IL94282A - Imadazopyridines and imidazodiazines are converted into their preparations and pharmaceutical preparations containing them - Google Patents
Imadazopyridines and imidazodiazines are converted into their preparations and pharmaceutical preparations containing themInfo
- Publication number
- IL94282A IL94282A IL9428290A IL9428290A IL94282A IL 94282 A IL94282 A IL 94282A IL 9428290 A IL9428290 A IL 9428290A IL 9428290 A IL9428290 A IL 9428290A IL 94282 A IL94282 A IL 94282A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- methyl
- butyl
- compound
- alkyl
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 8
- 150000005232 imidazopyridines Chemical class 0.000 title description 5
- 238000002360 preparation method Methods 0.000 title description 5
- MJQSRSOTRPMVKB-UHFFFAOYSA-N 5h-imidazo[4,5-c]pyridazine Chemical class C1=NNC2=NC=NC2=C1 MJQSRSOTRPMVKB-UHFFFAOYSA-N 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 101
- 238000000034 method Methods 0.000 claims abstract description 53
- 150000003839 salts Chemical class 0.000 claims abstract description 33
- 238000011282 treatment Methods 0.000 claims abstract description 8
- 230000008569 process Effects 0.000 claims abstract description 7
- 238000004519 manufacturing process Methods 0.000 claims abstract description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 63
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 52
- 239000000203 mixture Substances 0.000 claims description 36
- -1 2-cyclopentylethyl Chemical group 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- 239000007858 starting material Substances 0.000 claims description 27
- 239000001257 hydrogen Substances 0.000 claims description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 238000006243 chemical reaction Methods 0.000 claims description 23
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 11
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 10
- 239000002585 base Substances 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 150000002460 imidazoles Chemical class 0.000 claims description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 8
- 239000003085 diluting agent Substances 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 229910000063 azene Inorganic materials 0.000 claims description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims description 5
- 150000007530 organic bases Chemical class 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 4
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 4
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 claims description 4
- 229940124530 sulfonamide Drugs 0.000 claims description 4
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 4
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 150000002440 hydroxy compounds Chemical class 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 3
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 239000004411 aluminium Substances 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002883 imidazolyl group Chemical group 0.000 claims description 2
- 125000002346 iodo group Chemical group I* 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims description 2
- DRTQHJPVMGBUCF-UCVXFZOQSA-N 1-[(2s,3s,4s,5s)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@H]1[C@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UCVXFZOQSA-N 0.000 claims 1
- 230000009471 action Effects 0.000 abstract description 8
- 102000005862 Angiotensin II Human genes 0.000 abstract description 5
- 101800000733 Angiotensin-2 Proteins 0.000 abstract description 5
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 abstract description 5
- 229950006323 angiotensin ii Drugs 0.000 abstract description 5
- 206010020772 Hypertension Diseases 0.000 abstract description 4
- 206010007559 Cardiac failure congestive Diseases 0.000 abstract description 3
- 206010019280 Heart failures Diseases 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 81
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 76
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 69
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 66
- 238000001819 mass spectrum Methods 0.000 description 56
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 50
- 239000007787 solid Substances 0.000 description 48
- 239000000243 solution Substances 0.000 description 45
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 42
- 229910021529 ammonia Inorganic materials 0.000 description 33
- 238000000451 chemical ionisation Methods 0.000 description 32
- 238000012360 testing method Methods 0.000 description 31
- 238000004452 microanalysis Methods 0.000 description 30
- 238000010265 fast atom bombardment Methods 0.000 description 25
- 238000003818 flash chromatography Methods 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 238000001704 evaporation Methods 0.000 description 15
- 230000008020 evaporation Effects 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 230000029936 alkylation Effects 0.000 description 14
- 238000005804 alkylation reaction Methods 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 241001465754 Metazoa Species 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 238000000354 decomposition reaction Methods 0.000 description 9
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 8
- 241000282414 Homo sapiens Species 0.000 description 8
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 7
- 201000010099 disease Diseases 0.000 description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 7
- 230000007062 hydrolysis Effects 0.000 description 7
- 238000006460 hydrolysis reaction Methods 0.000 description 7
- KQJDPSBJMJYPPD-UHFFFAOYSA-N methyl 2-[4-[(8-butylpurin-9-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NC2=CN=CN=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(=O)OC KQJDPSBJMJYPPD-UHFFFAOYSA-N 0.000 description 7
- 230000000144 pharmacologic effect Effects 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- GKSMTEMNWWAJRD-UHFFFAOYSA-N 2h-pyrimidine-1,2-diamine Chemical compound NC1N=CC=CN1N GKSMTEMNWWAJRD-UHFFFAOYSA-N 0.000 description 6
- 102000015427 Angiotensins Human genes 0.000 description 6
- 108010064733 Angiotensins Proteins 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 150000004985 diamines Chemical class 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 230000001225 therapeutic effect Effects 0.000 description 6
- QLJONAAHRVGZCH-UHFFFAOYSA-N 8-butyl-7h-purine Chemical compound N1=CN=C2NC(CCCC)=NC2=C1 QLJONAAHRVGZCH-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 230000008485 antagonism Effects 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- LTSYIBPODUDLIX-UHFFFAOYSA-N methyl 2-[4-(aminomethyl)phenyl]benzoate Chemical compound COC(=O)C1=CC=CC=C1C1=CC=C(CN)C=C1 LTSYIBPODUDLIX-UHFFFAOYSA-N 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 238000010561 standard procedure Methods 0.000 description 5
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000002416 angiotensin derivative Substances 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 238000006073 displacement reaction Methods 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000012528 membrane Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- SBXWFLISHPUINY-UHFFFAOYSA-N triphenyltin Chemical compound C1=CC=CC=C1[Sn](C=1C=CC=CC=1)C1=CC=CC=C1 SBXWFLISHPUINY-UHFFFAOYSA-N 0.000 description 4
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 3
- HLVIJINGDIXEEV-UHFFFAOYSA-N 2-butyl-1h-imidazo[4,5-b]pyridine Chemical compound C1=CC=C2NC(CCCC)=NC2=N1 HLVIJINGDIXEEV-UHFFFAOYSA-N 0.000 description 3
- CMRGQRKSRIRJDE-UHFFFAOYSA-N 2-butyl-3,6-dihydroimidazo[4,5-d]pyridazin-7-one Chemical compound C(CCC)C1=NC=2C(=CN=NC2O)N1 CMRGQRKSRIRJDE-UHFFFAOYSA-N 0.000 description 3
- SJMUXDCUOZYTQH-UHFFFAOYSA-N 2-butyl-5-chloro-1h-imidazo[4,5-b]pyridine Chemical compound ClC1=CC=C2NC(CCCC)=NC2=N1 SJMUXDCUOZYTQH-UHFFFAOYSA-N 0.000 description 3
- ICACMUWUFCEQHS-UHFFFAOYSA-N 2-butyl-5-methyl-1h-imidazo[4,5-b]pyridine Chemical compound CC1=CC=C2NC(CCCC)=NC2=N1 ICACMUWUFCEQHS-UHFFFAOYSA-N 0.000 description 3
- VEUSWUDBFNJTLA-UHFFFAOYSA-N 2-butyl-7-methyl-1h-imidazo[4,5-b]pyridine Chemical compound C1=CN=C2NC(CCCC)=NC2=C1C VEUSWUDBFNJTLA-UHFFFAOYSA-N 0.000 description 3
- UBFFXXAXMCLNHE-UHFFFAOYSA-N 5-bromo-2h-pyrimidine-1,2-diamine Chemical compound NC1N=CC(Br)=CN1N UBFFXXAXMCLNHE-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 3
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 3
- 239000005909 Kieselgur Substances 0.000 description 3
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 3
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 3
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Natural products C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 239000003125 aqueous solvent Substances 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 239000012024 dehydrating agents Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- XUZLXCQFXTZASF-UHFFFAOYSA-N nitro(phenyl)methanol Chemical compound [O-][N+](=O)C(O)C1=CC=CC=C1 XUZLXCQFXTZASF-UHFFFAOYSA-N 0.000 description 3
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- 230000000069 prophylactic effect Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- 108020003175 receptors Proteins 0.000 description 3
- 230000036454 renin-angiotensin system Effects 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- QNSFUYBKNBKCPG-UHFFFAOYSA-N 2-[4-[(2-butylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzoic acid Chemical compound CCCCC1=NC2=CC=CN=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(O)=O QNSFUYBKNBKCPG-UHFFFAOYSA-N 0.000 description 2
- NBSSCVFJHSMPEM-UHFFFAOYSA-N 2-butyl-5-chloro-1-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine Chemical compound C(CCC)C=1N(C=2C(=NC(=CC2)Cl)N1)CC1=CC=C(C=C1)C1=C(C=CC=C1)C=1N=NN(N1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 NBSSCVFJHSMPEM-UHFFFAOYSA-N 0.000 description 2
- ZHHBWENLQRTNJB-UHFFFAOYSA-N 2-butyl-5-chloro-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine Chemical compound C(CCC)C1=NC=2C(=NC(=CC2)Cl)N1CC1=CC=C(C=C1)C1=C(C=CC=C1)C=1N=NN(N1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 ZHHBWENLQRTNJB-UHFFFAOYSA-N 0.000 description 2
- QPYBWWCIAOXHAJ-UHFFFAOYSA-N 2-butyl-7-chloro-1H-imidazo[4,5-b]pyridine Chemical compound C(CCC)C=1NC=2C(=NC=CC2Cl)N1 QPYBWWCIAOXHAJ-UHFFFAOYSA-N 0.000 description 2
- UUOLETYDNTVQDY-UHFFFAOYSA-N 2-chloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CN=C1Cl UUOLETYDNTVQDY-UHFFFAOYSA-N 0.000 description 2
- ILYSAKHOYBPSPC-UHFFFAOYSA-N 2-phenylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1 ILYSAKHOYBPSPC-UHFFFAOYSA-N 0.000 description 2
- BUJCVBRLTBAYCW-UHFFFAOYSA-N 3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenoxy)propan-1-one Chemical compound COC1=CC=CC=C1OC(CO)C(=O)C1=CC=C(O)C(OC)=C1 BUJCVBRLTBAYCW-UHFFFAOYSA-N 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- KEQMVROEHBTUAM-UHFFFAOYSA-N 4-[(2-butylimidazo[4,5-b]pyridin-3-yl)methyl]benzoic acid Chemical compound CCCCC1=NC2=CC=CN=C2N1CC1=CC=C(C(O)=O)C=C1 KEQMVROEHBTUAM-UHFFFAOYSA-N 0.000 description 2
- BFCKLCGWESHGGR-UHFFFAOYSA-N 5-bromo-2-butyl-3H-imidazo[4,5-b]pyrazine Chemical compound C(CCC)C1=NC=2C(=NC=C(N2)Br)N1 BFCKLCGWESHGGR-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 206010002091 Anaesthesia Diseases 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- DJRHFCOBJUILMX-UHFFFAOYSA-N C(CCC)C=1NC=2C(=[N+](C=CC2)[O-])N1 Chemical compound C(CCC)C=1NC=2C(=[N+](C=CC2)[O-])N1 DJRHFCOBJUILMX-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 206010020571 Hyperaldosteronism Diseases 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 108090000783 Renin Proteins 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- VNEMVKOXLBIWTB-UHFFFAOYSA-N aminomethyl benzoate Chemical compound NCOC(=O)C1=CC=CC=C1 VNEMVKOXLBIWTB-UHFFFAOYSA-N 0.000 description 2
- 238000001949 anaesthesia Methods 0.000 description 2
- 230000037005 anaesthesia Effects 0.000 description 2
- 230000003042 antagnostic effect Effects 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-M benzoate Chemical compound [O-]C(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-M 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 2
- 230000008602 contraction Effects 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 150000005235 imidazopyrazines Chemical class 0.000 description 2
- 150000005233 imidazopyridazines Chemical class 0.000 description 2
- 150000005237 imidazopyrimidines Chemical class 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- RMXGTMRDXKUUDJ-UHFFFAOYSA-N methyl 2-[4-(bromomethyl)phenyl]benzoate Chemical compound COC(=O)C1=CC=CC=C1C1=CC=C(CBr)C=C1 RMXGTMRDXKUUDJ-UHFFFAOYSA-N 0.000 description 2
- NNTPEIVSBHLCLN-UHFFFAOYSA-N methyl 2-[4-[(2-butyl-5-methoxyimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NC2=CC=C(OC)N=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(=O)OC NNTPEIVSBHLCLN-UHFFFAOYSA-N 0.000 description 2
- RRCMFSHHACCDLQ-UHFFFAOYSA-N methyl 2-[4-[(2-butylimidazo[4,5-b]pyridin-1-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NC2=NC=CC=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(=O)OC RRCMFSHHACCDLQ-UHFFFAOYSA-N 0.000 description 2
- ZPLUQUKOUKRGDF-UHFFFAOYSA-N methyl 2-[4-[(2-butylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NC2=CC=CN=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(=O)OC ZPLUQUKOUKRGDF-UHFFFAOYSA-N 0.000 description 2
- MSOVZPWIFRABDE-UHFFFAOYSA-N methyl 2-[4-[(8-butylpurin-7-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NC2=NC=NC=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(=O)OC MSOVZPWIFRABDE-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- DUCKXCGALKOSJF-UHFFFAOYSA-N pentanoyl pentanoate Chemical compound CCCCC(=O)OC(=O)CCCC DUCKXCGALKOSJF-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 230000036584 pressor response Effects 0.000 description 2
- 201000009395 primary hyperaldosteronism Diseases 0.000 description 2
- 239000008213 purified water Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 230000002110 toxicologic effect Effects 0.000 description 2
- 231100000027 toxicology Toxicity 0.000 description 2
- LYRCQNDYYRPFMF-UHFFFAOYSA-N trimethyltin Chemical compound C[Sn](C)C LYRCQNDYYRPFMF-UHFFFAOYSA-N 0.000 description 2
- 229940005605 valeric acid Drugs 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 1
- ZBTMRBYMKUEVEU-UHFFFAOYSA-N 1-bromo-4-methylbenzene Chemical compound CC1=CC=C(Br)C=C1 ZBTMRBYMKUEVEU-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- COXIHIQSBJRJTA-UHFFFAOYSA-N 2-[(5-bromo-2-butylimidazo[4,5-b]pyrazin-1-yl)methyl]-3-methyl-6-phenylbenzoic acid Chemical compound CCCCC1=NC2=NC(=CN=C2N1CC3=C(C=CC(=C3C(=O)O)C4=CC=CC=C4)C)Br COXIHIQSBJRJTA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- QQHZAARABFGGBY-UHFFFAOYSA-N 2-[4-(bromomethyl)phenyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=C(CBr)C=C1 QQHZAARABFGGBY-UHFFFAOYSA-N 0.000 description 1
- DZQJAXCNGLNEKC-UHFFFAOYSA-N 2-[4-[(2-butyl-5-oxo-4h-imidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzoic acid Chemical compound CCCCC1=NC=2C=CC(=O)NC=2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(O)=O DZQJAXCNGLNEKC-UHFFFAOYSA-N 0.000 description 1
- JQXGFOTVYZMFCE-UHFFFAOYSA-N 2-[4-[(2-butyl-7-sulfanylidene-6H-imidazo[4,5-d]pyridazin-1-yl)methyl]phenyl]benzoic acid Chemical compound CCCCC1=NC=2C=NNC(=S)C=2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(O)=O JQXGFOTVYZMFCE-UHFFFAOYSA-N 0.000 description 1
- IBJHRAHLAFXJBL-UHFFFAOYSA-N 2-[4-[(2-butylimidazo[4,5-b]pyrazin-3-yl)methyl]phenyl]benzoic acid Chemical compound CCCCC1=NC2=NC=CN=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(O)=O IBJHRAHLAFXJBL-UHFFFAOYSA-N 0.000 description 1
- LOYSUIRVAISUEJ-UHFFFAOYSA-N 2-[4-[(2-butylimidazo[4,5-c]pyridin-3-yl)methyl]phenyl]benzoic acid Chemical compound CCCCC1=NC2=CC=NC=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(O)=O LOYSUIRVAISUEJ-UHFFFAOYSA-N 0.000 description 1
- ZTXSRCJISPLXMO-UHFFFAOYSA-N 2-[4-[(8-butylpurin-9-yl)methyl]phenyl]benzoic acid Chemical compound CCCCC1=NC2=CN=CN=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(O)=O ZTXSRCJISPLXMO-UHFFFAOYSA-N 0.000 description 1
- MUHDOBPLTDHASL-UHFFFAOYSA-N 2-bromo-4-[(2-butylimidazo[4,5-b]pyridin-3-yl)methyl]benzoic acid Chemical compound CCCCC1=NC2=CC=CN=C2N1CC1=CC=C(C(O)=O)C(Br)=C1 MUHDOBPLTDHASL-UHFFFAOYSA-N 0.000 description 1
- KLZJARFHPRAPLX-UHFFFAOYSA-N 2-butyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine Chemical compound CCCCC1=NC2=C(N=CC=C2)N1CC1=CC=C(C=C1)C1=C(C=CC=C1)C1=NN(N=N1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 KLZJARFHPRAPLX-UHFFFAOYSA-N 0.000 description 1
- MHGOLTOQVHYGQL-UHFFFAOYSA-N 2-butyl-3-[[4-[2-(2h-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine;hydrochloride Chemical compound Cl.CCCCC1=NC2=CC=CN=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C=1N=NNN=1 MHGOLTOQVHYGQL-UHFFFAOYSA-N 0.000 description 1
- YFCNYKRLBYZKMG-UHFFFAOYSA-N 2-butyl-4-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine Chemical compound C(CCC)C1=NC=2C(N(C=CC=2)CC2=CC=C(C=C2)C2=C(C=CC=C2)C=2N=NN(N=2)C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)=N1 YFCNYKRLBYZKMG-UHFFFAOYSA-N 0.000 description 1
- LOORDZGKWMTZCD-UHFFFAOYSA-N 2-butyl-5,7-dimethyl-1h-imidazo[4,5-b]pyridine Chemical compound CC1=CC(C)=C2NC(CCCC)=NC2=N1 LOORDZGKWMTZCD-UHFFFAOYSA-N 0.000 description 1
- ZRDBGWAFZAWPFF-UHFFFAOYSA-N 2-butyl-5-methyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine Chemical compound C(CCC)C1=NC=2C(=NC(=CC=2)C)N1CC1=CC=C(C=C1)C1=C(C=CC=C1)C=1N=NN(N=1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 ZRDBGWAFZAWPFF-UHFFFAOYSA-N 0.000 description 1
- PBQQFZPKHTZKCW-UHFFFAOYSA-N 2-butyl-7-methyl-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine Chemical compound C(CCC)C1=NC=2C(=NC=CC=2C)N1CC1=CC=C(C=C1)C1=C(C=CC=C1)C=1N=NN(N=1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 PBQQFZPKHTZKCW-UHFFFAOYSA-N 0.000 description 1
- JHARVUVBTAAPLA-UHFFFAOYSA-N 2-chloro-4-methyl-3-nitropyridine Chemical compound CC1=CC=NC(Cl)=C1[N+]([O-])=O JHARVUVBTAAPLA-UHFFFAOYSA-N 0.000 description 1
- DVRGUTNVDGIKTP-UHFFFAOYSA-N 2-chloro-6-methoxy-3-nitropyridine Chemical compound COC1=CC=C([N+]([O-])=O)C(Cl)=N1 DVRGUTNVDGIKTP-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- QHWIGULJOZAPAQ-UHFFFAOYSA-N 3-fluoro-4-nitro-1-oxidopyridin-1-ium Chemical compound [O-][N+](=O)C1=CC=[N+]([O-])C=C1F QHWIGULJOZAPAQ-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- WERABQRUGJIMKQ-UHFFFAOYSA-N 6-chloro-3-nitropyridin-2-amine Chemical compound NC1=NC(Cl)=CC=C1[N+]([O-])=O WERABQRUGJIMKQ-UHFFFAOYSA-N 0.000 description 1
- SSEPRQDVCQZRPT-UHFFFAOYSA-N 8-butyl-9-[[4-[2-(2h-tetrazol-5-yl)phenyl]phenyl]methyl]purine Chemical compound CCCCC1=NC2=CN=CN=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C=1N=NNN=1 SSEPRQDVCQZRPT-UHFFFAOYSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-ZVIOFETBSA-N Aldosterone Chemical compound C([C@@]1([C@@H](C(=O)CO)CC[C@H]1[C@@H]1CC2)C=O)[C@H](O)[C@@H]1[C@]1(C)C2=CC(=O)CC1 PQSUYGKTWSAVDQ-ZVIOFETBSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-UHFFFAOYSA-N Aldosterone Natural products C1CC2C3CCC(C(=O)CO)C3(C=O)CC(O)C2C2(C)C1=CC(=O)CC2 PQSUYGKTWSAVDQ-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 101800000734 Angiotensin-1 Proteins 0.000 description 1
- 102400000344 Angiotensin-1 Human genes 0.000 description 1
- 102000004881 Angiotensinogen Human genes 0.000 description 1
- 108090001067 Angiotensinogen Proteins 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 102000004506 Blood Proteins Human genes 0.000 description 1
- 108010017384 Blood Proteins Proteins 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 241001480079 Corymbia calophylla Species 0.000 description 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 125000002061 L-isoleucyl group Chemical group [H]N([H])[C@]([H])(C(=O)[*])[C@](C([H])([H])[H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000006552 Liquidambar styraciflua Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 102100028255 Renin Human genes 0.000 description 1
- 206010041277 Sodium retention Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- GXBMIBRIOWHPDT-UHFFFAOYSA-N Vasopressin Natural products N1C(=O)C(CC=2C=C(O)C=CC=2)NC(=O)C(N)CSSCC(C(=O)N2C(CCC2)C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CC1=CC=CC=C1 GXBMIBRIOWHPDT-UHFFFAOYSA-N 0.000 description 1
- 102000002852 Vasopressins Human genes 0.000 description 1
- 108010004977 Vasopressins Proteins 0.000 description 1
- MNOHZPUSHIJNSL-UHFFFAOYSA-N ac1q2icf Chemical compound CC1=CC(C)=NC(N2CCN(CC2)C=2N3C4=CC=CC=C4N=C3C(C#N)=C3CCCC3=2)=N1 MNOHZPUSHIJNSL-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 210000004100 adrenal gland Anatomy 0.000 description 1
- 229960002478 aldosterone Drugs 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 210000000709 aorta Anatomy 0.000 description 1
- KBZOIRJILGZLEJ-LGYYRGKSSA-N argipressin Chemical compound C([C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CSSC[C@@H](C(N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N1)=O)N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(N)=O)C1=CC=CC=C1 KBZOIRJILGZLEJ-LGYYRGKSSA-N 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229960002179 ephedrine Drugs 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 230000013632 homeostatic process Effects 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 241001515942 marmosets Species 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 102000006240 membrane receptors Human genes 0.000 description 1
- 108020004084 membrane receptors Proteins 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- IHNIAWHITVGYJJ-UHFFFAOYSA-N methyl 2-(4-methylphenyl)benzoate Chemical compound COC(=O)C1=CC=CC=C1C1=CC=C(C)C=C1 IHNIAWHITVGYJJ-UHFFFAOYSA-N 0.000 description 1
- HZMYQCTVZKNTSP-UHFFFAOYSA-N methyl 2-[4-[(2-butyl-7-methylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NC2=C(C)C=CN=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(=O)OC HZMYQCTVZKNTSP-UHFFFAOYSA-N 0.000 description 1
- XRRSKTAYGHNOLE-UHFFFAOYSA-N methyl 2-[4-[(2-butyl-7-oxo-6h-imidazo[4,5-d]pyridazin-1-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NC=2C=NNC(=O)C=2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(=O)OC XRRSKTAYGHNOLE-UHFFFAOYSA-N 0.000 description 1
- XNWNJPIEUNAKDR-UHFFFAOYSA-N methyl 2-[4-[(2-butylimidazo[4,5-b]pyridin-4-yl)methyl]phenyl]benzoate Chemical compound C12=NC(CCCC)=NC2=CC=CN1CC(C=C1)=CC=C1C1=CC=CC=C1C(=O)OC XNWNJPIEUNAKDR-UHFFFAOYSA-N 0.000 description 1
- KRYGAEDCNCQDQA-UHFFFAOYSA-N methyl 2-[4-[(5-bromo-2-butylimidazo[4,5-b]pyrazin-1-yl)methyl]phenyl]benzoate Chemical compound CCCCC1=NC2=NC(Br)=CN=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C(=O)OC KRYGAEDCNCQDQA-UHFFFAOYSA-N 0.000 description 1
- ZTDXOVAPGGNGSD-UHFFFAOYSA-N methyl 2-bromo-4-(bromomethyl)benzoate Chemical compound COC(=O)C1=CC=C(CBr)C=C1Br ZTDXOVAPGGNGSD-UHFFFAOYSA-N 0.000 description 1
- DJTUYAFJAGLQCK-UHFFFAOYSA-N methyl 2-bromo-4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C=C1Br DJTUYAFJAGLQCK-UHFFFAOYSA-N 0.000 description 1
- AQBJGAUQEJFPKZ-UHFFFAOYSA-N methyl 4-(aminomethyl)benzoate Chemical compound COC(=O)C1=CC=C(CN)C=C1 AQBJGAUQEJFPKZ-UHFFFAOYSA-N 0.000 description 1
- CRFDRTNOJRPBEL-UHFFFAOYSA-N methyl 4-[(2-butylimidazo[4,5-b]pyridin-3-yl)methyl]benzoate Chemical compound CCCCC1=NC2=CC=CN=C2N1CC1=CC=C(C(=O)OC)C=C1 CRFDRTNOJRPBEL-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical compound N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229960002748 norepinephrine Drugs 0.000 description 1
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000011165 process development Methods 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003212 purines Chemical group 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000029865 regulation of blood pressure Effects 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 230000000894 saliuretic effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000003506 spasmogen Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 230000009723 vascular congestion Effects 0.000 description 1
- 210000005166 vasculature Anatomy 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- 229960003726 vasopressin Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Diabetes (AREA)
- Emergency Medicine (AREA)
- Endocrinology (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL10662890A IL106628A (en) | 1990-03-15 | 1990-05-03 | Imidaziopyridines and imadazodiazinesPoly are converted into their preparations and pharmaceutical preparations containing them |
| IL106628A IL106628A0 (en) | 1990-03-15 | 1993-08-09 | Azaindenes |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB898911855A GB8911855D0 (en) | 1989-05-23 | 1989-05-23 | Azaindenes |
| GB909005843A GB9005843D0 (en) | 1990-03-15 | 1990-03-15 | Nitrogen heterocycles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL94282A0 IL94282A0 (en) | 1991-03-10 |
| IL94282A true IL94282A (en) | 1995-12-31 |
Family
ID=26295388
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL9428290A IL94282A (en) | 1989-05-23 | 1990-05-03 | Imadazopyridines and imidazodiazines are converted into their preparations and pharmaceutical preparations containing them |
Country Status (14)
| Country | Link |
|---|---|
| EP (1) | EP0399731B2 (de) |
| JP (1) | JPH0749429B2 (de) |
| AT (1) | ATE98245T1 (de) |
| AU (1) | AU621483B2 (de) |
| CA (1) | CA2017066C (de) |
| DE (1) | DE69005026T3 (de) |
| DK (1) | DK0399731T4 (de) |
| ES (1) | ES2060951T5 (de) |
| FI (1) | FI93449C (de) |
| IE (1) | IE64514B1 (de) |
| IL (1) | IL94282A (de) |
| NO (1) | NO174202C (de) |
| NZ (1) | NZ233581A (de) |
| PT (1) | PT94114B (de) |
Families Citing this family (95)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5164407A (en) * | 1989-07-03 | 1992-11-17 | Merck & Co., Inc. | Substituted imidazo-fused 5-membered ring heterocycles and their use as angiotensin ii antagonsists |
| EP0415886A3 (en) * | 1989-08-30 | 1991-10-23 | Ciba-Geigy Ag | Aza compounds |
| IE70593B1 (en) * | 1989-09-29 | 1996-12-11 | Eisai Co Ltd | Biphenylmethane derivative the use of it and pharmacological compositions containing same |
| US5250554A (en) * | 1989-10-24 | 1993-10-05 | Takeda Chemical Industries, Ltd. | Benzimidazole derivatives useful as angiotensin II inhibitors |
| US5449682A (en) * | 1990-02-13 | 1995-09-12 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted benzyl element |
| DE122010000024I1 (de) * | 1990-02-19 | 2010-07-08 | Novartis Ag | Acylverbindungen |
| CA2041763A1 (en) * | 1990-05-11 | 1991-11-12 | Sheih-Shung T. Chen | Microbial transformation process for antihypertensive products |
| US5194379A (en) * | 1990-05-11 | 1993-03-16 | Merck & Co., Inc. | Microbial transformation process for the preparation of hydroxylanol imidazo (4,5-b) pyridines useful as angiotensin II receptor antagonists |
| WO1991019715A1 (en) * | 1990-06-15 | 1991-12-26 | G.D. Searle & Co. | 1H-SUBSTITUTED-IMIDAZO[4,5-d]PYRIDAZINE COMPOUNDS FOR TREATMENT OF CARDIOVASCULAR DISORDERS |
| AU653734B2 (en) * | 1990-06-19 | 1994-10-13 | Meiji Seika Kabushiki Kaisha | Substituted 4-biphenylmethoxypyridine derivatives |
| CA2047029A1 (en) * | 1990-07-19 | 1992-01-20 | Shieh-Shung T. Chen | Microbial transformation process for antihypertensive products |
| DE4023215A1 (de) * | 1990-07-21 | 1992-01-23 | Hoechst Ag | Substituierte azole, verfahren zu deren herstellung, sie enthaltende mittel und deren verwendung |
| EP0470543A1 (de) * | 1990-08-10 | 1992-02-12 | Dr. Karl Thomae GmbH | Heterocyclische Imidazole, diese Verbindungen enthaltende Arzneimittel und Verfahren zur ihrer Herstellung |
| WO1992004343A1 (fr) * | 1990-09-04 | 1992-03-19 | Yamanouchi Pharmaceutical Co., Ltd. | Nouveau derive de tetrahydrobenzazole |
| US5091390A (en) * | 1990-09-20 | 1992-02-25 | E. I. Du Pont De Nemours And Company | Treatment of CNS disorders with 4,5,6,7-tetrahydro-1H-imidazo (4,5-)-pyridines and analogs |
| US5210092A (en) * | 1990-09-25 | 1993-05-11 | Fujisawa Pharmaceutical Co., Ltd. | Angiotensin ii antagonizing heterocyclic derivatives |
| US5260285A (en) * | 1990-12-07 | 1993-11-09 | Merck & Co., Inc. | Substituted imidazopyridazines as angiotensin II antagonists |
| US5250521A (en) * | 1990-12-07 | 1993-10-05 | Merck & Co., Inc. | Substituted pyrazolopyrimidines as angiotensin II antagonists |
| US5049565A (en) * | 1990-12-07 | 1991-09-17 | Merck & Co., Inc. | Microbial transformation process for preparing anti-hypertensive products |
| US5087702A (en) * | 1991-01-30 | 1992-02-11 | Merck & Co., Inc. | Microbial transformation process for producing an antihypertensive product |
| US5124335A (en) * | 1991-01-30 | 1992-06-23 | Merck & Co., Inc. | Substituted pyrollo-fused 6 membered heterocycles as angiotensin ii antagonists |
| SI9210098B (sl) * | 1991-02-06 | 2000-06-30 | Dr. Karl Thomae | Benzimidazoli, zdravila, ki te spojine vsebujejo, in postopek za njihovo pripravo |
| CA2229000C (en) | 1991-02-21 | 2002-04-09 | Sankyo Company, Limited | 1-biphenylimidazole derivatives, their preparation and their therapeutic use |
| US5616599A (en) * | 1991-02-21 | 1997-04-01 | Sankyo Company, Limited | Angiotensin II antagosist 1-biphenylmethylimidazole compounds and their therapeutic use |
| US5202328A (en) * | 1991-03-06 | 1993-04-13 | Merck & Co., Inc. | Substituted fused pyrimidinones |
| EP0503838A3 (en) * | 1991-03-08 | 1992-10-07 | Merck & Co. Inc. | Heterocyclic compounds bearing acidic functional groups as angiotensin ii antagonists |
| US5236928A (en) * | 1991-03-19 | 1993-08-17 | Merck & Co., Inc. | Imidazole derivatives bearing acidic functional groups at the 5-position, their compositions and methods of use as angiotensin II antagonists |
| US5187179A (en) * | 1991-03-22 | 1993-02-16 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted imidazo [1,2-b][1,2,4]triazole |
| US5128327A (en) * | 1991-03-25 | 1992-07-07 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a nitrogen containing six membered ring heterocycle |
| US5177074A (en) | 1991-03-26 | 1993-01-05 | Merck & Co., Inc. | Angiotensin ii antagonists incorporating a substituted thiophene or furan |
| US5798364A (en) * | 1992-03-26 | 1998-08-25 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Imidazopyridines |
| DE4110019C2 (de) * | 1991-03-27 | 2000-04-13 | Merck Patent Gmbh | Imidazopyridine, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zubereitungen |
| US5164403A (en) * | 1991-04-05 | 1992-11-17 | G. D. Searle & Co. | N-arylheteroarylalkyl imidazol-2-one compounds for treatment of circulatory disorders |
| TW274551B (de) * | 1991-04-16 | 1996-04-21 | Takeda Pharm Industry Co Ltd | |
| DE4200954A1 (de) * | 1991-04-26 | 1992-10-29 | Bayer Ag | Heterocyclisch substituierte phenylessigsaeurederivate |
| US5252574A (en) * | 1991-04-26 | 1993-10-12 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted thiophene or furan |
| GB9109246D0 (en) * | 1991-04-30 | 1991-06-19 | Ici Plc | Nitrogen derivatives |
| US5198438A (en) * | 1991-05-07 | 1993-03-30 | Merck & Co., Inc. | Angiotensin ii antagonists incorporating a substituted thiophene or furan |
| US5506361A (en) * | 1991-05-08 | 1996-04-09 | Theupjohn Company | Imidazobenzoquinones and composition for preventing or treating hypertension or congestive heart failure containing the same |
| AU1751192A (en) * | 1991-05-16 | 1992-12-30 | Glaxo Group Limited | Benzofuran derivatives |
| IL101860A0 (en) * | 1991-05-31 | 1992-12-30 | Ici Plc | Heterocyclic derivatives |
| US5175164A (en) * | 1991-06-05 | 1992-12-29 | Merck & Co., Inc. | Angiotensin ii antagonists incorporating a substituted indole or dihydroindole |
| GB9113628D0 (en) * | 1991-06-25 | 1991-08-14 | Ici Plc | Heterocyclic derivatives |
| GB9113626D0 (en) * | 1991-06-25 | 1991-08-14 | Ici Plc | Heterocyclic compounds |
| IL102183A (en) * | 1991-06-27 | 1999-11-30 | Takeda Chemical Industries Ltd | Biphenyl substituted heterocyclic compounds their production and pharmaceutical compositions comprising them |
| AU2338992A (en) * | 1991-07-26 | 1993-03-02 | G.D. Searle & Co. | Carbonate-substituted imidazo(4,5-d) pyridazine compounds for treatment of cardiovascular disorders |
| EP0531874A1 (de) * | 1991-09-10 | 1993-03-17 | Tanabe Seiyaku Co., Ltd. | Imidazopyridin-Derivate und Verfahren für ihre Herstellung |
| TW300219B (de) * | 1991-09-14 | 1997-03-11 | Hoechst Ag | |
| US5187159A (en) * | 1991-10-07 | 1993-02-16 | Merck & Co., Inc. | Angiotensin II antagonists incorporating a substituted 1,3-benzodioxole or 1,3-benzodithiole |
| US5442062A (en) * | 1991-10-24 | 1995-08-15 | The Upjohn Company | Imidazole derivatives and pharmaceutical compositions containing the same |
| JPH06107661A (ja) * | 1991-10-24 | 1994-04-19 | Upjohn Co:The | イミダゾール誘導体およびこれを有効成分とする医薬組成物 |
| GB9201715D0 (en) * | 1992-01-28 | 1992-03-11 | Ici Plc | Chemical process |
| DE4208052A1 (de) * | 1992-03-13 | 1993-09-16 | Bayer Ag | Imidazolyl substituierte phenylessigsaeureamide |
| DE4208051A1 (de) * | 1992-03-13 | 1993-09-16 | Bayer Ag | Substituierte phenylessigsaeureamide |
| DE4211474A1 (de) * | 1992-04-06 | 1993-10-07 | Merck Patent Gmbh | Imidazopyridine |
| DE4212796A1 (de) * | 1992-04-16 | 1993-10-21 | Bayer Ag | Propenoyl-imidazolderivate |
| DE4215588A1 (de) * | 1992-05-12 | 1993-11-18 | Bayer Ag | Biphenylmethyl-substituierte Pyridone |
| DE4215587A1 (de) * | 1992-05-12 | 1993-11-18 | Bayer Ag | Sulfonylbenzyl-substituierte Benzo- und Pyridopyridone |
| US5583229A (en) * | 1992-12-07 | 1996-12-10 | Eisai Co., Ltd. | Process for the preparation of imidazopyridine derivatives |
| DE4220983A1 (de) * | 1992-06-26 | 1994-01-05 | Bayer Ag | Imidazolyl-substituierte Phenylpropion- und -zimtsäurederivate |
| EP0577023A3 (en) * | 1992-07-01 | 1996-12-18 | Hoechst Ag | Angiotensin-ii receptor-antagonists for the treatment of arrhythmices |
| EP0577025A3 (de) * | 1992-07-01 | 1998-02-04 | Hoechst Aktiengesellschaft | Angiotensin-II-Rezeptorantagonisten zur Behandlung und Prophylaxe von koronaren Herzerkrankungen |
| JPH07509464A (ja) * | 1992-07-17 | 1995-10-19 | メルク エンド カンパニー インコーポレーテッド | 置換ビフェニルメチルイミダゾピリジン |
| DE4225835A1 (de) * | 1992-08-05 | 1994-02-10 | Merck Patent Gmbh | Verfahren zur Herstellung von Imidazopyridinen |
| GB9216783D0 (en) * | 1992-08-07 | 1992-09-23 | Ici Plc | Heterocyclic derivatives |
| DE4319041A1 (de) * | 1992-10-23 | 1994-04-28 | Bayer Ag | Trisubstituierte Biphenyle |
| JP3501484B2 (ja) * | 1992-12-17 | 2004-03-02 | 三共株式会社 | ビフェニル誘導体 |
| DE4304455A1 (de) * | 1993-02-15 | 1994-08-18 | Bayer Ag | Heterocyclisch substituierte Phenyl-cyclohexan-carbonsäurederivate |
| DE4308788A1 (de) * | 1993-03-18 | 1994-09-22 | Bayer Ag | Hetero-tricyclisch-substituierte Phenyl-cyclohexan-carbonsäurederivate |
| US5338740A (en) * | 1993-07-13 | 1994-08-16 | Pfizer Inc. | Angiotensin II receptor antagonists |
| DE4339868A1 (de) * | 1993-11-23 | 1995-05-24 | Merck Patent Gmbh | Imidazopyridazine |
| KR0151816B1 (ko) * | 1994-02-08 | 1998-10-15 | 강박광 | 신규의 치환된 피리딜 이미다졸 유도체 및 그의 제조방법 |
| US5753672A (en) * | 1994-04-19 | 1998-05-19 | Tanabe Seiyaku Co., Ltd. | Imidazopyridine derivatives and process for preparing the same |
| US5646156A (en) * | 1994-04-25 | 1997-07-08 | Merck & Co., Inc. | Inhibition of eosinophil activation through A3 adenosine receptor antagonism |
| KR0151819B1 (ko) * | 1994-06-11 | 1998-10-15 | 강박광 | 신규의 피리딜 n-옥사이드로 치환된 피디딜이미다졸 유도체 및 그의 제조방법 |
| JP2002507996A (ja) | 1997-07-03 | 2002-03-12 | デュポン ファーマシューティカルズ カンパニー | 神経学的障害を治療するためのイミダゾピリミジン類およびイミダゾピリジン類 |
| ES2214013T3 (es) | 1998-03-04 | 2004-09-01 | Takeda Chemical Industries Ltd | Preparacion de liberacion sostenida para un antagonista de aii, su produccion y su uso. |
| US6124463A (en) * | 1998-07-02 | 2000-09-26 | Dupont Pharmaceuticals | Benzimidazoles as corticotropin release factor antagonists |
| US6365589B1 (en) | 1998-07-02 | 2002-04-02 | Bristol-Myers Squibb Pharma Company | Imidazo-pyridines, -pyridazines, and -triazines as corticotropin releasing factor antagonists |
| SE9903028D0 (sv) | 1999-08-27 | 1999-08-27 | Astra Ab | New use |
| EP1444988A4 (de) | 2001-11-13 | 2007-04-25 | Takeda Pharmaceutical | Krebsmittel |
| EP1474425B9 (de) | 2002-01-07 | 2008-07-02 | Eisai Co., Ltd. | Desazapurine und deren verwendung |
| MX2007012633A (es) | 2005-04-12 | 2008-01-11 | Vicore Pharma Ab | Nuevos agonistas biciclicos de angiotensina ii. |
| CA2604797C (en) | 2005-04-12 | 2013-05-28 | Vicore Pharma Ab | New tricyclic angiotensin ii agonists |
| KR101284573B1 (ko) | 2005-04-12 | 2013-07-11 | 바이코어 파마 아베 | 신규한 트리시클릭 안지오텐신 ⅱ 아고니스트 |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| MX2009013293A (es) | 2007-06-04 | 2010-02-15 | Synergy Pharmaceuticals Inc | Agonistas de guanilato ciclasa útiles para el tratamiento de trastornos gastrointestinales, inflamación, cáncer y otros trastornos. |
| US20090291942A1 (en) * | 2008-05-26 | 2009-11-26 | Ivan Cornella Taracido | Imidazo pyridine derivatives |
| EP2810951B1 (de) | 2008-06-04 | 2017-03-15 | Synergy Pharmaceuticals Inc. | Für die Behandlung von gastrointestinalen Erkrankungen, Entzündungen, Krebs und anderen Erkrankungen geeignete Agonisten von Guanylatcyclase |
| CA2730603C (en) | 2008-07-16 | 2019-09-24 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| JP2016514670A (ja) | 2013-03-15 | 2016-05-23 | シナジー ファーマシューティカルズ インコーポレイテッド | 他の薬物と組み合わせたグアニル酸シクラーゼ受容体アゴニスト |
| JP2016514671A (ja) | 2013-03-15 | 2016-05-23 | シナジー ファーマシューティカルズ インコーポレイテッド | グアニル酸シクラーゼのアゴニストおよびその使用 |
| EA201592263A1 (ru) | 2013-06-05 | 2016-05-31 | Синерджи Фармасьютикалз, Инк. | Ультрачистые агонисты гуанилатциклазы c, способ их получения и использования |
| WO2018005591A1 (en) | 2016-06-29 | 2018-01-04 | Universite De Montreal | Biarylmethyl heterocycles |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4612323A (en) * | 1983-06-27 | 1986-09-16 | Sumitomo Chemical Company, Limited | Insecticidal and acaricidal derivatives of 1-benzylbenzimidazole |
| JPS61151176A (ja) * | 1984-12-24 | 1986-07-09 | Sumitomo Chem Co Ltd | ベンズイミダゾール誘導体およびそれを有効成分とする殺虫、殺ダニ剤 |
| DE68920998T2 (de) * | 1988-03-15 | 1995-06-22 | Searle & Co | 1H/3H-[4-(N,N-CYCLOALKYL UND/ODER VERZWEIGTES ALKYLCARBOXAMIDO)-BENZYL]IMDAZO[4,5-c]PYRIDINE ALS PAF-ANTAGONISTEN. |
| AU3347889A (en) * | 1989-01-23 | 1990-08-13 | Board Of Regents, The University Of Texas System | Methods for identifying individuals genetically at risk for cancer |
| IL94390A (en) * | 1989-05-30 | 1996-03-31 | Merck & Co Inc | The 6-membered trans-nitrogen-containing heterocycles are compressed with imidazo and pharmaceutical preparations containing them |
| IE70593B1 (en) * | 1989-09-29 | 1996-12-11 | Eisai Co Ltd | Biphenylmethane derivative the use of it and pharmacological compositions containing same |
-
1990
- 1990-05-01 IE IE159490A patent/IE64514B1/en not_active IP Right Cessation
- 1990-05-03 IL IL9428290A patent/IL94282A/en not_active IP Right Cessation
- 1990-05-07 AU AU54779/90A patent/AU621483B2/en not_active Expired
- 1990-05-07 NZ NZ233581A patent/NZ233581A/en unknown
- 1990-05-17 CA CA002017066A patent/CA2017066C/en not_active Expired - Lifetime
- 1990-05-18 AT AT90305389T patent/ATE98245T1/de not_active IP Right Cessation
- 1990-05-18 ES ES90305389T patent/ES2060951T5/es not_active Expired - Lifetime
- 1990-05-18 DE DE69005026T patent/DE69005026T3/de not_active Expired - Lifetime
- 1990-05-18 DK DK90305389T patent/DK0399731T4/da active
- 1990-05-18 EP EP90305389A patent/EP0399731B2/de not_active Expired - Lifetime
- 1990-05-22 PT PT94114A patent/PT94114B/pt not_active IP Right Cessation
- 1990-05-22 FI FI902522A patent/FI93449C/fi active IP Right Grant
- 1990-05-22 NO NO902262A patent/NO174202C/no not_active IP Right Cessation
- 1990-05-23 JP JP2131476A patent/JPH0749429B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES2060951T3 (es) | 1994-12-01 |
| DE69005026T2 (de) | 1994-04-21 |
| IE64514B1 (en) | 1995-08-09 |
| DE69005026D1 (de) | 1994-01-20 |
| NO174202B (no) | 1993-12-20 |
| FI902522A0 (fi) | 1990-05-22 |
| IE901594L (en) | 1990-11-23 |
| DE69005026T3 (de) | 2002-02-14 |
| NO174202C (no) | 1994-04-06 |
| CA2017066C (en) | 2000-08-08 |
| NO902262L (no) | 1990-11-26 |
| PT94114A (pt) | 1991-01-08 |
| DK0399731T3 (da) | 1994-02-14 |
| DK0399731T4 (da) | 2001-09-17 |
| NO902262D0 (no) | 1990-05-22 |
| ATE98245T1 (de) | 1993-12-15 |
| JPH0749429B2 (ja) | 1995-05-31 |
| AU5477990A (en) | 1990-11-29 |
| EP0399731B1 (de) | 1993-12-08 |
| FI93449B (fi) | 1994-12-30 |
| AU621483B2 (en) | 1992-03-12 |
| JPH035480A (ja) | 1991-01-11 |
| IL94282A0 (en) | 1991-03-10 |
| EP0399731B2 (de) | 2001-07-11 |
| CA2017066A1 (en) | 1990-11-23 |
| PT94114B (pt) | 2001-04-30 |
| FI93449C (fi) | 1995-04-10 |
| EP0399731A1 (de) | 1990-11-28 |
| NZ233581A (en) | 1992-10-28 |
| ES2060951T5 (es) | 2001-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0399731B2 (de) | Azaindene | |
| US5126344A (en) | Diazine derivatives and pharmaceutical use | |
| EP0399732B1 (de) | Benzimidazole Derivate | |
| EP0516392B1 (de) | Naphthyridinderivate als Angiotensin-II-Antagonist-Inhibitoren | |
| US5387592A (en) | Substituted benzoxazole, benzthiazole, and benzimidazole derivatives as angiotensin II antagonists | |
| NZ237871A (en) | Pyridine derivatives, preparation, pharmaceutical compositions and intermediates thereof | |
| EP0499415A1 (de) | Pyridin- und Chinolinderivate, Verfahren zu deren Herstellung und deren Verwendung als Angiotensin-II-Antagonisten | |
| US5369114A (en) | Biphenylene branched alkyleneoxy quinolines | |
| US5281613A (en) | Heterocyclic compounds | |
| IE922785A1 (en) | Heterocyclic derivatives | |
| IE921093A1 (en) | Nitrogen derivatives | |
| US5373015A (en) | Fused pyridine derivatives useful as angiotensin II antagonists | |
| EP0499414A2 (de) | Pyridinderivate als Angiotensin II-Antagonisten, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zubereitungen | |
| EP0487252A1 (de) | Chinolin- und 1,5-Naphthyridinderivate, Verfahren und Zwischenprodukte zu ihrer Herstellung und diese enthaltende pharmazeutische Zubereitungen | |
| IL106628A (en) | Imidaziopyridines and imadazodiazinesPoly are converted into their preparations and pharmaceutical preparations containing them | |
| WO1994011379A1 (en) | Heterocyclic compounds as angiotensin ii antagonists | |
| WO1994003453A1 (en) | Pyrazolopyridine derivatives as angiotensin ii antagonists | |
| WO1994000450A1 (en) | Chromanderivatives as angiotensin ii antagonists |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FF | Patent granted | ||
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| EXP | Patent expired |