1=CC=CC=C1 PYKLUAIDKVVEOS-UHFFFAOYSA-N 0.000 description 1
- NNYRZQHKCHEXSD-UHFFFAOYSA-N Daimuron Chemical compound C1=CC(C)=CC=C1NC(=O)NC(C)(C)C1=CC=CC=C1 NNYRZQHKCHEXSD-UHFFFAOYSA-N 0.000 description 1
- 239000005504 Dicamba Substances 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- NRFQZTCQAYEXEE-UHFFFAOYSA-N Fenclorim Chemical compound ClC1=CC(Cl)=NC(C=2C=CC=CC=2)=N1 NRFQZTCQAYEXEE-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000299507 Gossypium hirsutum Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- 239000005575 MCPB Substances 0.000 description 1
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical compound C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 244000082988 Secale cereale Species 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 125000005089 alkenylaminocarbonyl group Chemical group 0.000 description 1
- 125000005090 alkenylcarbonyl group Chemical group 0.000 description 1
- 125000005091 alkenylcarbonylamino group Chemical group 0.000 description 1
- 125000005193 alkenylcarbonyloxy group Chemical group 0.000 description 1
- 125000005108 alkenylthio group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- 125000004691 alkyl thio carbonyl group Chemical group 0.000 description 1
- 125000005095 alkynylaminocarbonyl group Chemical group 0.000 description 1
- 125000005087 alkynylcarbonyl group Chemical group 0.000 description 1
- 125000005088 alkynylcarbonylamino group Chemical group 0.000 description 1
- 125000005198 alkynylcarbonyloxy group Chemical group 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- 125000005109 alkynylthio group Chemical group 0.000 description 1
- 125000005135 aryl sulfinyl group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 238000010353 genetic engineering Methods 0.000 description 1
- 125000004993 haloalkoxycarbonyl group Chemical group 0.000 description 1
- 125000004440 haloalkylsulfinyl group Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- JJTUDXZGHPGLLC-UHFFFAOYSA-N lactide Chemical compound CC1OC(=O)C(C)OC1=O JJTUDXZGHPGLLC-UHFFFAOYSA-N 0.000 description 1
- JCHMGYRXQDASJE-UHFFFAOYSA-N metcamifen Chemical compound C1=CC(NC(=O)NC)=CC=C1S(=O)(=O)NC(=O)C1=CC=CC=C1OC JCHMGYRXQDASJE-UHFFFAOYSA-N 0.000 description 1
- LQPRNRFJJUSONA-UHFFFAOYSA-N methyl 2-benzhydryloxyacetate Chemical compound C=1C=CC=CC=1C(OCC(=O)OC)C1=CC=CC=C1 LQPRNRFJJUSONA-UHFFFAOYSA-N 0.000 description 1
- WFVUIONFJOAYPK-UHFFFAOYSA-N n-(1,3-dioxolan-2-ylmethoxy)benzenecarboximidoyl cyanide Chemical compound C=1C=CC=CC=1C(C#N)=NOCC1OCCO1 WFVUIONFJOAYPK-UHFFFAOYSA-N 0.000 description 1
- NYDKNJDNBUFWRJ-UHFFFAOYSA-N n-[4-(dimethylcarbamoylamino)phenyl]sulfonyl-2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(=O)NS(=O)(=O)C1=CC=C(NC(=O)N(C)C)C=C1 NYDKNJDNBUFWRJ-UHFFFAOYSA-N 0.000 description 1
- ZYAOTFVRVOXVSD-UHFFFAOYSA-N n-[4-(dimethylcarbamoylamino)phenyl]sulfonylnaphthalene-1-carboxamide Chemical compound C1=CC(NC(=O)N(C)C)=CC=C1S(=O)(=O)NC(=O)C1=CC=CC2=CC=CC=C12 ZYAOTFVRVOXVSD-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000005302 thiazolylmethyl group Chemical group [H]C1=C([H])N=C(S1)C([H])([H])* 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19827855.1 | 1998-06-23 | ||
| DE19827855A DE19827855A1 (de) | 1998-06-23 | 1998-06-23 | Kombinationen aus Herbiziden und Safenern |
| PCT/EP1999/003980 WO1999066795A1 (de) | 1998-06-23 | 1999-06-09 | Kombinationen aus herbiziden und safenern |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2002518416A JP2002518416A (ja) | 2002-06-25 |
| JP2002518416A5 true JP2002518416A5 (enExample) | 2006-08-03 |
| JP4653307B2 JP4653307B2 (ja) | 2011-03-16 |
Family
ID=7871700
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2000555495A Expired - Lifetime JP4653307B2 (ja) | 1998-06-23 | 1999-06-09 | 除草剤と毒性緩和剤の結合 |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US6511940B1 (enExample) |
| EP (2) | EP1415537B1 (enExample) |
| JP (1) | JP4653307B2 (enExample) |
| KR (1) | KR20010053176A (enExample) |
| CN (1) | CN1167340C (enExample) |
| AR (1) | AR019870A1 (enExample) |
| AU (1) | AU4510499A (enExample) |
| BR (2) | BR9911443B1 (enExample) |
| CA (1) | CA2335945C (enExample) |
| DE (3) | DE19827855A1 (enExample) |
| ES (2) | ES2229720T3 (enExample) |
| HU (2) | HU230076B1 (enExample) |
| MX (2) | MX231281B (enExample) |
| PH (1) | PH11999001531B1 (enExample) |
| RU (1) | RU2221427C2 (enExample) |
| TW (1) | TW574024B (enExample) |
| WO (1) | WO1999066795A1 (enExample) |
| ZA (1) | ZA200007302B (enExample) |
Families Citing this family (86)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19853827A1 (de) | 1998-11-21 | 2000-05-25 | Aventis Cropscience Gmbh | Kombinationen aus Herbiziden und Safenern |
| DE19936437A1 (de) * | 1999-08-03 | 2001-02-08 | Aventis Cropscience Gmbh | Kombinationen aus Herbiziden und Safenern |
| SK3162002A3 (en) | 1999-09-08 | 2002-06-04 | Aventis Cropscience Uk Ltd | New herbicidal compositions |
| DE19950943A1 (de) * | 1999-10-22 | 2001-05-17 | Aventis Cropscience Gmbh | Synergistische herbizide Mittel enthaltend Herbizide aus der Gruppe der Hemmstoffe der Hydroxyphenylpyruvat-Dioxygenase |
| DE19958381A1 (de) * | 1999-12-03 | 2001-06-07 | Bayer Ag | Herbizide auf Basis von N-Aryl-uracilen |
| DE10031825A1 (de) * | 2000-06-30 | 2002-01-10 | Bayer Ag | Selektive Herbizide auf Basis von Arylsulfonylaminocarbonyltriazolinonen |
| GB0016787D0 (en) | 2000-07-07 | 2000-08-30 | Pfizer Ltd | Compounds useful in therapy |
| WO2002015695A2 (en) * | 2000-08-25 | 2002-02-28 | Basf Aktiengesellschaft | Synergistic combination of a dihydrobenzothiophene herbicide and a photosystem ii inhibitor |
| US20040110637A1 (en) * | 2001-01-31 | 2004-06-10 | Frank Ziemer | Method of safening crops using isoxazoline carboxylates |
| DE10106420A1 (de) * | 2001-02-12 | 2002-08-14 | Bayer Ag | Selektive Herbizide auf Basis von substituierten Arylketonen und Safenern |
| DE10119721A1 (de) * | 2001-04-21 | 2002-10-31 | Bayer Cropscience Gmbh | Herbizide Mittel enthaltend Benzoylcyclohexandione und Safener |
| DE10127328A1 (de) | 2001-06-06 | 2002-12-19 | Bayer Cropscience Gmbh | Herbizide Mittel enthaltend Benzoylpyrazole und Safener |
| DE10142333A1 (de) * | 2001-08-30 | 2003-03-20 | Bayer Cropscience Ag | Herbizide Mischungen auf Basis von substituierten Arylketonen |
| DE10142334A1 (de) * | 2001-08-30 | 2003-03-20 | Bayer Cropscience Ag | Herbizide auf Basis von substituierten Arylketonen |
| DE10143083A1 (de) * | 2001-09-03 | 2003-03-20 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von substituierten Arylsulfonylaminocarbonyltriazolinonen und Safenern |
| DE10145019A1 (de) | 2001-09-13 | 2003-04-03 | Bayer Cropscience Gmbh | Kombinationen aus Herbiziden und Safenern |
| DE10146591A1 (de) * | 2001-09-21 | 2003-04-10 | Bayer Cropscience Ag | Herbizide auf Basis von substituierten Thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)onen |
| DE10146590A1 (de) | 2001-09-21 | 2003-04-10 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von substituierten Thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)onen und Safenern |
| DE10157545A1 (de) | 2001-11-23 | 2003-06-12 | Bayer Cropscience Gmbh | Herbizide Mittel enthaltend Benzoylpyrazole und Safener |
| DE10159659A1 (de) * | 2001-12-05 | 2003-06-26 | Bayer Cropscience Ag | Herbizide auf Basis von substituierten Carbonsäureaniliden |
| DE10212887A1 (de) * | 2002-03-22 | 2003-10-02 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von substituierten Aminotriazinonen und substituierten Benzoylcyclohexandionen |
| DE10237461A1 (de) * | 2002-08-16 | 2004-02-26 | Bayer Cropscience Gmbh | Herbizide Mittel enthaltend Benzoylpyrazole und Safener |
| DE10301804A1 (de) * | 2003-01-20 | 2004-07-29 | Bayer Cropscience Ag | 2,4-Dihalogen-6-(C2-C3-alkyl)-phenyl substituierte Tetramsäure-Derivate |
| DE10301806A1 (de) * | 2003-01-20 | 2004-07-29 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von substituierten, cyclischen Dicarbonylverbindungen und Safenern |
| DE10311300A1 (de) | 2003-03-14 | 2004-09-23 | Bayer Cropscience Ag | 2,4,6-Phenylsubstituierte cyclische Ketoenole |
| DE10325659A1 (de) * | 2003-06-06 | 2004-12-23 | Bayer Cropscience Gmbh | Herbizide Mittel enthaltend 3-Aminobenzoylpyrazole und Safener |
| DE10326386A1 (de) * | 2003-06-12 | 2004-12-30 | Bayer Cropscience Ag | N-Heterocyclyl-phenylsubstituierte cyclische Ketoenole |
| DE10331675A1 (de) | 2003-07-14 | 2005-02-10 | Bayer Cropscience Ag | Hetarylsubstituierte Pyrazolidindion-Derivate |
| WO2005013696A1 (en) * | 2003-07-29 | 2005-02-17 | Syngenta Participation Ag | Method of controlling weeds in transgenic crops |
| DE10337497A1 (de) | 2003-08-14 | 2005-03-10 | Bayer Cropscience Ag | 4-Biphenylsubstituierte-Pyrazolidin-3,5-dion-Derivate |
| DE10337496A1 (de) | 2003-08-14 | 2005-04-14 | Bayer Cropscience Ag | 4-Biphenylsubstituierte-4-substituierte-pyrazolidin-3,5-dione |
| DE10355846A1 (de) * | 2003-11-26 | 2005-07-07 | Bayer Cropscience Gmbh | Herbizid wirksames Mittel |
| WO2005041654A2 (de) | 2003-11-03 | 2005-05-12 | Bayer Cropscience Gmbh | Herbizid wirksames mittel |
| DE10351234A1 (de) * | 2003-11-03 | 2005-06-16 | Bayer Cropscience Gmbh | Herbizid wirksames Mittel |
| US20050260244A9 (en) * | 2003-11-12 | 2005-11-24 | Sumitomo Chemical Company, Limited | Pesticidal particle |
| DE10354629A1 (de) | 2003-11-22 | 2005-06-30 | Bayer Cropscience Ag | 2-Ethyl-4,6-dimethyl-phenyl substituierte spirocyclische Tetramsäure-Derivate |
| DE102004010813A1 (de) | 2004-03-05 | 2005-11-10 | Bayer Cropscience Ag | Neue Herbizide auf Basis von substituierten Thien-3-yl-sulfonylamino(thio)carbonyltriazolin(thi)onen und 4-HPPD-Hemmstoffen |
| US20070060478A1 (en) * | 2005-09-13 | 2007-03-15 | Basf Aktiengesellschaft | Herbicidal mixtures comprising a safener |
| DE102004014620A1 (de) * | 2004-03-25 | 2005-10-06 | Bayer Cropscience Ag | 2,4,6-phenylsubstituierte cyclische Ketoenole |
| DE102004030753A1 (de) | 2004-06-25 | 2006-01-19 | Bayer Cropscience Ag | 3'-Alkoxy spirocyclische Tetram- und Tretronsäuren |
| DE102004035133A1 (de) | 2004-07-20 | 2006-02-16 | Bayer Cropscience Ag | Selektive Insektizide auf Basis von substituierten, cyclischen Ketoenolen und Safenern |
| DE102004035134A1 (de) | 2004-07-20 | 2006-02-16 | Bayer Cropscience Ag | Selektive Insektizide auf Basis von Halogenalkylnicotinsäurederivaten, Anthranilsäureamiden oder Phthalsäurediamiden und Safenern |
| US20080200499A1 (en) * | 2004-07-20 | 2008-08-21 | Reiner Fischer | Selective Insecticides and/or Acaricides Based on Substituted Cyclic Dicarbonyl Compounds and Safeners |
| DE102004044827A1 (de) | 2004-09-16 | 2006-03-23 | Bayer Cropscience Ag | Jod-phenylsubstituierte cyclische Ketoenole |
| DE102004053191A1 (de) | 2004-11-04 | 2006-05-11 | Bayer Cropscience Ag | 2,6-Diethyl-4-methyl-phenyl substituierte Tetramsäure-Derivate |
| DE102004053192A1 (de) | 2004-11-04 | 2006-05-11 | Bayer Cropscience Ag | 2-Alkoxy-6-alkyl-phenyl substituierte spirocyclische Tetramsäure-Derivate |
| DE102005008021A1 (de) * | 2005-02-22 | 2006-08-24 | Bayer Cropscience Ag | Spiroketal-substituierte cyclische Ketoenole |
| DE102005031787A1 (de) * | 2005-07-07 | 2007-01-18 | Bayer Cropscience Gmbh | Kulturpflanzenverträgliche herbizide Mittel enthaltend Herbizide Safener |
| DE102005051325A1 (de) * | 2005-10-27 | 2007-05-03 | Bayer Cropscience Ag | Alkoxyalkyl spirocyclische Tetram- und Tetronsäuren |
| DE102005059891A1 (de) | 2005-12-15 | 2007-06-28 | Bayer Cropscience Ag | 3'-Alkoxy-spirocyclopentyl substituierte Tetram- und Tetronsäuren |
| DE102006000971A1 (de) * | 2006-01-07 | 2007-07-12 | Bayer Cropscience Ag | 2,4,6-Trialkylphenylsubstituierte Cyclopentan-1,3-dione |
| DE102006007882A1 (de) | 2006-02-21 | 2007-08-30 | Bayer Cropscience Ag | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| DE102006018828A1 (de) * | 2006-04-22 | 2007-10-25 | Bayer Cropscience Ag | Alkoxyalkyl-substituierte cyclische Ketoenole |
| DE102006025874A1 (de) | 2006-06-02 | 2007-12-06 | Bayer Cropscience Ag | Alkoxyalkyl-substituierte cyclische Ketoenole |
| US7951995B2 (en) | 2006-06-28 | 2011-05-31 | Pioneer Hi-Bred International, Inc. | Soybean event 3560.4.3.5 and compositions and methods for the identification and detection thereof |
| DE102006050148A1 (de) | 2006-10-25 | 2008-04-30 | Bayer Cropscience Ag | Trifluormethoxy-phenylsubstituierte Tetramsäure-Derivate |
| ES2582552T3 (es) | 2006-10-31 | 2016-09-13 | E. I. Du Pont De Nemours And Company | Acontecimiento de soja DP-305423-1 y composiciones y métodos para su identificación y/o detección |
| DE102006057037A1 (de) | 2006-12-04 | 2008-06-05 | Bayer Cropscience Ag | cis-Alkoxyspirocyclische biphenylsubstituierte Tetramsäure-Derivate |
| DE102006057036A1 (de) | 2006-12-04 | 2008-06-05 | Bayer Cropscience Ag | Biphenylsubstituierte spirocyclische Ketoenole |
| EP2020413A1 (de) | 2007-08-02 | 2009-02-04 | Bayer CropScience AG | Oxaspirocyclische-spiro-substituierte Tetram- und Tetronsäure-Derivate |
| KR100947933B1 (ko) * | 2007-08-28 | 2010-03-15 | 주식회사 동부하이텍 | 인덕터 및 그 제조 방법 |
| EP2045240A1 (de) * | 2007-09-25 | 2009-04-08 | Bayer CropScience AG | Halogenalkoxyspirocyclische Tetram- und Tetronsäure-Derivate |
| WO2009089165A2 (en) * | 2008-01-07 | 2009-07-16 | Auburn University | Combinations of herbicides and safeners |
| EP2103615A1 (de) * | 2008-03-19 | 2009-09-23 | Bayer CropScience AG | 4'4'-Dioxaspiro-spirocyclisch substituierte Tetramate |
| GB0920891D0 (en) * | 2009-11-27 | 2010-01-13 | Syngenta Participations Ag | Herbicidal compositions |
| WO2011067184A1 (de) | 2009-12-01 | 2011-06-09 | Basf Se | 3- (4, 5 -dihydroisoxazol- 5 -yl) benzoylpyrazolverbindungen und ihre mischungen mit safenern |
| WO2011097187A2 (en) * | 2010-02-03 | 2011-08-11 | Dow Agrosciences Llc | Synergistic herbicidal composition containing penoxsulam and butachlor |
| US9187762B2 (en) | 2010-08-13 | 2015-11-17 | Pioneer Hi-Bred International, Inc. | Compositions and methods comprising sequences having hydroxyphenylpyruvate dioxygenase (HPPD) activity |
| WO2012071039A1 (en) | 2010-11-24 | 2012-05-31 | Pioner Hi-Bred International, Inc. | Brassica gat event dp-061061-7 and compositions and methods for the identification and/or detection thereof |
| EA031629B1 (ru) | 2010-11-24 | 2019-01-31 | Пайонир Хай-Бред Интернэшнл, Инк. | Событие gat dp-073496-4 brassica и композиции и способы для его идентификации и/или детектирования |
| TWI667347B (zh) | 2010-12-15 | 2019-08-01 | 瑞士商先正達合夥公司 | 大豆品種ｓｙｈｔ０ｈ２及偵測其之組合物及方法 |
| GB201109239D0 (en) * | 2011-06-01 | 2011-07-13 | Syngenta Participations Ag | Herbicidal compositions |
| GB201121314D0 (en) * | 2011-12-09 | 2012-01-25 | Syngenta Ltd | Herbicidal compositions |
| GB201202393D0 (en) * | 2012-02-09 | 2012-03-28 | Syngenta Ltd | Polymorphs |
| BR112014031260A2 (pt) | 2012-06-15 | 2019-08-20 | Du Pont | métodos e composições que envolvem variantes de als com preferência de substrato nativo |
| WO2014100525A2 (en) | 2012-12-21 | 2014-06-26 | Pioneer Hi-Bred International, Inc. | Compositions and methods for auxin-analog conjugation |
| HUE045111T2 (hu) * | 2013-03-05 | 2019-12-30 | Bayer Cropscience Ag | N-(2-metoxibenzil)-4-[(metilaminokarbonil)amino]benzolszulfonamid inszekticidekkel vagy fungicidekkel képzett kombinációjának alkalmazása növénytermesztés hatásfokának növelésére |
| WO2014159306A1 (en) | 2013-03-13 | 2014-10-02 | Pioneer Hi-Bred International, Inc. | Glyphosate application for weed control in brassica |
| BR112015023286A2 (pt) | 2013-03-14 | 2018-03-06 | Arzeda Corp | polipeptídeo recombinante com atividade da dicamba descarboxilase, construto de polinucleotídeo, célula, método de produção de uma célula hospedeira compreendendo um polinucleotídeo heterólogo que codifica um polipeptídeo tendo atividade da dicamba descarboxilase, método para descarboxilar dicamba, um derivado de dicamba ou um metabolito de dicamba, método para a detecção de um polipeptideo e método para a detecção da presença de um polinucleotideo que codifica um polipeptideo tendo atividade da dicamba descarboxilase |
| EP2970995A1 (en) | 2013-03-14 | 2016-01-20 | Pioneer Hi-Bred International, Inc. | Compositions having dicamba decarboxylase activity and methods of use |
| AU2014230997B2 (en) * | 2013-03-15 | 2017-08-24 | Syngenta Participations Ag | Herbicidal composition and method of use thereof |
| CN105874062B (zh) | 2013-10-18 | 2021-07-20 | 先锋国际良种公司 | 草甘膦-n-乙酰转移酶(glyat)序列以及使用方法 |
| NZ720004A (en) | 2013-11-18 | 2020-03-27 | Forma Therapeutics Inc | Tetrahydroquinoline compositions as bet bromodomain inhibitors |
| CN106029076B (zh) | 2013-11-18 | 2019-06-07 | 福马疗法公司 | 作为bet溴域抑制剂的苯并哌嗪组合物 |
| WO2018156554A1 (en) * | 2017-02-21 | 2018-08-30 | Dow Agrosciences Llc | 1-HYDROXY-1,3-DIHYDROBENZO[c][1,2]OXABOROLES AND THEIR USE AS HERBICIDES |
| CN111559965B (zh) * | 2019-02-14 | 2022-11-18 | 东莞市东阳光农药研发有限公司 | 取代的苯甲酰类化合物及其在农业中的应用 |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55157504A (en) * | 1979-05-24 | 1980-12-08 | Sankyo Co Ltd | Herbicide |
| US4938796A (en) * | 1987-07-06 | 1990-07-03 | Ici Americas Inc. | Herbicidal compositions of acylated 1,3-dicarbonyl herbicides and antidotes therefor |
| ATE84302T1 (de) * | 1988-10-20 | 1993-01-15 | Ciba Geigy Ag | Sulfamoylphenylharnstoffe. |
| GB9101660D0 (en) * | 1991-01-25 | 1991-03-06 | Rhone Poulenc Agriculture | New compositions of matter |
| DE59209757D1 (de) * | 1991-12-31 | 1999-11-18 | Hoechst Ag | Kombinationen aus Herbiziden und pflanzenschützenden Stoffen |
| GB9315796D0 (en) * | 1993-07-30 | 1993-09-15 | Rhone Poulenc Agriculture | New compositions of matter |
| DE4331448A1 (de) * | 1993-09-16 | 1995-03-23 | Hoechst Schering Agrevo Gmbh | Substituierte Isoxazoline, Verfahren zu deren Herstellung, diese enthaltende Mittel und deren Verwendung als Safener |
| DE4440354A1 (de) * | 1994-11-11 | 1996-05-15 | Hoechst Schering Agrevo Gmbh | Kombinationen aus Phenylsulfonylharnstoff-Herbiziden und Safenern |
| US5627131A (en) * | 1995-01-09 | 1997-05-06 | Zeneca Limited | Herbicidal compositions of 4-benzoylisoxazole and antidotes therefor |
| AU4634096A (en) * | 1995-02-15 | 1996-09-04 | Idemitsu Kosan Co. Ltd | Isoxazole derivatives |
| SK285225B6 (sk) * | 1995-02-24 | 2006-09-07 | Basf Aktiengesellschaft | Derivát pyrazolylbenzoylu, spôsob jeho prípravy aherbicídny prostriedok, ktorý ho obsahuje |
| JPH11509192A (ja) * | 1995-06-29 | 1999-08-17 | イー・アイ・デユポン・ドウ・ヌムール・アンド・カンパニー | 除草性ケタール類およびスピロ環類 |
| AU7227296A (en) * | 1995-10-09 | 1997-04-30 | Idemitsu Kosan Co. Ltd | 2-cyano-1,3-dione derivatives and herbicides containing the same as active ingredient |
| GB9606015D0 (en) * | 1996-03-22 | 1996-05-22 | Rhone Poulenc Agriculture | New herbicides |
| DE19621522A1 (de) * | 1996-05-29 | 1997-12-04 | Hoechst Schering Agrevo Gmbh | Neue N-Acylsulfonamide, neue Mischungen aus Herbiziden und Antidots und deren Verwendung |
| DE19742951A1 (de) * | 1997-09-29 | 1999-04-15 | Hoechst Schering Agrevo Gmbh | Acylsulfamoylbenzoesäureamide, diese enthaltende nutzpflanzenschützende Mittel und Verfahren zu ihrer Herstellung |
| WO2000017194A1 (en) * | 1998-05-22 | 2000-03-30 | Dow Agrosciences Llc | 1-alkyl-4-[(3-oxetanyl-)benzoyl]-5-hydroxypyrazole compounds and their use as herbicides |
-
1998
- 1998-06-23 DE DE19827855A patent/DE19827855A1/de not_active Withdrawn
-
1999
- 1999-06-09 ES ES99927934T patent/ES2229720T3/es not_active Expired - Lifetime
- 1999-06-09 BR BRPI9911443-7A patent/BR9911443B1/pt not_active IP Right Cessation
- 1999-06-09 CN CNB99807747XA patent/CN1167340C/zh not_active Expired - Lifetime
- 1999-06-09 HU HU0103422A patent/HU230076B1/hu unknown
- 1999-06-09 EP EP04002856A patent/EP1415537B1/de not_active Expired - Lifetime
- 1999-06-09 HU HU1500132A patent/HU230493B1/hu unknown
- 1999-06-09 JP JP2000555495A patent/JP4653307B2/ja not_active Expired - Lifetime
- 1999-06-09 DE DE59910460T patent/DE59910460D1/de not_active Expired - Fee Related
- 1999-06-09 ES ES04002856T patent/ES2334441T3/es not_active Expired - Lifetime
- 1999-06-09 AU AU45104/99A patent/AU4510499A/en not_active Abandoned
- 1999-06-09 DE DE59915101T patent/DE59915101D1/de not_active Expired - Lifetime
- 1999-06-09 MX MXPA01000081 patent/MX231281B/es active IP Right Grant
- 1999-06-09 RU RU2001101986/04A patent/RU2221427C2/ru active
- 1999-06-09 KR KR1020007014753A patent/KR20010053176A/ko not_active Ceased
- 1999-06-09 BR BRPI9917879-6A patent/BR9917879B1/pt not_active IP Right Cessation
- 1999-06-09 MX MXPA03008633 patent/MX240911B/es unknown
- 1999-06-09 CA CA002335945A patent/CA2335945C/en not_active Expired - Lifetime
- 1999-06-09 EP EP99927934A patent/EP1089627B1/de not_active Expired - Lifetime
- 1999-06-09 WO PCT/EP1999/003980 patent/WO1999066795A1/de not_active Ceased
- 1999-06-18 AR ARP990102944A patent/AR019870A1/es active IP Right Grant
- 1999-06-21 TW TW88110359A patent/TW574024B/zh active
- 1999-06-21 US US09/337,135 patent/US6511940B1/en not_active Expired - Lifetime
- 1999-06-22 PH PH11999001531A patent/PH11999001531B1/en unknown
-
2000
- 2000-12-08 ZA ZA200007302A patent/ZA200007302B/en unknown
-
2002
- 2002-10-07 US US10/265,925 patent/US7135434B2/en not_active Expired - Lifetime
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2002518416A5 (enExample) | ||
| RU2001101986A (ru) | Комбинации гербицидов и протекторов | |
| RU2001117066A (ru) | Комбинации гербицидов и антидотов | |
| RU2003133978A (ru) | Гербицидные средства, содержащие бензоилциклогександионы и защитные средства | |
| JP5608676B2 (ja) | イソオキサゾリン誘導体及びその殺虫剤としての使用 | |
| AU2012224521B2 (en) | Isoxazole derivatives | |
| EP1150944B1 (en) | N2-phenylamidine derivatives | |
| ZA200007302B (en) | Combination of herbicides and safeners. | |
| RU97110120A (ru) | Комбинации фенилсульфонилмочевинных гербицидов с антидотами | |
| US20110245274A1 (en) | Isoxazolines derivatives and their use as pesticide | |
| RU2013139313A (ru) | 6-амино-2-замещенные-5- винилсилилпиримидин-4-карбоновые кислоты и сложные эфиры и 4-амино-6-замещенные-3-винилсилилпиридин-пиколиновые кислоты и сложные эфиры как гербициды | |
| BRPI0516820A (pt) | substáncias ativas para o tratamento de semente | |
| IL114391A (en) | 2[1',2',4'-triazole-3'-yloxymethylene] benzene derivatives, compositions for controlling animal pests or harmful fungi comprising 2-[1',2',4'-triazole-3'-yloxymethylene] anilides and their preparation | |
| ZA200103701B (en) | Combinations of herbicides and safeners. | |
| ATE291578T1 (de) | Pyrazolylsubstituierte thienyloxy-pyridine | |
| RU2001105955A (ru) | Трифторметилпирролкарбоксамиды | |
| JP2005517635A5 (enExample) | ||
| RU2024226C1 (ru) | ПРОИЗВОДНЫЕ S- β -ТИОАКРИЛАМИДОВ И КОМПОЗИЦИЯ ДЛЯ ПРЕДОТВРАЩЕНИЯ ИЛИ ИНГИБИРОВАНИЯ РОСТА БАКТЕРИЙ | |
| JP2013512929A5 (enExample) | ||
| BR9406478A (pt) | Derivados de ácido 3-(het)aril-carboxílico processo para obtenção dos mesmos composições herbicidas e para regular o crescimetno vegetal e processos para o controle de vegetação indesejável e para regular o crescimento vegetal | |
| JP2005516037A5 (enExample) | ||
| WO2013079407A1 (en) | Aryl derivatives for controlling ectoparasites | |
| KR950032204A (ko) | 13-위치에 치환된 밀베마이신 유도체, 그의 제조방법 및 용도 | |
| KR940701216A (ko) | 제초제와 해독제의 신규 혼합물 | |
| KR970019852A (ko) | 상승 작용을 갖는 제초제 조성물 및 잡초 방제법 |