IE48168B1 - Halogenated hydroxyphenoxypyridine intermediates - Google Patents
Halogenated hydroxyphenoxypyridine intermediatesInfo
- Publication number
- IE48168B1 IE48168B1 IE74/84A IE748478A IE48168B1 IE 48168 B1 IE48168 B1 IE 48168B1 IE 74/84 A IE74/84 A IE 74/84A IE 748478 A IE748478 A IE 748478A IE 48168 B1 IE48168 B1 IE 48168B1
- Authority
- IE
- Ireland
- Prior art keywords
- compounds
- compound
- radical
- mixture
- formula
- Prior art date
Links
- 239000000543 intermediate Substances 0.000 title abstract description 8
- JOEQIEKMEQPYQE-UHFFFAOYSA-N 2-phenoxypyridin-3-ol Chemical class OC1=CC=CN=C1OC1=CC=CC=C1 JOEQIEKMEQPYQE-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 100
- 150000003839 salts Chemical group 0.000 claims abstract description 25
- 239000000460 chlorine Substances 0.000 claims abstract description 18
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 16
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 13
- 239000001257 hydrogen Substances 0.000 claims abstract description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000011737 fluorine Substances 0.000 claims abstract description 5
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 17
- 229910052751 metal Chemical class 0.000 claims description 9
- 239000002184 metal Chemical class 0.000 claims description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- LXXDBPUREVMTMI-UHFFFAOYSA-N 4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenol Chemical class C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 LXXDBPUREVMTMI-UHFFFAOYSA-N 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- NMJNUBBLJFJUKE-UHFFFAOYSA-N 4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenol Chemical class C1=CC(O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl NMJNUBBLJFJUKE-UHFFFAOYSA-N 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 230000001335 demethylating effect Effects 0.000 claims 1
- -1 alkyl radical Chemical group 0.000 abstract description 41
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 22
- 230000002363 herbicidal effect Effects 0.000 abstract description 12
- 150000002367 halogens Chemical class 0.000 abstract description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract description 7
- 229910052736 halogen Inorganic materials 0.000 abstract description 7
- 150000003222 pyridines Chemical class 0.000 abstract description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 5
- 150000003254 radicals Chemical class 0.000 abstract description 5
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 abstract description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract description 3
- QPAXMPYBNSHKAK-UHFFFAOYSA-N chloro(difluoro)methane Chemical compound F[C](F)Cl QPAXMPYBNSHKAK-UHFFFAOYSA-N 0.000 abstract description 3
- 125000001424 substituent group Chemical group 0.000 abstract description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 abstract description 2
- 241001148683 Zostera marina Species 0.000 abstract description 2
- 125000003342 alkenyl group Chemical group 0.000 abstract description 2
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 2
- 125000005843 halogen group Chemical group 0.000 abstract description 2
- 239000004009 herbicide Substances 0.000 abstract description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 abstract description 2
- 125000003917 carbamoyl group Chemical class [H]N([H])C(*)=O 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 66
- 238000002360 preparation method Methods 0.000 description 47
- 239000000243 solution Substances 0.000 description 44
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 42
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- 239000003921 oil Substances 0.000 description 32
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 21
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 19
- 241000196324 Embryophyta Species 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- 239000002904 solvent Substances 0.000 description 17
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 13
- 239000012259 ether extract Substances 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 12
- 238000009835 boiling Methods 0.000 description 11
- VLJIVLGVKMTBOD-UHFFFAOYSA-N 2-chloro-5-(trichloromethyl)pyridine Chemical compound ClC1=CC=C(C(Cl)(Cl)Cl)C=N1 VLJIVLGVKMTBOD-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 230000006378 damage Effects 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- 238000004809 thin layer chromatography Methods 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- JFZJMSDDOOAOIV-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=C(Cl)N=C1 JFZJMSDDOOAOIV-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 8
- 125000003545 alkoxy group Chemical group 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 244000025254 Cannabis sativa Species 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 7
- 239000000839 emulsion Substances 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- XVBWGQSXLITICX-UHFFFAOYSA-N 2,3-dichloro-5-(trichloromethyl)pyridine Chemical compound ClC1=CC(C(Cl)(Cl)Cl)=CN=C1Cl XVBWGQSXLITICX-UHFFFAOYSA-N 0.000 description 6
- 235000007320 Avena fatua Nutrition 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000003085 diluting agent Substances 0.000 description 6
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 6
- ODNBVEIAQAZNNM-UHFFFAOYSA-N 1-(6-chloroimidazo[1,2-b]pyridazin-3-yl)ethanone Chemical compound C1=CC(Cl)=NN2C(C(=O)C)=CN=C21 ODNBVEIAQAZNNM-UHFFFAOYSA-N 0.000 description 5
- GUNJVIDCYZYFGV-UHFFFAOYSA-K Antimony trifluoride Inorganic materials F[Sb](F)F GUNJVIDCYZYFGV-UHFFFAOYSA-K 0.000 description 5
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000004094 surface-active agent Substances 0.000 description 5
- ABNQGNFVSFKJGI-UHFFFAOYSA-N 2,3-dichloro-5-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CN=C(Cl)C(Cl)=C1 ABNQGNFVSFKJGI-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- 244000075850 Avena orientalis Species 0.000 description 4
- 241000209763 Avena sativa Species 0.000 description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 4
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000012025 fluorinating agent Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 229940126062 Compound A Drugs 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 3
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- NWGKJDSIEKMTRX-AAZCQSIUSA-N Sorbitan monooleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-AAZCQSIUSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 239000002361 compost Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 244000038559 crop plants Species 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 3
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 3
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 3
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- QHMQWEPBXSHHLH-UHFFFAOYSA-N sulfur tetrafluoride Chemical compound FS(F)(F)F QHMQWEPBXSHHLH-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- UUODQIKUTGWMPT-UHFFFAOYSA-N 2-fluoro-5-(trifluoromethyl)pyridine Chemical compound FC1=CC=C(C(F)(F)F)C=N1 UUODQIKUTGWMPT-UHFFFAOYSA-N 0.000 description 2
- ISNRJFOYJNIKTN-UHFFFAOYSA-N 3-bromo-2-chloro-5-methylpyridine Chemical compound CC1=CN=C(Cl)C(Br)=C1 ISNRJFOYJNIKTN-UHFFFAOYSA-N 0.000 description 2
- VGVHNLRUAMRIEW-UHFFFAOYSA-N 4-methylcyclohexan-1-one Chemical compound CC1CCC(=O)CC1 VGVHNLRUAMRIEW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 244000075634 Cyperus rotundus Species 0.000 description 2
- 235000016854 Cyperus rotundus Nutrition 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 240000004296 Lolium perenne Species 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 240000002439 Sorghum halepense Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- XIMFCGSNSKXPBO-UHFFFAOYSA-N ethyl 2-bromobutanoate Chemical compound CCOC(=O)C(Br)CC XIMFCGSNSKXPBO-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000004533 oil dispersion Substances 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical class CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- POEBLBFTVMMIRE-UHFFFAOYSA-N 1,2-dichloro-5-(trichloromethyl)-2h-pyrimidine Chemical compound ClC1N=CC(C(Cl)(Cl)Cl)=CN1Cl POEBLBFTVMMIRE-UHFFFAOYSA-N 0.000 description 1
- SKPKJHRHRNVOEX-UHFFFAOYSA-N 2,3,3-trichloro-4-(difluoromethyl)-2h-pyridine Chemical compound FC(F)C1=CC=NC(Cl)C1(Cl)Cl SKPKJHRHRNVOEX-UHFFFAOYSA-N 0.000 description 1
- ZGYMLUQWQWHXMI-UHFFFAOYSA-N 2,3-bis(trichloromethyl)pyridine Chemical compound ClC(Cl)(Cl)C1=CC=CN=C1C(Cl)(Cl)Cl ZGYMLUQWQWHXMI-UHFFFAOYSA-N 0.000 description 1
- GDFCUTHAIBYLSX-UHFFFAOYSA-N 2,5-dichloro-3-(difluoromethyl)pyridine Chemical compound FC(F)C1=CC(Cl)=CN=C1Cl GDFCUTHAIBYLSX-UHFFFAOYSA-N 0.000 description 1
- AQIHDXGKQHFBNW-UHFFFAOYSA-N 2-(4-hydroxyphenoxy)propanoic acid Chemical class OC(=O)C(C)OC1=CC=C(O)C=C1 AQIHDXGKQHFBNW-UHFFFAOYSA-N 0.000 description 1
- NJWIMFZLESWFIM-UHFFFAOYSA-N 2-(chloromethyl)pyridine Chemical compound ClCC1=CC=CC=N1 NJWIMFZLESWFIM-UHFFFAOYSA-N 0.000 description 1
- ATRQECRSCHYSNP-UHFFFAOYSA-N 2-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=CC=N1 ATRQECRSCHYSNP-UHFFFAOYSA-N 0.000 description 1
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 1
- GNNKEUJOCAJOBW-UHFFFAOYSA-N 2-bromo-3-chloro-5-methylpyridine Chemical compound CC1=CN=C(Br)C(Cl)=C1 GNNKEUJOCAJOBW-UHFFFAOYSA-N 0.000 description 1
- WMJJNNLRGDZCAJ-UHFFFAOYSA-N 2-bromo-5-methylpyridine 2-chloro-5-(trichloromethyl)pyridine Chemical compound BrC1=NC=C(C=C1)C.ClC1=NC=C(C=C1)C(Cl)(Cl)Cl WMJJNNLRGDZCAJ-UHFFFAOYSA-N 0.000 description 1
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 1
- TZKVGCQBQQFWOV-UHFFFAOYSA-N 2-chloro-3-(trichloromethyl)pyridine Chemical compound ClC1=NC=CC=C1C(Cl)(Cl)Cl TZKVGCQBQQFWOV-UHFFFAOYSA-N 0.000 description 1
- JNAYPRPPXRWGQO-UHFFFAOYSA-N 2-chloropropanenitrile Chemical compound CC(Cl)C#N JNAYPRPPXRWGQO-UHFFFAOYSA-N 0.000 description 1
- MSJLMQTXVKCUCD-UHFFFAOYSA-M 2-dodecylisoquinolin-2-ium;bromide Chemical compound [Br-].C1=CC=CC2=C[N+](CCCCCCCCCCCC)=CC=C21 MSJLMQTXVKCUCD-UHFFFAOYSA-M 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- CBQDTCDOVVBGMN-UHFFFAOYSA-N 2-methyl-3-octylphenol Chemical compound CCCCCCCCC1=CC=CC(O)=C1C CBQDTCDOVVBGMN-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- DUIOKRXOKLLURE-UHFFFAOYSA-N 2-octylphenol Chemical compound CCCCCCCCC1=CC=CC=C1O DUIOKRXOKLLURE-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- HPDOBXJPYGEFSY-UHFFFAOYSA-N 3-chloro-2-(4-methoxyphenoxy)-5-(trifluoromethyl)pyridine Chemical compound C1=CC(OC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl HPDOBXJPYGEFSY-UHFFFAOYSA-N 0.000 description 1
- GDSROTVTTLUHCO-UHFFFAOYSA-N 3-chloro-2-fluoro-5-(trifluoromethyl)pyridine Chemical compound FC1=NC=C(C(F)(F)F)C=C1Cl GDSROTVTTLUHCO-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 1
- UAWMVMPAYRWUFX-UHFFFAOYSA-N 6-Chloronicotinic acid Chemical compound OC(=O)C1=CC=C(Cl)N=C1 UAWMVMPAYRWUFX-UHFFFAOYSA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241001621841 Alopecurus myosuroides Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000207894 Convolvulus arvensis Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 241000380130 Ehrharta erecta Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241000207890 Ipomoea purpurea Species 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- 235000003228 Lactuca sativa Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- GOFBFCNUGMDJRY-UHFFFAOYSA-N NC1=NC=C(C=C1)C.NC1=NC=C(C=C1Br)C Chemical compound NC1=NC=C(C=C1)C.NC1=NC=C(C=C1Br)C GOFBFCNUGMDJRY-UHFFFAOYSA-N 0.000 description 1
- GRJQUQURXOWNOG-UHFFFAOYSA-N NC1=NC=C(C=C1)C.NC1=NC=C(C=C1Cl)C Chemical compound NC1=NC=C(C=C1)C.NC1=NC=C(C=C1Cl)C GRJQUQURXOWNOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 244000292693 Poa annua Species 0.000 description 1
- 244000292697 Polygonum aviculare Species 0.000 description 1
- 235000006386 Polygonum aviculare Nutrition 0.000 description 1
- 244000234609 Portulaca oleracea Species 0.000 description 1
- 235000001855 Portulaca oleracea Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 241000003690 Xanthium spinosum Species 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 125000001931 aliphatic group Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229920005550 ammonium lignosulfonate Polymers 0.000 description 1
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JIJAYWGYIDJVJI-UHFFFAOYSA-N butyl naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)OCCCC)=CC=CC2=C1 JIJAYWGYIDJVJI-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 229940125844 compound 46 Drugs 0.000 description 1
- 229940127113 compound 57 Drugs 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 239000012649 demethylating agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- WNFUWONOILPKNX-UHFFFAOYSA-N ethyl 2-bromo-3-methylbutanoate Chemical compound CCOC(=O)C(Br)C(C)C WNFUWONOILPKNX-UHFFFAOYSA-N 0.000 description 1
- ORSIRXYHFPHWTN-UHFFFAOYSA-N ethyl 2-bromopentanoate Chemical compound CCCC(Br)C(=O)OCC ORSIRXYHFPHWTN-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 125000005447 octyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- WROZTZHKRRNHBS-UHFFFAOYSA-N phenyl propaneperoxoate Chemical compound CCC(=O)OOC1=CC=CC=C1 WROZTZHKRRNHBS-UHFFFAOYSA-N 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000009666 routine test Methods 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Plant Pathology (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3403977 | 1977-08-12 | ||
| GB4454177 | 1977-10-26 | ||
| GB523078 | 1978-02-09 | ||
| IE1518/78A IE48166B1 (en) | 1977-08-12 | 1978-07-27 | Herbicidal pyridine compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IE48168B1 true IE48168B1 (en) | 1984-10-17 |
Family
ID=27254605
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE74/84A IE48168B1 (en) | 1977-08-12 | 1978-07-27 | Halogenated hydroxyphenoxypyridine intermediates |
| IE73/84A IE48167B1 (en) | 1977-08-12 | 1978-07-27 | Trihalomethylpyridine intermediates |
| IE1518/78A IE48166B1 (en) | 1977-08-12 | 1978-07-27 | Herbicidal pyridine compounds |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE73/84A IE48167B1 (en) | 1977-08-12 | 1978-07-27 | Trihalomethylpyridine intermediates |
| IE1518/78A IE48166B1 (en) | 1977-08-12 | 1978-07-27 | Herbicidal pyridine compounds |
Country Status (20)
| Country | Link |
|---|---|
| US (5) | US4317913A (enExample) |
| EP (4) | EP0001473B1 (enExample) |
| JP (3) | JPS5432479A (enExample) |
| AU (2) | AU572085B2 (enExample) |
| BR (1) | BR7808677A (enExample) |
| CA (5) | CA1205805A (enExample) |
| DD (1) | DD139988A5 (enExample) |
| DE (4) | DE2862490D1 (enExample) |
| DK (2) | DK157296C (enExample) |
| ES (3) | ES472501A1 (enExample) |
| GR (1) | GR64540B (enExample) |
| HU (1) | HU189134B (enExample) |
| IE (3) | IE48168B1 (enExample) |
| IL (3) | IL62140A (enExample) |
| IT (1) | IT1099592B (enExample) |
| MY (1) | MY101299A (enExample) |
| NZ (2) | NZ188041A (enExample) |
| PT (1) | PT68410A (enExample) |
| WO (1) | WO1979000094A1 (enExample) |
| YU (3) | YU40919B (enExample) |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| JPS54119476A (en) * | 1978-03-10 | 1979-09-17 | Ishihara Sangyo Kaisha Ltd | 4-(5-fluoromethyl-2-pyridyloxy)phenoxyalkanecarbocyic acid derivatives and their preparation |
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| US4491468A (en) * | 1977-07-22 | 1985-01-01 | The Dow Chemical Company | Herbicidal trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanenitriles and derivatives thereof |
| US4753673A (en) * | 1977-07-22 | 1988-06-28 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| US4628099A (en) * | 1977-07-22 | 1986-12-09 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy propanoic acid chlorides |
| DE2862490D1 (en) * | 1977-08-12 | 1988-04-21 | Ici Plc | Phenoxypyridine compound |
| JPS5461182A (en) * | 1977-10-20 | 1979-05-17 | Ishihara Sangyo Kaisha Ltd | 2-phenoxy-5-trifluoromethylpyridine compounds |
| JPS5461183A (en) * | 1977-10-21 | 1979-05-17 | Ishihara Sangyo Kaisha Ltd | 2-substituted-5-trifluoromethyl pyridine compounds |
| DE2755536A1 (de) * | 1977-12-13 | 1979-06-21 | Ciba Geigy Ag | Neue herbizid und pflanzenregulatorisch wirksame pyridyloxy-phenoxy-propionsaeurederivate |
| CH650493A5 (en) * | 1977-12-24 | 1985-07-31 | Hoechst Ag | D-(+)-alpha-phenoxypropionic acid derivatives |
| JPS5492970A (en) * | 1977-12-29 | 1979-07-23 | Ciba Geigy Ag | Pyridyloxyyphenoxyypropionic acid derivative* its manufacture and herbicide or plant growth regulating composition |
| WO1979000624A1 (en) * | 1978-02-15 | 1979-09-06 | Ici Ltd | Herbicidal derivatives of 2-(4(2-pyridyloxy)phenoxy)propane,processes for preparing them,and herbicidal compositions containing them |
| DE2967486D1 (en) * | 1978-03-01 | 1985-08-29 | Ici Plc | Mixtures of herbicidal pyridyloxyphenoxypropanoic acid derivatives with other herbicides, and processes of killing unwanted plants therewith |
| EP0003890B2 (en) * | 1978-03-01 | 1990-04-04 | Imperial Chemical Industries Plc | Herbicidal pyridine compounds and herbicidal compositions containing them |
| JPS54132433U (enExample) * | 1978-03-03 | 1979-09-13 | ||
| JPS54163582A (en) * | 1978-06-09 | 1979-12-26 | Ishihara Mining & Chemical Co | 22phenoxyy55 trifluoromethypiridine compound |
| ATE1284T1 (de) * | 1978-06-29 | 1982-07-15 | Ciba-Geigy Ag | Herbizid wirksame, optisch aktive r(+)-dichlorpyridyloxy-al pha-phenoxy-propionsaeure-propargylester, verfahren zu ihrer herstellung und deren verwendung in mitteln zur unkrautbekaempfung. |
| JPS5543017A (en) * | 1978-09-22 | 1980-03-26 | Ishihara Sangyo Kaisha Ltd | Preparation of 2-chloro-5-trichloromethylpyridine |
| EP0013474B1 (en) * | 1978-12-07 | 1983-06-29 | Imperial Chemical Industries Plc | Preparation of 2-chloro-5-trifluoromethylpyridine |
| NZ192948A (en) * | 1979-03-09 | 1982-02-23 | Ishihara Sangyo Kaisha | Preparation of beta-trifuloromethyl-pyridine derivatives directly from beta-picoline |
| JPS55149114U (enExample) * | 1979-04-13 | 1980-10-27 | ||
| DE3062601D1 (en) * | 1979-06-20 | 1983-05-11 | Ici Plc | Pyridine derivatives, processes for preparing them, herbicidal compositions containing them and methods of killing plants therewith |
| JPS5629573A (en) * | 1979-08-16 | 1981-03-24 | Daikin Ind Ltd | Preparation of halogeno-trifluoromethyl-pyridine |
| JPS5690060A (en) * | 1979-12-24 | 1981-07-21 | Ishihara Sangyo Kaisha Ltd | 2-amino-trifluoromethylpyridine derivative and its preparation |
| JPS56125369A (en) * | 1980-03-07 | 1981-10-01 | Ishihara Sangyo Kaisha Ltd | Preparation of 3-halogeno-5-trifluoromethylpyridine compound |
| EP0040478A1 (en) * | 1980-05-15 | 1981-11-25 | Imperial Chemical Industries Plc | Process for preparing pyridine derivatives and intermediates useful in the process |
| WO1982000400A1 (en) * | 1980-07-30 | 1982-02-18 | Smith L | Method for selectively controlling grassy weeds in rice |
| EP0058173B1 (en) * | 1980-08-26 | 1984-12-05 | Ici Australia Limited | Process for the synthesis of aryloxy derivatives |
| PH17279A (en) * | 1980-10-15 | 1984-07-06 | Ciba Geigy | Novel alpha-(pyridyl-2-oxy-phenoxy)-propionic acid derivatives and their use as herbicides and/or regulators of plant growth |
| DE3170423D1 (en) * | 1980-11-26 | 1985-06-13 | Hoffmann La Roche | Oxime esters, processes for their preparation, their use and compositions containing these esters |
| US4330321A (en) * | 1981-03-16 | 1982-05-18 | The Dow Chemical Company | Compounds and method for selectively controlling grassy weeds in broadleaved crops |
| US4511571A (en) * | 1981-10-20 | 1985-04-16 | Ciba Geigy Corporation | N-(2-Pyridyloxyphenyl)-N'-benzoyl ureas, pesticidal compositions containing same and pesticidal methods of use |
| US4505743A (en) * | 1981-12-31 | 1985-03-19 | Ciba-Geigy Corporation | α-[4-(3-Fluoro-5'-halopyridyl-2'-oxy)-phenoxy]-propionic acid derivatives having herbicidal activity |
| DE3205150A1 (de) * | 1982-02-13 | 1983-08-18 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Pyridinderivate, ihre herstellung und verwendung |
| US4518416A (en) * | 1982-06-04 | 1985-05-21 | Bayer Aktiengesellschaft | Certain trimethyl silyl-lower-alkyl esters of pyridyloxy-phenoxy-lower alkanoic acids, compositions containing same and herbicidal method of use |
| IL68822A (en) * | 1982-06-18 | 1990-07-12 | Dow Chemical Co | Pyridyl(oxy/thio)phenoxy compounds,herbicidal compositions and methods of using them |
| USRE33478E (en) * | 1982-06-18 | 1990-12-11 | The Dow Chemical Company | Pyridyl(oxy/thio)phenoxy compounds herbicidal compositions and methods |
| US4851539A (en) * | 1982-06-18 | 1989-07-25 | The Dow Chemical Company | 2,3-Difluoropyridine and 3-fluoro-2-pyridinyloxyphenol compounds |
| US4480102A (en) * | 1982-07-23 | 1984-10-30 | The Dow Chemical Company | 2,3-Difluoro-5-(trifluoromethyl)pyridine and methods of making and using the same |
| US4473696A (en) | 1982-10-07 | 1984-09-25 | Ici Americas Inc. | Synthesis of 2-substituted-5-methyl-pyridines |
| IL70307A (en) * | 1982-11-26 | 1987-02-27 | Dow Chemical Co | Preparation of(trifluoromethyl)pyridines |
| US4650875A (en) * | 1983-05-09 | 1987-03-17 | The Dow Chemical Company | Preparation of (trifluoromethyl)pyridines |
| US4590279A (en) * | 1982-11-26 | 1986-05-20 | The Dow Chemical Company | Preparation of (trifluoromethyl)pyridines under liquid phase conditions |
| US4640703A (en) | 1983-12-06 | 1987-02-03 | Ciba-Geigy Corporation | 2-phenoxypropionic acid cyanamides as herbicides |
| US4547577A (en) * | 1984-06-08 | 1985-10-15 | The Dow Chemical Company | Preparation of (trifluoromethyl)pyridines |
| FR2569191B1 (fr) * | 1984-08-20 | 1987-07-10 | Solvay | Procede pour la preparation de derives chlores de composes pyridiniques et initiateurs radicalaires utilises dans ce procede |
| US4563530A (en) * | 1984-10-29 | 1986-01-07 | The Dow Chemical Company | Preparation of fluoropyridines |
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| ZA862977B (en) * | 1985-05-02 | 1987-12-30 | Dow Chemical Co | Haloalkoxy anilide derivatives of 2-(4-heterocyclic oxyphenoxy)alkanoic acids and their use as herbicides |
| DE3607080A1 (de) * | 1986-03-04 | 1987-09-10 | Mannesmann Ag | Vorrichtung fuer den papiertransport in druckern mit balkenfoermigem druckwiderlager, insbesondere in matrixdruckern |
| US5186735A (en) * | 1986-03-07 | 1993-02-16 | Dowelanco | Derivatives of 4-((aryloxy)phenoxy)alkenols and their herbicidal uses |
| US5034050A (en) * | 1988-02-01 | 1991-07-23 | Dowelanco | Derivatives of 4-((aryloxy)phenoxy)alkenols and their herbicidal uses |
| US5156667A (en) * | 1986-03-07 | 1992-10-20 | Dowelanco | Derivatives of 4-((aryloxy)phenoxy)alkenols and their herbicidal uses |
| US4731108A (en) * | 1986-03-07 | 1988-03-15 | The Dow Chemical Company | Derivatives of 4-((aryloxy)phenoxy)alkenols and their herbicidal uses |
| JPS61280477A (ja) * | 1986-06-06 | 1986-12-11 | Ishihara Sangyo Kaisha Ltd | 4−(5−フルオロメチル−2−ピリジルオキシ)フエノキシアルカンカルボン酸およびその誘導体 |
| PT86297B (pt) * | 1986-12-05 | 1990-11-07 | Du Pont | Processo para a preparacao de derivados do acido ariloxibenzenoacetico e de composicoes herbicidas que os contem |
| GB8630847D0 (en) * | 1986-12-24 | 1987-02-04 | Ici Plc | Chemical compounds |
| US4897481A (en) * | 1988-05-31 | 1990-01-30 | The Dow Chemical Company | Process for the minimization of racemization in the preparation of optically active ((aryloxy)phenoxy)propionate herbicides |
| HU208311B (en) * | 1989-11-02 | 1993-09-28 | Alkaloida Vegyeszeti Gyar | Resolving process for producing enantiomers of 2-/4-(5-trifluoromethyl-2-pyridyloxy)-phenoxy/-propanoic acid |
| JPH0566178U (ja) * | 1992-02-15 | 1993-08-31 | 松下電工株式会社 | 蝶番による扉の取付構造 |
| JPH0578867U (ja) * | 1992-03-30 | 1993-10-26 | 松下電工株式会社 | 蝶番による扉の取付装置 |
| IL109104A (en) * | 1993-03-26 | 1998-08-16 | Shell Int Research | History of pyridine from wool - 2,6 Preparation and use as herbicides containing them |
| DE4429465A1 (de) * | 1994-08-19 | 1996-02-22 | Bayer Ag | Verfahren zur Herstellung von 2-Halogenpyridinaldehyden und neue 2-Halogenpyridinaldehyde |
| US7125880B1 (en) | 1995-06-06 | 2006-10-24 | Pfizer Inc. | Corticotropin releasing factor antagonists |
| CA2222204C (en) | 1995-06-06 | 2002-02-19 | Pfizer Inc. | Process for converting 2,4-dichloropyridines into 2-aryloxy-4-chloropyridines |
| JP4682492B2 (ja) * | 2001-09-21 | 2011-05-11 | パナソニック株式会社 | 回転検出装置 |
| WO2005105747A1 (en) * | 2004-04-26 | 2005-11-10 | Dow Agrosciences Llc | VAPOR PHASE CATALYTIC CHLORINATION OF β-PICOLINE |
| EP1987718A1 (de) * | 2007-04-30 | 2008-11-05 | Bayer CropScience AG | Verwendung von Pyridin-2-oxy-3-carbonamiden als Safener |
| CN102452977A (zh) * | 2010-10-28 | 2012-05-16 | 宁波大学 | 2-氯-5-三氯甲基吡啶的制备方法 |
| ES2632454T3 (es) | 2013-06-14 | 2017-09-13 | Cheminova A/S | Un procedimiento de producción de 2,3-dicloro-5-(triclorometil)piridina |
| US20150284341A1 (en) * | 2014-04-07 | 2015-10-08 | Catylix, Inc. | Fluoroalkyl-substituted derivatives of pyridine, pyrimidine, and pyrazine |
| CN109232400B (zh) * | 2018-11-22 | 2020-10-27 | 中触媒新材料股份有限公司 | 一种连续化合成2,3-二氯-5-三氟甲基吡啶的方法 |
Family Cites Families (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2516402A (en) * | 1945-09-04 | 1950-07-25 | Purdue Research Foundation | Fluoromethylpyridines |
| US2679453A (en) * | 1952-10-10 | 1954-05-25 | Charles H Brett | Method and composition for the control of undesired vegetation |
| US3418323A (en) * | 1961-11-15 | 1968-12-24 | Dow Chemical Co | 2-chloro-6-(trichloromethyl)pyridine compounds |
| US3297556A (en) * | 1962-11-28 | 1967-01-10 | Olin Mathieson | Manufacture of 2-chloropyridine using photolytic light |
| US3244722A (en) * | 1964-01-28 | 1966-04-05 | Dow Chemical Co | Certain ethers of (trichloromethyl) pyridine compounds |
| NL132136C (enExample) * | 1964-08-05 | |||
| US3461125A (en) * | 1965-01-11 | 1969-08-12 | Merck & Co Inc | Process for preparing chloroalkyl thiazoles,pyrimidines and pyridines |
| US3420833A (en) * | 1967-09-08 | 1969-01-07 | Dow Chemical Co | Vapor phase production of polychlorinated compounds |
| US3732230A (en) * | 1970-12-07 | 1973-05-08 | Dow Chemical Co | Liquid phase polychlorination of pyridine hydrochlorides |
| US3755329A (en) * | 1970-12-22 | 1973-08-28 | Du Pont | Nitrogen-heterocyclylgold(i) compounds |
| GB1424359A (en) * | 1972-05-04 | 1976-02-11 | Ici Ltd | Herbicidal process |
| DE2223894C3 (de) * | 1972-05-17 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Herbizide Mittel auf Basis von Phenoxycarbonsäurederivaten |
