HU196396B - Process for n-alkylating dihydro-lisergic acid - Google Patents
Process for n-alkylating dihydro-lisergic acid Download PDFInfo
- Publication number
- HU196396B HU196396B HU864145A HU414586A HU196396B HU 196396 B HU196396 B HU 196396B HU 864145 A HU864145 A HU 864145A HU 414586 A HU414586 A HU 414586A HU 196396 B HU196396 B HU 196396B
- Authority
- HU
- Hungary
- Prior art keywords
- sub
- acid
- mmol
- alkyl
- formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 33
- 239000002253 acid Substances 0.000 title description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 13
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical class [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 claims abstract description 3
- 229940077388 benzenesulfonate Drugs 0.000 claims abstract description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical group [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 30
- 238000002360 preparation method Methods 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 239000000010 aprotic solvent Substances 0.000 claims description 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 2
- -1 bromo, methyl Chemical group 0.000 abstract description 16
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 13
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- 238000005804 alkylation reaction Methods 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 230000029936 alkylation Effects 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- ORBSYPFBZQJNJE-MPKXVKKWSA-N (6ar,9r,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC([C@H]2C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ORBSYPFBZQJNJE-MPKXVKKWSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000002168 alkylating agent Substances 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 229940100198 alkylating agent Drugs 0.000 description 5
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 150000002475 indoles Chemical class 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- XGYGRQGHYWSQOV-POWSATBFSA-N (6ar,10ar)-7-methyl-4-pentan-3-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1([C@@H]2[C@H](N(CC(C2)C(O)=O)C)C2)=CC=CC3=C1C2=CN3C(CC)CC XGYGRQGHYWSQOV-POWSATBFSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000004503 metal oxide affinity chromatography Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- QDCCHSDAIHXEKD-POWSATBFSA-N (6ar,10ar)-4-cyclopentyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C([C@@H]1[C@@H](C=2C=CC=C3C4=2)CC(CN1C)C(O)=O)C4=CN3C1CCCC1 QDCCHSDAIHXEKD-POWSATBFSA-N 0.000 description 1
- NAGMITMLYCSORO-RJPUVWTNSA-N (6ar,10ar)-7-methyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1([C@@H]2[C@H](N(CC(C2)C(O)=O)C)C2)=CC=CC3=C1C2=CN3C(C)C NAGMITMLYCSORO-RJPUVWTNSA-N 0.000 description 1
- BLRHMMGNCXNXJL-UHFFFAOYSA-N 1-methylindole Chemical compound C1=CC=C2N(C)C=CC2=C1 BLRHMMGNCXNXJL-UHFFFAOYSA-N 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- DQAHNGDSMVTVLQ-UHFFFAOYSA-N CCC(C(C)C)c1ccc(cc1)S(O)(=O)=O Chemical compound CCC(C(C)C)c1ccc(cc1)S(O)(=O)=O DQAHNGDSMVTVLQ-UHFFFAOYSA-N 0.000 description 1
- 206010007270 Carcinoid syndrome Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 206010026749 Mania Diseases 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 206010029216 Nervousness Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 206010047115 Vasculitis Diseases 0.000 description 1
- DXGTUUQHTDOFFQ-UHFFFAOYSA-N [N].C1=CC=C2NC=CC2=C1 Chemical group [N].C1=CC=C2NC=CC2=C1 DXGTUUQHTDOFFQ-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000004596 appetite loss Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- OVHDZBAFUMEXCX-UHFFFAOYSA-N benzyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1=CC=CC=C1 OVHDZBAFUMEXCX-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- ZWOQVPFVARFZSF-UHFFFAOYSA-N cyclopentyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1CCCC1 ZWOQVPFVARFZSF-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- RHGUXDUPXYFCTE-ZWNOBZJWSA-N ergoline Chemical class C1=CC([C@@H]2[C@H](NCCC2)C2)=C3C2=CNC3=C1 RHGUXDUPXYFCTE-ZWNOBZJWSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 235000021266 loss of appetite Nutrition 0.000 description 1
- 208000019017 loss of appetite Diseases 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000013014 purified material Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000012925 reference material Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/782,339 US4734501A (en) | 1985-10-01 | 1985-10-01 | N-alkylation of dihydrolysergic acid |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT41779A HUT41779A (en) | 1987-05-28 |
| HU196396B true HU196396B (en) | 1988-11-28 |
Family
ID=25125737
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU864145A HU196396B (en) | 1985-10-01 | 1986-09-30 | Process for n-alkylating dihydro-lisergic acid |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4734501A (,) |
| EP (1) | EP0219256B1 (,) |
| JP (1) | JPH0670049B2 (,) |
| KR (1) | KR870001680B1 (,) |
| CN (1) | CN1013446B (,) |
| AT (1) | ATE62483T1 (,) |
| AU (1) | AU578169B2 (,) |
| CA (1) | CA1296323C (,) |
| DE (1) | DE3678665D1 (,) |
| DK (1) | DK170044B1 (,) |
| EG (1) | EG17902A (,) |
| ES (1) | ES2002393A6 (,) |
| GR (1) | GR862463B (,) |
| HK (1) | HK24192A (,) |
| HU (1) | HU196396B (,) |
| IE (1) | IE58690B1 (,) |
| IL (1) | IL80194A (,) |
| NZ (1) | NZ217721A (,) |
| PH (1) | PH23030A (,) |
| PT (1) | PT83449B (,) |
| SU (1) | SU1486062A3 (,) |
| ZA (1) | ZA867417B (,) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2584719B1 (fr) * | 1985-07-11 | 1987-10-02 | Rhone Poulenc Sante | Procede de preparation des derives n-methyles du lysergol et du methoxy-10a lumilysergol |
| IL80193A0 (en) * | 1985-10-01 | 1986-12-31 | Lilly Co Eli | Esters of dihydrolysergic acid |
| US4906639A (en) * | 1985-10-01 | 1990-03-06 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid |
| US4968802A (en) * | 1985-10-01 | 1990-11-06 | Eli Lilly And Company | Process of making alkoxy cycloalkanol esters of dihydrolysergic acid |
| US4845224A (en) * | 1985-10-01 | 1989-07-04 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid having peripheral serotonin antagonist properties |
| US4914107A (en) * | 1989-01-17 | 1990-04-03 | Eli Lilly And Company | Method for selectively blocking 5-HT2 receptors |
| US5441961A (en) * | 1992-08-27 | 1995-08-15 | Eli Lilly And Company | Substituted cyclo or bicycloalkylamides of (8β)-6-(substituted) ergolines |
| WO2004087637A1 (en) * | 2003-03-31 | 2004-10-14 | Takasago International Corporation | Production of n-alkylamide compounds |
| CN102775402B (zh) * | 2011-05-13 | 2015-08-26 | 上海现代制药股份有限公司 | 一种制备二氢麦角酸的中间体及其制备方法 |
| RU2615949C1 (ru) * | 2015-11-18 | 2017-04-11 | Федеральное государственное казенное образовательное учреждение высшего профессионального образования "Калининградский пограничный институт Федеральной службы безопасности Российской Федерации" | Способ сигнализационного прикрытия т-образного перекрестка дорог |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1095296A (,) * | 1900-01-01 | |||
| US3183234A (en) * | 1963-11-21 | 1965-05-11 | Lilly Co Eli | Octahydroindoloquinolines |
| US3580916A (en) * | 1969-02-20 | 1971-05-25 | Lilly Co Eli | Hydroxyesters of hexa- and octahydroindoloquinolines |
| YU40004B (en) * | 1977-07-21 | 1985-06-30 | Lek Tovarna Farmacevtskih | Praocess for preparing n-substituted esters of 9,10-dihydrlysergic acid |
| DE3304361A1 (de) * | 1982-02-17 | 1983-08-25 | Sandoz-Patent-GmbH, 7850 Lörrach | Mutterkornalkaloide, verfahren zu deren herstellung sowie diese verbindungen enthaltende pharmazeutische zusammensetzungen |
| IL80193A0 (en) * | 1985-10-01 | 1986-12-31 | Lilly Co Eli | Esters of dihydrolysergic acid |
-
1985
- 1985-10-01 US US06/782,339 patent/US4734501A/en not_active Expired - Lifetime
-
1986
- 1986-09-29 AU AU63209/86A patent/AU578169B2/en not_active Ceased
- 1986-09-29 AT AT86307442T patent/ATE62483T1/de active
- 1986-09-29 NZ NZ217721A patent/NZ217721A/xx unknown
- 1986-09-29 IL IL80194A patent/IL80194A/xx not_active IP Right Cessation
- 1986-09-29 CA CA000519289A patent/CA1296323C/en not_active Expired - Lifetime
- 1986-09-29 PH PH34317A patent/PH23030A/en unknown
- 1986-09-29 EP EP86307442A patent/EP0219256B1/en not_active Expired - Lifetime
- 1986-09-29 PT PT83449A patent/PT83449B/pt not_active IP Right Cessation
- 1986-09-29 ZA ZA867417A patent/ZA867417B/xx unknown
- 1986-09-29 DE DE8686307442T patent/DE3678665D1/de not_active Expired - Lifetime
- 1986-09-29 EG EG610/86A patent/EG17902A/xx active
- 1986-09-29 GR GR862463A patent/GR862463B/el unknown
- 1986-09-30 ES ES8602321A patent/ES2002393A6/es not_active Expired
- 1986-09-30 SU SU864028225A patent/SU1486062A3/ru active
- 1986-09-30 JP JP61234255A patent/JPH0670049B2/ja not_active Expired - Lifetime
- 1986-09-30 IE IE258786A patent/IE58690B1/en not_active IP Right Cessation
- 1986-09-30 DK DK466786A patent/DK170044B1/da not_active IP Right Cessation
- 1986-09-30 CN CN86106720A patent/CN1013446B/zh not_active Expired
- 1986-09-30 KR KR1019860008206A patent/KR870001680B1/ko not_active Expired
- 1986-09-30 HU HU864145A patent/HU196396B/hu not_active IP Right Cessation
-
1992
- 1992-04-02 HK HK241/92A patent/HK24192A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| HK24192A (en) | 1992-04-10 |
| IL80194A (en) | 1990-12-23 |
| KR870001680B1 (ko) | 1987-09-22 |
| PT83449B (pt) | 1989-05-12 |
| CA1296323C (en) | 1992-02-25 |
| AU6320986A (en) | 1987-04-02 |
| SU1486062A3 (ru) | 1989-06-07 |
| HUT41779A (en) | 1987-05-28 |
| ATE62483T1 (de) | 1991-04-15 |
| NZ217721A (en) | 1989-02-24 |
| ES2002393A6 (es) | 1988-08-01 |
| DK170044B1 (da) | 1995-05-08 |
| EG17902A (en) | 1991-03-30 |
| KR870004027A (ko) | 1987-05-07 |
| EP0219256A1 (en) | 1987-04-22 |
| AU578169B2 (en) | 1988-10-13 |
| IL80194A0 (en) | 1986-12-31 |
| DK466786D0 (da) | 1986-09-30 |
| JPH0670049B2 (ja) | 1994-09-07 |
| JPS6284083A (ja) | 1987-04-17 |
| PT83449A (en) | 1986-10-01 |
| IE862587L (en) | 1987-04-01 |
| US4734501A (en) | 1988-03-29 |
| IE58690B1 (en) | 1993-11-03 |
| ZA867417B (en) | 1988-04-27 |
| DK466786A (da) | 1987-04-02 |
| GR862463B (,) | 1987-02-02 |
| PH23030A (en) | 1989-03-10 |
| DE3678665D1 (de) | 1991-05-16 |
| EP0219256B1 (en) | 1991-04-10 |
| CN86106720A (zh) | 1987-04-01 |
| CN1013446B (zh) | 1991-08-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU221978B1 (hu) | Új eritromicinszármazékok előállítására alkalmazható intermedierek | |
| JP4664814B2 (ja) | イミダゾリジン誘導体 | |
| FR2529547A1 (fr) | Derives n-imidazolyliques de composes bicycliques, leur procede de preparation et leur utilisation dans le reglage de l'hemostase vasculaire | |
| US11739057B2 (en) | Polymorphic forms of Belinostat and processes for preparation thereof | |
| HU196396B (en) | Process for n-alkylating dihydro-lisergic acid | |
| JP3030780B2 (ja) | 光学活性なケテンジチオアセタール誘導体及びその製造方法 | |
| JP3148281B2 (ja) | ラクタム誘導体の製造法 | |
| IE66980B1 (en) | Novel neplanocin derivatives | |
| WO2005084664A1 (ja) | インドール誘導体及びその用途 | |
| US7781598B2 (en) | Process for the preparation of substituted indoles | |
| US4801590A (en) | Pyrido(1,8)naphthyridinones, and their use as pharmaceuticals | |
| CN102459163B (zh) | 羟吲哚类和邻位取代的苯胺的制备方法及其作为合成中间产物的用途 | |
| RU1817776C (ru) | Способ получени (4-амино-2,6-диметилфенилсульфонил)нитрометана | |
| EP0356673A2 (en) | Substituted 5,6,7,8-tetrahydroimidazo[1,5-a]pyridines and process for their preparation | |
| US4001276A (en) | α-Alkyl(or aryl)thio-5-hydroxytryptophan derivative and the preparation process thereof | |
| US4960888A (en) | Preparation of 6-amino-1,2-dihydro-1-hydroxy-2-imino-4-piperidinopyrimidine compounds | |
| KR100241263B1 (ko) | N-알킬옥시카르보닐-베타-알킬술포닐발린 화합물의 제조방법 | |
| HU195218B (en) | Process for production of derivatives of substituated in position 5 or 6 beta-carbolin-3-carbonic acid esther and containing them medical preparatives | |
| KR101680396B1 (ko) | N[5(3디메틸아미노-아크릴로일)2플루오로페닐]n메틸아세트아미드의 제조를 위한 공정 | |
| US3892766A (en) | Process for the preparation of 4-keto-1,2,3,4-tetrahydrocarbazole | |
| US4977274A (en) | 4-hydroxyindole derivatives, the process for preparation thereof and their use | |
| Cirrincione et al. | REARRANGEMENTS OF N-UREIDOPYRROLES: A CASE OF MONONUCLEAR HETEROCYCLIC REARRANGEMENT INVOLVING AN AROMATIC HETEROCYCLE AS CARBON-NITROGEN-NITROGEN SEQUENCE | |
| PL189248B1 (pl) | Sposób wytwarzania 1-(p-metoksybenzoilo)-2-pirolidonu | |
| CS255876B2 (en) | Process for preparing new 10 alpha-methoxy-6-methyl-ergolines | |
| US20040039203A1 (en) | Process for the preparation of 1,5-disubstituted-3-amino-1,2,4,-triazoles and substituted aminoguanidines as intermediate compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |