IE42137B1 - Compositions containing piperidyl xanthenes,thioxanthenes and dibenzozepins - Google Patents
Compositions containing piperidyl xanthenes,thioxanthenes and dibenzozepinsInfo
- Publication number
- IE42137B1 IE42137B1 IE2398/75A IE239875A IE42137B1 IE 42137 B1 IE42137 B1 IE 42137B1 IE 2398/75 A IE2398/75 A IE 2398/75A IE 239875 A IE239875 A IE 239875A IE 42137 B1 IE42137 B1 IE 42137B1
- Authority
- IE
- Ireland
- Prior art keywords
- chloro
- hydrogen
- compound according
- mol
- methyl
- Prior art date
Links
- -1 piperidyl xanthenes Chemical class 0.000 title claims abstract description 28
- 239000000203 mixture Substances 0.000 title claims description 56
- 150000005075 thioxanthenes Chemical class 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 33
- 238000000034 method Methods 0.000 claims abstract description 25
- 230000000561 anti-psychotic effect Effects 0.000 claims abstract description 12
- 231100000252 nontoxic Toxicity 0.000 claims abstract description 11
- 230000003000 nontoxic effect Effects 0.000 claims abstract description 11
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 6
- 239000001257 hydrogen Substances 0.000 claims description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims description 30
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 24
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 20
- 208000027776 Extrapyramidal disease Diseases 0.000 claims description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 19
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 18
- 239000001301 oxygen Substances 0.000 claims description 18
- 229910052760 oxygen Inorganic materials 0.000 claims description 18
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 13
- NCYNKWQXFADUOZ-UHFFFAOYSA-N 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one Chemical compound C1=CC=C2C(=O)OS(=O)(=O)C2=C1 NCYNKWQXFADUOZ-UHFFFAOYSA-N 0.000 claims description 12
- 235000019260 propionic acid Nutrition 0.000 claims description 12
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 12
- 150000001408 amides Chemical class 0.000 claims description 11
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 239000011777 magnesium Substances 0.000 claims description 7
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 claims description 6
- 239000003937 drug carrier Substances 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 5
- 150000002431 hydrogen Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 229910052749 magnesium Inorganic materials 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims description 3
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 claims description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 150000001263 acyl chlorides Chemical class 0.000 claims description 2
- 150000001347 alkyl bromides Chemical class 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 5
- 239000000460 chlorine Substances 0.000 claims 5
- 229910052801 chlorine Inorganic materials 0.000 claims 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 3
- 229910052794 bromium Inorganic materials 0.000 claims 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 2
- 239000005864 Sulphur Substances 0.000 claims 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims 2
- 239000011737 fluorine Substances 0.000 claims 2
- 229910052731 fluorine Inorganic materials 0.000 claims 2
- CPNAKTVMAXLKKO-UHFFFAOYSA-N 4-(2-chloroxanthen-9-ylidene)-1-methylpiperidine;methanesulfonic acid Chemical compound CS(O)(=O)=O.C1CN(C)CCC1=C1C2=CC(Cl)=CC=C2OC2=CC=CC=C21 CPNAKTVMAXLKKO-UHFFFAOYSA-N 0.000 claims 1
- 240000008100 Brassica rapa Species 0.000 claims 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 claims 1
- CAXBJKFBIPJTRB-UHFFFAOYSA-M [Cl-].CN1CCCCC1[Mg+] Chemical compound [Cl-].CN1CCCCC1[Mg+] CAXBJKFBIPJTRB-UHFFFAOYSA-M 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 abstract description 9
- 238000006243 chemical reaction Methods 0.000 abstract description 8
- 241001465754 Metazoa Species 0.000 abstract description 6
- JNELGWHKGNBSMD-UHFFFAOYSA-N xanthone powder Natural products C1=CC=C2C(=O)C3=CC=CC=C3OC2=C1 JNELGWHKGNBSMD-UHFFFAOYSA-N 0.000 abstract description 4
- YRHRIQCWCFGUEQ-UHFFFAOYSA-N thioxanthen-9-one Chemical class C1=CC=C2C(=O)C3=CC=CC=C3SC2=C1 YRHRIQCWCFGUEQ-UHFFFAOYSA-N 0.000 abstract description 3
- 150000007964 xanthones Chemical class 0.000 abstract description 2
- 208000024891 symptom Diseases 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 122
- 239000000243 solution Substances 0.000 description 67
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 57
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 40
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 33
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 21
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 20
- 239000000284 extract Substances 0.000 description 19
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- 239000007818 Grignard reagent Substances 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 10
- 150000004795 grignard reagents Chemical class 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 239000003814 drug Substances 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 229940098779 methanesulfonic acid Drugs 0.000 description 7
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 235000011054 acetic acid Nutrition 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 239000012280 lithium aluminium hydride Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- QTOOYVGXYKLUNG-UHFFFAOYSA-N 4-(2-chloroxanthen-9-ylidene)piperidine Chemical compound C12=CC(Cl)=CC=C2OC2=CC=CC=C2C1=C1CCNCC1 QTOOYVGXYKLUNG-UHFFFAOYSA-N 0.000 description 5
- 239000005711 Benzoic acid Substances 0.000 description 5
- 102000015554 Dopamine receptor Human genes 0.000 description 5
- 108050004812 Dopamine receptor Proteins 0.000 description 5
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 239000000164 antipsychotic agent Substances 0.000 description 5
- 235000010233 benzoic acid Nutrition 0.000 description 5
- 229940093499 ethyl acetate Drugs 0.000 description 5
- 235000019439 ethyl acetate Nutrition 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 238000010626 work up procedure Methods 0.000 description 5
- JFRMYMMIJXLMBB-UHFFFAOYSA-N xanthydrol Chemical compound C1=CC=C2C(O)C3=CC=CC=C3OC2=C1 JFRMYMMIJXLMBB-UHFFFAOYSA-N 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 4
- 239000012259 ether extract Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 230000003902 lesion Effects 0.000 description 4
- 150000002688 maleic acid derivatives Chemical class 0.000 description 4
- 239000006188 syrup Substances 0.000 description 4
- 235000020357 syrup Nutrition 0.000 description 4
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 3
- OVZSYTCZMSZVHZ-UHFFFAOYSA-N 4-(2-bromoxanthen-9-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC(Br)=CC=C2OC2=CC=CC=C21 OVZSYTCZMSZVHZ-UHFFFAOYSA-N 0.000 description 3
- QUXRAOQDUJFWIA-UHFFFAOYSA-N 4-(2-chloroxanthen-9-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC(Cl)=CC=C2OC2=CC=CC=C21 QUXRAOQDUJFWIA-UHFFFAOYSA-N 0.000 description 3
- IWNPWQRBFNOGHM-UHFFFAOYSA-N 9h-thioxanthen-9-ol Chemical compound C1=CC=C2C(O)C3=CC=CC=C3SC2=C1 IWNPWQRBFNOGHM-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229940025084 amphetamine Drugs 0.000 description 3
- 229940005529 antipsychotics Drugs 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 3
- 229960001076 chlorpromazine Drugs 0.000 description 3
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 3
- 229940045803 cuprous chloride Drugs 0.000 description 3
- YKGMKSIHIVVYKY-UHFFFAOYSA-N dabrafenib mesylate Chemical compound CS(O)(=O)=O.S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 YKGMKSIHIVVYKY-UHFFFAOYSA-N 0.000 description 3
- 229960003638 dopamine Drugs 0.000 description 3
- 230000003291 dopaminomimetic effect Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 150000004678 hydrides Chemical class 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 239000011976 maleic acid Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- UHDMWWNTXDVAEZ-UHFFFAOYSA-N 1-methyl-4-[2-(trifluoromethyl)xanthen-9-ylidene]piperidine Chemical compound C1CN(C)CCC1=C1C2=CC(C(F)(F)F)=CC=C2OC2=CC=CC=C21 UHDMWWNTXDVAEZ-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- BQDNFXRLGVGWRP-UHFFFAOYSA-N 2,6-difluorothioxanthen-9-one Chemical compound C1=C(F)C=C2C(=O)C3=CC=C(F)C=C3SC2=C1 BQDNFXRLGVGWRP-UHFFFAOYSA-N 0.000 description 2
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- YESXXPJHOUAICR-UHFFFAOYSA-N 3-fluorothioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC=C(F)C=C3SC2=C1 YESXXPJHOUAICR-UHFFFAOYSA-N 0.000 description 2
- GRDFBQYTISLLEI-UHFFFAOYSA-N 4-(2,6-difluorothioxanthen-9-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC(F)=CC=C2SC2=CC(F)=CC=C21 GRDFBQYTISLLEI-UHFFFAOYSA-N 0.000 description 2
- UHGZJXZINNENOT-UHFFFAOYSA-N 4-(2-bromothioxanthen-9-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC(Br)=CC=C2SC2=CC=CC=C21 UHGZJXZINNENOT-UHFFFAOYSA-N 0.000 description 2
- MMRUORAYNHPZDW-UHFFFAOYSA-N 4-(2-bromoxanthen-9-ylidene)-1-butylpiperidine Chemical compound C1CN(CCCC)CCC1=C1C2=CC(Br)=CC=C2OC2=CC=CC=C21 MMRUORAYNHPZDW-UHFFFAOYSA-N 0.000 description 2
- WTZPERAJKMXMSC-UHFFFAOYSA-N 4-(2-bromoxanthen-9-ylidene)piperidine Chemical compound C12=CC(Br)=CC=C2OC2=CC=CC=C2C1=C1CCNCC1 WTZPERAJKMXMSC-UHFFFAOYSA-N 0.000 description 2
- FQLSBXCEUFTIHI-UHFFFAOYSA-N 4-(2-chlorothioxanthen-9-ylidene)piperidine Chemical compound C12=CC(Cl)=CC=C2SC2=CC=CC=C2C1=C1CCNCC1 FQLSBXCEUFTIHI-UHFFFAOYSA-N 0.000 description 2
- BVJWSYBOHUTZNN-UHFFFAOYSA-N 4-(2-chloroxanthen-9-ylidene)-1-ethylpiperidine Chemical compound C1CN(CC)CCC1=C1C2=CC(Cl)=CC=C2OC2=CC=CC=C21 BVJWSYBOHUTZNN-UHFFFAOYSA-N 0.000 description 2
- JTGRTBCDDBKEQR-UHFFFAOYSA-N 4-(2-fluoroxanthen-9-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC(F)=CC=C2OC2=CC=CC=C21 JTGRTBCDDBKEQR-UHFFFAOYSA-N 0.000 description 2
- OKIHXNKYYGUVTE-UHFFFAOYSA-N 4-Fluorothiophenol Chemical compound FC1=CC=C(S)C=C1 OKIHXNKYYGUVTE-UHFFFAOYSA-N 0.000 description 2
- LRRDANNSUCQNDU-UHFFFAOYSA-N 4-chloro-2-iodobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1I LRRDANNSUCQNDU-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 239000012223 aqueous fraction Substances 0.000 description 2
- 230000006399 behavior Effects 0.000 description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- JFWMYCVMQSLLOO-UHFFFAOYSA-N cyclobutanecarbonyl chloride Chemical compound ClC(=O)C1CCC1 JFWMYCVMQSLLOO-UHFFFAOYSA-N 0.000 description 2
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- 210000001577 neostriatum Anatomy 0.000 description 2
- 210000002569 neuron Anatomy 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 1
- KBUXNPLRCIYXKH-WLHGVMLRSA-N (e)-but-2-enedioic acid;9-(1-methylpiperidin-4-ylidene)thioxanthene-2-carbonitrile Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1=C1C2=CC(C#N)=CC=C2SC2=CC=CC=C21 KBUXNPLRCIYXKH-WLHGVMLRSA-N 0.000 description 1
- MKJSSRHKJABRFF-BTJKTKAUSA-N (z)-but-2-enedioic acid;4-(3-fluorothioxanthen-9-ylidene)-1-methylpiperidine Chemical compound OC(=O)\C=C/C(O)=O.C1CN(C)CCC1=C1C2=CC=C(F)C=C2SC2=CC=CC=C21 MKJSSRHKJABRFF-BTJKTKAUSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- KKSUXAKOAMZNSQ-UHFFFAOYSA-N 1-butyl-4-(2-chlorothioxanthen-9-ylidene)piperidine Chemical compound C1CN(CCCC)CCC1=C1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 KKSUXAKOAMZNSQ-UHFFFAOYSA-N 0.000 description 1
- ABIQSKZDEDTACZ-UHFFFAOYSA-N 1-butyl-4-(2-chlorothioxanthen-9-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CN(CCCC)CCC1=C1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 ABIQSKZDEDTACZ-UHFFFAOYSA-N 0.000 description 1
- XFKPWNMQHBQZQK-UHFFFAOYSA-N 1-butyl-4-[2-(trifluoromethyl)xanthen-9-ylidene]piperidine Chemical compound C1CN(CCCC)CCC1=C1C2=CC(C(F)(F)F)=CC=C2OC2=CC=CC=C21 XFKPWNMQHBQZQK-UHFFFAOYSA-N 0.000 description 1
- FPANKUUAVASGAH-UHFFFAOYSA-N 1-methyl-4-(2-methylsulfanylthioxanthen-9-ylidene)piperidine Chemical compound C12=CC(SC)=CC=C2SC2=CC=CC=C2C1=C1CCN(C)CC1 FPANKUUAVASGAH-UHFFFAOYSA-N 0.000 description 1
- LUCXZIWEARVJTL-UHFFFAOYSA-N 1-methyl-4-(2-methylsulfanylxanthen-9-ylidene)piperidine Chemical compound C12=CC(SC)=CC=C2OC2=CC=CC=C2C1=C1CCN(C)CC1 LUCXZIWEARVJTL-UHFFFAOYSA-N 0.000 description 1
- CGAKGHASBCDTPM-UHFFFAOYSA-N 2,6-difluoro-9-(1-methylpiperidin-4-yl)thioxanthen-9-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC(F)=CC=C2SC2=CC(F)=CC=C21 CGAKGHASBCDTPM-UHFFFAOYSA-N 0.000 description 1
- FOAXQGRSEHPVEN-UHFFFAOYSA-N 2-(2h-benzo[d][1]benzoxepin-1-ylidene)piperidine Chemical compound N1CCCCC1=C1C(C=2C(=CC=CC=2)C=CO2)=C2C=CC1 FOAXQGRSEHPVEN-UHFFFAOYSA-N 0.000 description 1
- FNROCHFTHIONLL-UHFFFAOYSA-N 2-(9h-thioxanthen-10-ylidene)piperidine Chemical class N1CCCCC1=S1C2=CC=CC=C2CC2=CC=CC=C21 FNROCHFTHIONLL-UHFFFAOYSA-N 0.000 description 1
