HU185206B - Herbicide compositions containing n-bracket- phosphono-methyl-bracket closed-glycine-benzyl- and -aryl-esters and process for producing the active agents - Google Patents
Herbicide compositions containing n-bracket- phosphono-methyl-bracket closed-glycine-benzyl- and -aryl-esters and process for producing the active agents Download PDFInfo
- Publication number
- HU185206B HU185206B HU76MO971A HUMO000971A HU185206B HU 185206 B HU185206 B HU 185206B HU 76MO971 A HU76MO971 A HU 76MO971A HU MO000971 A HUMO000971 A HU MO000971A HU 185206 B HU185206 B HU 185206B
- Authority
- HU
- Hungary
- Prior art keywords
- phosphonomethyl
- glycinate
- alkyl
- benzyl
- ethyl
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims abstract description 16
- 239000000203 mixture Substances 0.000 title claims description 64
- 238000000034 method Methods 0.000 title claims description 17
- 239000004009 herbicide Substances 0.000 title abstract description 9
- 239000013543 active substance Substances 0.000 title 1
- -1 benzyloxy, phenoxy Chemical group 0.000 claims abstract description 136
- 150000001875 compounds Chemical class 0.000 claims abstract description 27
- 239000004480 active ingredient Substances 0.000 claims abstract description 22
- 238000002360 preparation method Methods 0.000 claims abstract description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 167
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 158
- 239000007787 solid Substances 0.000 claims description 89
- 239000013638 trimer Substances 0.000 claims description 36
- 239000002904 solvent Substances 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 20
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 13
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- 239000007788 liquid Substances 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000004094 surface-active agent Substances 0.000 claims description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 7
- 150000007513 acids Chemical class 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 6
- 150000008301 phosphite esters Chemical group 0.000 claims description 6
- 150000005691 triesters Chemical class 0.000 claims description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 150000007860 aryl ester derivatives Chemical class 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 239000000377 silicon dioxide Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 3
- 239000000243 solution Substances 0.000 description 74
- 239000003921 oil Substances 0.000 description 68
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 54
- 238000004458 analytical method Methods 0.000 description 44
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 43
- 238000010992 reflux Methods 0.000 description 43
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 36
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 26
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 17
- 239000004471 Glycine Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 239000000725 suspension Substances 0.000 description 14
- 150000002148 esters Chemical class 0.000 description 13
- 241000196324 Embryophyta Species 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 239000002002 slurry Substances 0.000 description 8
- 235000009899 Agrostemma githago Nutrition 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- 244000178320 Vaccaria pyramidata Species 0.000 description 7
- 239000002270 dispersing agent Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229910052698 phosphorus Inorganic materials 0.000 description 6
- 239000011574 phosphorus Substances 0.000 description 6
- 239000006228 supernatant Substances 0.000 description 6
- 240000001579 Cirsium arvense Species 0.000 description 5
- 235000005918 Cirsium arvense Nutrition 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 239000003337 fertilizer Substances 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 5
- 239000000080 wetting agent Substances 0.000 description 5
- SPXOTSHWBDUUMT-UHFFFAOYSA-N 138-42-1 Chemical compound OS(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 SPXOTSHWBDUUMT-UHFFFAOYSA-N 0.000 description 4
- CWFKYFPDOFMXFX-UHFFFAOYSA-N 2-(methylideneamino)butanoic acid Chemical compound C(=O)(O)C(CC)N=C CWFKYFPDOFMXFX-UHFFFAOYSA-N 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- 230000006378 damage Effects 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229940098779 methanesulfonic acid Drugs 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- 244000058871 Echinochloa crus-galli Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- CCNJNUGDZQIZBL-UHFFFAOYSA-N bis(2-methylphenyl) hydrogen phosphite Chemical compound CC1=CC=CC=C1OP(O)OC1=CC=CC=C1C CCNJNUGDZQIZBL-UHFFFAOYSA-N 0.000 description 3
- MWZWOLDTGUGECQ-UHFFFAOYSA-N bis(4-methoxyphenyl) hydrogen phosphite Chemical compound C1=CC(OC)=CC=C1OP(O)OC1=CC=C(OC)C=C1 MWZWOLDTGUGECQ-UHFFFAOYSA-N 0.000 description 3
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 3
- KUMNEOGIHFCNQW-UHFFFAOYSA-N diphenyl phosphite Chemical compound C=1C=CC=CC=1OP([O-])OC1=CC=CC=C1 KUMNEOGIHFCNQW-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WPTKMZOZPKPYPJ-UHFFFAOYSA-N C=1C=C(F)C=CC=1OP(O)OC1=CC=C(F)C=C1 Chemical compound C=1C=C(F)C=CC=1OP(O)OC1=CC=C(F)C=C1 WPTKMZOZPKPYPJ-UHFFFAOYSA-N 0.000 description 2
- 235000002566 Capsicum Nutrition 0.000 description 2
- 235000005853 Cyperus esculentus Nutrition 0.000 description 2
- 244000075634 Cyperus rotundus Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000006002 Pepper Substances 0.000 description 2
- 235000016761 Piper aduncum Nutrition 0.000 description 2
- 235000017804 Piper guineense Nutrition 0.000 description 2
- 244000203593 Piper nigrum Species 0.000 description 2
- 235000008184 Piper nigrum Nutrition 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- MTEYMAVTLVFIJG-UHFFFAOYSA-N (3-chlorophenyl)peroxy-[[(2-ethoxy-2-oxoethyl)amino]-hydroxymethyl]phosphinic acid Chemical compound CCOC(=O)CNC(O)P(O)(=O)OOC1=CC=CC(Cl)=C1 MTEYMAVTLVFIJG-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- QCYOIFVBYZNUNW-UHFFFAOYSA-N 2-(dimethylazaniumyl)propanoate Chemical compound CN(C)C(C)C(O)=O QCYOIFVBYZNUNW-UHFFFAOYSA-N 0.000 description 1
- YWACJRGCEVWOES-UHFFFAOYSA-N 2-aminoacetic acid methanesulfonic acid Chemical compound CS(O)(=O)=O.NCC(O)=O YWACJRGCEVWOES-UHFFFAOYSA-N 0.000 description 1
- RUECTJATXCACED-UHFFFAOYSA-N 2-aminoacetic acid;hydrate Chemical compound [OH-].[NH3+]CC(O)=O RUECTJATXCACED-UHFFFAOYSA-N 0.000 description 1
- XBPPLECAZBTMMK-UHFFFAOYSA-N 2-chloro-n,n-dimethylacetamide Chemical compound CN(C)C(=O)CCl XBPPLECAZBTMMK-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- AHDQKXFYKFGUQJ-UHFFFAOYSA-N 2-hydroxy-1,3,2-benzodioxaphosphole Chemical compound C1=CC=C2OP(O)OC2=C1 AHDQKXFYKFGUQJ-UHFFFAOYSA-N 0.000 description 1
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 244000055702 Amaranthus viridis Species 0.000 description 1
- 235000004135 Amaranthus viridis Nutrition 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 241000428352 Amma Species 0.000 description 1
- 241001233887 Ania Species 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 208000035484 Cellulite Diseases 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 1
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 1
- HSSBORCLYSCBJR-UHFFFAOYSA-N Chloramben Chemical compound NC1=CC(Cl)=CC(C(O)=O)=C1Cl HSSBORCLYSCBJR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- QAHFOPIILNICLA-UHFFFAOYSA-N Diphenamid Chemical compound C=1C=CC=CC=1C(C(=O)N(C)C)C1=CC=CC=C1 QAHFOPIILNICLA-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 244000248416 Fagopyrum cymosum Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 206010049752 Peau d'orange Diseases 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- YXOFGFDLPGFUAR-UHFFFAOYSA-N [O-][N+](C1=CC=C(CP(O)(O)O)C=C1)=O Chemical compound [O-][N+](C1=CC=C(CP(O)(O)O)C=C1)=O YXOFGFDLPGFUAR-UHFFFAOYSA-N 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 150000008061 acetanilides Chemical class 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 125000001539 acetonyl group Chemical group [H]C([H])([H])C(=O)C([H])([H])* 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 1
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-VQEHIDDOSA-N benzoic acid Chemical compound OC(=O)C1=CC=C[13CH]=C1 WPYMKLBDIGXBTP-VQEHIDDOSA-N 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QEASXYHBCOBLEU-UHFFFAOYSA-N bis(2,4,6-trimethylphenyl) hydrogen phosphite Chemical compound CC1=CC(C)=CC(C)=C1OP(O)OC1=C(C)C=C(C)C=C1C QEASXYHBCOBLEU-UHFFFAOYSA-N 0.000 description 1
- SSYOMRGYRMCHSY-UHFFFAOYSA-N bis(2,4-dichlorophenyl) hydrogen phosphite Chemical compound C=1C=C(Cl)C=C(Cl)C=1OP(O)OC1=CC=C(Cl)C=C1Cl SSYOMRGYRMCHSY-UHFFFAOYSA-N 0.000 description 1
- ZUAGNRHSAPEJRW-UHFFFAOYSA-N bis(2-methoxyphenyl) hydrogen phosphite Chemical compound COC1=CC=CC=C1OP(O)OC1=CC=CC=C1OC ZUAGNRHSAPEJRW-UHFFFAOYSA-N 0.000 description 1
- DXRRZSFVGCBWHI-UHFFFAOYSA-N bis(2-phenylphenyl) hydrogen phosphite Chemical compound C=1C=CC=C(C=2C=CC=CC=2)C=1OP(O)OC1=CC=CC=C1C1=CC=CC=C1 DXRRZSFVGCBWHI-UHFFFAOYSA-N 0.000 description 1
- PDPQEMNLXUGHNS-UHFFFAOYSA-N bis(3,4-dichlorophenyl) hydrogen phosphite Chemical compound C=1C=C(Cl)C(Cl)=CC=1OP(O)OC1=CC=C(Cl)C(Cl)=C1 PDPQEMNLXUGHNS-UHFFFAOYSA-N 0.000 description 1
- RKEKRPPUHVNPIX-UHFFFAOYSA-N bis(3,4-dimethylphenyl) hydrogen phosphite Chemical compound C1=C(C)C(C)=CC=C1OP(O)OC1=CC=C(C)C(C)=C1 RKEKRPPUHVNPIX-UHFFFAOYSA-N 0.000 description 1
- LEEIJMDGSPFENF-UHFFFAOYSA-N bis(3-chlorophenyl) hydrogen phosphite Chemical compound C=1C=CC(Cl)=CC=1OP(O)OC1=CC=CC(Cl)=C1 LEEIJMDGSPFENF-UHFFFAOYSA-N 0.000 description 1
- WAPALSKUZQDHKX-UHFFFAOYSA-N bis(3-methyl-4-nitrophenyl) hydrogen phosphite Chemical compound C1=C([N+]([O-])=O)C(C)=CC(OP(O)OC=2C=C(C)C(=CC=2)[N+]([O-])=O)=C1 WAPALSKUZQDHKX-UHFFFAOYSA-N 0.000 description 1
- ZJRNBGVJGIFZRO-UHFFFAOYSA-N bis(3-nitrophenyl) hydrogen phosphite Chemical compound C=1C=CC([N+]([O-])=O)=CC=1OP(O)OC1=CC=CC([N+]([O-])=O)=C1 ZJRNBGVJGIFZRO-UHFFFAOYSA-N 0.000 description 1
- ZOLLZXLIZDRUPF-UHFFFAOYSA-N bis(4-chlorophenyl) hydrogen phosphite Chemical compound C=1C=C(Cl)C=CC=1OP(O)OC1=CC=C(Cl)C=C1 ZOLLZXLIZDRUPF-UHFFFAOYSA-N 0.000 description 1
- KCLCBPCCSWKWOV-UHFFFAOYSA-N bis(4-nitrophenyl) hydrogen phosphite Chemical compound C=1C=C([N+]([O-])=O)C=CC=1OP(O)OC1=CC=C([N+]([O-])=O)C=C1 KCLCBPCCSWKWOV-UHFFFAOYSA-N 0.000 description 1
- VKDJPEPIWXNSFL-UHFFFAOYSA-N bis(4-phenylmethoxyphenyl) hydrogen phosphite Chemical compound C=1C=C(OCC=2C=CC=CC=2)C=CC=1OP(O)OC(C=C1)=CC=C1OCC1=CC=CC=C1 VKDJPEPIWXNSFL-UHFFFAOYSA-N 0.000 description 1
- CUNVXHFNIKHBAU-UHFFFAOYSA-N bis(4-tert-butylphenyl) hydrogen phosphite Chemical compound C1=CC(C(C)(C)C)=CC=C1OP(O)OC1=CC=C(C(C)(C)C)C=C1 CUNVXHFNIKHBAU-UHFFFAOYSA-N 0.000 description 1
- LOEOWXVVVPWDCX-UHFFFAOYSA-N bis[(4-bromophenyl)methyl] hydrogen phosphite Chemical compound C=1C=C(Br)C=CC=1COP(O)OCC1=CC=C(Br)C=C1 LOEOWXVVVPWDCX-UHFFFAOYSA-N 0.000 description 1
- GKXDRYGGSKHTCG-UHFFFAOYSA-N bis[(4-chlorophenyl)methyl] hydrogen phosphite Chemical compound C=1C=C(Cl)C=CC=1COP(O)OCC1=CC=C(Cl)C=C1 GKXDRYGGSKHTCG-UHFFFAOYSA-N 0.000 description 1
- SLEAUGLJRCPRES-UHFFFAOYSA-N bis[3-(trifluoromethyl)phenyl]phosphane Chemical compound FC(F)(F)C1=CC=CC(PC=2C=C(C=CC=2)C(F)(F)F)=C1 SLEAUGLJRCPRES-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- YFNONBGXNFCTMM-UHFFFAOYSA-N butoxybenzene Chemical group CCCCOC1=CC=CC=C1 YFNONBGXNFCTMM-UHFFFAOYSA-N 0.000 description 1
- 150000003940 butylamines Chemical class 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000036232 cellulite Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 125000004803 chlorobenzyl group Chemical group 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- OAIVIYSBZFEOIU-UHFFFAOYSA-N chloroform;propan-2-one Chemical compound CC(C)=O.ClC(Cl)Cl OAIVIYSBZFEOIU-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- IVUXTESCPZUGJC-UHFFFAOYSA-N chloroxuron Chemical compound C1=CC(NC(=O)N(C)C)=CC=C1OC1=CC=C(Cl)C=C1 IVUXTESCPZUGJC-UHFFFAOYSA-N 0.000 description 1
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012045 crude solution Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 125000006286 dichlorobenzyl group Chemical group 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 229940116901 diethyldithiocarbamate Drugs 0.000 description 1
- LMBWSYZSUOEYSN-UHFFFAOYSA-N diethyldithiocarbamic acid Chemical compound CCN(CC)C(S)=S LMBWSYZSUOEYSN-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- YHAIUSTWZPMYGG-UHFFFAOYSA-L disodium;2,2-dioctyl-3-sulfobutanedioate Chemical compound [Na+].[Na+].CCCCCCCCC(C([O-])=O)(C(C([O-])=O)S(O)(=O)=O)CCCCCCCC YHAIUSTWZPMYGG-UHFFFAOYSA-L 0.000 description 1
- JMGZBMRVDHKMKB-UHFFFAOYSA-L disodium;2-sulfobutanedioate Chemical class [Na+].[Na+].OS(=O)(=O)C(C([O-])=O)CC([O-])=O JMGZBMRVDHKMKB-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- RFRXWABRBNUAHS-UHFFFAOYSA-N ethyl 2-(methylideneamino)acetate Chemical compound CCOC(=O)CN=C RFRXWABRBNUAHS-UHFFFAOYSA-N 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- BMLIZLVNXIYGCK-UHFFFAOYSA-N monuron Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C=C1 BMLIZLVNXIYGCK-UHFFFAOYSA-N 0.000 description 1
- 125000005186 naphthyloxy group Chemical group C1(=CC=CC2=CC=CC=C12)O* 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- XITQUSLLOSKDTB-UHFFFAOYSA-N nitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1Cl XITQUSLLOSKDTB-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- RQKYHDHLEMEVDR-UHFFFAOYSA-N oxo-bis(phenylmethoxy)phosphanium Chemical compound C=1C=CC=CC=1CO[P+](=O)OCC1=CC=CC=C1 RQKYHDHLEMEVDR-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000002743 phosphorus functional group Chemical group 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- WJNRPILHGGKWCK-UHFFFAOYSA-N propazine Chemical compound CC(C)NC1=NC(Cl)=NC(NC(C)C)=N1 WJNRPILHGGKWCK-UHFFFAOYSA-N 0.000 description 1
- PHNUZKMIPFFYSO-UHFFFAOYSA-N propyzamide Chemical compound C#CC(C)(C)NC(=O)C1=CC(Cl)=CC(Cl)=C1 PHNUZKMIPFFYSO-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- RROSXLCQOOGZBR-UHFFFAOYSA-N sodium;isothiocyanate Chemical compound [Na+].[N-]=C=S RROSXLCQOOGZBR-UHFFFAOYSA-N 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000012439 solid excipient Substances 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000002426 superphosphate Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 229910002029 synthetic silica gel Inorganic materials 0.000 description 1
- 239000003784 tall oil Substances 0.000 description 1
- 229940104261 taurate Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 229940035893 uracil Drugs 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4006—Esters of acyclic acids which can have further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Cosmetics (AREA)
- Medicines Containing Plant Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64440675A | 1975-12-29 | 1975-12-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU185206B true HU185206B (en) | 1984-12-28 |
Family
ID=24584785
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU76MO971A HU185206B (en) | 1975-12-29 | 1976-12-28 | Herbicide compositions containing n-bracket- phosphono-methyl-bracket closed-glycine-benzyl- and -aryl-esters and process for producing the active agents |
Country Status (40)
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4053505A (en) * | 1976-01-05 | 1977-10-11 | Monsanto Company | Preparation of n-phosphonomethyl glycine |
| US4180394A (en) * | 1978-07-10 | 1979-12-25 | Monsanto Company | Derivatives of N-trifluoroacetyl-N-phosphonomethylglycinates and the herbicidal use thereof |
| US4218235A (en) * | 1978-07-10 | 1980-08-19 | Monsanto Company | Ester derivatives of n-trifluoroacetyl-n-phosphonomethylglycine and the herbicidal use thereof |
| US4175946A (en) * | 1978-07-10 | 1979-11-27 | Monsanto Company | Thio derivatives of N-trifluoroacetyl-N-phosphonomethylglycine |
| US4251258A (en) | 1978-09-29 | 1981-02-17 | Monsanto Company | N-(Substituted carbonyl) derivatives of N-phosphinylmethylglycinates and the herbicidal use thereof |
| US4300942A (en) | 1978-09-29 | 1981-11-17 | Monsanto Company | N-(Substituted carbonyl) derivatives of N-phos-phinylmethylglycinates and the herbicidal use thereof |
| US4226611A (en) * | 1978-11-03 | 1980-10-07 | Monsanto Company | N-Phosphonomethylglycine thioester herbicides |
| US4211547A (en) * | 1978-12-22 | 1980-07-08 | Monsanto Company | N-Phosphonomethyliminodiacetonitrile and certain derivatives thereof |
| US4211548A (en) * | 1978-12-26 | 1980-07-08 | Monsanto Company | Esters of N-phosphinothioylmethylglycine and herbicidal method |
| US4340416A (en) * | 1979-08-02 | 1982-07-20 | Monsanto Company | N-Substituted triesters of N-phosphonomethylglycine |
| US4261727A (en) * | 1979-08-02 | 1981-04-14 | Monsanto Company | Herbicidal N-substituted triesters of N-phosphonomethylglycine |
| US4322238A (en) * | 1980-08-13 | 1982-03-30 | Monsanto Company | N-Nitroso-N-phosphonomethylglycinonitrile esters and the herbicidal use thereof |
| US4322239A (en) * | 1980-08-13 | 1982-03-30 | Monsanto Company | N-Nitroso-N-phosphonomethylglycine esters and the herbicidal use thereof |
| US4395374A (en) * | 1981-01-02 | 1983-07-26 | Monsanto Company | Alkyl N-arylsulfenyl-N-diaryloxy-phosphinylmethylglycinates |
| US4666500A (en) * | 1981-01-02 | 1987-05-19 | Monsanto Company | Alkyl N-arylsulfenyl-N-diaryloxy-phosphinylmethylglycinates |
| US4401455A (en) * | 1981-10-05 | 1983-08-30 | Monsanto Company | Ester derivatives of N-alkylthio- N-cycloalkyl thio-N-phosphonomethylglycine and herbicidal methods using same |
| US4428765A (en) | 1981-10-05 | 1984-01-31 | Monsanto Company | Thiosulfenamide derivatives of N-phosphonomethylglycine triesters as herbicides |
| US4445928A (en) * | 1981-10-05 | 1984-05-01 | Monsanto Company | Herbicidal aminosulfenamide derivatives of N-phosphonomethylglycine triesters |
| US4401604A (en) * | 1981-10-05 | 1983-08-30 | Monsanto Company | Process for preparing thiosulfenamide derivatives of N-phosphonomethylglycine triesters |
| JPS5972094U (ja) * | 1982-11-06 | 1984-05-16 | オンキヨー株式会社 | スピ−カ−フレ−ム |
| EP0141794A1 (en) * | 1983-08-04 | 1985-05-15 | Monsanto Company | Aralower alkyl and substituted aralower alkyl esters of N-phosphonomethylglycines |
| US4471131A (en) * | 1983-09-27 | 1984-09-11 | Monsanto Company | Novel silyl esters of N-phosphonomethylglycine |
| US4519832A (en) * | 1984-04-27 | 1985-05-28 | Monsanto Company | Unsymmetrical aminosulfinamide derivatives of N-phosphonomethylglycine triesters, herbicidal compositions and use |
| US4594093A (en) * | 1984-11-26 | 1986-06-10 | Monsanto Co. | Triester derivatives of N-phosphonomethylthionoglycine as herbicides |
| US4601744A (en) * | 1985-02-05 | 1986-07-22 | Monsanto Company | Esters of N,N'-methylene-bis-[N-[(diaryloxyphosphinyl)methyl]glycine] as herbicides |
| US5580841A (en) * | 1985-05-29 | 1996-12-03 | Zeneca Limited | Solid, phytoactive compositions and method for their preparation |
| US4634788A (en) * | 1985-06-06 | 1987-01-06 | Monsanto Company | Herbicidal glyphosate oxime derivatives |
| US5468718A (en) * | 1985-10-21 | 1995-11-21 | Ici Americas Inc. | Liquid, phytoactive compositions and method for their preparation |
| JPS6328933U (enExample) * | 1986-08-11 | 1988-02-25 | ||
| ITTO980048A1 (it) * | 1998-01-20 | 1999-07-20 | Ipici Spa | Composizioni erbicide, procedimenti per la loro preparazione ed impieghi |
| US8470741B2 (en) * | 2003-05-07 | 2013-06-25 | Croda Americas Llc | Homogeneous liquid saccharide and oil systems |
| WO2012159047A1 (en) * | 2011-05-19 | 2012-11-22 | Gilead Sciences, Inc. | Processes and intermediates for preparing anti-hiv agents |
| PL3661937T3 (pl) | 2017-08-01 | 2021-12-20 | Gilead Sciences, Inc. | Formy krystaliczne ((s)-((((2r,5r)-5-(6-amino-9h-puryn-9-ylo)-4-fluoro-2,5-dihydrofuran-2-ylo)oksy)metylo)(fenoksy)fosforylo)-l-alaninianu etylu (gs-9131) do leczenia zakażeń wirusowych |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3799758A (en) * | 1971-08-09 | 1974-03-26 | Monsanto Co | N-phosphonomethyl-glycine phytotoxicant compositions |
| US3859183A (en) * | 1973-11-07 | 1975-01-07 | Monsanto Co | Process for producing n-phosphonomethyl glycine triesters |
| JPS5236627A (en) * | 1975-09-13 | 1977-03-22 | Nissan Chem Ind Ltd | Process for preparation of n- phosphonomethylglycine |
| JPS5272823A (en) * | 1975-12-16 | 1977-06-17 | Nissan Chem Ind Ltd | Herbicide |
-
1976
- 1976-12-17 MX MX765245U patent/MX3898E/es unknown
- 1976-12-23 IE IE2834/76A patent/IE44325B1/en unknown
- 1976-12-24 AU AU20895/76A patent/AU507499B2/en not_active Expired
- 1976-12-24 CA CA 268710 patent/CA1070704A/en not_active Expired
- 1976-12-27 ES ES454604A patent/ES454604A1/es not_active Expired
- 1976-12-27 NL NLAANVRAGE7614431,A patent/NL182881C/xx not_active IP Right Cessation
- 1976-12-28 CH CH1638176A patent/CH627922A5/de not_active IP Right Cessation
- 1976-12-28 IN IN2280/CAL/76A patent/IN145471B/en unknown
- 1976-12-28 IT IT30928/76A patent/IT1070047B/it active
- 1976-12-28 TR TR19596A patent/TR19596A/xx unknown
- 1976-12-28 DD DD76203329A patent/DD136696A5/xx unknown
- 1976-12-28 NO NO764376A patent/NO152861C/no unknown
- 1976-12-28 OA OA56025A patent/OA05523A/xx unknown
- 1976-12-28 BR BR7608756A patent/BR7608756A/pt unknown
- 1976-12-28 PL PL1976194773A patent/PL106856B1/pl unknown
- 1976-12-28 CS CS768703A patent/CS196338B2/cs unknown
- 1976-12-28 FI FI763713A patent/FI63761C/fi not_active IP Right Cessation
- 1976-12-28 BG BG035915A patent/BG27736A3/xx unknown
- 1976-12-28 EG EG799/76A patent/EG12175A/xx active
- 1976-12-28 ZA ZA767654A patent/ZA767654B/xx unknown
- 1976-12-28 PL PL1976209063A patent/PL113916B1/pl unknown
- 1976-12-28 SU SU762436651A patent/SU639416A3/ru active
- 1976-12-28 DK DK584476A patent/DK144215C/da not_active IP Right Cessation
- 1976-12-28 IL IL51170A patent/IL51170A/xx unknown
- 1976-12-28 LU LU76475A patent/LU76475A1/xx unknown
- 1976-12-28 BE BE173679A patent/BE849907A/xx not_active IP Right Cessation
- 1976-12-28 GR GR52489A patent/GR62427B/el unknown
- 1976-12-28 AT AT971076A patent/AT351858B/de not_active IP Right Cessation
- 1976-12-28 PH PH19298A patent/PH16654A/en unknown
- 1976-12-28 PT PT66022A patent/PT66022B/pt unknown
- 1976-12-28 JP JP15763776A patent/JPS5297949A/ja active Granted
- 1976-12-28 AR AR266012A patent/AR220309A1/es active
- 1976-12-28 BG BG035032A patent/BG27533A3/xx unknown
- 1976-12-28 HU HU76MO971A patent/HU185206B/hu not_active IP Right Cessation
- 1976-12-28 FR FR7639274A patent/FR2337142A1/fr active Granted
- 1976-12-28 RO RO7688876A patent/RO71484A/ro unknown
- 1976-12-28 SE SE7614619A patent/SE435386B/xx not_active IP Right Cessation
- 1976-12-28 DD DD7600196654A patent/DD130857A5/xx unknown
- 1976-12-28 DE DE2659172A patent/DE2659172C2/de not_active Expired
- 1976-12-29 GB GB54229/76A patent/GB1538209A/en not_active Expired
- 1976-12-29 YU YU03181/76A patent/YU318176A/xx unknown
-
1977
- 1977-01-06 NZ NZ183000A patent/NZ183000A/xx unknown
- 1977-03-16 NO NO770935A patent/NO152874C/no unknown
- 1977-07-12 PH PH19989A patent/PH14019A/en unknown
- 1977-09-09 SU SU772518560A patent/SU843755A3/ru active
- 1977-10-04 US US05/839,244 patent/US4120689A/en not_active Expired - Lifetime
- 1977-12-09 ES ES464928A patent/ES464928A1/es not_active Expired
-
1981
- 1981-06-24 JP JP56096797A patent/JPS5935919B2/ja not_active Expired
-
1983
- 1983-12-07 NO NO834498A patent/NO834498L/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU185206B (en) | Herbicide compositions containing n-bracket- phosphono-methyl-bracket closed-glycine-benzyl- and -aryl-esters and process for producing the active agents | |
| US4168963A (en) | Herbicidal agents | |
| US4089671A (en) | N,N'-methylenebis-[O,O-diaryl N-phosphonomethylglycinonitriles] | |
| CA1083172A (en) | N-thiolcarbonyl derivatives of n- phosphonomethylglycine | |
| ES8104810A1 (es) | Procedimiento para la preparacion de nuevos derivados 2- substituidos del acido 5-fenoxifenilfosfonico | |
| FI62842B (fi) | N-karboximetyl-n-fosfonometyl-amidsyror anvaendbara som ograesmedel | |
| EP0281103A2 (en) | Phenoxycarboxylic acid compounds and herbicide comprising it as active ingredient | |
| US4675429A (en) | Herbicides of the type N-(phosphonomethylglycyl)sulfonylamines process for forming N-(phosphonomethylglycyl) sulfonylamides | |
| US4211547A (en) | N-Phosphonomethyliminodiacetonitrile and certain derivatives thereof | |
| US2954394A (en) | O-aryl o-alkyl o-hydrogen phosphorothioates and their salts | |
| EP0007210B1 (en) | Ester derivatives of n-trifluoro-acetyl-n-phosphonomethylglycine and the herbicidal use thereof | |
| HU184657B (en) | Herbicide compositions containing n-hydroxy-n-/phosphono-methyl/-glycine or salts thereof as active substances and process for preparing the active substance | |
| HU184655B (en) | Herbicide compositions containing o-aryl- or 0,0-diaryl-n-/phosphono-methyl/-glycine nitriles and process for preparing the active substances | |
| KR840000741B1 (ko) | N-포스포노 메틸글리시노니트릴 디아릴 에스테르의 퍼플루오로 아미드의 제조방법 | |
| KR830000553B1 (ko) | 0-아릴 n-포스포노메틸글리시노니트릴의 제조방법 | |
| EP0141794A1 (en) | Aralower alkyl and substituted aralower alkyl esters of N-phosphonomethylglycines | |
| KR810000914B1 (ko) | N,n'-메틸렌 비스-[0,0-디아릴 n-포스포노 메틸-글리시노 니트릴]의 제조방법 | |
| US3449390A (en) | Benzyl,alkyl arsenic acids and the preparation thereof | |
| EP0146219A1 (en) | Aminophosphonic & aminophosphinic acid derivatives processes for their preparation & herbicidal compositions containing them | |
| US3260719A (en) | Organo-phosphorus s-triazine derivatives | |
| KR810000411B1 (ko) | N-포스포노메틸글리신 유도체의 제조방법 | |
| PL236261B1 (pl) | Bisamoniowe ciecze jonowe z kationem alkilo-1,X-bis-(decylodimetyloamoniowym), sposób ich otrzymywania oraz zastosowanie jako herbicydy | |
| HU177354B (en) | Herbicide compositions containing n,n-comma above-methylene-bis-square bracket-o,o-diaryl-n-phosphono-methyl-glycine-nitril-square bracket closed derivatives and process for producing the active agents | |
| KR800001179B1 (ko) | N-포스포노메틸 글리신의 n-티올카보닐 유도체의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |