IL124597A - Amides of acrylic acids, troaryl, tetrahydronaphthalene, chromium, theochroman and 1,2,3,4 tetrahydroquinoline carboxyls are converted in the aromatic or trohromatic green, electron-withdrawing transducer, having retinal-like biological activity - Google Patents
Amides of acrylic acids, troaryl, tetrahydronaphthalene, chromium, theochroman and 1,2,3,4 tetrahydroquinoline carboxyls are converted in the aromatic or trohromatic green, electron-withdrawing transducer, having retinal-like biological activityInfo
- Publication number
- IL124597A IL124597A IL12459796A IL12459796A IL124597A IL 124597 A IL124597 A IL 124597A IL 12459796 A IL12459796 A IL 12459796A IL 12459796 A IL12459796 A IL 12459796A IL 124597 A IL124597 A IL 124597A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- carbons
- fluoro
- carbamoyl
- accordance
- Prior art date
Links
- -1 heteroaryl amides Chemical class 0.000 title claims description 44
- 125000003118 aryl group Chemical group 0.000 title claims description 15
- 125000001424 substituent group Chemical group 0.000 title claims description 11
- 125000001072 heteroaryl group Chemical group 0.000 title claims description 9
- 230000004071 biological effect Effects 0.000 title abstract description 9
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical compound C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 title description 10
- WPWNEKFMGCWNPR-UHFFFAOYSA-N 3,4-dihydro-2h-thiochromene Chemical compound C1=CC=C2CCCSC2=C1 WPWNEKFMGCWNPR-UHFFFAOYSA-N 0.000 title description 8
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 title description 7
- OSJVTYVKQNOXPP-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline-2-carboxylic acid Chemical class C1=CC=C2NC(C(=O)O)CCC2=C1 OSJVTYVKQNOXPP-UHFFFAOYSA-N 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 324
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 113
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 83
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 61
- 125000000217 alkyl group Chemical group 0.000 claims description 54
- 239000002253 acid Substances 0.000 claims description 48
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 35
- 239000005711 Benzoic acid Substances 0.000 claims description 27
- 235000010233 benzoic acid Nutrition 0.000 claims description 27
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 21
- 201000010099 disease Diseases 0.000 claims description 20
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 125000003342 alkenyl group Chemical group 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 12
- 125000000304 alkynyl group Chemical group 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 10
- 239000003814 drug Substances 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 claims description 2
- 125000002883 imidazolyl group Chemical group 0.000 claims description 2
- 125000002971 oxazolyl group Chemical group 0.000 claims description 2
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 8
- 125000000547 substituted alkyl group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 138
- 238000006243 chemical reaction Methods 0.000 description 58
- 239000000243 solution Substances 0.000 description 53
- 238000005481 NMR spectroscopy Methods 0.000 description 50
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 41
- 238000000034 method Methods 0.000 description 39
- 239000011541 reaction mixture Substances 0.000 description 37
- 239000007787 solid Substances 0.000 description 37
- 229940050390 benzoate Drugs 0.000 description 35
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 30
- 210000004027 cell Anatomy 0.000 description 29
- 150000001408 amides Chemical class 0.000 description 28
- 239000000203 mixture Substances 0.000 description 26
- 230000015572 biosynthetic process Effects 0.000 description 23
- 150000002148 esters Chemical class 0.000 description 23
- 238000003786 synthesis reaction Methods 0.000 description 23
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 22
- 235000019441 ethanol Nutrition 0.000 description 20
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 19
- 238000004440 column chromatography Methods 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 230000000694 effects Effects 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 17
- 239000012267 brine Substances 0.000 description 17
- 239000003921 oil Substances 0.000 description 17
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 17
- 239000002904 solvent Substances 0.000 description 17
- 239000003153 chemical reaction reagent Substances 0.000 description 16
- 229960004365 benzoic acid Drugs 0.000 description 14
- CSCPPACGZOOCGX-WFGJKAKNSA-N deuterated acetone Substances [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 14
- NNMJPCUZFNRTEG-UHFFFAOYSA-N ethyl 4-amino-2-fluorobenzoate Chemical compound CCOC(=O)C1=CC=C(N)C=C1F NNMJPCUZFNRTEG-UHFFFAOYSA-N 0.000 description 14
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 12
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 12
- 238000001914 filtration Methods 0.000 description 12
- 102000005962 receptors Human genes 0.000 description 12
- 108020003175 receptors Proteins 0.000 description 12
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 11
- 150000001412 amines Chemical class 0.000 description 11
- 238000003556 assay Methods 0.000 description 11
- 229910002092 carbon dioxide Inorganic materials 0.000 description 11
- 239000012044 organic layer Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 10
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 10
- 230000002265 prevention Effects 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000012230 colorless oil Substances 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical class C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 7
- 229910004373 HOAc Inorganic materials 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 150000001805 chlorine compounds Chemical class 0.000 description 7
- 229940125904 compound 1 Drugs 0.000 description 7
- 125000004122 cyclic group Chemical group 0.000 description 7
- BXGTVNLGPMZLAZ-UHFFFAOYSA-N n'-ethylmethanediimine;hydrochloride Chemical compound Cl.CCN=C=N BXGTVNLGPMZLAZ-UHFFFAOYSA-N 0.000 description 7
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 7
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 7
- 108090000064 retinoic acid receptors Proteins 0.000 description 7
- 102000003702 retinoic acid receptors Human genes 0.000 description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 7
- NCQLQMICDXPLQH-UHFFFAOYSA-N 2,2,4,4,8-pentamethyl-3h-chromene-6-carboxylic acid Chemical compound O1C(C)(C)CC(C)(C)C2=C1C(C)=CC(C(O)=O)=C2 NCQLQMICDXPLQH-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 206010028980 Neoplasm Diseases 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 102000034527 Retinoid X Receptors Human genes 0.000 description 6
- 108010038912 Retinoid X Receptors Proteins 0.000 description 6
- 239000012298 atmosphere Substances 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 239000003446 ligand Substances 0.000 description 6
- 150000004702 methyl esters Chemical class 0.000 description 6
- 102000027483 retinoid hormone receptors Human genes 0.000 description 6
- 108091008679 retinoid hormone receptors Proteins 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- JXKBUOWTZSPVGC-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3h-chromene-6-carboxylic acid Chemical compound OC(=O)C1=CC=C2OC(C)(C)CC(C)(C)C2=C1 JXKBUOWTZSPVGC-UHFFFAOYSA-N 0.000 description 5
- DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 5
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 5
- 238000005361 D2 NMR spectroscopy Methods 0.000 description 5
- 150000001299 aldehydes Chemical class 0.000 description 5
- IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 150000001735 carboxylic acids Chemical class 0.000 description 5
- 238000000670 ligand binding assay Methods 0.000 description 5
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 5
- UWPLTCWTTVMXCM-UHFFFAOYSA-N methyl 4-amino-2,6-difluorobenzoate Chemical compound COC(=O)C1=C(F)C=C(N)C=C1F UWPLTCWTTVMXCM-UHFFFAOYSA-N 0.000 description 5
- 210000000056 organ Anatomy 0.000 description 5
- 229940104230 thymidine Drugs 0.000 description 5
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 101100202237 Danio rerio rxrab gene Proteins 0.000 description 4
- 101100309320 Danio rerio rxrga gene Proteins 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- 241000701806 Human papillomavirus Species 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 208000002158 Proliferative Vitreoretinopathy Diseases 0.000 description 4
- 101150050070 RXRA gene Proteins 0.000 description 4
- 101150066717 Rara gene Proteins 0.000 description 4
- 206010038934 Retinopathy proliferative Diseases 0.000 description 4
- 150000001241 acetals Chemical class 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 4
- 230000006907 apoptotic process Effects 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- FVIZARNDLVOMSU-UHFFFAOYSA-N ginsenoside K Natural products C1CC(C2(CCC3C(C)(C)C(O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC1OC(CO)C(O)C(O)C1O FVIZARNDLVOMSU-UHFFFAOYSA-N 0.000 description 4
- 238000011905 homologation Methods 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 230000003463 hyperproliferative effect Effects 0.000 description 4
- 230000002757 inflammatory effect Effects 0.000 description 4
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 4
- 208000021971 neovascular inflammatory vitreoretinopathy Diseases 0.000 description 4
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 4
- 230000006785 proliferative vitreoretinopathy Effects 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 208000017520 skin disease Diseases 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- QLHRHTZKXWBOSG-UHFFFAOYSA-N 2,2,4,4-tetramethyl-8-nitro-3h-chromene-6-carboxylic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=C2OC(C)(C)CC(C)(C)C2=C1 QLHRHTZKXWBOSG-UHFFFAOYSA-N 0.000 description 3
- YAQSPKCDFSUPDE-UHFFFAOYSA-N 2-(4-hydroxy-2,4-dimethylpentan-2-yl)-6-methylphenol Chemical compound CC1=CC=CC(C(C)(C)CC(C)(C)O)=C1O YAQSPKCDFSUPDE-UHFFFAOYSA-N 0.000 description 3
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 3
- VGMGQJOQTUARPK-UHFFFAOYSA-N 3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylic acid Chemical compound CC1(C)CCC(C)(C)C2=C1C=C(C(O)=O)C(OCOC)=C2 VGMGQJOQTUARPK-UHFFFAOYSA-N 0.000 description 3
- KSEZYZSBKCPEKP-UHFFFAOYSA-N 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylic acid Chemical class OC(=O)C1=CC=C2C(C)(C)CCC(C)(C)C2=C1 KSEZYZSBKCPEKP-UHFFFAOYSA-N 0.000 description 3
- QTFXZYRTNHDGRZ-UHFFFAOYSA-N 6-bromo-2,2,4,4,8-pentamethyl-3h-chromene Chemical compound O1C(C)(C)CC(C)(C)C2=C1C(C)=CC(Br)=C2 QTFXZYRTNHDGRZ-UHFFFAOYSA-N 0.000 description 3
- BPEONMBGNDPSON-UHFFFAOYSA-N 6-bromo-7-(methoxymethoxy)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene Chemical compound CC1(C)CCC(C)(C)C2=C1C=C(Br)C(OCOC)=C2 BPEONMBGNDPSON-UHFFFAOYSA-N 0.000 description 3
- NTVVCEGIGSIJPY-UHFFFAOYSA-N 8-bromo-2,2,4,4-tetramethyl-3h-chromene-6-carboxylic acid Chemical compound OC(=O)C1=CC(Br)=C2OC(C)(C)CC(C)(C)C2=C1 NTVVCEGIGSIJPY-UHFFFAOYSA-N 0.000 description 3
- 208000002874 Acne Vulgaris Diseases 0.000 description 3
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- OJRUSAPKCPIVBY-KQYNXXCUSA-N C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(CP(=O)(O)O)O)O)O)I)N Chemical compound C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(CP(=O)(O)O)O)O)O)I)N OJRUSAPKCPIVBY-KQYNXXCUSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- 201000004681 Psoriasis Diseases 0.000 description 3
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 description 3
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 206010000496 acne Diseases 0.000 description 3
- 239000000556 agonist Substances 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229940088710 antibiotic agent Drugs 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 210000003679 cervix uteri Anatomy 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229940125758 compound 15 Drugs 0.000 description 3
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 3
- ONCCWDRMOZMNSM-FBCQKBJTSA-N compound Z Chemical compound N1=C2C(=O)NC(N)=NC2=NC=C1C(=O)[C@H]1OP(O)(=O)OC[C@H]1O ONCCWDRMOZMNSM-FBCQKBJTSA-N 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- NWYIWVNRQQJKRU-UHFFFAOYSA-N ethyl 3-amino-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylate Chemical compound CC1(C)CCC(C)(C)C2=C1C=C(N)C(C(=O)OCC)=C2 NWYIWVNRQQJKRU-UHFFFAOYSA-N 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 239000012091 fetal bovine serum Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 3
- 239000001963 growth medium Substances 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 150000003141 primary amines Chemical class 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 229930002330 retinoic acid Natural products 0.000 description 3
- 150000004492 retinoid derivatives Chemical class 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 229960000187 tissue plasminogen activator Drugs 0.000 description 3
- 230000000699 topical effect Effects 0.000 description 3
- 239000012049 topical pharmaceutical composition Substances 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- 239000011534 wash buffer Substances 0.000 description 3
- STBLNCCBQMHSRC-BATDWUPUSA-N (2s)-n-[(3s,4s)-5-acetyl-7-cyano-4-methyl-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)[C@H](C)N(C(C)=O)C2=CC(C#N)=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 STBLNCCBQMHSRC-BATDWUPUSA-N 0.000 description 2
- IQFYYKKMVGJFEH-HVMUMPLKSA-N 1-[(2r,4s,5r)-4-hydroxy-5-[hydroxy(tritio)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione Chemical compound C1[C@H](O)[C@@H](C(O)[3H])O[C@H]1N1C(=O)NC(=O)C(C)=C1 IQFYYKKMVGJFEH-HVMUMPLKSA-N 0.000 description 2
- KNUVSXJENMFDQL-UHFFFAOYSA-N 2,2,4,4-tetramethyl-8-(trifluoromethyl)-3h-chromene-6-carboxylic acid Chemical compound OC(=O)C1=CC(C(F)(F)F)=C2OC(C)(C)CC(C)(C)C2=C1 KNUVSXJENMFDQL-UHFFFAOYSA-N 0.000 description 2
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 2
- WIQISTBTOQNVCE-UHFFFAOYSA-N 2-fluoro-1-methyl-4-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1F WIQISTBTOQNVCE-UHFFFAOYSA-N 0.000 description 2
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 2
- UMCMPZBLKLEWAF-BCTGSCMUSA-N 3-[(3-cholamidopropyl)dimethylammonio]propane-1-sulfonate Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(=O)NCCC[N+](C)(C)CCCS([O-])(=O)=O)C)[C@@]2(C)[C@@H](O)C1 UMCMPZBLKLEWAF-BCTGSCMUSA-N 0.000 description 2
- UCKHDBZWOMQSAF-UHFFFAOYSA-N 4-bromo-3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylic acid Chemical compound OC1=C(C(O)=O)C=C2C(C)(C)CCC(C)(C)C2=C1Br UCKHDBZWOMQSAF-UHFFFAOYSA-N 0.000 description 2
- QCGSHHFJTSRKSK-UHFFFAOYSA-N 4-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(C)(C)CCC(C)(C)C2=C1Br QCGSHHFJTSRKSK-UHFFFAOYSA-N 0.000 description 2
- FLTKOYSZHNTBGH-UHFFFAOYSA-N 8-bromo-4,4-dimethyl-2,3-dihydrochromene-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(C)(C)CCOC2=C1Br FLTKOYSZHNTBGH-UHFFFAOYSA-N 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- 206010059313 Anogenital warts Diseases 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 206010003694 Atrophy Diseases 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- 208000024172 Cardiovascular disease Diseases 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- 208000000907 Condylomata Acuminata Diseases 0.000 description 2
- 201000004624 Dermatitis Diseases 0.000 description 2
- 206010012438 Dermatitis atopic Diseases 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 208000003556 Dry Eye Syndromes Diseases 0.000 description 2
- 206010013774 Dry eye Diseases 0.000 description 2
- 208000032928 Dyslipidaemia Diseases 0.000 description 2
- 206010058314 Dysplasia Diseases 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 102000004457 Granulocyte-Macrophage Colony-Stimulating Factor Human genes 0.000 description 2
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 description 2
- 102000018997 Growth Hormone Human genes 0.000 description 2
- 108010051696 Growth Hormone Proteins 0.000 description 2
- 229910004039 HBF4 Inorganic materials 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- 206010021197 Ichthyoses Diseases 0.000 description 2
- 208000007766 Kaposi sarcoma Diseases 0.000 description 2
- 208000001126 Keratosis Diseases 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 206010054949 Metaplasia Diseases 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 208000018737 Parkinson disease Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 208000006994 Precancerous Conditions Diseases 0.000 description 2
- 206010038848 Retinal detachment Diseases 0.000 description 2
- 239000006146 Roswell Park Memorial Institute medium Substances 0.000 description 2
- 208000006011 Stroke Diseases 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 210000001744 T-lymphocyte Anatomy 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 206010052779 Transplant rejections Diseases 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 208000000260 Warts Diseases 0.000 description 2
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 208000009621 actinic keratosis Diseases 0.000 description 2
- 238000002399 angioplasty Methods 0.000 description 2
- 208000025009 anogenital human papillomavirus infection Diseases 0.000 description 2
- 201000004201 anogenital venereal wart Diseases 0.000 description 2
- 230000000845 anti-microbial effect Effects 0.000 description 2
- 239000004599 antimicrobial Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 2
- 201000008937 atopic dermatitis Diseases 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 230000037444 atrophy Effects 0.000 description 2
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000000481 breast Anatomy 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 206010009887 colitis Diseases 0.000 description 2
- 210000001072 colon Anatomy 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 229940125846 compound 25 Drugs 0.000 description 2
- 229940125851 compound 27 Drugs 0.000 description 2
- 229940125878 compound 36 Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 210000003238 esophagus Anatomy 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- JDSOGQBPMSYRQV-UHFFFAOYSA-N ethyl 2,2,4,4-tetramethyl-8-nitro-3h-chromene-6-carboxylate Chemical compound O1C(C)(C)CC(C)(C)C2=CC(C(=O)OCC)=CC([N+]([O-])=O)=C21 JDSOGQBPMSYRQV-UHFFFAOYSA-N 0.000 description 2
- KGLJHQMYPYCYCR-UHFFFAOYSA-N ethyl 2-fluoro-4-nitrobenzoate Chemical compound CCOC(=O)C1=CC=C([N+]([O-])=O)C=C1F KGLJHQMYPYCYCR-UHFFFAOYSA-N 0.000 description 2
- KHUVOOOVVRVWJQ-UHFFFAOYSA-N ethyl 3-fluoro-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylate Chemical compound CC1(C)CCC(C)(C)C2=C1C=C(F)C(C(=O)OCC)=C2 KHUVOOOVVRVWJQ-UHFFFAOYSA-N 0.000 description 2
- NAHVMSGNHQCHBM-UHFFFAOYSA-N ethyl 4-amino-2-bromobenzoate Chemical compound CCOC(=O)C1=CC=C(N)C=C1Br NAHVMSGNHQCHBM-UHFFFAOYSA-N 0.000 description 2
- JJTKYTOTGVRSRP-UHFFFAOYSA-N ethyl 4-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylate Chemical compound CC1(C)CCC(C)(C)C=2C1=CC(C(=O)OCC)=CC=2Br JJTKYTOTGVRSRP-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- ZTQSADJAYQOCDD-UHFFFAOYSA-N ginsenoside-Rd2 Natural products C1CC(C2(CCC3C(C)(C)C(OC4C(C(O)C(O)C(CO)O4)O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC(C(C(O)C1O)O)OC1COC1OCC(O)C(O)C1O ZTQSADJAYQOCDD-UHFFFAOYSA-N 0.000 description 2
- 239000003862 glucocorticoid Substances 0.000 description 2
- 239000003102 growth factor Substances 0.000 description 2
- 239000000122 growth hormone Substances 0.000 description 2
- 230000003779 hair growth Effects 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 206010021198 ichthyosis Diseases 0.000 description 2
- 208000009326 ileitis Diseases 0.000 description 2
- 210000000987 immune system Anatomy 0.000 description 2
- 229960001438 immunostimulant agent Drugs 0.000 description 2
- 239000003022 immunostimulating agent Substances 0.000 description 2
- 230000003308 immunostimulating effect Effects 0.000 description 2
- 229960003444 immunosuppressant agent Drugs 0.000 description 2
- 239000003018 immunosuppressive agent Substances 0.000 description 2
- 230000006882 induction of apoptosis Effects 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 2
- 230000003780 keratinization Effects 0.000 description 2
- 210000000867 larynx Anatomy 0.000 description 2
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 2
- 208000002741 leukoplakia Diseases 0.000 description 2
- 201000011486 lichen planus Diseases 0.000 description 2
- 238000005567 liquid scintillation counting Methods 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- 210000004324 lymphatic system Anatomy 0.000 description 2
- 230000003211 malignant effect Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000015689 metaplastic ossification Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 210000000214 mouth Anatomy 0.000 description 2
- 210000004400 mucous membrane Anatomy 0.000 description 2
- 230000009826 neoplastic cell growth Effects 0.000 description 2
- 230000004770 neurodegeneration Effects 0.000 description 2
- 208000015122 neurodegenerative disease Diseases 0.000 description 2
- 230000009871 nonspecific binding Effects 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 208000003154 papilloma Diseases 0.000 description 2
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 2
- 230000008832 photodamage Effects 0.000 description 2
- 230000001817 pituitary effect Effects 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 210000002307 prostate Anatomy 0.000 description 2
- 238000000159 protein binding assay Methods 0.000 description 2
- 208000005069 pulmonary fibrosis Diseases 0.000 description 2
- 208000037803 restenosis Diseases 0.000 description 2
- 230000004264 retinal detachment Effects 0.000 description 2
- 102000027478 retinoid receptor subtypes Human genes 0.000 description 2
- 108091008678 retinoid receptor subtypes Proteins 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 201000010153 skin papilloma Diseases 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 206010041823 squamous cell carcinoma Diseases 0.000 description 2
- 150000003431 steroids Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- 210000003932 urinary bladder Anatomy 0.000 description 2
- 210000004291 uterus Anatomy 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- 230000029663 wound healing Effects 0.000 description 2
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 1
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 1
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- FNHHVPPSBFQMEL-KQHDFZBMSA-N (3S)-5-N-[(1S,5R)-3-hydroxy-6-bicyclo[3.1.0]hexanyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide Chemical compound CNC(=O)c1cc(cc2c1OC[C@@]2(C)c1ccccc1)C(=O)NC1[C@H]2CC(O)C[C@@H]12 FNHHVPPSBFQMEL-KQHDFZBMSA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- UNILWMWFPHPYOR-KXEYIPSPSA-M 1-[6-[2-[3-[3-[3-[2-[2-[3-[[2-[2-[[(2r)-1-[[2-[[(2r)-1-[3-[2-[2-[3-[[2-(2-amino-2-oxoethoxy)acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]-3-hydroxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-[(2r)-2,3-di(hexadecanoyloxy)propyl]sulfanyl-1-oxopropan-2-yl Chemical compound O=C1C(SCCC(=O)NCCCOCCOCCOCCCNC(=O)COCC(=O)N[C@@H](CSC[C@@H](COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(=O)NCC(=O)N[C@H](CO)C(=O)NCCCOCCOCCOCCCNC(=O)COCC(N)=O)CC(=O)N1CCNC(=O)CCCCCN\1C2=CC=C(S([O-])(=O)=O)C=C2CC/1=C/C=C/C=C/C1=[N+](CC)C2=CC=C(S([O-])(=O)=O)C=C2C1 UNILWMWFPHPYOR-KXEYIPSPSA-M 0.000 description 1
- BPIUIOXAFBGMNB-UHFFFAOYSA-N 1-hexoxyhexane Chemical compound CCCCCCOCCCCCC BPIUIOXAFBGMNB-UHFFFAOYSA-N 0.000 description 1
- ANOOTOPTCJRUPK-UHFFFAOYSA-N 1-iodohexane Chemical compound CCCCCCI ANOOTOPTCJRUPK-UHFFFAOYSA-N 0.000 description 1
- RFKILNPYYDXJTC-UHFFFAOYSA-N 2,2,4,4,8-pentamethyl-3h-chromene Chemical compound O1C(C)(C)CC(C)(C)C2=C1C(C)=CC=C2 RFKILNPYYDXJTC-UHFFFAOYSA-N 0.000 description 1
- RNNPVVWJFUXQHJ-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3h-thiochromene-6-carboxylic acid Chemical compound OC(=O)C1=CC=C2SC(C)(C)CC(C)(C)C2=C1 RNNPVVWJFUXQHJ-UHFFFAOYSA-N 0.000 description 1
- WEPXLRANFJEOFZ-UHFFFAOYSA-N 2,3,4-trifluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(F)=C1F WEPXLRANFJEOFZ-UHFFFAOYSA-N 0.000 description 1
- WFNRNCNCXRGUKN-UHFFFAOYSA-N 2,3,5,6-tetrafluoroterephthalic acid Chemical compound OC(=O)C1=C(F)C(F)=C(C(O)=O)C(F)=C1F WFNRNCNCXRGUKN-UHFFFAOYSA-N 0.000 description 1
- SJZATRRXUILGHH-UHFFFAOYSA-N 2,4,6-trifluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=C(F)C=C1F SJZATRRXUILGHH-UHFFFAOYSA-N 0.000 description 1
- SGRODURINDARRU-UHFFFAOYSA-N 2,4-bis(4-methoxyphenyl)-1,3,2,4-dithiadiphosphetane Chemical compound C1=CC(OC)=CC=C1P1SP(C=2C=CC(OC)=CC=2)S1 SGRODURINDARRU-UHFFFAOYSA-N 0.000 description 1
- LWKOWFVDUSZDRA-UHFFFAOYSA-N 2,5-difluoroterephthalic acid Chemical compound OC(=O)C1=CC(F)=C(C(O)=O)C=C1F LWKOWFVDUSZDRA-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- XFZFJQHXWJIBQV-UHFFFAOYSA-N 2-bromo-1-methyl-4-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1Br XFZFJQHXWJIBQV-UHFFFAOYSA-N 0.000 description 1
- CYMRPDYINXWJFU-UHFFFAOYSA-N 2-carbamoylbenzoic acid Chemical compound NC(=O)C1=CC=CC=C1C(O)=O CYMRPDYINXWJFU-UHFFFAOYSA-N 0.000 description 1
- LLYXJBROWQDVMI-UHFFFAOYSA-N 2-chloro-4-nitrotoluene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1Cl LLYXJBROWQDVMI-UHFFFAOYSA-N 0.000 description 1
- UNIDCOAAXBSCIM-UHFFFAOYSA-N 3-amino-5,5,8,8-tetramethylnaphthalene-2-carboxylic acid Chemical compound OC(=O)C1=C(N)C=C2C(C)(C)C=CC(C)(C)C2=C1 UNIDCOAAXBSCIM-UHFFFAOYSA-N 0.000 description 1
- BPWJFRMNQQXQHD-UHFFFAOYSA-N 3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylic acid Chemical compound OC(=O)C1=C(O)C=C2C(C)(C)CCC(C)(C)C2=C1 BPWJFRMNQQXQHD-UHFFFAOYSA-N 0.000 description 1
- BDUBTLFQHNYXPC-UHFFFAOYSA-N 3-methylbut-2-enoyl chloride Chemical compound CC(C)=CC(Cl)=O BDUBTLFQHNYXPC-UHFFFAOYSA-N 0.000 description 1
- NVBIWLJQMCJZHL-UHFFFAOYSA-N 4,4,8-trimethyl-3h-chromen-2-one Chemical compound O1C(=O)CC(C)(C)C2=C1C(C)=CC=C2 NVBIWLJQMCJZHL-UHFFFAOYSA-N 0.000 description 1
- JXKADCQRCBTEBF-UHFFFAOYSA-N 4,4-dimethyl-2,3-dihydrochromene-2-carboxylic acid Chemical compound C1=CC=C2C(C)(C)CC(C(O)=O)OC2=C1 JXKADCQRCBTEBF-UHFFFAOYSA-N 0.000 description 1
- WTNSXWSOTDBWOR-UHFFFAOYSA-N 4-amino-2,3,5,6-tetrafluorobenzoic acid Chemical compound NC1=C(F)C(F)=C(C(O)=O)C(F)=C1F WTNSXWSOTDBWOR-UHFFFAOYSA-N 0.000 description 1
- QHERSCUZBKDVOC-UHFFFAOYSA-N 4-amino-2-fluorobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C(F)=C1 QHERSCUZBKDVOC-UHFFFAOYSA-N 0.000 description 1
- SAJYSJVBNGUWJK-UHFFFAOYSA-N 4-amino-2-nitrobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C([N+]([O-])=O)=C1 SAJYSJVBNGUWJK-UHFFFAOYSA-N 0.000 description 1
- IRUDFVTZXQTEFN-UHFFFAOYSA-N 4-bromo-2,3-difluorobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C(F)=C1F IRUDFVTZXQTEFN-UHFFFAOYSA-N 0.000 description 1
- YWZSTHLOAZTDFJ-UHFFFAOYSA-N 4-bromo-2,5-difluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(Br)C=C1F YWZSTHLOAZTDFJ-UHFFFAOYSA-N 0.000 description 1
- BKCVIDHJENJJNF-UHFFFAOYSA-N 4-bromo-3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylic acid Chemical compound CC1(C)CCC(C)(C)C2=C1C=C(C(O)=O)C(OCOC)=C2Br BKCVIDHJENJJNF-UHFFFAOYSA-N 0.000 description 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 1
- UZHCJGSIRIFQTO-UHFFFAOYSA-N 5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol Chemical compound OC1=CC=C2C(C)(C)CCC(C)(C)C2=C1 UZHCJGSIRIFQTO-UHFFFAOYSA-N 0.000 description 1
- RSWXAGBBPCRION-UHFFFAOYSA-N 5,6,7,8-tetrahydro-2-naphthoic acid Chemical class C1CCCC2=CC(C(=O)O)=CC=C21 RSWXAGBBPCRION-UHFFFAOYSA-N 0.000 description 1
- VNIYCXIHHCRMAX-UHFFFAOYSA-N 5-amino-3,4-dibromothiophene-2-carboxylic acid Chemical compound NC=1SC(C(O)=O)=C(Br)C=1Br VNIYCXIHHCRMAX-UHFFFAOYSA-N 0.000 description 1
- WDJARUKOMOGTHA-UHFFFAOYSA-N 5-aminopyridine-2-carboxylic acid Chemical compound NC1=CC=C(C(O)=O)N=C1 WDJARUKOMOGTHA-UHFFFAOYSA-N 0.000 description 1
- YZRVTSCLFRCFPW-UHFFFAOYSA-N 5-aminothiophene-2-carboxylic acid Chemical compound NC1=CC=C(C(O)=O)S1 YZRVTSCLFRCFPW-UHFFFAOYSA-N 0.000 description 1
- ZCIFWRHIEBXBOY-UHFFFAOYSA-N 6-aminonicotinic acid Chemical compound NC1=CC=C(C(O)=O)C=N1 ZCIFWRHIEBXBOY-UHFFFAOYSA-N 0.000 description 1
- TVEXGJYMHHTVKP-UHFFFAOYSA-N 6-oxabicyclo[3.2.1]oct-3-en-7-one Chemical compound C1C2C(=O)OC1C=CC2 TVEXGJYMHHTVKP-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- LRJNDCOLPPJUEM-UHFFFAOYSA-N 8-iodo-2,2,4,4-tetramethyl-3h-chromene-6-carboxylic acid Chemical compound OC(=O)C1=CC(I)=C2OC(C)(C)CC(C)(C)C2=C1 LRJNDCOLPPJUEM-UHFFFAOYSA-N 0.000 description 1
- WGIPVKFOAZITET-UHFFFAOYSA-N 8-methylnaphthalene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(C)=CC=CC2=C1 WGIPVKFOAZITET-UHFFFAOYSA-N 0.000 description 1
- SHGAZHPCJJPHSC-ZVCIMWCZSA-N 9-cis-retinoic acid Chemical compound OC(=O)/C=C(\C)/C=C/C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-ZVCIMWCZSA-N 0.000 description 1
- 206010000503 Acne cystic Diseases 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 238000006218 Arndt-Eistert homologation reaction Methods 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- KCBAMQOKOLXLOX-BSZYMOERSA-N CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O Chemical compound CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O KCBAMQOKOLXLOX-BSZYMOERSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229940126657 Compound 17 Drugs 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000640876 Homo sapiens Retinoic acid receptor RXR-beta Proteins 0.000 description 1
- 101001132698 Homo sapiens Retinoic acid receptor beta Proteins 0.000 description 1
- 101001132658 Homo sapiens Retinoic acid receptor gamma Proteins 0.000 description 1
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 102000004877 Insulin Human genes 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- ZFMITUMMTDLWHR-UHFFFAOYSA-N Minoxidil Chemical compound NC1=[N+]([O-])C(N)=CC(N2CCCCC2)=N1 ZFMITUMMTDLWHR-UHFFFAOYSA-N 0.000 description 1
- 208000034578 Multiple myelomas Diseases 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 241000315040 Omura Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010035226 Plasma cell myeloma Diseases 0.000 description 1
- 102000013566 Plasminogen Human genes 0.000 description 1
- 108010051456 Plasminogen Proteins 0.000 description 1
- 239000012979 RPMI medium Substances 0.000 description 1
- 102100034253 Retinoic acid receptor RXR-beta Human genes 0.000 description 1
- 102100033909 Retinoic acid receptor beta Human genes 0.000 description 1
- 102100033912 Retinoic acid receptor gamma Human genes 0.000 description 1
- 229910006124 SOCl2 Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 239000013504 Triton X-100 Substances 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 150000003978 alpha-halocarboxylic acids Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- XQIJUNRYEIASNK-UHFFFAOYSA-N amino carbamodithioate Chemical class NSC(N)=S XQIJUNRYEIASNK-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 210000003969 blast cell Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- CAKNZLNLUKXNCC-UHFFFAOYSA-N carbamoyl benzoate Chemical compound NC(=O)OC(=O)C1=CC=CC=C1 CAKNZLNLUKXNCC-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 108091092356 cellular DNA Proteins 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 108700010039 chimeric receptor Proteins 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940127573 compound 38 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- ZPCFOKAQPFCNRR-UHFFFAOYSA-N ethyl 2,2,4,4-tetramethyl-3h-chromene-6-carboxylate Chemical compound O1C(C)(C)CC(C)(C)C2=CC(C(=O)OCC)=CC=C21 ZPCFOKAQPFCNRR-UHFFFAOYSA-N 0.000 description 1
- HFARGRKXXMIIAF-UHFFFAOYSA-N ethyl 2-amino-4-chloro-1h-pyridine-2-carboxylate Chemical compound CCOC(=O)C1(N)NC=CC(Cl)=C1 HFARGRKXXMIIAF-UHFFFAOYSA-N 0.000 description 1
- XNAVBHBEHKEANY-UHFFFAOYSA-N ethyl 3-amino-5-chloro-4h-pyridine-3-carboxylate Chemical compound CCOC(=O)C1(N)CC(Cl)=CN=C1 XNAVBHBEHKEANY-UHFFFAOYSA-N 0.000 description 1
- BMEYIUXRDDPFQU-UHFFFAOYSA-N ethyl 4-amino-2,3,5,6-tetrafluorobenzoate Chemical compound CCOC(=O)C1=C(F)C(F)=C(N)C(F)=C1F BMEYIUXRDDPFQU-UHFFFAOYSA-N 0.000 description 1
- RAIGEAVXXPZKJB-UHFFFAOYSA-N ethyl 4-amino-2-chlorobenzoate Chemical compound CCOC(=O)C1=CC=C(N)C=C1Cl RAIGEAVXXPZKJB-UHFFFAOYSA-N 0.000 description 1
- VFUYFRZMIKZJPM-UHFFFAOYSA-N ethyl 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxylate Chemical compound CC1(C)CCC(C)(C)C=2C1=CC(C(=O)OCC)=CC=2 VFUYFRZMIKZJPM-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000013265 extended release Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 210000003714 granulocyte Anatomy 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 210000003958 hematopoietic stem cell Anatomy 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000000413 hydrolysate Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 1
- 229960004716 idoxuridine Drugs 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002485 inorganic esters Chemical class 0.000 description 1
- 229910001410 inorganic ion Inorganic materials 0.000 description 1
- 229940125396 insulin Drugs 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 230000037356 lipid metabolism Effects 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000004973 liquid crystal related substance Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- JHPAOEXOUXURFL-UHFFFAOYSA-N methyl 2,3,4-trifluorobenzoate Chemical compound COC(=O)C1=CC=C(F)C(F)=C1F JHPAOEXOUXURFL-UHFFFAOYSA-N 0.000 description 1
- 229960003632 minoxidil Drugs 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- 238000004264 monolayer culture Methods 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 230000023603 positive regulation of transcription initiation, DNA-dependent Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 230000030541 receptor transactivation Effects 0.000 description 1
- 238000001403 relative X-ray reflectometry Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 230000036620 skin dryness Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- UYCAUPASBSROMS-AWQJXPNKSA-M sodium;2,2,2-trifluoroacetate Chemical compound [Na+].[O-][13C](=O)[13C](F)(F)F UYCAUPASBSROMS-AWQJXPNKSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000009870 specific binding Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000004114 suspension culture Methods 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 150000003556 thioamides Chemical class 0.000 description 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
- 229960001727 tretinoin Drugs 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 241000701447 unidentified baculovirus Species 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/66—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings being part of condensed ring systems and singly-bound oxygen atoms, bound to the same carbon skeleton
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/81—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/88—Carboxylic acid amides having nitrogen atoms of carboxamide groups bound to an acyclic carbon atom and to a carbon atom of a six-membered aromatic ring wherein at least one ortho-hydrogen atom has been replaced
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
- C07C327/38—Amides of thiocarboxylic acids
- C07C327/48—Amides of thiocarboxylic acids having carbon atoms of thiocarboxamide groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/40—Nitrogen atoms attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/06—Benzothiopyrans; Hydrogenated benzothiopyrans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/10—One of the condensed rings being a six-membered aromatic ring the other ring being six-membered, e.g. tetraline
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Dermatology (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/562,000 US5675024A (en) | 1995-11-22 | 1995-11-22 | Aryl or heteroaryl amides of tetrahydronaphthalene, chroman, thiochroman and 1,2,3,4,-tetrahydroquinoline carboxylic acids, having an electron withdrawing substituent in the aromatic or heteroaromatic moiety, having retinoid-like biological activity |
| PCT/US1996/018580 WO1997019052A1 (en) | 1995-11-22 | 1996-11-18 | Aryl or heteroaryl amides of tetrahydronaphthalene, chroman, thiochroman and 1,2,3,4-tetrahydroquinoline carboxylic acids having retinoid-like biological activity |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL124597A0 IL124597A0 (en) | 1998-12-06 |
| IL124597A true IL124597A (en) | 2001-08-08 |
Family
ID=24244382
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL12459796A IL124597A (en) | 1995-11-22 | 1996-11-18 | Amides of acrylic acids, troaryl, tetrahydronaphthalene, chromium, theochroman and 1,2,3,4 tetrahydroquinoline carboxyls are converted in the aromatic or trohromatic green, electron-withdrawing transducer, having retinal-like biological activity |
Country Status (20)
| Country | Link |
|---|---|
| US (5) | US5675024A (enExample) |
| EP (1) | EP0876330B1 (enExample) |
| JP (1) | JP4112003B2 (enExample) |
| KR (1) | KR100450498B1 (enExample) |
| CN (1) | CN1117070C (enExample) |
| AT (1) | ATE200074T1 (enExample) |
| AU (1) | AU702499B2 (enExample) |
| BR (1) | BR9611758A (enExample) |
| CA (1) | CA2238274C (enExample) |
| DE (1) | DE69612303T2 (enExample) |
| DK (1) | DK0876330T3 (enExample) |
| ES (1) | ES2157470T3 (enExample) |
| GR (1) | GR3035979T3 (enExample) |
| IL (1) | IL124597A (enExample) |
| MX (1) | MX9804087A (enExample) |
| NZ (1) | NZ323581A (enExample) |
| PL (1) | PL186404B1 (enExample) |
| PT (1) | PT876330E (enExample) |
| RU (1) | RU2163906C2 (enExample) |
| WO (1) | WO1997019052A1 (enExample) |
Families Citing this family (76)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5264578A (en) * | 1987-03-20 | 1993-11-23 | Allergan, Inc. | Disubstituted acetylenes bearing heterobicyclic groups and heteroaromatic or phenyl groups having retinoid like activity |
| US5648514A (en) | 1994-12-29 | 1997-07-15 | Allergan | Substituted acetylenes having retinoid-like biological activity |
| US5534641A (en) * | 1994-12-29 | 1996-07-09 | Allergan | Acetylenes disubstituted with 2-tetrahydropyranoxyaryl and aryl or heteroaryl groups having retinoid-like biological activity |
| US5917082A (en) * | 1995-06-06 | 1999-06-29 | Allergan Sales, Inc. | 2,4-pentadienoic acid derivatives having retinoid-like biological activity |
| US5675033A (en) | 1995-06-06 | 1997-10-07 | Allergan | 2,4-pentadienoic acid derivatives having retinoid-like biological activity |
| US5952345A (en) | 1995-09-01 | 1999-09-14 | Allergan Sales, Inc. | Synthesis and use of retinoid compounds having negative hormone and/or antagonist activities |
| US5958954A (en) | 1995-09-01 | 1999-09-28 | Allergan Sales, Inc. | Synthesis and use of retinoid compounds having negative hormone and/or antagonist activities |
| US6008204A (en) | 1995-09-01 | 1999-12-28 | Allergan Sales, Inc. | Synthesis and use of retinoid compounds having negative hormone and/or antagonist activities |
| US6218128B1 (en) | 1997-09-12 | 2001-04-17 | Allergan Sales, Inc. | Methods of identifying compounds having nuclear receptor negative hormone and/or antagonist activities |
| US6942980B1 (en) | 1995-09-01 | 2005-09-13 | Allergan, Inc. | Methods of identifying compounds having nuclear receptor negative hormone and/or antagonist activities |
| US5675024A (en) | 1995-11-22 | 1997-10-07 | Allergan | Aryl or heteroaryl amides of tetrahydronaphthalene, chroman, thiochroman and 1,2,3,4,-tetrahydroquinoline carboxylic acids, having an electron withdrawing substituent in the aromatic or heteroaromatic moiety, having retinoid-like biological activity |
| US20030219832A1 (en) * | 1996-03-11 | 2003-11-27 | Klein Elliott S. | Synthesis and use of retinoid compounds having negative hormone and/or antagonist activities |
| US5877207A (en) * | 1996-03-11 | 1999-03-02 | Allergan Sales, Inc. | Synthesis and use of retinoid compounds having negative hormone and/or antagonist activities |
| HUP0101131A3 (en) * | 1996-06-07 | 2002-04-29 | Procter & Gamble | Anti-inflammatory dihydrobenzopyran derivatives, medicaments containing the same, and their use |
| US5741896A (en) | 1996-06-21 | 1998-04-21 | Allergan | O- or S- substituted tetrahydronaphthalene derivatives having retinoid and/or retinoid antagonist-like biological activity |
| US6555690B2 (en) * | 1996-06-21 | 2003-04-29 | Allergan, Inc. | Alkyl or aryl substituted dihydronaphthalene derivatives having retinoid and/or retinoid antagonist-like biological activity |
| US5763635A (en) * | 1996-06-21 | 1998-06-09 | Allergan | Tetrahydronaphthalene derivatives substituted in the 8 position with alkyhidene groups having retinoid and/or retinoid antagonist-like biological activity |
| US5773594A (en) * | 1996-06-21 | 1998-06-30 | Allergan | Alkyl or aryl substituted dihydronaphthalene derivatives having retinoid and/or retinoid antagonist-like biological activity |
| GB9614347D0 (en) * | 1996-07-09 | 1996-09-04 | Smithkline Beecham Spa | Novel compounds |
| US5739338A (en) * | 1996-11-05 | 1998-04-14 | Allergan | N-aryl substituted tetrahydroquinolines having retinoid agonist, retinoid antagonist or retinoid inverse agonist type biological activity |
| US5728846A (en) | 1996-12-12 | 1998-03-17 | Allergan | Benzo 1,2-g!-chrom-3-ene and benzo 1,2-g!-thiochrom-3-ene derivatives |
| FR2758325B1 (fr) * | 1997-01-16 | 1999-04-09 | Europ De Bioprospective Centre | Composes tetracycliques aromatiques de type retinoide leur procede de preparation et leur utilisation pour la fabrication de compositions pharmaceutiques et cosmetiques |
| WO1999067238A2 (en) | 1998-06-25 | 1999-12-29 | Sepracor, Inc. | Tetrahydroquinoline-indole derivatives antimicrobial agents, their uses and compositions containing them |
| US6197798B1 (en) | 1998-07-21 | 2001-03-06 | Novartis Ag | Amino-benzocycloalkane derivatives |
| AU4222400A (en) * | 1999-04-14 | 2000-11-14 | Allergan Sales, Inc. | Methods and compositions for the treatment and prevention of lung disease |
| US6274608B1 (en) | 1999-04-20 | 2001-08-14 | Novo Nordisk A/S | Compounds, their preparation and use |
| AU3958200A (en) * | 1999-04-20 | 2000-11-02 | Novo Nordisk A/S | New compounds, their preparation and use |
| US6127382A (en) * | 1999-08-16 | 2000-10-03 | Allergan Sales, Inc. | Amines substituted with a tetrahydroquinolinyl group an aryl or heteroaryl group and an alkyl group, having retinoid-like biological activity |
| WO2001042233A1 (en) * | 1999-12-13 | 2001-06-14 | Chugai Seiyaku Kabushiki Kaisha | Optically active chroman and thiochroman derivatives |
| ATE295836T1 (de) * | 2000-01-18 | 2005-06-15 | Novartis Pharma Gmbh | Carboxamide und ihre verwendung als inhibitoren des mikrosomalen triglycerid-transfer-proteins und der apolipoprotein b (apo b) sekretion |
| TWI281911B (en) * | 2000-04-04 | 2007-06-01 | Allergan Inc | Treatment of tumors with RARalpha selective retinoid compounds in combination with other anti-tumor agents |
| CA2416169C (en) | 2000-07-14 | 2008-09-23 | Allergan, Inc. | Compositions containing therapeutically active components having enhanced solubility |
| US6369225B1 (en) | 2000-08-29 | 2002-04-09 | Allergan Sales, Inc. | Compounds having activity as inhibitors of cytochrome P450RAI |
| US6380256B1 (en) | 2000-08-29 | 2002-04-30 | Allergan Sales, Inc. | Compounds having activity as inhibitors of cytochrome P450RAI |
| US6313107B1 (en) | 2000-08-29 | 2001-11-06 | Allergan Sales, Inc. | Methods of providing and using compounds having activity as inhibitors of cytochrome P450RAI |
| US6252090B1 (en) | 2000-08-29 | 2001-06-26 | Allergan Sales, Inc. | Compounds having activity as inhibitors of cytochrome P450RAI |
| CA2464289C (en) * | 2001-10-31 | 2009-09-15 | F. Hoffmann-La Roche Ag | Heterocyclic retinoid compounds |
| US6740676B2 (en) | 2002-03-19 | 2004-05-25 | Allergan, Inc. | 4-[(8-ethynyl, 8-vinyl or 8-ethynyl-methyl)-6-chromanoyl]-benzoic and 2-[4-[(8-ethynyl, 8-vinyl or 8-ethynyl-methyl)-6-chromanoyl]-phenyl]-acetic acid, their esters and salts having cytochrome p450rai inhibitory activity |
| US6620963B1 (en) | 2002-09-19 | 2003-09-16 | Allergan, Inc. | TRICYCLO[6.2.202,7]DODECA-2(7),3,5-TRIEN-4-CARBONYLAMINO-PHENYL AND TRICYCLO[6.2.202,7]DODECA-2(7),3,5-TRIEN-4-CARBONYLAMINO-HETEROARYL AND RELATED COMPOUNDS HAVING RARα RECEPTOR SELECTIVE BIOLOGICAL ACTIVITY |
| WO2004048391A1 (en) * | 2002-11-25 | 2004-06-10 | Amedis Pharmaceuticals Ltd. | Silicon compounds to be used as ligands for retinoid receptors |
| US6683092B1 (en) | 2003-04-09 | 2004-01-27 | Allergan, Inc. | [3-(c5-14alkyl-2-oxo-1,2,3,4-tetrahydro-quinolin-6-yl)-3-oxo-propenyl]-phenyl and [3-(c5-14alkyl-2-oxo-1,2,3,4- tetrahydro-quinolin-6-yl)-3-oxo-propenyl]-heteroaryl derivatives having anti-tumor activity |
| US6734193B1 (en) | 2003-06-03 | 2004-05-11 | Allergan, Inc. | (1,2,3,4-tetrahydroquinolin-8-yl)-heptatrienoic acid derivatives having serum glucose reducing activity |
| BRPI0412259B1 (pt) | 2003-07-22 | 2019-08-20 | Astex Therapeutics Limited | Compostos de 1H-pirazol 3,4-dissubstituídos como moduladores de quinases dependentes de ciclina (CDK), seus usos, processo para a preparação dos mesmos e composição farmacêutica |
| ITTO20030140U1 (it) * | 2003-09-16 | 2005-03-17 | Interfila Srl | Matita cosmetica |
| US7470798B2 (en) | 2003-09-19 | 2008-12-30 | Edison Pharmaceuticals, Inc. | 7,8-bicycloalkyl-chroman derivatives |
| US7226951B2 (en) * | 2003-12-17 | 2007-06-05 | Allergan, Inc. | Compounds having selective cytochrome P450RAI-1 or selective cytochrome P450RAI-2 inhibitory activity and methods of obtaining the same |
| JP4737084B2 (ja) * | 2004-03-12 | 2011-07-27 | 堺化学工業株式会社 | アミド化合物、医薬組成物及びrxr機能調節剤 |
| JP5475234B2 (ja) | 2005-01-21 | 2014-04-16 | アステックス・セラピューティクス・リミテッド | 医薬化合物 |
| US8404718B2 (en) | 2005-01-21 | 2013-03-26 | Astex Therapeutics Limited | Combinations of pyrazole kinase inhibitors |
| AR054425A1 (es) | 2005-01-21 | 2007-06-27 | Astex Therapeutics Ltd | Sales de adicion de piperidin 4-il- amida de acido 4-(2,6-dicloro-benzoilamino) 1h-pirazol-3-carboxilico. |
| AU2006207325B2 (en) | 2005-01-21 | 2012-08-16 | Astex Therapeutics Limited | Pharmaceutical compounds |
| ES2690304T3 (es) | 2005-09-30 | 2018-11-20 | Io Therapeutics, Llc | Tratamiento del cáncer con agonistas específicos de RXR |
| US8628756B2 (en) * | 2005-12-30 | 2014-01-14 | Revance Therapeutics, Inc. | Arginine heteromers for topical administration |
| WO2008020028A1 (en) | 2006-08-16 | 2008-02-21 | Action Medicines, S.L. | 2,5 dihydroxybenzene compounds for the treatment of rosacea |
| JP5284574B2 (ja) * | 2006-10-06 | 2013-09-11 | 財団法人乙卯研究所 | レチノイドプロドラッグ化合物 |
| WO2008044045A1 (en) | 2006-10-12 | 2008-04-17 | Astex Therapeutics Limited | Pharmaceutical combinations |
| EP2073803B1 (en) | 2006-10-12 | 2018-09-19 | Astex Therapeutics Limited | Pharmaceutical combinations |
| CA2703684A1 (en) | 2007-10-31 | 2009-05-07 | Research Foundation Itsuu Laboratory | Retinoid prodrug compound |
| WO2013019626A1 (en) * | 2011-07-29 | 2013-02-07 | Tempero Pharmaceuticals, Inc. | Compounds and methods |
| US10653650B2 (en) | 2011-12-13 | 2020-05-19 | Io Therapeutics, Inc. | Treatment of diseases by concurrently eliciting remyelination effects and immunomodulatory effects using selective RXR agonists |
| CN104114171A (zh) | 2011-12-13 | 2014-10-22 | Io治疗公司 | 使用rxr激动剂的自身免疫紊乱的治疗 |
| CN102727480A (zh) * | 2012-06-14 | 2012-10-17 | 合肥博太医药生物技术发展有限公司 | 视黄酸及其衍生物在制备防治肺纤维化药物中的应用 |
| EP3967305A1 (en) | 2015-03-31 | 2022-03-16 | Syros Pharmaceuticals, Inc. | Methods of stratifying patients for treatment with retinoic acid receptor-alpha agonists |
| HK1255075A1 (zh) | 2015-10-31 | 2019-08-02 | Io治疗公司 | 使用rxr激动剂和甲状腺激素的组合治疗神经系统紊乱 |
| CN115227826A (zh) | 2016-03-10 | 2022-10-25 | Io治疗公司 | Rxr激动剂和甲状腺激素在制备用于治疗自身免疫疾病的药物中的用途 |
| JP7169647B2 (ja) | 2016-03-10 | 2022-11-11 | アイオー セラピューティクス インコーポレイテッド | Rxrアゴニストおよび甲状腺ホルモンの組み合わせでの筋肉障害の治療 |
| AU2017248187B2 (en) | 2016-04-08 | 2023-03-16 | Syros Pharmaceuticals, Inc. | Rara agonists for the treatment of AML and MDS |
| US9868994B2 (en) | 2016-04-08 | 2018-01-16 | Syros Pharmaceuticals, Inc. | Methods of stratifying patients for treatment with retinoic acid receptor-α agonists |
| CA3047433A1 (en) * | 2016-12-14 | 2019-06-21 | Queen's University At Kingston | Compounds and methods for inhibiting cyp26 enzymes |
| EP3684348A4 (en) | 2017-09-20 | 2021-08-18 | IO Therapeutics, Inc. | TREATMENT OF DISEASES WITH ETERS FROM SELECTIVE RXR AGONISTS |
| US11795148B2 (en) | 2017-12-12 | 2023-10-24 | Queen's University At Kingston | Compounds and methods for inhibiting CYP26 enzymes |
| US10966950B2 (en) | 2019-06-11 | 2021-04-06 | Io Therapeutics, Inc. | Use of an RXR agonist in treating HER2+ cancers |
| CN111423405B (zh) * | 2019-12-03 | 2021-11-26 | 浙江工业大学 | 一种合成苯并吡喃3醇衍生物类化合物的方法 |
| CA3242047A1 (en) | 2021-12-07 | 2023-06-15 | Io Therapeutics, Inc. | Use of an rxr agonist in treating drug resistant her2+ cancers |
| MX2024006978A (es) | 2021-12-07 | 2024-07-19 | Io Therapeutics Inc | Uso de un agonista de rxr y taxanos en el tratamiento de cáncer her2+. |
| CN119451672A (zh) * | 2022-06-27 | 2025-02-14 | Io治疗公司 | 四氢萘酚的合成及其用途 |
Family Cites Families (109)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4085091A (en) * | 1976-12-16 | 1978-04-18 | E. I. Dupont De Nemours And Company | Thermally stable, rigid polyesters from thermally stable, rigid dibasic acids and aromatic dihydroxy compounds |
| US4326055A (en) * | 1977-12-22 | 1982-04-20 | Hoffmann-La Roche Inc. | Stilbene derivatives |
| DE2920947A1 (de) * | 1979-05-23 | 1980-12-04 | Bayer Ag | 2-phenyl-alken-1-yl-cyclopropan- carbonsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide und akarizide und zwischenprodukte zu ihrer herstellung |
| EP0047817A3 (de) * | 1980-08-14 | 1982-05-26 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Hydrierte Naphthaline, deren Herstellung und Verwendung sowie derartige Naphthaline enthaltende Gemische |
| CH651034A5 (de) * | 1982-05-12 | 1985-08-30 | Hoffmann La Roche | Chroman-, thiochroman- oder 1,2,3,4-tetrahydrochinolinderivate und ihre verwendung als arzneimittel-wirkstoffe. |
| DK158947C (da) * | 1982-07-06 | 1991-01-21 | Hoffmann La Roche | Tetrahydronaphthalin-,benzofuran- og benzothiophenderivater, fremstilling og anvendelse deraf samt rodenticid indeholdende saadanne derivater |
| US4539154A (en) * | 1983-06-15 | 1985-09-03 | Hoffmann-La Roche Inc. | Polyene compounds |
| EP0130795B1 (en) * | 1983-07-05 | 1988-11-23 | Pfizer Inc. | Carboxylic acid derivatives useful for inhibiting the degradation of cartilage |
| WO1985000806A1 (en) * | 1983-08-08 | 1985-02-28 | Sri International | Benzonorbornenyl, benzopyranyl and benzothiopyranyl retinoic acid analogues |
| FR2562539B1 (fr) * | 1984-04-06 | 1987-04-17 | Chauvin Blache Lab | Nouveaux derives de l'acide vinyl-4 benzoique, leur procede de preparation et leurs applications en therapeutique et comme ligands |
| US4826984A (en) * | 1984-04-09 | 1989-05-02 | The Board Of Regents For The Oklahoma Agricultural And Mechanical College Acting For And On Behalf Of Oklahoma State University | Heteroarotinoid compounds as anticancer agents |
| JPS60222445A (ja) * | 1984-04-19 | 1985-11-07 | Yoshitomi Pharmaceut Ind Ltd | フタル酸化合物 |
| JPS6122046A (ja) * | 1984-07-07 | 1986-01-30 | Koichi Shiyudo | スチルベン誘導体 |
| EP0170105B1 (en) * | 1984-07-07 | 1990-10-17 | Koichi Prof. Dr. Shudo | Benzoic acid derivatives |
| LU85544A1 (fr) * | 1984-09-19 | 1986-04-03 | Cird | Derives heterocycliques aromatiques,leur procede de preparation et leur application dans les domaines therapeutique et cosmetique |
| DE3434946A1 (de) * | 1984-09-22 | 1986-04-03 | Basf Ag, 6700 Ludwigshafen | Diarylacetylene, ihre herstellung und verwendung |
| DE3434942A1 (de) * | 1984-09-22 | 1986-04-03 | Basf Ag, 6700 Ludwigshafen | Tetralin-derivate, ihre herstellung und verwendung |
| DE3434947A1 (de) * | 1984-09-22 | 1986-04-03 | Basf Ag, 6700 Ludwigshafen | Isoxazolcarbonsaeure-derivate, ihre herstellung und verwendung |
| IL80270A0 (en) * | 1985-10-11 | 1987-01-30 | Cird | Naphthalene derivatives,their preparation and pharmaceutical compositions containing them |
| DE3602473A1 (de) * | 1986-01-28 | 1987-07-30 | Basf Ag | Vinylphenolderivate, ihre herstellung und verwendung |
| LU86351A1 (fr) * | 1986-03-12 | 1987-11-11 | Oreal | Composes benzopyrannyl et benzothiopyrannyl benzoiques,leur procede de preparation et leur utilisation en cosmetique et en medecine humaine et veterinaire |
| DE3615157A1 (de) * | 1986-05-05 | 1987-11-12 | Schwabe Willmar Gmbh & Co | 5-arylalkyl-4-alkoxy-2(5h)-furanone, zwischenprodukte und verfahren zu ihrer herstellung sowie ihre anwendung als therapeutische wirkstoffe |
| ZW6587A1 (en) * | 1986-05-13 | 1987-12-02 | Hoffmann La Roche | Tetrahydro naphthanline derivatives |
| ZW7487A1 (en) * | 1986-05-23 | 1987-12-16 | Hoffmann La Roche | Tetrahydronaphthaline and indane derivatives |
| ZW10287A1 (en) * | 1986-07-15 | 1988-01-13 | Hoffmann La Roche | Tetrahydronaphthaline and indane derivatives |
| FR2601670B1 (fr) * | 1986-07-17 | 1988-10-07 | Cird | Nouveaux derives bicycliques aromatiques, leur procede de preparation et leur utilisation en medecine humaine et veterinaire et en cosmetique |
| US4739098A (en) * | 1986-09-22 | 1988-04-19 | Allergan, Inc. | Ethynylphenyl-containing retinoic acid derivatives |
| US4927947A (en) * | 1986-12-24 | 1990-05-22 | Allergan, Inc. | Ethynylheteroaromatic-acids having retinoic acid-like activity |
| NZ222968A (en) * | 1986-12-24 | 1990-05-28 | Allergan Inc | Ethynylheteroaromatic derivatives and medicaments |
| US4923884A (en) * | 1986-12-24 | 1990-05-08 | Allergan, Inc. | Ethynylheteroaromatic-acids having retinoic acid-like activity |
| US4914097A (en) * | 1987-02-25 | 1990-04-03 | Mitsubishi Kasei Corporation | N-indanyl carboxamide derivative and agricultural/horticultural fungicide containing the derivative as active ingredient |
| US5149705A (en) * | 1987-03-13 | 1992-09-22 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a tetralin group and having retinoid like activity |
| CA1305480C (en) * | 1987-03-20 | 1992-07-21 | Roshantha A.S. Chandraratna | Disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups having retinoid like activity |
| US5264578A (en) * | 1987-03-20 | 1993-11-23 | Allergan, Inc. | Disubstituted acetylenes bearing heterobicyclic groups and heteroaromatic or phenyl groups having retinoid like activity |
| US5234926A (en) * | 1987-03-20 | 1993-08-10 | Allergan, Inc. | Disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups having retinoid like activity |
| US5089509A (en) * | 1988-09-15 | 1992-02-18 | Allergan, Inc. | Disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups having retinoid like activity |
| US5602130A (en) * | 1987-03-20 | 1997-02-11 | Allergan | Disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups having retinoid like activity |
| US4810804A (en) * | 1987-03-26 | 1989-03-07 | Allergan, Inc. | Acetylenes disubstituted with a phenyl group and a heterobicyclic group having retinoid-like activity |
| IL85896A (en) | 1987-04-06 | 1993-01-14 | Riker Laboratories Inc | Substituted di-tert.- butylphenols and pharmaceutical compositions containing them |
| DE3726806A1 (de) | 1987-08-12 | 1989-02-23 | Basf Ag | Arylphosphorderivate, ihre herstellung und verwendung |
| ZA885192B (en) * | 1987-08-19 | 1989-04-26 | Hoffmann La Roche | Pharmaceutical preparations |
| CA1298309C (en) * | 1987-11-06 | 1992-03-31 | Michael Klaus | Benzocycloheptene derivatives |
| AU618590B2 (en) * | 1988-04-11 | 1992-01-02 | Allergan, Inc. | Tetralin esters of phenols or benzoic acids having retinoid like activity |
| US5231113A (en) * | 1988-04-11 | 1993-07-27 | Allergan, Inc. | Tetralin esters of phenols or benzoic acids having retinoid like activity |
| US5015658A (en) * | 1988-06-29 | 1991-05-14 | Allergan, Inc. | Thiochroman esters of phenols and terephthallates having retinoid-like activity |
| US4895868A (en) * | 1988-06-29 | 1990-01-23 | Allergan, Inc. | Thiochroman esters of phenols and terephthallates having retinoid-like activity |
| AU626881B2 (en) * | 1988-07-14 | 1992-08-13 | F. Hoffmann-La Roche Ag | Benzofused heterocyclics used as pharmaceuticals |
| US5068252A (en) * | 1989-07-26 | 1991-11-26 | Allergan, Inc. | Methods of using phenylethenyl compounds having retinoid-like activity |
| US4992468A (en) * | 1989-07-26 | 1991-02-12 | Allergan, Inc. | Phenylethenyl compounds having retinoid-like activity |
| DE3926148A1 (de) | 1989-08-08 | 1991-02-28 | Basf Ag | Diarylacetylene, ihre herstellung und verwendung |
| US5272156A (en) * | 1989-09-19 | 1993-12-21 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a 2-substituted 1,2,3,4-tetrahydroquinolinyl group having retinoid-like activity |
| US5053523A (en) * | 1989-09-19 | 1991-10-01 | Allergan, Inc. | Ethynyl-chroman compounds |
| US5399561A (en) * | 1989-09-19 | 1995-03-21 | Allergan, Inc. | Acetylenes disubstituted with a phenyl or heteroaryl group and a 2-oxochromanyl, 2-oxothiochromanyl or 2-oxo-1,2,3,4-tetrahydro-quinolinyl group having retinoid-like biological activity |
| US5183827A (en) * | 1989-09-19 | 1993-02-02 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a 2-substituted chromanyl, thiochromanyl or 1,2,3,4-tetrahydroquinolinyl group having retinoid-like activity |
| US5248777A (en) * | 1989-09-19 | 1993-09-28 | Allergan, Inc. | Process and intermediates for preparing compounds having a disubstituted acetylene moiety and retinoic acid-like biological activity |
| US4980369A (en) * | 1989-09-19 | 1990-12-25 | Allergan, Inc. | Acetylenes disubstituted with a phenyl group and a 2-substituted chromanyl or thiochromanyl group having retinoid-like activity |
| US5045551A (en) * | 1989-09-19 | 1991-09-03 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a 2-substituted chromanyl, thiochromanyl or 1,2,3,4-tetrahydroquinolinyl group having retinoid-like activity |
| US5023341A (en) * | 1989-09-19 | 1991-06-11 | Allergan, Inc. | Compounds having a disubstituted acetylene moiety and retinoic acid-like biological activity |
| US5162546A (en) * | 1989-09-19 | 1992-11-10 | Allergan, Inc. | Acetylenes disubstituted with a phenyl group and a 2-substituted chromanyl, thiochromanyl or 1,2,3,4-tetrahydroquinolinyl group having retinoid-like activity |
| US5006550A (en) * | 1989-12-29 | 1991-04-09 | Allergan, Inc. | Chroman esters of phenols and benzoic acids having retinoid-like activity |
| US5175185A (en) * | 1989-12-29 | 1992-12-29 | Allergan, Inc. | Acetylenes disubstituted with a heteroaromatic group and a substituted phenyl group having retinoid like activity |
| US5013744B1 (en) * | 1989-12-29 | 1994-09-20 | Allegran Inc | Acetylenes disubstituted with a pyridinyl group and a substituted phenyl group having retinoid like activity |
| US5264456A (en) * | 1989-12-29 | 1993-11-23 | Allergan, Inc. | Acetylenes disubstituted with a furyl group and a substituted phenyl group having retinoid like activity |
| US5202471A (en) * | 1990-02-06 | 1993-04-13 | Allergan, Inc. | Alkyl, alkoxy and thioalkoxy substituted diphenyl acetylenes having retinoid like activity |
| HU210300B (en) | 1990-03-20 | 1995-03-28 | Shionogi & Co | Process for producing bicyclic amide derivatives |
| EP0525109A4 (en) * | 1990-04-16 | 1993-06-30 | Rhone-Poulenc Rorer International (Holdings) Inc. | Styryl-substituted monocyclic and bicyclic heteroaryl compounds which inhibit egf receptor tyrosine kinase |
| LU87821A1 (fr) * | 1990-10-12 | 1992-05-25 | Cird Galderma | Composes bi-aromatiques,et leur utilisation en medecine humaine et veterinaire et en cosmetique |
| US5563292A (en) * | 1990-10-17 | 1996-10-08 | Schering Corporation | Lipoxygenase inhibitors |
| DE69214632T2 (de) * | 1991-02-13 | 1997-05-28 | Allergan Inc | 7-phenylethynyl-substituierte chromane und thiochromane mit retinoid-ähnlicher biologischer aktivität |
| US5134159A (en) * | 1991-03-26 | 1992-07-28 | Allergan, Inc. | 7-chromanyl esters of phenols and benzoic acids having retinoid-like activity |
| JP3157523B2 (ja) * | 1991-03-26 | 2001-04-16 | アラーガン、インコーポレイテッド | レチノイド様生物学的活性を有する7位にヘテロアリールエチニル置換基を有するクロマンおよびチオクロマン |
| FR2676440B1 (fr) | 1991-05-15 | 1993-07-30 | Cird Galderma | Nouveaux composes aromatiques derives d'imine, leur procede de preparation et leur utilisation en medecine humaine et veterinaire ainsi qu'en cosmetique. |
| EP0626955A1 (en) * | 1992-02-11 | 1994-12-07 | Allergan, Inc. | Heteroaryl substituted phenylethenyl compounds having retinoid-like biological activity |
| US5326898A (en) * | 1992-02-11 | 1994-07-05 | Allergan, Inc. | Substituted phenylethenyl compounds having retinoid-like biological activity |
| US5420145A (en) * | 1993-03-22 | 1995-05-30 | Koichi Shudo | Carboxylic acid derivative |
| EP0617020A1 (en) * | 1992-04-02 | 1994-09-28 | Shudo, Koichi, Prof. Dr. | Carboxylic acid derivatives having retinoic acid-like activity |
| US5324840A (en) * | 1992-06-11 | 1994-06-28 | Allergan, Inc. | Method of treatment with compounds having retinoid-like activity and reduced skin toxicity and lacking teratogenic effects |
| US5466861A (en) * | 1992-11-25 | 1995-11-14 | Sri International | Bridged bicyclic aromatic compounds and their use in modulating gene expression of retinoid receptors |
| US5455265A (en) * | 1993-02-11 | 1995-10-03 | Allergan, Inc. | Method of treatment with compounds having selective agonist-like activity on RXR retinoid receptors |
| US5399586A (en) * | 1993-03-11 | 1995-03-21 | Allergan, Inc. | Treatment of mammals afflicted with tumors with compounds having RXR retinoid receptor agonist activity |
| EP0619116A3 (en) | 1993-04-05 | 1994-11-23 | Hoechst Japan | Use of synthetic retinoids for osteopathy. |
| US5344959A (en) * | 1993-05-18 | 1994-09-06 | Allergan, Inc. | Tetrahydronaphthyl and cyclopropyl substituted 1,3-butadienes having retinoid-like activity |
| US5475022A (en) * | 1993-10-18 | 1995-12-12 | Allergan, Inc. | Phenyl or heteroaryl and tetrahydronaphthyl substituted diene compounds having retinoid like biological activity |
| FR2713635B1 (fr) | 1993-12-15 | 1996-01-05 | Cird Galderma | Nouveaux composés propynyl bi-aromatiques, compositions pharmaceutiques et cosmétiques les contenant et utilisations. |
| US5426118A (en) * | 1993-12-30 | 1995-06-20 | Allergan, Inc. | [4-(1,2-epoxycyclohexanyl)but-3-en-1-ynyl]aromatic and heteroaromatic acids and derivatives having retinoid-like biological activity |
| US5451605A (en) * | 1993-12-30 | 1995-09-19 | Allergan, Inc. | 1,2-epoxycyclohexanyl and bicyclic aromatic substituted ethyne compounds having retinoid-like biological activity |
| US5470999A (en) * | 1993-12-30 | 1995-11-28 | Allergan, Inc. | Cyclohexene and bicyclic aromatic substituted ethyne compounds having retinoid-like biological activity |
| US5648385A (en) * | 1994-01-03 | 1997-07-15 | Bristol-Myers Squibb Co. | Retinoid-like compounds |
| CA2138000A1 (en) * | 1994-01-03 | 1995-07-04 | John E. Starrett, Jr. | Retinoid-like compounds |
| CA2137997A1 (en) * | 1994-01-03 | 1995-07-04 | John E. Starrett, Jr. | Retinoid-like compounds |
| US5498755A (en) * | 1994-08-23 | 1996-03-12 | Chandraratna; Roshantha A. | Disubstituted aryl and heteroaryl imines having retinoid-like biological activity |
| IL116259A (en) | 1994-12-19 | 2000-07-16 | American Cyanamid Co | Analogs of 9-cis retinoic acid and their use |
| US5498795A (en) * | 1994-12-29 | 1996-03-12 | Allergan, Inc. | Acetylenes disubstituted with hydroxyaryl and aryl or heteroaryl groups having retinoid-like biological activity |
| US5543534A (en) * | 1994-12-29 | 1996-08-06 | Allergan | Acetylenes disubstituted with a 5 substituted tetrahydronaphthyl group and with an aryl or heteroaryl groups having retinoid-like biological activity |
| US5514825A (en) * | 1994-12-29 | 1996-05-07 | Allergan, Inc. | Acetylenes disubstituted with a 5 substituted tetrahydronaphthyl group and with an aryl or heteroaryl group having retinoid-like biological activity |
| US5556996A (en) * | 1994-12-29 | 1996-09-17 | Allergan | Oxiranyls disubstituted with a phenyl group and a substituted chromanyl or tetrahydroquinolinyl group having retinoid like activity |
| US5534641A (en) * | 1994-12-29 | 1996-07-09 | Allergan | Acetylenes disubstituted with 2-tetrahydropyranoxyaryl and aryl or heteroaryl groups having retinoid-like biological activity |
| US5599967A (en) * | 1994-12-29 | 1997-02-04 | Allergan | Acetylenes disubstituted with a 5 substituted tetrahydronaphthyl group and with an aryl of heteroaryl group having retinoid-like biological activity |
| US5618931A (en) * | 1994-12-29 | 1997-04-08 | Allergan | Acetylenes disubstituted with a 5 substituted dihydronaphthyl group and with an aryl or heteroaryl group having retinoid-like biological activity |
| US5489584A (en) * | 1994-12-29 | 1996-02-06 | Allergan, Inc. | Acetylenes disubstituted with a 5-amino or substituted 5-amino substituted tetrahydronaphthyl group and with an aryl or heteroaryl group having retinoid-like biological activity |
| US5648514A (en) * | 1994-12-29 | 1997-07-15 | Allergan | Substituted acetylenes having retinoid-like biological activity |
| US5618943A (en) * | 1994-12-29 | 1997-04-08 | Allergan | Acetylenes disubstituted with a 5 OXO substituted tetrahydronaphthyl group and with an aryl or heteroaryl group having retinoid-like biological activity |
| US5559248A (en) * | 1995-04-05 | 1996-09-24 | Bristol-Myers Squibb Co. | Retinoid-like heterocycles |
| US5616712A (en) * | 1995-05-16 | 1997-04-01 | Allergan | Acetylenes disubstituted with a phenyl or heteroaryl group and a 2-thio-1,2,3,4-tetrahdroquinolinyl, 2-alkylthio-3,4-dihydroquinolinyl or 2-alkoxy-3,4-dihydroquinolinyl group having retinoid-like biological activity |
| US5675033A (en) * | 1995-06-06 | 1997-10-07 | Allergan | 2,4-pentadienoic acid derivatives having retinoid-like biological activity |
| AU7598596A (en) * | 1995-11-01 | 1997-05-22 | Allergan, Inc. | Sulfides, sulfoxides and sulfones disubstituted with a tetrahydronaphthalenyl, chromanyl, thiochromanyl or tetrahydroquinolinyl and substituted phenyl or heteroaryl group, having retinoid-like biological activity |
| US5663357A (en) * | 1995-11-22 | 1997-09-02 | Allergan | Substituted heteroarylamides having retinoid-like biological activity |
| US5675024A (en) | 1995-11-22 | 1997-10-07 | Allergan | Aryl or heteroaryl amides of tetrahydronaphthalene, chroman, thiochroman and 1,2,3,4,-tetrahydroquinoline carboxylic acids, having an electron withdrawing substituent in the aromatic or heteroaromatic moiety, having retinoid-like biological activity |
| US5688957A (en) * | 1995-12-29 | 1997-11-18 | Allergan | (3"-thioxacyclohex-1"-enyl)!-but-3'-ene-1'-ynyl!aryl and (3"-thioxacyclohex-1"-enyl)!-but-3'-ene-1'-ynyl!heteroaryl carboxylic acids and esters having retinoid-like biological activity |
-
1995
- 1995-11-22 US US08/562,000 patent/US5675024A/en not_active Expired - Lifetime
-
1996
- 1996-11-18 WO PCT/US1996/018580 patent/WO1997019052A1/en not_active Ceased
- 1996-11-18 PT PT96941408T patent/PT876330E/pt unknown
- 1996-11-18 NZ NZ323581A patent/NZ323581A/xx unknown
- 1996-11-18 IL IL12459796A patent/IL124597A/en not_active IP Right Cessation
- 1996-11-18 JP JP51985297A patent/JP4112003B2/ja not_active Expired - Lifetime
- 1996-11-18 BR BR9611758A patent/BR9611758A/pt not_active Application Discontinuation
- 1996-11-18 AU AU10560/97A patent/AU702499B2/en not_active Ceased
- 1996-11-18 CA CA002238274A patent/CA2238274C/en not_active Expired - Fee Related
- 1996-11-18 ES ES96941408T patent/ES2157470T3/es not_active Expired - Lifetime
- 1996-11-18 PL PL96327457A patent/PL186404B1/pl not_active IP Right Cessation
- 1996-11-18 CN CN96199714A patent/CN1117070C/zh not_active Expired - Lifetime
- 1996-11-18 DE DE69612303T patent/DE69612303T2/de not_active Expired - Lifetime
- 1996-11-18 RU RU98111757/04A patent/RU2163906C2/ru not_active IP Right Cessation
- 1996-11-18 DK DK96941408T patent/DK0876330T3/da active
- 1996-11-18 AT AT96941408T patent/ATE200074T1/de not_active IP Right Cessation
- 1996-11-18 EP EP96941408A patent/EP0876330B1/en not_active Expired - Lifetime
- 1996-11-19 KR KR10-1998-0703817A patent/KR100450498B1/ko not_active Expired - Fee Related
-
1997
- 1997-09-04 US US08/923,864 patent/US5856490A/en not_active Expired - Fee Related
-
1998
- 1998-05-22 MX MX9804087A patent/MX9804087A/es unknown
- 1998-10-15 US US09/173,574 patent/US6034244A/en not_active Expired - Fee Related
-
2000
- 2000-01-25 US US09/491,176 patent/US6124455A/en not_active Expired - Fee Related
- 2000-08-04 US US09/634,733 patent/US6342602B1/en not_active Expired - Fee Related
-
2001
- 2001-05-31 GR GR20010400830T patent/GR3035979T3/el not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| RU2163906C2 (ru) | 2001-03-10 |
| AU1056097A (en) | 1997-06-11 |
| US5675024A (en) | 1997-10-07 |
| DE69612303T2 (de) | 2001-09-20 |
| US6124455A (en) | 2000-09-26 |
| US5856490A (en) | 1999-01-05 |
| IL124597A0 (en) | 1998-12-06 |
| ATE200074T1 (de) | 2001-04-15 |
| DK0876330T3 (da) | 2001-08-06 |
| CA2238274C (en) | 2007-07-24 |
| PL186404B1 (pl) | 2004-01-30 |
| MX9804087A (es) | 1998-09-30 |
| US6342602B1 (en) | 2002-01-29 |
| PL327457A1 (en) | 1998-12-07 |
| EP0876330A1 (en) | 1998-11-11 |
| JP2000500499A (ja) | 2000-01-18 |
| CN1117070C (zh) | 2003-08-06 |
| DE69612303D1 (de) | 2001-05-03 |
| NZ323581A (en) | 1999-07-29 |
| CA2238274A1 (en) | 1997-05-29 |
| BR9611758A (pt) | 1999-03-30 |
| EP0876330B1 (en) | 2001-03-28 |
| KR19990071543A (ko) | 1999-09-27 |
| ES2157470T3 (es) | 2001-08-16 |
| AU702499B2 (en) | 1999-02-25 |
| US6034244A (en) | 2000-03-07 |
| KR100450498B1 (ko) | 2004-11-20 |
| PT876330E (pt) | 2001-09-28 |
| CN1214675A (zh) | 1999-04-21 |
| WO1997019052A1 (en) | 1997-05-29 |
| GR3035979T3 (en) | 2001-08-31 |
| JP4112003B2 (ja) | 2008-07-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6342602B1 (en) | Aryl or heteroaryl amides of tetrahydronaphthalene, chroman, thichroman and 1,2,3,4-tetrahydroquinolinecarboxlic acids, having an electron withdrawing substituent in the aromatic or heteroaromatic moiety, having retinoid-like biological activity | |
| US5965606A (en) | Methods of treatment with compounds having RAR.sub.α receptor specific or selective activity | |
| US6320047B1 (en) | Substituted aryl or heteroarylamides having retinoid-like biological activity |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FF | Patent granted | ||
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| MM9K | Patent not in force due to non-payment of renewal fees |