- LEOGBDMNMFJKRV-UHFFFAOYSA-N 2-(trifluoromethyl)xanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(C(F)(F)F)=CC=C3OC2=C1 LEOGBDMNMFJKRV-UHFFFAOYSA-N 0.000 description 1
- LGHCZVSOBXVGPI-UHFFFAOYSA-N 2-[(3-chlorophenoxy)methyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1COC1=CC=CC(Cl)=C1 LGHCZVSOBXVGPI-UHFFFAOYSA-N 0.000 description 1
- LMGKTLVTHWRMTL-UHFFFAOYSA-N 2-[4-(2-bromoxanthen-9-ylidene)piperidin-1-yl]ethanol Chemical compound C1CN(CCO)CCC1=C1C2=CC(Br)=CC=C2OC2=CC=CC=C21 LMGKTLVTHWRMTL-UHFFFAOYSA-N 0.000 description 1
- CEISOYSSAJSHEM-UHFFFAOYSA-N 2-[4-(2-chloroxanthen-9-ylidene)piperidin-1-yl]ethanol Chemical compound C1CN(CCO)CCC1=C1C2=CC(Cl)=CC=C2OC2=CC=CC=C21 CEISOYSSAJSHEM-UHFFFAOYSA-N 0.000 description 1
- LLWMVWNVHRHURV-UHFFFAOYSA-N 2-[4-(2-chloroxanthen-9-ylidene)piperidin-1-yl]ethanol;methanesulfonic acid Chemical compound CS(O)(=O)=O.C1CN(CCO)CCC1=C1C2=CC(Cl)=CC=C2OC2=CC=CC=C21 LLWMVWNVHRHURV-UHFFFAOYSA-N 0.000 description 1
- LGPVTNAJFDUWLF-UHFFFAOYSA-N 2-amino-4-fluorobenzoic acid Chemical compound NC1=CC(F)=CC=C1C(O)=O LGPVTNAJFDUWLF-UHFFFAOYSA-N 0.000 description 1
- RNQLTZQIRHJZAH-UHFFFAOYSA-N 2-bromo-9-(1-methylpiperidin-4-yl)thioxanthen-9-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC(Br)=CC=C2SC2=CC=CC=C21 RNQLTZQIRHJZAH-UHFFFAOYSA-N 0.000 description 1
- LFDHQGUYWJNDRH-UHFFFAOYSA-N 2-bromo-9-(1-methylpiperidin-4-yl)xanthen-9-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC(Br)=CC=C2OC2=CC=CC=C21 LFDHQGUYWJNDRH-UHFFFAOYSA-N 0.000 description 1
- XOYDXFFMXDJBQU-UHFFFAOYSA-N 2-bromothioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(Br)=CC=C3SC2=C1 XOYDXFFMXDJBQU-UHFFFAOYSA-N 0.000 description 1
- DYQUGFRRGGOYCA-UHFFFAOYSA-N 2-bromoxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(Br)=CC=C3OC2=C1 DYQUGFRRGGOYCA-UHFFFAOYSA-N 0.000 description 1
- VKOJCXWEBUNAGY-UHFFFAOYSA-N 2-chloro-9-(1-methylpiperidin-4-yl)xanthen-9-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC(Cl)=CC=C2OC2=CC=CC=C21 VKOJCXWEBUNAGY-UHFFFAOYSA-N 0.000 description 1
- PRWJZNITVOUZBU-UHFFFAOYSA-N 2-chloroxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(Cl)=CC=C3OC2=C1 PRWJZNITVOUZBU-UHFFFAOYSA-N 0.000 description 1
- RCIYMDPJHINGHS-UHFFFAOYSA-N 2-fluoro-9-(1-methylpiperidin-4-yl)thioxanthen-9-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC(F)=CC=C2SC2=CC=CC=C21 RCIYMDPJHINGHS-UHFFFAOYSA-N 0.000 description 1
- VVZWCWXLBDGDPJ-UHFFFAOYSA-N 2-fluorothioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(F)=CC=C3SC2=C1 VVZWCWXLBDGDPJ-UHFFFAOYSA-N 0.000 description 1
- AWMISBKXHLTLHZ-UHFFFAOYSA-N 2-fluoroxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(F)=CC=C3OC2=C1 AWMISBKXHLTLHZ-UHFFFAOYSA-N 0.000 description 1
- MLGQCJSEUUWVLJ-UHFFFAOYSA-N 2h-benzo[d][1]benzoxepin-1-one Chemical class C12=CC=CC=C2C=COC2=C1C(=O)CC=C2 MLGQCJSEUUWVLJ-UHFFFAOYSA-N 0.000 description 1
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 1
- QOSNGGUXDYCOHO-UHFFFAOYSA-N 3-[4-(2-chloroxanthen-9-ylidene)piperidin-1-yl]propan-1-ol Chemical compound C1CN(CCCO)CCC1=C1C2=CC(Cl)=CC=C2OC2=CC=CC=C21 QOSNGGUXDYCOHO-UHFFFAOYSA-N 0.000 description 1
- OIBSKUZEPFZETH-UHFFFAOYSA-N 3-[4-(2-chloroxanthen-9-ylidene)piperidin-1-yl]propan-1-ol;hydrochloride Chemical compound Cl.C1CN(CCCO)CCC1=C1C2=CC(Cl)=CC=C2OC2=CC=CC=C21 OIBSKUZEPFZETH-UHFFFAOYSA-N 0.000 description 1
- IGYAIXIGFFZSEL-UHFFFAOYSA-N 3-chloro-11-(1-methylpiperidin-4-yl)-6h-benzo[c][1]benzoxepin-11-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC=C(Cl)C=C2OCC2=CC=CC=C21 IGYAIXIGFFZSEL-UHFFFAOYSA-N 0.000 description 1
- AAXAGZNBGJOBKK-UHFFFAOYSA-N 3-chloro-6h-benzo[c][1]benzoxepin-11-one Chemical compound O1CC2=CC=CC=C2C(=O)C2=CC=C(Cl)C=C12 AAXAGZNBGJOBKK-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- BMJAEFAFDQQSOL-UHFFFAOYSA-N 3-fluoro-9-(1-methylpiperidin-4-yl)thioxanthen-9-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC=C(F)C=C2SC2=CC=CC=C21 BMJAEFAFDQQSOL-UHFFFAOYSA-N 0.000 description 1
- GAIRGASUWHLTOE-UHFFFAOYSA-N 3h-oxepin-2-one Chemical compound O=C1CC=CC=CO1 GAIRGASUWHLTOE-UHFFFAOYSA-N 0.000 description 1
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 1
- NFASNUQKFYMUQO-UHFFFAOYSA-N 4-(1-chlorothioxanthen-9-ylidene)piperidine Chemical compound C1=2C(Cl)=CC=CC=2SC2=CC=CC=C2C1=C1CCNCC1 NFASNUQKFYMUQO-UHFFFAOYSA-N 0.000 description 1
- JKOPHSDEIVGYHJ-UHFFFAOYSA-N 4-(2-bromothioxanthen-9-ylidene)-1-methylpiperidine;methanesulfonic acid Chemical compound CS(O)(=O)=O.C1CN(C)CCC1=C1C2=CC(Br)=CC=C2SC2=CC=CC=C21 JKOPHSDEIVGYHJ-UHFFFAOYSA-N 0.000 description 1
- NFNMTKIGBXDIEI-UHFFFAOYSA-N 4-(2-bromoxanthen-9-ylidene)piperidine;methanesulfonic acid Chemical compound CS(O)(=O)=O.C12=CC(Br)=CC=C2OC2=CC=CC=C2C1=C1CCNCC1 NFNMTKIGBXDIEI-UHFFFAOYSA-N 0.000 description 1
- FOHDTRSBGNQKHU-UHFFFAOYSA-N 4-(2-chlorothioxanthen-9-ylidene)-1-(cyclobutylmethyl)piperidine Chemical compound C12=CC(Cl)=CC=C2SC2=CC=CC=C2C1=C(CC1)CCN1CC1CCC1 FOHDTRSBGNQKHU-UHFFFAOYSA-N 0.000 description 1
- CPDUFJSQGFSFIK-UHFFFAOYSA-N 4-(2-chlorothioxanthen-9-ylidene)-1-ethylpiperidine Chemical compound C1CN(CC)CCC1=C1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 CPDUFJSQGFSFIK-UHFFFAOYSA-N 0.000 description 1
- RKTNOVXEBZABBM-UHFFFAOYSA-N 4-(2-chlorothioxanthen-9-ylidene)-1-ethylpiperidine;hydrochloride Chemical compound Cl.C1CN(CC)CCC1=C1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 RKTNOVXEBZABBM-UHFFFAOYSA-N 0.000 description 1
- BLGMFJSWCUYAKO-UHFFFAOYSA-N 4-(2-chlorothioxanthen-9-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 BLGMFJSWCUYAKO-UHFFFAOYSA-N 0.000 description 1
- LNGGMSPZRSOIPB-UHFFFAOYSA-N 4-(2-chloroxanthen-9-ylidene)-1-(cyclobutylmethyl)piperidine Chemical compound C12=CC(Cl)=CC=C2OC2=CC=CC=C2C1=C(CC1)CCN1CC1CCC1 LNGGMSPZRSOIPB-UHFFFAOYSA-N 0.000 description 1
- VPXXCGKDFKRSQL-UHFFFAOYSA-N 4-(2-chloroxanthen-9-ylidene)piperidine-1-carbonitrile Chemical compound C12=CC(Cl)=CC=C2OC2=CC=CC=C2C1=C1CCN(C#N)CC1 VPXXCGKDFKRSQL-UHFFFAOYSA-N 0.000 description 1
- KJOCPEKKUHGOJA-UHFFFAOYSA-N 4-(2-chloroxanthen-9-ylidene)piperidine;methanesulfonic acid Chemical compound CS(O)(=O)=O.C12=CC(Cl)=CC=C2OC2=CC=CC=C2C1=C1CCNCC1 KJOCPEKKUHGOJA-UHFFFAOYSA-N 0.000 description 1
- XSLAHYGDZCKXBR-UHFFFAOYSA-N 4-(3-chloro-6h-benzo[c][1]benzoxepin-11-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC=C(Cl)C=C2OCC2=CC=CC=C21 XSLAHYGDZCKXBR-UHFFFAOYSA-N 0.000 description 1
- WVEVKAPHMIXOSP-UHFFFAOYSA-N 4-(3-fluorothioxanthen-9-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC=C(F)C=C2SC2=CC=CC=C21 WVEVKAPHMIXOSP-UHFFFAOYSA-N 0.000 description 1
- VBVKTDKVGOAIMP-UHFFFAOYSA-N 4-(6-chloro-2-fluorothioxanthen-9-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC(F)=CC=C2SC2=CC(Cl)=CC=C21 VBVKTDKVGOAIMP-UHFFFAOYSA-N 0.000 description 1
- JKCMWELDRYNUOL-UHFFFAOYSA-N 4-(6-chloro-2-fluoroxanthen-9-ylidene)-1-methylpiperidine;hydrochloride Chemical compound Cl.C1CN(C)CCC1=C1C2=CC(F)=CC=C2OC2=CC(Cl)=CC=C21 JKCMWELDRYNUOL-UHFFFAOYSA-N 0.000 description 1
- WWTWKSKVODPWBD-UHFFFAOYSA-N 4-(9-chloro-6h-benzo[c][1]benzoxepin-11-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC(Cl)=CC=C2COC2=CC=CC=C21 WWTWKSKVODPWBD-UHFFFAOYSA-N 0.000 description 1
- QDOJNWFOCOWAPO-UHFFFAOYSA-N 4-chloro-1-methylpiperidine;hydron;chloride Chemical compound Cl.CN1CCC(Cl)CC1 QDOJNWFOCOWAPO-UHFFFAOYSA-N 0.000 description 1
- YZDVBIUEBCTERM-UHFFFAOYSA-N 4-chloro-2-(4-fluorophenoxy)benzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1OC1=CC=C(F)C=C1 YZDVBIUEBCTERM-UHFFFAOYSA-N 0.000 description 1
- IPDBSSDXGDFUAM-UHFFFAOYSA-N 4-fluoro-2-(4-fluorophenyl)sulfanylbenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1SC1=CC=C(F)C=C1 IPDBSSDXGDFUAM-UHFFFAOYSA-N 0.000 description 1
- DUKFTVLJAXWGPI-UHFFFAOYSA-N 4-fluoro-2-iodobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1I DUKFTVLJAXWGPI-UHFFFAOYSA-N 0.000 description 1
- QUVQNOHPBDQQHX-UHFFFAOYSA-N 4-fluoro-2-phenylsulfanylbenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1SC1=CC=CC=C1 QUVQNOHPBDQQHX-UHFFFAOYSA-N 0.000 description 1
- KTZQMOQHSQRAJH-UHFFFAOYSA-N 5-chloro-2-(phenoxymethyl)benzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1COC1=CC=CC=C1 KTZQMOQHSQRAJH-UHFFFAOYSA-N 0.000 description 1
- TYZUUCOYSNUKKM-UHFFFAOYSA-N 6-chloro-2-fluoro-9-(1-methylpiperidin-4-yl)thioxanthen-9-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC(F)=CC=C2SC2=CC(Cl)=CC=C21 TYZUUCOYSNUKKM-UHFFFAOYSA-N 0.000 description 1
- AANHDQKCLTZXOK-UHFFFAOYSA-N 6-chloro-2-fluorothioxanthen-9-one Chemical compound ClC1=CC=C2C(=O)C3=CC(F)=CC=C3SC2=C1 AANHDQKCLTZXOK-UHFFFAOYSA-N 0.000 description 1
- NUAVXUHBPNMQEV-UHFFFAOYSA-N 6-chloro-3h-2-benzofuran-1-one Chemical compound ClC1=CC=C2COC(=O)C2=C1 NUAVXUHBPNMQEV-UHFFFAOYSA-N 0.000 description 1
- SKTFQHRVFFOHTQ-UHFFFAOYSA-N 8-bromo-1,3-dimethyl-7h-purine-2,6-dione Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC(Br)=N2 SKTFQHRVFFOHTQ-UHFFFAOYSA-N 0.000 description 1
- ZIUNYNUCENTFPS-UHFFFAOYSA-N 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC(C(F)(F)F)=CC=C2OC2=CC=CC=C21 ZIUNYNUCENTFPS-UHFFFAOYSA-N 0.000 description 1
- PPEMMIHFUFWQCF-UHFFFAOYSA-N 9-(1-methylpiperidin-4-yl)xanthen-9-ol Chemical compound C1CN(C)CCC1C1(O)C2=CC=CC=C2OC2=CC=CC=C21 PPEMMIHFUFWQCF-UHFFFAOYSA-N 0.000 description 1
- VAVKIJNEVUPNQP-UHFFFAOYSA-N 9-(1-methylpiperidin-4-ylidene)xanthene-2-carbonitrile Chemical compound C1CN(C)CCC1=C1C2=CC(C#N)=CC=C2OC2=CC=CC=C21 VAVKIJNEVUPNQP-UHFFFAOYSA-N 0.000 description 1
- YYXZIVILIOMTLU-UHFFFAOYSA-N 9-chloro-6h-benzo[c][1]benzoxepin-11-one Chemical compound C1OC2=CC=CC=C2C(=O)C2=CC(Cl)=CC=C21 YYXZIVILIOMTLU-UHFFFAOYSA-N 0.000 description 1
- PQJUJGAVDBINPI-UHFFFAOYSA-N 9H-thioxanthene Chemical compound C1=CC=C2CC3=CC=CC=C3SC2=C1 PQJUJGAVDBINPI-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical class O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 208000028017 Psychotic disease Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N Theophylline Natural products O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- KLBQZWRITKRQQV-UHFFFAOYSA-N Thioridazine Chemical compound C12=CC(SC)=CC=C2SC2=CC=CC=C2N1CCC1CCCCN1C KLBQZWRITKRQQV-UHFFFAOYSA-N 0.000 description 1
- GZLGNNHEHXBCBI-UHFFFAOYSA-L [Na+].[Na+].OC(=O)C(O)C(O)C(O)=O.[O-]C(=O)C(O)C(O)C([O-])=O Chemical compound [Na+].[Na+].OC(=O)C(O)C(O)C(O)=O.[O-]C(=O)C(O)C(O)C([O-])=O GZLGNNHEHXBCBI-UHFFFAOYSA-L 0.000 description 1
- GANYMSDHMBJFIL-UHFFFAOYSA-N acetonitrile;ethoxyethane Chemical compound CC#N.CCOCC GANYMSDHMBJFIL-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000000768 catecholaminergic effect Effects 0.000 description 1
- 229960004170 clozapine Drugs 0.000 description 1
- QZUDBNBUXVUHMW-UHFFFAOYSA-N clozapine Chemical compound C1CN(C)CCN1C1=NC2=CC(Cl)=CC=C2NC2=CC=CC=C12 QZUDBNBUXVUHMW-UHFFFAOYSA-N 0.000 description 1
- 230000002153 concerted effect Effects 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- FVWDBVACVTXVJN-UHFFFAOYSA-L dipotassium;propan-2-one;carbonate Chemical compound [K+].[K+].CC(C)=O.[O-]C([O-])=O FVWDBVACVTXVJN-UHFFFAOYSA-L 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229960003878 haloperidol Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- QXUAFCKBYYPTPQ-ZWKAXHIPSA-L magnesium (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol octadecanoate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O QXUAFCKBYYPTPQ-ZWKAXHIPSA-L 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 239000003176 neuroleptic agent Substances 0.000 description 1
- 230000001962 neuropharmacologic effect Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 1
- 229960002748 norepinephrine Drugs 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- DIVDFFZHCJEHGG-UHFFFAOYSA-N oxidopamine Chemical compound NCCC1=CC(O)=C(O)C=C1O DIVDFFZHCJEHGG-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- 239000006201 parenteral dosage form Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- YVUQSNJEYSNKRX-UHFFFAOYSA-N pimozide Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)CCCN1CCC(N2C(NC3=CC=CC=C32)=O)CC1 YVUQSNJEYSNKRX-UHFFFAOYSA-N 0.000 description 1
- 229960003634 pimozide Drugs 0.000 description 1
- 230000001144 postural effect Effects 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 210000003523 substantia nigra Anatomy 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 230000005062 synaptic transmission Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 229960002784 thioridazine Drugs 0.000 description 1
- ZEWQUBUPAILYHI-UHFFFAOYSA-N trifluoperazine Chemical compound C1CN(C)CCN1CCCN1C2=CC(C(F)(F)F)=CC=C2SC2=CC=CC=C21 ZEWQUBUPAILYHI-UHFFFAOYSA-N 0.000 description 1
- 229960002324 trifluoperazine Drugs 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/21—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups
- C07C65/24—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups polycyclic
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Biomedical Technology (AREA)
- Psychiatry (AREA)
- Epidemiology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52121674A | 1974-11-06 | 1974-11-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42137L IE42137L (en) | 1976-05-06 |
| IE42137B1 true IE42137B1 (en) | 1980-06-04 |
Family
ID=24075868
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2398/75A IE42137B1 (en) | 1974-11-06 | 1975-11-04 | Compositions containing piperidyl xanthenes,thioxanthenes and dibenzozepins |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5826754B2 (enExample) |
| AU (1) | AU498298B2 (enExample) |
| BE (1) | BE835224A (enExample) |
| CA (1) | CA1055945A (enExample) |
| CH (1) | CH624403A5 (enExample) |
| DE (1) | DE2549841A1 (enExample) |
| DK (1) | DK139429B (enExample) |
| ES (1) | ES442357A1 (enExample) |
| FR (1) | FR2290202A1 (enExample) |
| HU (1) | HU174639B (enExample) |
| IE (1) | IE42137B1 (enExample) |
| IL (1) | IL48400A (enExample) |
| LU (1) | LU73714A1 (enExample) |
| NL (1) | NL7512974A (enExample) |
| NZ (1) | NZ179139A (enExample) |
| PH (1) | PH12158A (enExample) |
| ZA (1) | ZA756550B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7511064B2 (en) | 2001-10-25 | 2009-03-31 | Biofrontera Bioscience Gmbh | Derivatives of 4-(thio- or selenoxanthene-9-ylidene)-piperidine or acridine and its use as a selective 5-HT2B receptor antagonist |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2357251A1 (fr) * | 1976-07-09 | 1978-02-03 | Merck & Co Inc | 1-methyl-4-(2-carboxy-1-thioxanthan-9-ylidene)-piperidine |
| US4073912A (en) * | 1976-10-12 | 1978-02-14 | Smithkline Corporation | Piperidylidene derivatives of benzo-fused xanthenes, thioxanthenes and dibenzoxepins and antipsychotic use thereof |
| US4089961A (en) * | 1976-11-08 | 1978-05-16 | Smithkline Corporation | Antipsychotically useful quinolizidylidene derivatives of xanthenes, thioxanthenes and dibenzoxepins |
| NZ189108A (en) * | 1977-12-29 | 1982-02-23 | Kefalas As | 2-methylthio-6-fluoro-9-(1-methyl-4-piperidylidene)-thioxanthene and pharmaceutical compositions intermediate 2-methylthio-6-fluoro-9-(1-methyl-4-piperidyl)-thioxanthen-9-ol |
| US4777177A (en) * | 1984-10-19 | 1988-10-11 | Ciba-Geigy Corporation | Pesticidal thioxanthen-9-ylidenepiperidines |
| US5250681A (en) * | 1988-06-02 | 1993-10-05 | Ajinomoto Co., Inc. | Piperidine derivatives and hypotensives containing the same |
| CA2004211A1 (en) * | 1988-11-30 | 1990-05-31 | Masataka Syoji | Piperidine derivatives and hyportensives containing the same |
| EP1306376A1 (en) * | 2001-10-25 | 2003-05-02 | Biofrontera Pharmaceuticals AG | Derivatives of 4-(thio- or selenoxanthene-9-ylidene)-piperidine or acridine and its use as a selective 5-HT2B receptor antagonist |
| EA015491B1 (ru) | 2003-06-27 | 2011-08-30 | Янссен Фармацевтика Н.В. | ТРИЦИКЛИЧЕСКИЕ δ-ОПИОИДНЫЕ МОДУЛЯТОРЫ |
| KR20080027216A (ko) | 2004-08-05 | 2008-03-26 | 얀센 파마슈티카 엔.브이. | 트리사이클릭 δ-오피오이드 조절자 |
| CA2592464A1 (en) | 2004-12-22 | 2006-06-29 | Janssen Pharmaceutica N.V. | Tricyclic .delta.-opioid modulators |
| DE602005014671D1 (de) | 2004-12-22 | 2009-07-09 | Janssen Pharmaceutica Nv | Tricyclische delta-opioid-modulatoren |
| JP2008525481A (ja) * | 2004-12-22 | 2008-07-17 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプ | 三環式δ−オピオイド・モジュレーター |
| AU2006203880A1 (en) | 2005-01-06 | 2006-07-13 | Janssen Pharmaceutica N.V. | Tricyclic delta-opioid modulators |
| AU2006259273A1 (en) | 2005-06-16 | 2006-12-28 | Janssen Pharmaceutica N.V. | Tricyclic opioid modulators |
| JP5044562B2 (ja) * | 2006-09-29 | 2012-10-10 | 日本臓器製薬株式会社 | オキセピン誘導体 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL260070A (enExample) * | 1960-02-25 | |||
| NL122808C (enExample) * | 1961-09-29 | |||
| DE1670118A1 (de) * | 1966-07-22 | 1970-11-05 | Boehringer Mannheim Gmbh | Verfahren zur Herstellung neuer Derivate des 6,11-Dihydro-dibenz[b,e]oxepins und ihrer Salze |
| US3470188A (en) * | 1967-01-05 | 1969-09-30 | Smithkline Corp | 9-cycloalkyl-lower alkyl-piperidylidene derivatives of xanthenes and thioxanthenes |
| JPS5018478A (enExample) * | 1973-05-17 | 1975-02-26 |
-
1975
- 1975-10-16 ZA ZA00756550A patent/ZA756550B/xx unknown
- 1975-10-31 AU AU86247/75A patent/AU498298B2/en not_active Expired
- 1975-10-31 CA CA238,781A patent/CA1055945A/en not_active Expired
- 1975-11-02 IL IL48400A patent/IL48400A/xx unknown
- 1975-11-03 PH PH17733A patent/PH12158A/en unknown
- 1975-11-03 NZ NZ179139A patent/NZ179139A/xx unknown
- 1975-11-03 HU HU75SI1494A patent/HU174639B/hu not_active IP Right Cessation
- 1975-11-04 LU LU73714A patent/LU73714A1/xx unknown
- 1975-11-04 IE IE2398/75A patent/IE42137B1/en unknown
- 1975-11-04 BE BE161500A patent/BE835224A/xx not_active IP Right Cessation
- 1975-11-04 FR FR7533631A patent/FR2290202A1/fr active Granted
- 1975-11-04 DK DK495775AA patent/DK139429B/da not_active IP Right Cessation
- 1975-11-05 CH CH1432175A patent/CH624403A5/de not_active IP Right Cessation
- 1975-11-05 JP JP50133564A patent/JPS5826754B2/ja not_active Expired
- 1975-11-05 ES ES442357A patent/ES442357A1/es not_active Expired
- 1975-11-05 NL NL7512974A patent/NL7512974A/xx not_active Application Discontinuation
- 1975-11-06 DE DE19752549841 patent/DE2549841A1/de active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7511064B2 (en) | 2001-10-25 | 2009-03-31 | Biofrontera Bioscience Gmbh | Derivatives of 4-(thio- or selenoxanthene-9-ylidene)-piperidine or acridine and its use as a selective 5-HT2B receptor antagonist |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2290202A1 (fr) | 1976-06-04 |
| DK139429C (enExample) | 1979-08-06 |
| DE2549841A1 (de) | 1976-05-13 |
| AU498298B2 (en) | 1979-03-01 |
| ZA756550B (en) | 1976-09-29 |
| IL48400A (en) | 1979-01-31 |
| DK139429B (da) | 1979-02-19 |
| NZ179139A (en) | 1978-04-28 |
| JPS5826754B2 (ja) | 1983-06-04 |
| AU8624775A (en) | 1977-05-05 |
| NL7512974A (nl) | 1976-05-10 |
| IE42137L (en) | 1976-05-06 |
| JPS5170768A (enExample) | 1976-06-18 |
| PH12158A (en) | 1978-11-10 |
| FR2290202B1 (enExample) | 1980-05-23 |
| BE835224A (fr) | 1976-05-04 |
| DK495775A (enExample) | 1976-05-07 |
| LU73714A1 (enExample) | 1976-06-11 |
| CH624403A5 (en) | 1981-07-31 |
| DE2549841C2 (enExample) | 1988-07-07 |
| IL48400A0 (en) | 1976-01-30 |
| CA1055945A (en) | 1979-06-05 |
| ES442357A1 (es) | 1977-04-01 |
| HU174639B (hu) | 1980-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4086350A (en) | Pharmaceutical compositions and method of producing anti-psychotic activity without extrapyramidal symptoms | |
| IE42137B1 (en) | Compositions containing piperidyl xanthenes,thioxanthenes and dibenzozepins | |
| US3014911A (en) | Derivatives of dibenzo[a, e]cycloheptatriene | |
| DE69331888T2 (de) | Bicyclische Pyridinderivate, Verfahren zu ihrer Herstellung, Zwischenprodukte, ihre Anwendung als Arzneimittel und diese enthaltende pharmazeutische Zusammensetzungen | |
| NZ236117A (en) | Indole derivatives and pharmaceutical compositions | |
| DE69420394T2 (de) | Pyrrolopyridinderivate als dopaminrezeptor liganden | |
| JPH06510764A (ja) | 5−ht4レセプター・アンタゴニスト用のアザ二環式化合物 | |
| NZ246915A (en) | Benzopyran, benzothiopyran and benzofuran derivatives, preparation and pharmaceutical compositions thereof | |
| EP0937715B1 (en) | Tetrahydrobenzindole compounds | |
| NO156055B (no) | Fremgangsmaate ved fremstilling av anloept sortblikk av kvalitet t-3 | |
| NO146359B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive cyproheptadinderivater | |
| DK159441B (da) | 11-substituerede 5,11-dihydro-6h-dibenz(b,e)azepin-6-on-derivater, laegemidler indeholdende disse forbindelser og analogifremgangsmaade til forbindelsernes fremstilling | |
| NO150837B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive xanten- og tioxantenderivater | |
| CS249545B2 (en) | Method of phenylbenzo(b)thiophenic derivatives production | |
| CA1102807A (en) | Piperidylidene derivatives of benzo-fused xanthenes, thioxanthenes and dibenzoxepins | |
| DE2256392A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| US4042695A (en) | Thiaxanthene derivatives, compositions thereof and methods of treating therewith | |
| DE2056590A1 (de) | Morphohn und Piperazindenvate | |
| DE3204157A1 (de) | Substituierte dibenzodiazepinone, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| US3445464A (en) | Phenothiazine derivatives | |
| HUP9904526A2 (hu) | Piperidinszármazékok, eljárás előállításukra és ezeket tartalmazó gyógyszerkészítmények | |
| US3531480A (en) | Phenothiazine derivatives | |
| EP0000716B1 (en) | Pyrrolo(2,1-b)(3)benzazepine derivatives, process for their preparation and pharmaceutical compositions containing them | |
| DE2014911A1 (de) | Verfahren zur Herstellung von neuen Imidazolidinenderivaten | |
| US4206210A (en) | Alkylthio-7,8-dihdroxy-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepines having dopaminergic activity |