GB1561792A - Process for the production of polyesteramides - Google Patents
Process for the production of polyesteramides Download PDFInfo
- Publication number
- GB1561792A GB1561792A GB39488/76A GB3948876A GB1561792A GB 1561792 A GB1561792 A GB 1561792A GB 39488/76 A GB39488/76 A GB 39488/76A GB 3948876 A GB3948876 A GB 3948876A GB 1561792 A GB1561792 A GB 1561792A
- Authority
- GB
- United Kingdom
- Prior art keywords
- stage
- water
- process according
- acid
- pressure
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 34
- 229920006149 polyester-amide block copolymer Polymers 0.000 title claims description 18
- 238000004519 manufacturing process Methods 0.000 title claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 43
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 13
- 150000002009 diols Chemical class 0.000 claims description 10
- 150000003951 lactams Chemical class 0.000 claims description 9
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 229920002601 oligoester Polymers 0.000 claims description 7
- 238000009833 condensation Methods 0.000 claims description 6
- 230000005494 condensation Effects 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 6
- 239000006227 byproduct Substances 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 239000000178 monomer Substances 0.000 claims description 3
- 150000005846 sugar alcohols Polymers 0.000 claims description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 20
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 20
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 20
- 239000000047 product Substances 0.000 description 17
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 16
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 14
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 10
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 239000008187 granular material Substances 0.000 description 9
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 8
- 239000001361 adipic acid Substances 0.000 description 8
- 235000011037 adipic acid Nutrition 0.000 description 8
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 6
- 238000006068 polycondensation reaction Methods 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 5
- 150000004985 diamines Chemical class 0.000 description 5
- 150000001991 dicarboxylic acids Chemical class 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- 239000004952 Polyamide Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- PXGZQGDTEZPERC-UHFFFAOYSA-N 1,4-cyclohexanedicarboxylic acid Chemical compound OC(=O)C1CCC(C(O)=O)CC1 PXGZQGDTEZPERC-UHFFFAOYSA-N 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- -1 alkali metal hydrogen Chemical class 0.000 description 3
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 3
- GTZOYNFRVVHLDZ-UHFFFAOYSA-N dodecane-1,1-diol Chemical compound CCCCCCCCCCCC(O)O GTZOYNFRVVHLDZ-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 3
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000004246 zinc acetate Substances 0.000 description 3
- HASUJDLTAYUWCO-UHFFFAOYSA-N 2-aminoundecanoic acid Chemical compound CCCCCCCCCC(N)C(O)=O HASUJDLTAYUWCO-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- FPCJKVGGYOAWIZ-UHFFFAOYSA-N butan-1-ol;titanium Chemical compound [Ti].CCCCO.CCCCO.CCCCO.CCCCO FPCJKVGGYOAWIZ-UHFFFAOYSA-N 0.000 description 2
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 2
- 239000001639 calcium acetate Substances 0.000 description 2
- 235000011092 calcium acetate Nutrition 0.000 description 2
- 229960005147 calcium acetate Drugs 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- QUBNFZFTFXTLKH-UHFFFAOYSA-N 2-aminododecanoic acid Chemical compound CCCCCCCCCCC(N)C(O)=O QUBNFZFTFXTLKH-UHFFFAOYSA-N 0.000 description 1
- MIDXCONKKJTLDX-UHFFFAOYSA-N 3,5-dimethylcyclopentane-1,2-dione Chemical compound CC1CC(C)C(=O)C1=O MIDXCONKKJTLDX-UHFFFAOYSA-N 0.000 description 1
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- UFFRSDWQMJYQNE-UHFFFAOYSA-N 6-azaniumylhexylazanium;hexanedioate Chemical compound [NH3+]CCCCCC[NH3+].[O-]C(=O)CCCCC([O-])=O UFFRSDWQMJYQNE-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 241000353355 Oreosoma atlanticum Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- OXIKYYJDTWKERT-UHFFFAOYSA-N [4-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCC(CN)CC1 OXIKYYJDTWKERT-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- YDLSUFFXJYEVHW-UHFFFAOYSA-N azonan-2-one Chemical compound O=C1CCCCCCCN1 YDLSUFFXJYEVHW-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 235000013736 caramel Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000007257 deesterification reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- LNGAGQAGYITKCW-UHFFFAOYSA-N dimethyl cyclohexane-1,4-dicarboxylate Chemical compound COC(=O)C1CCC(C(=O)OC)CC1 LNGAGQAGYITKCW-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- PBLZLIFKVPJDCO-UHFFFAOYSA-N omega-Aminododecanoic acid Natural products NCCCCCCCCCCCC(O)=O PBLZLIFKVPJDCO-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000009666 routine test Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- CRHIAMBJMSSNNM-UHFFFAOYSA-N tetraphenylstannane Chemical compound C1=CC=CC=C1[Sn](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CRHIAMBJMSSNNM-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/44—Polyester-amides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2542467A DE2542467C2 (de) | 1975-09-24 | 1975-09-24 | Verfahren zur Herstellung thermoplastisch verarbeitbarer, farbloser bzw. praktisch farbloser Polyesteramide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1561792A true GB1561792A (en) | 1980-03-05 |
Family
ID=5957208
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB39488/76A Expired GB1561792A (en) | 1975-09-24 | 1976-09-23 | Process for the production of polyesteramides |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4101524A (enExample) |
| JP (1) | JPS5847403B2 (enExample) |
| BE (1) | BE846514A (enExample) |
| CH (1) | CH601381A5 (enExample) |
| DE (1) | DE2542467C2 (enExample) |
| FR (1) | FR2325674A1 (enExample) |
| GB (1) | GB1561792A (enExample) |
| IT (1) | IT1066197B (enExample) |
| NL (1) | NL172962C (enExample) |
| SU (1) | SU609474A3 (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2712987C2 (de) * | 1977-03-24 | 1981-09-24 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Herstellung von thermoplastischen Polyetheresteramiden mit statistisch in der Polymerkette verteilten Einheiten der Ausgangskomponenten |
| DE2913460A1 (de) * | 1979-04-04 | 1980-10-16 | Bayer Ag | Estermodifizierte polyamide |
| DE2936759C2 (de) * | 1979-09-12 | 1987-03-26 | Hüls AG, 4370 Marl | Transparente Copolyamide |
| EP0042008B1 (en) * | 1979-12-21 | 1986-04-09 | Toray Industries, Inc. | Polyester amides and adhesives therefrom |
| DE3274456D1 (en) * | 1981-06-15 | 1987-01-15 | Toray Industries | Process for producing aliphatic copolyesteramide and tube moulded therefrom |
| JPS58154725A (ja) * | 1983-02-25 | 1983-09-14 | Toray Ind Inc | ポリエステルアミド |
| US4482587A (en) * | 1983-05-19 | 1984-11-13 | Eastman Kodak Company | Bonding compositions and shaped articles utilizing the bonding compositions |
| DE3465725D1 (en) * | 1983-05-19 | 1987-10-08 | Eastman Kodak Co | Bonding compositions for polyester-poly(vinyl alcohol) laminates |
| US4481238A (en) * | 1983-05-19 | 1984-11-06 | Eastman Kodak Company | Bonding compositions and shaped articles utilizing the bonding compositions |
| US4482588A (en) * | 1983-05-19 | 1984-11-13 | Eastman Kodak Company | Bonding compositions and shaped articles utilizing the bonding compositions |
| DE3909215A1 (de) * | 1989-02-11 | 1990-08-23 | Bayer Ag | Polyetheramid-schmelzklebstoffe |
| US7196127B2 (en) * | 2003-09-22 | 2007-03-27 | Jen-Show Lai | Biodegradable polyesteramide and preparation method |
| KR101570561B1 (ko) | 2012-12-28 | 2015-11-19 | 제일모직주식회사 | 결정성 폴리아미드에스테르 수지, 이의 제조방법 및 이를 포함하는 제품 |
| KR101593745B1 (ko) | 2013-05-31 | 2016-02-12 | 제일모직주식회사 | 폴리아미드에스테르 수지, 이의 제조방법 및 이를 포함하는 제품 |
| WO2019147457A2 (en) * | 2018-01-23 | 2019-08-01 | Eastman Chemical Company | Novel polyestermides, processes for the preparation thereof, and polyesteramide compositions |
| CN116535641B (zh) * | 2023-05-08 | 2024-06-11 | 湖南聚仁新材料股份公司 | 一种嵌段型聚酯酰胺及其制备方法 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT210143B (de) * | 1937-08-20 | 1960-07-11 | Du Pont | Verfahren zur Herstellung von linearen Polyamiden |
| DE926935C (de) * | 1938-09-27 | 1955-04-25 | Du Pont | Verfahren zur Herstellung von linearen Polyester-Polyamiden |
| US2241322A (en) * | 1938-09-30 | 1941-05-06 | Du Pont | Process for preparing polyamides from cyclic amides |
| US2396248A (en) * | 1940-04-22 | 1946-03-12 | Du Pont | Fiber-forming polymers and method of making them |
| BE592181A (enExample) * | 1955-12-22 | |||
| GB960249A (en) * | 1955-12-22 | 1964-06-10 | Kodak Ltd | Improvements in linear polyesteramides |
| NL255414A (enExample) * | 1959-08-31 | |||
| US3272776A (en) * | 1962-04-05 | 1966-09-13 | Eastman Kodak Co | Preparation of poly |
| DE1495149B2 (de) * | 1963-10-26 | 1970-04-09 | Badische Anilin- & Soda-Fabrik AG, 67OO Ludwigshafen | Verfahren zur Herstellung von PoIylaurinlactam |
| GB1124271A (en) * | 1965-01-12 | 1968-08-21 | Ici Ltd | Process for treatment of shaped articles |
| GB1126824A (en) * | 1965-02-17 | 1968-09-11 | Eastman Kodak Co | Poly (amide-esters) of aromatic compounds |
| DE1745448A1 (de) * | 1967-05-09 | 1971-09-16 | Veba Chemie Ag | Verfahren zur Herstellung von polymeren Esteramiden |
| DE1745455A1 (de) * | 1967-07-12 | 1971-09-09 | Veba Chemie Ag | Verfahren zur Herstellung von Polyesteramiden |
| GB1241447A (en) * | 1968-07-04 | 1971-08-04 | Ici Ltd | Polycondensates containing ester groups and alkoxymethylated amide groups, and treatment of shaped articles therewith |
| US3546178A (en) * | 1968-12-23 | 1970-12-08 | Eastman Kodak Co | Preparation of linear poly(ester-amides) |
| US3836574A (en) * | 1971-09-02 | 1974-09-17 | Hoechst Ag | Process for the manufacture of film-and fiber-forming polyesters |
| DE2152194C3 (de) * | 1971-10-20 | 1984-09-20 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Herstellung von Polylaurinlactam |
| US3828010A (en) * | 1973-06-04 | 1974-08-06 | Eastman Kodak Co | Water-dissipatable polyesteramides |
-
1975
- 1975-09-24 DE DE2542467A patent/DE2542467C2/de not_active Expired
-
1976
- 1976-08-24 US US05/717,358 patent/US4101524A/en not_active Expired - Lifetime
- 1976-09-15 FR FR7627737A patent/FR2325674A1/fr active Granted
- 1976-09-21 IT IT51366/76A patent/IT1066197B/it active
- 1976-09-21 CH CH1194276A patent/CH601381A5/xx not_active IP Right Cessation
- 1976-09-22 JP JP51114362A patent/JPS5847403B2/ja not_active Expired
- 1976-09-22 SU SU762399532A patent/SU609474A3/ru active
- 1976-09-23 NL NLAANVRAGE7610586,A patent/NL172962C/xx not_active IP Right Cessation
- 1976-09-23 GB GB39488/76A patent/GB1561792A/en not_active Expired
- 1976-09-23 BE BE170888A patent/BE846514A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2325674B1 (enExample) | 1981-08-07 |
| JPS5847403B2 (ja) | 1983-10-22 |
| NL172962C (nl) | 1983-11-16 |
| BE846514A (fr) | 1977-03-23 |
| US4101524A (en) | 1978-07-18 |
| FR2325674A1 (fr) | 1977-04-22 |
| SU609474A3 (ru) | 1978-05-30 |
| NL172962B (nl) | 1983-06-16 |
| CH601381A5 (enExample) | 1978-07-14 |
| NL7610586A (nl) | 1977-03-28 |
| IT1066197B (it) | 1985-03-04 |
| DE2542467C2 (de) | 1983-05-05 |
| JPS5245693A (en) | 1977-04-11 |
| DE2542467A1 (de) | 1977-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1561792A (en) | Process for the production of polyesteramides | |
| US3313777A (en) | Linear polyesters and polyester-amides from 2, 2, 4, 4-tetraalkyl-1, 3-cyclobutanediols | |
| US2901466A (en) | Linear polyesters and polyester-amides from 1,4-cyclohexanedimethanol | |
| KR101377355B1 (ko) | 반-결정성 반-방향족 폴리아마이드 | |
| US4115475A (en) | Method to prepare copolyesteramides for moulding | |
| GB1602691A (en) | Process for the production of polyether esteramides | |
| JP3190373B2 (ja) | 無定形コポリアミド、その製法及び成形部材の製法 | |
| US3301827A (en) | Polymers from polycyclic reactants having functional substituents on bridgehead carbon atoms | |
| US4111921A (en) | Transparent polyamides | |
| EP1226202B1 (en) | Copolyamide based on tetramethylene terephthalamide and hexamethylene terephthalamide | |
| UA112561C2 (uk) | Спосіб отримання аліфатичних поліестерів | |
| IE50612B1 (en) | Copolyesteramides which are pliable at low temperature | |
| JPS63456B2 (enExample) | ||
| AU697198B2 (en) | Partially crystalline block copolyester-polyamides | |
| Serrano et al. | Alternating polyesteramides based on 1, 4-butylene terephthalamide: 2. Alternating polyesteramides based on a single, linear diol (4NTm) | |
| US5504148A (en) | Aliphatic polyesters and method of preparing the same | |
| CA1048688A (en) | Linear copolyesters based on terephthalic acid and/or isophthalic acid | |
| US3647761A (en) | Polyamides of a c7-12 aliphatic dicarboxylic acid terephthalic acid and an aliphatic diamine | |
| US3761451A (en) | Amino acid urethane polymer solutions and shaped products | |
| US4195165A (en) | Aliphatic polyamide from disubstituted decane diamine | |
| JPS5946976B2 (ja) | ポリエステルアミドの製造法 | |
| JPH06322081A (ja) | 脂肪族ポリエステル及びその製造方法 | |
| Garg et al. | Concept and synthesis of poly (ester amide) s with one isolated, two or three consecutive amide bonds randomly distributed along the polyester backbone | |
| US4108841A (en) | Thermoplastic polyesters and processes for their manufacture | |
| US2865894A (en) | Polyamides from dicyclohexyladipic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |