IL26696A - M-(carbamoyloxy)-carbanilates and herbicidal compositions containing them - Google Patents
M-(carbamoyloxy)-carbanilates and herbicidal compositions containing themInfo
- Publication number
- IL26696A IL26696A IL26696A IL2669666A IL26696A IL 26696 A IL26696 A IL 26696A IL 26696 A IL26696 A IL 26696A IL 2669666 A IL2669666 A IL 2669666A IL 26696 A IL26696 A IL 26696A
- Authority
- IL
- Israel
- Prior art keywords
- hydrogen
- lower alkyl
- alkyl
- cyclohexyl
- phenyl
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims 4
- 239000000203 mixture Substances 0.000 title claims 2
- 125000000217 alkyl group Chemical group 0.000 claims 13
- 229910052739 hydrogen Inorganic materials 0.000 claims 10
- 239000001257 hydrogen Substances 0.000 claims 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 3
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims 3
- 125000001188 haloalkyl group Chemical group 0.000 claims 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 2
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 2
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- YSMODUONRAFBET-UHFFFAOYSA-N 5-hydroxylysine Chemical group NCC(O)CCC(N)C(O)=O YSMODUONRAFBET-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 230000008635 plant growth Effects 0.000 claims 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
- A01N47/22—O-Aryl or S-Aryl esters thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US41955964A | 1964-12-18 | 1964-12-18 | |
| US507713A US3404975A (en) | 1964-12-18 | 1965-11-15 | m-(carbamoyloxy)-carbanilates as herbicides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL26696A true IL26696A (en) | 1972-01-27 |
Family
ID=27024523
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL26696A IL26696A (en) | 1964-12-18 | 1966-10-14 | M-(carbamoyloxy)-carbanilates and herbicidal compositions containing them |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3404975A (enExample) |
| BE (1) | BE689440A (enExample) |
| BR (1) | BR6684570D0 (enExample) |
| CA (1) | CA933178A (enExample) |
| CH (1) | CH484611A (enExample) |
| DE (1) | DE1568621C3 (enExample) |
| DK (1) | DK127091B (enExample) |
| FR (1) | FR1498834A (enExample) |
| GB (1) | GB1173753A (enExample) |
| IL (1) | IL26696A (enExample) |
| MY (1) | MY7000169A (enExample) |
| NL (1) | NL152255B (enExample) |
| NO (1) | NO119822B (enExample) |
| SE (1) | SE340543B (enExample) |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1567151C3 (de) * | 1965-04-09 | 1974-02-21 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende herbizide Mittel |
| US3546343A (en) * | 1966-01-18 | 1970-12-08 | Union Carbide Corp | 4-(methylcarbamoyloxy) carbanilates as insecticides and nematocides |
| DE1593520C3 (de) * | 1966-09-05 | 1974-07-11 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 3-(Carbamoyloxyphenyl)-harnstoffe bzw. -thioharnstoffe, diese enthaltende Mittel mit selektiver herbizider Wirkung sowie Verfahren zu deren Herstellung |
| US3535101A (en) * | 1966-09-07 | 1970-10-20 | Schering Ag | Herbicide and algicide means |
| DE1567164C2 (de) * | 1966-09-10 | 1985-03-07 | Schering AG, 1000 Berlin und 4709 Bergkamen | Herbizide Mittel auf Basis von N-Carbamoyloxyphenyl-Carbamaten |
| DE1618169A1 (de) * | 1967-05-31 | 1970-12-10 | Basf Ag | Substituierte Phenylcarbaminsaeureureidophenylester |
| US3539333A (en) * | 1968-08-21 | 1970-11-10 | Gulf Research Development Co | Combating weeds in sugar beets |
| US3898075A (en) * | 1970-01-20 | 1975-08-05 | Freund Heinz Eberhard | Stabilized liquid compositions |
| DE2020729C2 (de) * | 1970-04-23 | 1983-04-21 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Herbizide Mittel auf Basis von N-(3-(N'-Aryl-carbamoyloxy)-phenyl)-carbamaten |
| US3839010A (en) * | 1970-05-19 | 1974-10-01 | Exxon Research Engineering Co | Thiocarbamic acid ester pesticides |
| US3979202A (en) * | 1970-05-26 | 1976-09-07 | Monsanto Company | Meta-bifunctional benzenes and herbicidal compositions |
| US3671571A (en) * | 1970-07-17 | 1972-06-20 | Basf Ag | Biscarbamates |
| US4076518A (en) * | 1970-08-20 | 1978-02-28 | Schering Aktiengesellschaft | Substituted phenyl thiocarbamates with herbicidal action and method for their production |
| US4242122A (en) * | 1970-10-02 | 1980-12-30 | Monsanto Company | Herbicidal meta-bifunctional benzenes |
| US3847587A (en) * | 1970-11-02 | 1974-11-12 | Stauffer Chemical Co | Meta-thiocarbamyl phenylene amides and ureas as herbicides |
| US4077798A (en) * | 1970-11-24 | 1978-03-07 | Schering Aktiengesellschaft | Selective herbicides |
| US3947511A (en) * | 1970-11-25 | 1976-03-30 | E. I. Du Pont De Nemours And Company | 1-Hydrocarbyl-3-mono- and -dithiocarbamoylureas |
| US3869275A (en) * | 1970-12-04 | 1975-03-04 | Schering Ag | Herbicidal mixtures |
| US4153447A (en) * | 1971-04-27 | 1979-05-08 | Schering Aktiengesellschaft | Herbicidal methylphenyl carbamates |
| US3885953A (en) * | 1971-12-22 | 1975-05-27 | Scm Corp | Meta-ureidophenyl n-haloalkyl carbamates as herbicides |
| US3792994A (en) * | 1972-12-26 | 1974-02-19 | Stauffer Chemical Co | Anilide carbamates as algicidal agents |
| DE2310649C3 (de) * | 1973-03-01 | 1982-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Diurethane sowie diese enthaltende selektive herbizide Mittel |
| US4065293A (en) * | 1973-03-01 | 1977-12-27 | Schering Aktiengesellschaft | Method for controlling the growth of weeds in a field containing growing plants of cotton |
| DE2310648C3 (de) * | 1973-03-01 | 1982-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel |
| US3867429A (en) * | 1973-03-26 | 1975-02-18 | American Cyanamid Co | Alkynyloxy)alkyl and (alkenyloxy)alkyl carbamates |
| US3997325A (en) * | 1973-05-24 | 1976-12-14 | American Cyanamid Company | (Alkynyloxy)alkyl and (alkenyloxy)alkyl carbamates and their use as herbicides |
| DE2341079C2 (de) * | 1973-08-10 | 1982-05-06 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | m-Diurethane und selektive herbizide Mittel enthaltend diese Verbindungen als Wirkstoffe |
| DE2413933A1 (de) * | 1974-03-20 | 1975-09-25 | Schering Ag | Diurethane mit selektiver herbizider wirkung |
| JPS523829A (en) * | 1975-06-11 | 1977-01-12 | Nippon Kayaku Co Ltd | Germicides for agriculture and gardening |
| US4202684A (en) * | 1975-12-18 | 1980-05-13 | Schering Aktiengesellschaft | Carbanilic acid esters, process for making the same and herbicidal compositions containing same |
| DE2557552C2 (de) * | 1975-12-18 | 1984-12-20 | Schering AG, 1000 Berlin und 4709 Bergkamen | Diurethane und herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe |
| DE2630418A1 (de) * | 1976-07-02 | 1978-01-05 | Schering Ag | Carbanilsaeureester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| DE2650796A1 (de) * | 1976-11-03 | 1978-05-11 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltendes selektives herbizides mittel |
| DE2651526A1 (de) * | 1976-11-09 | 1978-05-18 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltendes selektives herbizides mittel |
| DE2730325A1 (de) * | 1977-07-01 | 1979-01-11 | Schering Ag | Carbanilsaeure-(3-ureido-phenyl)- ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| DE2732848A1 (de) * | 1977-07-18 | 1979-02-08 | Schering Ag | Diurethane, herbizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| US4303793A (en) * | 1979-03-12 | 1981-12-01 | Ppg Industries, Inc. | Aqueous carbamate dispersions |
| IT1163687B (it) * | 1979-07-27 | 1987-04-08 | Montedison Spa | Soluzioni e formulazioni di carbammati antiparassitari stabili nel tempo e che resistono a basse ed alte temperature |
| US4381195A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | N-Methylcarbamoyloxy anilides as herbicide extenders |
| US4381196A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | O-(Substituted phenyl) N-methylcarbamates as herbicide extenders |
| FR2510994A1 (fr) * | 1981-08-10 | 1983-02-11 | Rhone Poulenc Agrochimie | Procede de preparation de l'herbicide phenmedipham |
| GR78909B (enExample) * | 1982-08-13 | 1984-10-02 | Sipcam Spa | |
| ES8604495A1 (es) * | 1983-09-20 | 1986-02-01 | Koege Kemisk Vaerk | Un procedimiento para preparar fenil-carbamatos sustituidos |
| US5246912A (en) * | 1984-02-29 | 1993-09-21 | Berol Nobel (Suisse) S.A. | Herbicidal compositions of phenmedipham and desmedipham |
| CZ156191A3 (en) * | 1984-02-29 | 1995-10-18 | Schering Ag | Stabilized liquid herbicidal agent and method of controlling weed |
| SE8904064D0 (sv) * | 1989-12-01 | 1989-12-01 | Astra Ab | Improved method of preparing an intermediate for the manufacture of bambuterol |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB545152A (en) * | 1940-10-11 | 1942-05-13 | William Henry Roberts | Improvements in and relating to apparatus for testing prime movers |
| NL221293A (enExample) * | 1957-10-02 | |||
| NL266054A (enExample) * | 1960-06-17 |
-
1965
- 1965-11-15 US US507713A patent/US3404975A/en not_active Expired - Lifetime
-
1966
- 1966-10-03 CA CA971964A patent/CA933178A/en not_active Expired
- 1966-10-05 NO NO165021A patent/NO119822B/no unknown
- 1966-10-14 IL IL26696A patent/IL26696A/en unknown
- 1966-11-07 FR FR82750A patent/FR1498834A/fr not_active Expired
- 1966-11-08 BE BE689440D patent/BE689440A/xx not_active IP Right Cessation
- 1966-11-11 GB GB50621/66A patent/GB1173753A/en not_active Expired
- 1966-11-11 NL NL666615986A patent/NL152255B/xx not_active IP Right Cessation
- 1966-11-14 DK DK589766AA patent/DK127091B/da unknown
- 1966-11-14 BR BR184570/66A patent/BR6684570D0/pt unknown
- 1966-11-14 CH CH1632366A patent/CH484611A/de not_active IP Right Cessation
- 1966-11-15 SE SE15611/66A patent/SE340543B/xx unknown
- 1966-11-15 DE DE1568621A patent/DE1568621C3/de not_active Expired
-
1970
- 1970-12-31 MY MY1970169A patent/MY7000169A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL152255B (nl) | 1977-02-15 |
| DK127091B (da) | 1973-09-24 |
| CH484611A (de) | 1970-01-31 |
| SE340543B (enExample) | 1971-11-22 |
| CA933178A (en) | 1973-09-04 |
| NL6615986A (enExample) | 1967-05-16 |
| DE1568621C3 (de) | 1975-09-04 |
| NO119822B (enExample) | 1970-07-06 |
| MY7000169A (en) | 1970-12-31 |
| US3404975A (en) | 1968-10-08 |
| FR1498834A (fr) | 1967-10-20 |
| DE1568621A1 (de) | 1970-03-19 |
| DE1568621B2 (de) | 1975-01-30 |
| BR6684570D0 (pt) | 1973-10-25 |
| BE689440A (enExample) | 1967-05-08 |
| GB1173753A (en) | 1969-12-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL26696A (en) | M-(carbamoyloxy)-carbanilates and herbicidal compositions containing them | |
| MX2021004762A (es) | Compuesto (hetero)arilimidazol y agente de control de organismos nocivos. | |
| MD1743B2 (ro) | Derivaţi ai indolului, procedeu de obţinere a lor, compoziţie fungicidă şi procedeu de combatere a fungilor | |
| GR69684B (enExample) | ||
| IE830057L (en) | Azolylmethyltetrahydrofurans | |
| PH12021552946A1 (en) | Pyrazole-substituted pyrrolidinones as herbicides | |
| GB1448851A (en) | Agents for inhibiting plant growth | |
| PH12021551013B1 (en) | Meta-diamide compounds for controlling invertebrate pests | |
| DK278480A (da) | Nye alfa-azolylglycolderivater fremgangsmaade til fremstilling deraf fungicide og plantevaekstregulerende midler der indeholder disse og fremgangsmaade til bekaempelse af fungi og til reggulering af plantevaekst og anvendelsen deraf som fungicider og plantevaekstregulerende midler | |
| GB1414646A (en) | Thiophosphonic acid esters having pesticidal properties | |
| GB1320667A (en) | Regulation of plant growth | |
| GB1340299A (en) | Agents for regulating plant growth | |
| GB1236969A (en) | Phytologically active compositions | |
| GB1450005A (en) | Agents for regulating plant growth | |
| ES8504145A1 (es) | Procedimiento para la obtencion de aroxi-pirimidinil-alcanoles | |
| GB1099243A (en) | Improvements in control of plant diseases | |
| ES434312A1 (es) | Procedimiento para preparar sales de pirazolio. | |
| SU1311600A3 (ru) | Фунгицидное средство | |
| TW235294B (enExample) | ||
| GB1498751A (en) | Agents for regulating plant growth | |
| GB1503432A (en) | 4-amino-5-thione-1,2,4-triazines processes for their preparation and their use as herbicides | |
| GB1427554A (en) | Fungicidal agents | |
| GB1161035A (en) | Insect Repelling Compounds and Compositions and method for Repelling Insects using them | |
| GB1339116A (en) | N-arylcarbamic acid esters processes for their preparation and their use as plant-growth regulators | |
| GB1123016A (en) | Substituted pyridazones and the use thereof as herbicides |