IL26696A - M-(carbamoyloxy)-carbanilates and herbicidal compositions containing them - Google Patents
M-(carbamoyloxy)-carbanilates and herbicidal compositions containing themInfo
- Publication number
- IL26696A IL26696A IL26696A IL2669666A IL26696A IL 26696 A IL26696 A IL 26696A IL 26696 A IL26696 A IL 26696A IL 2669666 A IL2669666 A IL 2669666A IL 26696 A IL26696 A IL 26696A
- Authority
- IL
- Israel
- Prior art keywords
- hydrogen
- lower alkyl
- alkyl
- cyclohexyl
- phenyl
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims 4
- 239000000203 mixture Substances 0.000 title claims 2
- 125000000217 alkyl group Chemical group 0.000 claims 13
- 229910052739 hydrogen Inorganic materials 0.000 claims 10
- 239000001257 hydrogen Substances 0.000 claims 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 3
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims 3
- 125000001188 haloalkyl group Chemical group 0.000 claims 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 2
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 2
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- YSMODUONRAFBET-UHFFFAOYSA-N 5-hydroxylysine Chemical group NCC(O)CCC(N)C(O)=O YSMODUONRAFBET-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 230000008635 plant growth Effects 0.000 claims 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
- A01N47/22—O-Aryl or S-Aryl esters thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US41955964A | 1964-12-18 | 1964-12-18 | |
| US507713A US3404975A (en) | 1964-12-18 | 1965-11-15 | m-(carbamoyloxy)-carbanilates as herbicides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL26696A true IL26696A (en) | 1972-01-27 |
Family
ID=27024523
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL26696A IL26696A (en) | 1964-12-18 | 1966-10-14 | M-(carbamoyloxy)-carbanilates and herbicidal compositions containing them |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3404975A (enExample) |
| BE (1) | BE689440A (enExample) |
| BR (1) | BR6684570D0 (enExample) |
| CA (1) | CA933178A (enExample) |
| CH (1) | CH484611A (enExample) |
| DE (1) | DE1568621C3 (enExample) |
| DK (1) | DK127091B (enExample) |
| FR (1) | FR1498834A (enExample) |
| GB (1) | GB1173753A (enExample) |
| IL (1) | IL26696A (enExample) |
| MY (1) | MY7000169A (enExample) |
| NL (1) | NL152255B (enExample) |
| NO (1) | NO119822B (enExample) |
| SE (1) | SE340543B (enExample) |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1567151C3 (de) * | 1965-04-09 | 1974-02-21 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende herbizide Mittel |
| US3546343A (en) * | 1966-01-18 | 1970-12-08 | Union Carbide Corp | 4-(methylcarbamoyloxy) carbanilates as insecticides and nematocides |
| DE1593520C3 (de) * | 1966-09-05 | 1974-07-11 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 3-(Carbamoyloxyphenyl)-harnstoffe bzw. -thioharnstoffe, diese enthaltende Mittel mit selektiver herbizider Wirkung sowie Verfahren zu deren Herstellung |
| US3535101A (en) * | 1966-09-07 | 1970-10-20 | Schering Ag | Herbicide and algicide means |
| DE1567164C2 (de) * | 1966-09-10 | 1985-03-07 | Schering AG, 1000 Berlin und 4709 Bergkamen | Herbizide Mittel auf Basis von N-Carbamoyloxyphenyl-Carbamaten |
| DE1618169A1 (de) * | 1967-05-31 | 1970-12-10 | Basf Ag | Substituierte Phenylcarbaminsaeureureidophenylester |
| US3539333A (en) * | 1968-08-21 | 1970-11-10 | Gulf Research Development Co | Combating weeds in sugar beets |
| US3898075A (en) * | 1970-01-20 | 1975-08-05 | Freund Heinz Eberhard | Stabilized liquid compositions |
| DE2020729C2 (de) * | 1970-04-23 | 1983-04-21 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Herbizide Mittel auf Basis von N-(3-(N'-Aryl-carbamoyloxy)-phenyl)-carbamaten |
| US3839010A (en) * | 1970-05-19 | 1974-10-01 | Exxon Research Engineering Co | Thiocarbamic acid ester pesticides |
| US3979202A (en) * | 1970-05-26 | 1976-09-07 | Monsanto Company | Meta-bifunctional benzenes and herbicidal compositions |
| US3671571A (en) * | 1970-07-17 | 1972-06-20 | Basf Ag | Biscarbamates |
| US4076518A (en) * | 1970-08-20 | 1978-02-28 | Schering Aktiengesellschaft | Substituted phenyl thiocarbamates with herbicidal action and method for their production |
| US4242122A (en) * | 1970-10-02 | 1980-12-30 | Monsanto Company | Herbicidal meta-bifunctional benzenes |
| US3847587A (en) * | 1970-11-02 | 1974-11-12 | Stauffer Chemical Co | Meta-thiocarbamyl phenylene amides and ureas as herbicides |
| US4077798A (en) * | 1970-11-24 | 1978-03-07 | Schering Aktiengesellschaft | Selective herbicides |
| US3947511A (en) * | 1970-11-25 | 1976-03-30 | E. I. Du Pont De Nemours And Company | 1-Hydrocarbyl-3-mono- and -dithiocarbamoylureas |
| US3869275A (en) * | 1970-12-04 | 1975-03-04 | Schering Ag | Herbicidal mixtures |
| US4153447A (en) * | 1971-04-27 | 1979-05-08 | Schering Aktiengesellschaft | Herbicidal methylphenyl carbamates |
| US3885953A (en) * | 1971-12-22 | 1975-05-27 | Scm Corp | Meta-ureidophenyl n-haloalkyl carbamates as herbicides |
| US3792994A (en) * | 1972-12-26 | 1974-02-19 | Stauffer Chemical Co | Anilide carbamates as algicidal agents |
| DE2310649C3 (de) * | 1973-03-01 | 1982-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Diurethane sowie diese enthaltende selektive herbizide Mittel |
| DE2310648C3 (de) * | 1973-03-01 | 1982-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel |
| US4065293A (en) * | 1973-03-01 | 1977-12-27 | Schering Aktiengesellschaft | Method for controlling the growth of weeds in a field containing growing plants of cotton |
| US3867429A (en) * | 1973-03-26 | 1975-02-18 | American Cyanamid Co | Alkynyloxy)alkyl and (alkenyloxy)alkyl carbamates |
| US3997325A (en) * | 1973-05-24 | 1976-12-14 | American Cyanamid Company | (Alkynyloxy)alkyl and (alkenyloxy)alkyl carbamates and their use as herbicides |
| DE2341079C2 (de) * | 1973-08-10 | 1982-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | m-Diurethane und selektive herbizide Mittel enthaltend diese Verbindungen als Wirkstoffe |
| DE2413933A1 (de) * | 1974-03-20 | 1975-09-25 | Schering Ag | Diurethane mit selektiver herbizider wirkung |
| JPS523829A (en) * | 1975-06-11 | 1977-01-12 | Nippon Kayaku Co Ltd | Germicides for agriculture and gardening |
| DE2557552C2 (de) * | 1975-12-18 | 1984-12-20 | Schering AG, 1000 Berlin und 4709 Bergkamen | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe |
| US4202684A (en) * | 1975-12-18 | 1980-05-13 | Schering Aktiengesellschaft | Carbanilic acid esters, process for making the same and herbicidal compositions containing same |
| DE2630418A1 (de) * | 1976-07-02 | 1978-01-05 | Schering Ag | Carbanilsaeureester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| DE2650796A1 (de) * | 1976-11-03 | 1978-05-11 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltendes selektives herbizides mittel |
| DE2651526A1 (de) * | 1976-11-09 | 1978-05-18 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltendes selektives herbizides mittel |
| DE2730325A1 (de) * | 1977-07-01 | 1979-01-11 | Schering Ag | Carbanilsaeure-(3-ureido-phenyl)- ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| DE2732848A1 (de) * | 1977-07-18 | 1979-02-08 | Schering Ag | Diurethane, herbizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| US4303793A (en) * | 1979-03-12 | 1981-12-01 | Ppg Industries, Inc. | Aqueous carbamate dispersions |
| IT1163687B (it) * | 1979-07-27 | 1987-04-08 | Montedison Spa | Soluzioni e formulazioni di carbammati antiparassitari stabili nel tempo e che resistono a basse ed alte temperature |
| US4381196A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | O-(Substituted phenyl) N-methylcarbamates as herbicide extenders |
| US4381195A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | N-Methylcarbamoyloxy anilides as herbicide extenders |
| FR2510994A1 (fr) * | 1981-08-10 | 1983-02-11 | Rhone Poulenc Agrochimie | Procede de preparation de l'herbicide phenmedipham |
| GR78909B (enExample) * | 1982-08-13 | 1984-10-02 | Sipcam Spa | |
| ES8604495A1 (es) * | 1983-09-20 | 1986-02-01 | Koege Kemisk Vaerk | Un procedimiento para preparar fenil-carbamatos sustituidos |
| US5246912A (en) * | 1984-02-29 | 1993-09-21 | Berol Nobel (Suisse) S.A. | Herbicidal compositions of phenmedipham and desmedipham |
| SK278523B6 (en) * | 1984-02-29 | 1997-08-06 | Erik Nielsen | A stabilised liquid herbicidal agent and method for killing weed plants |
| SE8904064D0 (sv) * | 1989-12-01 | 1989-12-01 | Astra Ab | Improved method of preparing an intermediate for the manufacture of bambuterol |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB545152A (en) * | 1940-10-11 | 1942-05-13 | William Henry Roberts | Improvements in and relating to apparatus for testing prime movers |
| NL94726C (enExample) * | 1957-10-02 | |||
| BE605039A (enExample) * | 1960-06-17 |
-
1965
- 1965-11-15 US US507713A patent/US3404975A/en not_active Expired - Lifetime
-
1966
- 1966-10-03 CA CA971964A patent/CA933178A/en not_active Expired
- 1966-10-05 NO NO165021A patent/NO119822B/no unknown
- 1966-10-14 IL IL26696A patent/IL26696A/en unknown
- 1966-11-07 FR FR82750A patent/FR1498834A/fr not_active Expired
- 1966-11-08 BE BE689440D patent/BE689440A/xx not_active IP Right Cessation
- 1966-11-11 GB GB50621/66A patent/GB1173753A/en not_active Expired
- 1966-11-11 NL NL666615986A patent/NL152255B/xx not_active IP Right Cessation
- 1966-11-14 DK DK589766AA patent/DK127091B/da unknown
- 1966-11-14 CH CH1632366A patent/CH484611A/de not_active IP Right Cessation
- 1966-11-14 BR BR184570/66A patent/BR6684570D0/pt unknown
- 1966-11-15 SE SE15611/66A patent/SE340543B/xx unknown
- 1966-11-15 DE DE1568621A patent/DE1568621C3/de not_active Expired
-
1970
- 1970-12-31 MY MY1970169A patent/MY7000169A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6615986A (enExample) | 1967-05-16 |
| SE340543B (enExample) | 1971-11-22 |
| BR6684570D0 (pt) | 1973-10-25 |
| CA933178A (en) | 1973-09-04 |
| DE1568621A1 (de) | 1970-03-19 |
| BE689440A (enExample) | 1967-05-08 |
| NL152255B (nl) | 1977-02-15 |
| NO119822B (enExample) | 1970-07-06 |
| CH484611A (de) | 1970-01-31 |
| DE1568621B2 (de) | 1975-01-30 |
| GB1173753A (en) | 1969-12-10 |
| DK127091B (da) | 1973-09-24 |
| US3404975A (en) | 1968-10-08 |
| FR1498834A (fr) | 1967-10-20 |
| DE1568621C3 (de) | 1975-09-04 |
| MY7000169A (en) | 1970-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL26696A (en) | M-(carbamoyloxy)-carbanilates and herbicidal compositions containing them | |
| MX2021004967A (es) | Composicion para el control de organismos nocivos y metodo para su uso. | |
| MX2021004762A (es) | Compuesto (hetero)arilimidazol y agente de control de organismos nocivos. | |
| MD1743B2 (ro) | Derivaţi ai indolului, procedeu de obţinere a lor, compoziţie fungicidă şi procedeu de combatere a fungilor | |
| GR69684B (enExample) | ||
| IE830057L (en) | Azolylmethyltetrahydrofurans | |
| GB1448851A (en) | Agents for inhibiting plant growth | |
| PH12021551013A1 (en) | Meta-diamide compounds for controlling invertebrate pests | |
| ES2053946T3 (es) | Un procedimiento para la preparacion de tetrahidroimidazo(1,4)benzodiazepin-2-onas. | |
| PH12021550390A1 (en) | Fungicidal nitroanilino substituted pyrazoles | |
| UA27900C2 (uk) | Фунгіцидна композиція та спосіб боротьби з грибковими інфекціями рослин | |
| GB1414646A (en) | Thiophosphonic acid esters having pesticidal properties | |
| GB1320667A (en) | Regulation of plant growth | |
| GB1340299A (en) | Agents for regulating plant growth | |
| GB1236969A (en) | Phytologically active compositions | |
| GB1450005A (en) | Agents for regulating plant growth | |
| ES386820A1 (es) | Procedimiento para la preparacion de un medio pesticida. | |
| ES8504145A1 (es) | Procedimiento para la obtencion de aroxi-pirimidinil-alcanoles | |
| GB1099243A (en) | Improvements in control of plant diseases | |
| ES483466A1 (es) | Procedimiento para la obtencion de derivados del 1,2,4-tria-zol | |
| ES434312A1 (es) | Procedimiento para preparar sales de pirazolio. | |
| SU1311600A3 (ru) | Фунгицидное средство | |
| GB1498751A (en) | Agents for regulating plant growth | |
| GB1503432A (en) | 4-amino-5-thione-1,2,4-triazines processes for their preparation and their use as herbicides | |
| GB1427554A (en) | Fungicidal agents |