| AR208500A1 (es) | 1972-06-14 | 1977-02-15 | Merck & Co Inc | Procedimiento para la preparacion de derivados de oxazolo(4,5-b)-piridinas |
| US3974166A (en) * | 1973-07-10 | 1976-08-10 | Ciba-Geigy Corporation | Process for the manufacture of bromopyridines |
| CS185694B2 (en) * | 1974-07-17 | 1978-10-31 | Ishihara Sangyo Kaisha | Herbicidal agent |
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
| US4038396A (en) * | 1975-02-24 | 1977-07-26 | Merck & Co., Inc. | Anti-inflammatory oxazole[4,5-b]pyridines |
| JPS51142537A (en) * | 1975-05-30 | 1976-12-08 | Ishihara Sangyo Kaisha Ltd | A herbicide |
| GB1512189A (en) * | 1975-10-29 | 1978-05-24 | Ishihara Mining & Chemical Co | Herbicidal composition and method of use thereof |
| NL7612668A (nl) * | 1976-01-06 | 1977-07-08 | Dow Chemical Co | Werkwijze voor het bereiden van nieuwe organo- fosforusverbindingen. |
| CH622169A5 (en) * | 1976-07-23 | 1981-03-31 | Ciba Geigy Ag | Herbicidal composition containing, as active ingredient, pyridyloxyphenoxyalkanecarboxylic acid derivatives |
| US4133675A (en) * | 1976-07-23 | 1979-01-09 | Ciba-Geigy Corporation | Pyridyloxy-phenoxy-alkanecarboxylic acid derivatives which are effective as herbicides and as agents regulating plant growth |
| AU529649B2 (en) * | 1977-02-17 | 1983-06-16 | Dow Chemical Company, The | Trifluoromethyl pyridinyl (oxy/thio) phenols |
| EP0000176B1 (de) * | 1977-06-29 | 1981-09-16 | Ciba-Geigy Ag | Pyridyloxy-phenoxy-alkancarbonsäurederivate, Verfahren zu deren Herstellung, und deren Verwendung als Herbizide oder als pflanzenwachstumsregulierende Mittel |
| MX5595E (es) * | 1977-07-21 | 1983-11-04 | Ishihara Sangyo Kaisha | Proceso para la preparacion de derivados del acido 4-(5-fluorometil-2-piridiloxi)-fenoxialcancarboxilico |
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| JPS54119476A (en) * | 1978-03-10 | 1979-09-17 | Ishihara Sangyo Kaisha Ltd | 4-(5-fluoromethyl-2-pyridyloxy)phenoxyalkanecarbocyic acid derivatives and their preparation |
| US4753673A (en) * | 1977-07-22 | 1988-06-28 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| DE2862490D1 (en) * | 1977-08-12 | 1988-04-21 | Ici Plc | Phenoxypyridine compound |
| JPS5461182A (en) * | 1977-10-20 | 1979-05-17 | Ishihara Sangyo Kaisha Ltd | 2-phenoxy-5-trifluoromethylpyridine compounds |
| JPS5461183A (en) * | 1977-10-21 | 1979-05-17 | Ishihara Sangyo Kaisha Ltd | 2-substituted-5-trifluoromethyl pyridine compounds |
| CH650493A5 (en) * | 1977-12-24 | 1985-07-31 | Hoechst Ag | D-(+)-alpha-phenoxypropionic acid derivatives |
| BE862325A (fr) * | 1977-12-27 | 1978-06-27 | Ciba Geigy | Nouveaux derives d'acide pyridyloxy-phenoxypropionique ayant une action herbicide et phytoregulatrice |
| JPS5492970A (en) * | 1977-12-29 | 1979-07-23 | Ciba Geigy Ag | Pyridyloxyyphenoxyypropionic acid derivative* its manufacture and herbicide or plant growth regulating composition |
| GB1599783A (en) * | 1978-02-15 | 1981-10-07 | Ici Ltd | Partial chlorination of 3-methyl pyridine |
| EP0003648A3 (en) * | 1978-02-15 | 1979-09-05 | Imperial Chemical Industries Plc | 4-aryloxy-substituted phenoxypropionamide derivatives useful as herbicides, compositions containing them, and processes for making them |
| DE2967486D1 (en) * | 1978-03-01 | 1985-08-29 | Ici Plc | Mixtures of herbicidal pyridyloxyphenoxypropanoic acid derivatives with other herbicides, and processes of killing unwanted plants therewith |
| JPS54144375A (en) * | 1978-04-27 | 1979-11-10 | Ishihara Sangyo Kaisha Ltd | 4-(5-trifluoromethyl-2-pyridyloxy)phenoxyalkane derivative and herbicide containing the same |
| JPS5543017A (en) * | 1978-09-22 | 1980-03-26 | Ishihara Sangyo Kaisha Ltd | Preparation of 2-chloro-5-trichloromethylpyridine |
| US4249009A (en) * | 1979-01-29 | 1981-02-03 | Reilly Tar & Chemical Corp. | Processes for preparing 2-chloro-5-trifluoromethylpyridine |
| NZ192948A (en) * | 1979-03-09 | 1982-02-23 | Ishihara Sangyo Kaisha | Preparation of beta-trifuloromethyl-pyridine derivatives directly from beta-picoline |
| US4309548A (en) * | 1981-01-19 | 1982-01-05 | The Dow Chemical Company | Chlorination of 2-chloro-5-trichloromethylpyridine |
| JPS5840947A (ja) * | 1981-09-04 | 1983-03-10 | Oki Electric Ind Co Ltd | チャンネル多重化方式 |
| US4565568A (en) * | 1982-06-18 | 1986-01-21 | The Dow Chemical Company | Pyridyl(oxy/thio)phenoxy compounds, herbicidal compositions and methods |
-
1978
- 1978-07-26 DE DE8080201077T patent/DE2862490D1/de not_active Expired
- 1978-07-26 EP EP78300203A patent/EP0001473B1/en not_active Expired
- 1978-07-26 DE DE8383110864T patent/DE2862491D1/de not_active Expired
- 1978-07-26 DE DE7878300203T patent/DE2862492D1/de not_active Expired
- 1978-07-26 EP EP80103907A patent/EP0021453B1/en not_active Expired
- 1978-07-26 EP EP83110864A patent/EP0107866B1/en not_active Expired
- 1978-07-26 EP EP80201077A patent/EP0028870B1/en not_active Expired
- 1978-07-26 DE DE8080103907T patent/DE2862462D1/de not_active Expired
- 1978-07-27 IE IE74/84A patent/IE48168B1/en not_active IP Right Cessation
- 1978-07-27 IE IE73/84A patent/IE48167B1/en not_active IP Right Cessation
- 1978-07-27 IE IE1518/78A patent/IE48166B1/en not_active IP Right Cessation
- 1978-08-02 NZ NZ188041A patent/NZ188041A/xx unknown
- 1978-08-02 NZ NZ192231A patent/NZ192231A/xx unknown
- 1978-08-03 AU AU38596/78A patent/AU572085B2/en not_active Expired
- 1978-08-07 IL IL62140A patent/IL62140A/xx not_active IP Right Cessation
- 1978-08-07 IL IL55300A patent/IL55300A/xx active IP Right Grant
- 1978-08-09 HU HU78IE843A patent/HU189134B/hu unknown
- 1978-08-10 WO PCT/GB1978/000008 patent/WO1979000094A1/en not_active Ceased
- 1978-08-10 PT PT68410A patent/PT68410A/pt unknown
- 1978-08-10 YU YU1927/78A patent/YU40919B/xx unknown
- 1978-08-10 BR BR7808677A patent/BR7808677A/pt unknown
- 1978-08-11 DD DD78207242A patent/DD139988A5/de unknown
- 1978-08-11 ES ES472501A patent/ES472501A1/es not_active Expired
- 1978-08-11 GR GR56980A patent/GR64540B/el unknown
- 1978-08-11 CA CA 474506 patent/CA1205805A/xx not_active Expired
- 1978-08-11 IT IT26761/78A patent/IT1099592B/it active
- 1978-08-11 CA CA000309182A patent/CA1246080A/en not_active Expired
- 1978-08-12 JP JP9862178A patent/JPS5432479A/ja active Granted
- 1978-08-14 DK DK357878A patent/DK157296C/da not_active IP Right Cessation
- 1978-12-19 ES ES476133A patent/ES476133A1/es not_active Expired
- 1978-12-19 ES ES476134A patent/ES476134A1/es not_active Expired
-
1979
- 1979-08-17 CA CA000334016A patent/CA1142524A/en not_active Expired
-
1980
- 1980-08-27 US US06/181,806 patent/US4317913A/en not_active Expired - Lifetime
- 1980-08-27 US US06/181,876 patent/US4324627A/en not_active Expired - Lifetime
-
1981
- 1981-02-15 IL IL62140A patent/IL62140A0/xx unknown
-
1982
- 1982-09-30 US US06/431,373 patent/US4508907A/en not_active Expired - Lifetime
- 1982-12-01 YU YU2672/82A patent/YU40960B/xx unknown
- 1982-12-01 YU YU2670/82A patent/YU40959B/xx unknown
-
1984
- 1984-03-27 AU AU26149/84A patent/AU584066B2/en not_active Expired
-
1985
- 1985-02-06 US US06/698,690 patent/US4555575A/en not_active Expired - Lifetime
-
1986
- 1986-03-26 US US06/843,839 patent/US4925947A/en not_active Expired - Lifetime
- 1986-06-06 CA CA000511078A patent/CA1218065A/en not_active Expired
-
1987
- 1987-04-15 MY MYPI87000487A patent/MY101299A/en unknown
- 1987-05-21 DK DK259487A patent/DK259487D0/da not_active Application Discontinuation
-
1988
- 1988-01-08 CA CA000556182A patent/CA1260001A/en not_active Expired
- 1988-03-22 JP JP6593688A patent/JPS6425760A/ja active Granted
- 1988-03-22 JP JP6593788A patent/JPS6463572A/ja active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE48168B1 (en) | Halogenated hydroxyphenoxypyridine intermediates | |
| US5374604A (en) | Herbicidal 2,6-substituted pyridines | |
| TWI286548B (en) | Benzoylpyridine derivative or its salt, fungicide containing it as an active ingredient, its production process and intermediate for producing it | |
| CA1244441A (en) | 2(4-pyridyl-2-oxyphenoxy) propanol compounds | |
| US4184041A (en) | 2-Substituted-5-trifluoromethylpyridine compounds | |
| US4565568A (en) | Pyridyl(oxy/thio)phenoxy compounds, herbicidal compositions and methods | |
| US4308053A (en) | Certain 2-pyridinyloxy-N-lower-alkane-sulfonyl benzamides and their use as herbicides | |
| GB1599122A (en) | 2-phenoxy-5-trifluoromethylpyridine compounds and their use in the production of herbicides | |
| US4246419A (en) | Herbicidal compounds | |
| KR830000333B1 (ko) | 제초성 피리딘 화합물의 제조방법 | |
| EP0004433B1 (en) | Herbicidal 2-(p-substituted-phenoxy)-pyridines and process for preparing them | |
| JPH0433788B2 (enExample) | ||
| HU185767B (en) | Herbicide compositions containing pyridine derivatives as active agents and process for producing the active agents | |
| SI8212672A8 (sl) | Postopek za pripravo piridinskih spojin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK9A | Patent expired |