FI80043C - Foerfarande foer framstaellning av terapeutiskt anvaendbara substituerade 3-aminometylcefalossporiner och nya mellanprodukter. - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara substituerade 3-aminometylcefalossporiner och nya mellanprodukter. Download PDFInfo
- Publication number
- FI80043C FI80043C FI842211A FI842211A FI80043C FI 80043 C FI80043 C FI 80043C FI 842211 A FI842211 A FI 842211A FI 842211 A FI842211 A FI 842211A FI 80043 C FI80043 C FI 80043C
- Authority
- FI
- Finland
- Prior art keywords
- alkyl
- formula
- solvent
- nmr
- hydrogen
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 71
- 229930186147 Cephalosporin Natural products 0.000 title claims description 35
- 229940124587 cephalosporin Drugs 0.000 title claims description 35
- 238000002360 preparation method Methods 0.000 title claims description 11
- 239000000543 intermediate Substances 0.000 title description 7
- -1 2-aminothiazol-4-yl Chemical group 0.000 claims description 117
- 150000001875 compounds Chemical class 0.000 claims description 104
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 87
- 125000000217 alkyl group Chemical group 0.000 claims description 65
- 239000000460 chlorine Substances 0.000 claims description 46
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 41
- 229910052739 hydrogen Inorganic materials 0.000 claims description 39
- 239000001257 hydrogen Substances 0.000 claims description 38
- 150000001780 cephalosporins Chemical class 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 27
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 24
- 150000003839 salts Chemical class 0.000 claims description 24
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 14
- 150000002431 hydrogen Chemical class 0.000 claims description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 239000002585 base Substances 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 125000006239 protecting group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 7
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 7
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 6
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 6
- 239000012458 free base Substances 0.000 claims description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 4
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 150000002500 ions Chemical class 0.000 claims description 3
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 2
- LWTIGYSPAXKMDG-UHFFFAOYSA-N 2,3-dihydro-1h-imidazole Chemical compound C1NC=CN1 LWTIGYSPAXKMDG-UHFFFAOYSA-N 0.000 claims description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000006620 amino-(C1-C6) alkyl group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical group C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 7
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 2
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000006528 (C2-C6) alkyl group Chemical group 0.000 claims 1
- 125000006529 (C3-C6) alkyl group Chemical group 0.000 claims 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 1
- SCEVBRBKKQZTKM-UHFFFAOYSA-N 5-[[6-chloro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-N-hydroxy-2-methylbenzamide Chemical compound ClC=1C(=CC2=C(NC(=N2)OC=2C=CC(=C(C(=O)NO)C=2)C)C=1)C=1C=C2C=CN(C2=CC=1)C SCEVBRBKKQZTKM-UHFFFAOYSA-N 0.000 claims 1
- 125000005236 alkanoylamino group Chemical group 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 310
- 239000002904 solvent Substances 0.000 description 241
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 120
- 239000007858 starting material Substances 0.000 description 115
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 90
- 239000000203 mixture Substances 0.000 description 87
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 86
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 79
- 239000000047 product Substances 0.000 description 70
- 239000000243 solution Substances 0.000 description 69
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 63
- 239000003480 eluent Substances 0.000 description 60
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 57
- 238000004128 high performance liquid chromatography Methods 0.000 description 55
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 49
- 229910004373 HOAc Inorganic materials 0.000 description 49
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 40
- 238000006243 chemical reaction Methods 0.000 description 37
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 35
- 238000004587 chromatography analysis Methods 0.000 description 32
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 30
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 29
- 239000011347 resin Substances 0.000 description 24
- 229920005989 resin Polymers 0.000 description 24
- 238000003756 stirring Methods 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 20
- 239000000706 filtrate Substances 0.000 description 18
- 239000002244 precipitate Substances 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 235000019439 ethyl acetate Nutrition 0.000 description 17
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 15
- 235000017557 sodium bicarbonate Nutrition 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- 238000010992 reflux Methods 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 12
- 101100313763 Arabidopsis thaliana TIM22-2 gene Proteins 0.000 description 12
- 241000588724 Escherichia coli Species 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 12
- YTJSFYQNRXLOIC-UHFFFAOYSA-N octadecylsilane Chemical compound CCCCCCCCCCCCCCCCCC[SiH3] YTJSFYQNRXLOIC-UHFFFAOYSA-N 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 239000007868 Raney catalyst Substances 0.000 description 10
- 229910000564 Raney nickel Inorganic materials 0.000 description 10
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 10
- 230000008020 evaporation Effects 0.000 description 10
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 9
- 239000005909 Kieselgur Substances 0.000 description 9
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 238000000746 purification Methods 0.000 description 9
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 8
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 8
- 239000001099 ammonium carbonate Substances 0.000 description 8
- 235000012501 ammonium carbonate Nutrition 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 8
- 238000010561 standard procedure Methods 0.000 description 8
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 7
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000012299 nitrogen atmosphere Substances 0.000 description 7
- 238000001556 precipitation Methods 0.000 description 7
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 6
- XCHSSZMKKXPBAI-UHFFFAOYSA-N 4-methylsulfanylpyridine Chemical compound CSC1=CC=NC=C1 XCHSSZMKKXPBAI-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 6
- 230000000844 anti-bacterial effect Effects 0.000 description 6
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 6
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 241000219470 Mirabilis Species 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 238000010511 deprotection reaction Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 125000000623 heterocyclic group Chemical group 0.000 description 5
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000008194 pharmaceutical composition Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- ILTKGLWEAOKGAK-UHFFFAOYSA-M 4-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C=C1 ILTKGLWEAOKGAK-UHFFFAOYSA-M 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 229960004424 carbon dioxide Drugs 0.000 description 4
- 235000011089 carbon dioxide Nutrition 0.000 description 4
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 238000010898 silica gel chromatography Methods 0.000 description 4
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- YWWZASFPWWPUBN-UHFFFAOYSA-N 1-bromoisoquinoline Chemical compound C1=CC=C2C(Br)=NC=CC2=C1 YWWZASFPWWPUBN-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- LMYLEZYGXCVCEY-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)pyridine Chemical compound ClCC1=CC(Cl)=CC=N1 LMYLEZYGXCVCEY-UHFFFAOYSA-N 0.000 description 3
- PVMNPAUTCMBOMO-UHFFFAOYSA-N 4-chloropyridine Chemical class ClC1=CC=NC=C1 PVMNPAUTCMBOMO-UHFFFAOYSA-N 0.000 description 3
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical compound OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- JPUTTYRVDANTBN-UHFFFAOYSA-N ethyl methanimidate;hydrochloride Chemical compound Cl.CCOC=N JPUTTYRVDANTBN-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- WXAZKFDZPUFDML-WMMMYUQOSA-N (2z)-2-(cyanomethoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound N#CCO\N=C(C(=O)O)\C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 WXAZKFDZPUFDML-WMMMYUQOSA-N 0.000 description 2
- IUGLELXUMXFCQD-JYUHDHNASA-N (2z)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CC(C)(C)OC(=O)NCCO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 IUGLELXUMXFCQD-JYUHDHNASA-N 0.000 description 2
- BJJVYGINKGULCF-OMNKOJBGSA-N (6r)-3-(aminomethyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(CN)=C(C(O)=O)N2C(=O)C(NC(=O)OC(C)(C)C)[C@H]21 BJJVYGINKGULCF-OMNKOJBGSA-N 0.000 description 2
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- XXJGBENTLXFVFI-UHFFFAOYSA-N 1-amino-methylene Chemical compound N[CH2] XXJGBENTLXFVFI-UHFFFAOYSA-N 0.000 description 2
- IBYHHJPAARCAIE-UHFFFAOYSA-N 1-bromo-2-chloroethane Chemical compound ClCCBr IBYHHJPAARCAIE-UHFFFAOYSA-N 0.000 description 2
- WGMHMVLZFAJNOT-UHFFFAOYSA-N 1-ethoxyethylideneazanium;chloride Chemical compound [Cl-].CCOC(C)=[NH2+] WGMHMVLZFAJNOT-UHFFFAOYSA-N 0.000 description 2
- OWVBVNSYKXWWAE-UHFFFAOYSA-N 2-(azidomethyl)-4-chloropyridine Chemical compound ClC1=CC=NC(CN=[N+]=[N-])=C1 OWVBVNSYKXWWAE-UHFFFAOYSA-N 0.000 description 2
- RXNZFHIEDZEUQM-UHFFFAOYSA-N 2-bromo-1,3-thiazole Chemical compound BrC1=NC=CS1 RXNZFHIEDZEUQM-UHFFFAOYSA-N 0.000 description 2
- MVAXKFAQKTWRAH-UHFFFAOYSA-N 4-chloro-6-methylpyrimidine Chemical compound CC1=CC(Cl)=NC=N1 MVAXKFAQKTWRAH-UHFFFAOYSA-N 0.000 description 2
- VZDOLJHAWASTCZ-UHFFFAOYSA-N 4-methylsulfanyl-2-propylquinazoline Chemical compound C1=CC=CC2=NC(CCC)=NC(SC)=C21 VZDOLJHAWASTCZ-UHFFFAOYSA-N 0.000 description 2
- COABNVNLVJLMAS-UHFFFAOYSA-N 4-methylsulfanylquinazoline Chemical compound C1=CC=C2C(SC)=NC=NC2=C1 COABNVNLVJLMAS-UHFFFAOYSA-N 0.000 description 2
- OTCYFCHOGMFRDM-UHFFFAOYSA-N 7-chloro-4-methylsulfanylquinazoline Chemical compound ClC1=CC=C2C(SC)=NC=NC2=C1 OTCYFCHOGMFRDM-UHFFFAOYSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 241000588697 Enterobacter cloacae Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000022244 formylation Effects 0.000 description 2
- 238000006170 formylation reaction Methods 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000002829 nitrogen Chemical class 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000008055 phosphate buffer solution Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- XTVAOGFZTSUERE-UHFFFAOYSA-N tert-butyl n-[2-(4-chloropyridin-1-ium-1-yl)ethyl]carbamate;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CC(C)(C)OC(=O)NCC[N+]1=CC=C(Cl)C=C1 XTVAOGFZTSUERE-UHFFFAOYSA-N 0.000 description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- DWAWYEUJUWLESO-UHFFFAOYSA-N trichloromethylsilane Chemical compound [SiH3]C(Cl)(Cl)Cl DWAWYEUJUWLESO-UHFFFAOYSA-N 0.000 description 2
- SIOVKLKJSOKLIF-HJWRWDBZSA-N trimethylsilyl (1z)-n-trimethylsilylethanimidate Chemical compound C[Si](C)(C)OC(/C)=N\[Si](C)(C)C SIOVKLKJSOKLIF-HJWRWDBZSA-N 0.000 description 2
- LZTRCELOJRDYMQ-UHFFFAOYSA-N triphenylmethanol Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)C1=CC=CC=C1 LZTRCELOJRDYMQ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NSWHTWVHOBWFDQ-MRRCHDRASA-N (2e)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetic acid Chemical compound C=1SC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=NC=1/C(C(=O)O)=N\OC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 NSWHTWVHOBWFDQ-MRRCHDRASA-N 0.000 description 1
- IPARGUVYMOMVNU-LLVKDONJSA-N (2r)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid Chemical compound O=C1C(=O)N(CC)CCN1C(=O)N[C@@H](C(O)=O)C1=CC=C(O)C=C1 IPARGUVYMOMVNU-LLVKDONJSA-N 0.000 description 1
- QMMPFPLSEIBZCF-WMMMYUQOSA-N (2z)-2-(2-amino-2-oxoethoxy)imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound NC(=O)CO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 QMMPFPLSEIBZCF-WMMMYUQOSA-N 0.000 description 1
- DHHGKPVJEBCXLJ-WMMMYUQOSA-N (2z)-2-(2-bromoethoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound BrCCO\N=C(C(=O)O)\C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 DHHGKPVJEBCXLJ-WMMMYUQOSA-N 0.000 description 1
- XRSOYEWUZGNEFB-GDWJVWIDSA-N (2z)-2-(2-ethoxyethoxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CCOCCO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 XRSOYEWUZGNEFB-GDWJVWIDSA-N 0.000 description 1
- FILXMIKOWJWDKV-WCIBSUBMSA-N (2z)-2-(5-bromo-2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CO\N=C(/C(O)=O)C=1N=C(NC=O)SC=1Br FILXMIKOWJWDKV-WCIBSUBMSA-N 0.000 description 1
- RLIIROLYNCDXLI-RLANJUCJSA-N (2z)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutyl]oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound C=1SC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=NC=1C(/C(O)=O)=N/OC1(C(=O)OC(C)(C)C)CCC1 RLIIROLYNCDXLI-RLANJUCJSA-N 0.000 description 1
- PHBAFSJFAJNNSF-KCFYYHDHSA-N (2z)-2-[2-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]sulfanylethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CC(C)(C)OC(=O)C1=CC=CC=C1SCCO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 PHBAFSJFAJNNSF-KCFYYHDHSA-N 0.000 description 1
- LWRXBZDYMOWJEV-FAJYDZGRSA-N (2z)-2-ethoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CCO\N=C(/C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 LWRXBZDYMOWJEV-FAJYDZGRSA-N 0.000 description 1
- GYPXHTYLLUUDHE-AUWJEWJLSA-N (2z)-2-methoxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-4-yl]acetic acid Chemical compound CO\N=C(/C(O)=O)C1=COC(NC(=O)OC(C)(C)C)=N1 GYPXHTYLLUUDHE-AUWJEWJLSA-N 0.000 description 1
- MATCFRWXASIMLN-UHFFFAOYSA-M (4-chloro-1-methylpyridin-1-ium-2-yl)methyl acetate;methyl sulfate Chemical compound COS([O-])(=O)=O.CC(=O)OCC1=CC(Cl)=CC=[N+]1C MATCFRWXASIMLN-UHFFFAOYSA-M 0.000 description 1
- WOEWMGJSTHBCRB-HWZXHQHMSA-N (6R)-7-amino-3-(azidomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC1[C@@H]2N(C(=C(CS2)CN=[N+]=[N-])C(=O)O)C1=O WOEWMGJSTHBCRB-HWZXHQHMSA-N 0.000 description 1
- XSBHBYCNRIIYDF-BAFYGKSASA-N (6r)-4-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CC(N)S[C@@H]2CC(=O)N21 XSBHBYCNRIIYDF-BAFYGKSASA-N 0.000 description 1
- FZDRVLJSDYQRPO-HWZXHQHMSA-N (6r)-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CC(C)S[C@@H]2CC(=O)N21 FZDRVLJSDYQRPO-HWZXHQHMSA-N 0.000 description 1
- 125000005868 (methoxymethoxy)methanyl group Chemical group [H]C([H])([H])OC([H])([H])OC([H])([H])* 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 1
- KXAHDPKQOFASEB-UHFFFAOYSA-N 1,4-dibromoisoquinoline Chemical compound C1=CC=C2C(Br)=CN=C(Br)C2=C1 KXAHDPKQOFASEB-UHFFFAOYSA-N 0.000 description 1
- OYQZQNMFTCJSLQ-UHFFFAOYSA-M 1-(4-methylsulfinylpyridin-1-ium-1-yl)propan-2-one;chloride Chemical compound [Cl-].CC(=O)C[N+]1=CC=C(S(C)=O)C=C1 OYQZQNMFTCJSLQ-UHFFFAOYSA-M 0.000 description 1
- BIAAQBNMRITRDV-UHFFFAOYSA-N 1-(chloromethoxy)-2-methoxyethane Chemical compound COCCOCCl BIAAQBNMRITRDV-UHFFFAOYSA-N 0.000 description 1
- OAPXNORCQAMGAJ-UHFFFAOYSA-M 1-benzyl-4-chloropyridin-1-ium;bromide Chemical compound [Br-].C1=CC(Cl)=CC=[N+]1CC1=CC=CC=C1 OAPXNORCQAMGAJ-UHFFFAOYSA-M 0.000 description 1
- OTRYVKDIWLGHNU-UHFFFAOYSA-M 1-benzyl-4-methylsulfanylquinazolin-1-ium;chloride Chemical compound [Cl-].C12=CC=CC=C2C(SC)=NC=[N+]1CC1=CC=CC=C1 OTRYVKDIWLGHNU-UHFFFAOYSA-M 0.000 description 1
- MMYKTRPLXXWLBC-UHFFFAOYSA-N 1-bromo-2-ethoxyethane Chemical compound CCOCCBr MMYKTRPLXXWLBC-UHFFFAOYSA-N 0.000 description 1
- ZLTKWHIWKLGHOF-UHFFFAOYSA-N 1-cyclopropylpyridin-4-one Chemical compound C1=CC(=O)C=CN1C1CC1 ZLTKWHIWKLGHOF-UHFFFAOYSA-N 0.000 description 1
- HIJUNUKEBATFPF-UHFFFAOYSA-M 1-ethylpyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC[N+]1=CC=CC=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 HIJUNUKEBATFPF-UHFFFAOYSA-M 0.000 description 1
- KDRNILXJMALQBN-UHFFFAOYSA-N 1-ethylpyridin-4-one Chemical compound CCN1C=CC(=O)C=C1 KDRNILXJMALQBN-UHFFFAOYSA-N 0.000 description 1
- KCDJQVCUGATWAS-UHFFFAOYSA-M 1-methoxy-3-methylbenzimidazol-3-ium;iodide Chemical compound [I-].C1=CC=C2[N+](OC)=CN(C)C2=C1 KCDJQVCUGATWAS-UHFFFAOYSA-M 0.000 description 1
- WTDKNKIQGBNMKG-UHFFFAOYSA-M 1-methylpyridin-1-ium;bromide Chemical compound [Br-].C[N+]1=CC=CC=C1 WTDKNKIQGBNMKG-UHFFFAOYSA-M 0.000 description 1
- HLNJFEXZDGURGZ-UHFFFAOYSA-M 1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1 HLNJFEXZDGURGZ-UHFFFAOYSA-M 0.000 description 1
- MIUVWJJNPDWVMH-UHFFFAOYSA-N 1-propylpyridin-4-one Chemical compound CCCN1C=CC(=O)C=C1 MIUVWJJNPDWVMH-UHFFFAOYSA-N 0.000 description 1
- XZSDAVQPXFMHBG-UHFFFAOYSA-N 1-tert-butyl-4-chloropyridin-1-ium Chemical compound CC(C)(C)[N+]1=CC=C(Cl)C=C1 XZSDAVQPXFMHBG-UHFFFAOYSA-N 0.000 description 1
- DMSSTTLDFWKBSX-UHFFFAOYSA-N 1h-1,2,3-benzotriazin-4-one Chemical compound C1=CC=C2C(=O)N=NNC2=C1 DMSSTTLDFWKBSX-UHFFFAOYSA-N 0.000 description 1
- KMOYVWBLNBADMY-UHFFFAOYSA-N 1h-azepine;methanesulfonic acid Chemical compound CS(O)(=O)=O.N1C=CC=CC=C1 KMOYVWBLNBADMY-UHFFFAOYSA-N 0.000 description 1
- PMRFHZGOPOAXMA-UHFFFAOYSA-N 2,3,4,5-tetramethylquinoline;azide Chemical compound [N-]=[N+]=[N-].C1=CC(C)=C2C(C)=C(C)C(C)=NC2=C1 PMRFHZGOPOAXMA-UHFFFAOYSA-N 0.000 description 1
- HBGBCWDOYVUUAA-UHFFFAOYSA-M 2-(4-methylsulfanylpyridin-1-ium-1-yl)ethanimidamide;chloride Chemical compound [Cl-].CSC1=CC=[N+](CC(N)=N)C=C1 HBGBCWDOYVUUAA-UHFFFAOYSA-M 0.000 description 1
- NFYNNDGVKASWCX-UHFFFAOYSA-M 2-(4-methylsulfanylpyridin-1-ium-1-yl)ethanol;bromide Chemical compound [Br-].CSC1=CC=[N+](CCO)C=C1 NFYNNDGVKASWCX-UHFFFAOYSA-M 0.000 description 1
- XZQMXNVNYKWYPC-UHFFFAOYSA-N 2-(4-methylsulfinylpyridin-1-ium-1-yl)acetamide;bromide Chemical compound [Br-].CS(=O)C1=CC=[N+](CC(N)=O)C=C1 XZQMXNVNYKWYPC-UHFFFAOYSA-N 0.000 description 1
- NQWQXURKJJAXQR-UHFFFAOYSA-M 2-(4-methylsulfinylpyridin-1-ium-1-yl)ethanimidamide;chloride Chemical compound [Cl-].CS(=O)C1=CC=[N+](CC(N)=N)C=C1 NQWQXURKJJAXQR-UHFFFAOYSA-M 0.000 description 1
- JULREWKAXYSVBX-UHFFFAOYSA-M 2-(4-methylsulfinylpyridin-1-ium-1-yl)ethanol;bromide Chemical compound [Br-].CS(=O)C1=CC=[N+](CCO)C=C1 JULREWKAXYSVBX-UHFFFAOYSA-M 0.000 description 1
- NLOVPGZATCSLMB-UHFFFAOYSA-M 2-[(4-chloropyridin-1-ium-1-yl)methyl]benzonitrile;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C1=CC(Cl)=CC=[N+]1CC1=CC=CC=C1C#N NLOVPGZATCSLMB-UHFFFAOYSA-M 0.000 description 1
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- LDNJYYHKSRADIU-UHFFFAOYSA-M 2-bromoquinolizin-5-ium;bromide Chemical compound [Br-].C1=CC=CC2=CC(Br)=CC=[N+]21 LDNJYYHKSRADIU-UHFFFAOYSA-M 0.000 description 1
- JVMJNDLIVMDWJS-UHFFFAOYSA-M 2-chloro-1,3-dimethylimidazol-1-ium;iodide Chemical compound [I-].CN1C=C[N+](C)=C1Cl JVMJNDLIVMDWJS-UHFFFAOYSA-M 0.000 description 1
- ABFPKTQEQNICFT-UHFFFAOYSA-M 2-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Cl ABFPKTQEQNICFT-UHFFFAOYSA-M 0.000 description 1
- BFYRXCWLDJORHM-UHFFFAOYSA-N 2-chloro-4,5-dihydro-1h-imidazole Chemical compound ClC1=NCCN1 BFYRXCWLDJORHM-UHFFFAOYSA-N 0.000 description 1
- GUPOZVHRTJYZCX-UHFFFAOYSA-N 2-chloroethanimidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])CCl GUPOZVHRTJYZCX-UHFFFAOYSA-N 0.000 description 1
- 125000006012 2-chloroethoxy group Chemical group 0.000 description 1
- OCVXSFKKWXMYPF-UHFFFAOYSA-N 2-chloroimidazole Chemical compound ClC1=NC=CN1 OCVXSFKKWXMYPF-UHFFFAOYSA-N 0.000 description 1
- FNRMMDCDHWCQTH-UHFFFAOYSA-N 2-chloropyridine;3-chloropyridine;4-chloropyridine Chemical compound ClC1=CC=NC=C1.ClC1=CC=CN=C1.ClC1=CC=CC=N1 FNRMMDCDHWCQTH-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- LNFZAUNJFRYZLE-UHFFFAOYSA-N 2-fluoro-1h-imidazole Chemical compound FC1=NC=CN1 LNFZAUNJFRYZLE-UHFFFAOYSA-N 0.000 description 1
- NYWWLAGHUMTSBB-UHFFFAOYSA-N 2-methoxy-1-oxidopyridin-1-ium Chemical compound COC1=CC=CC=[N+]1[O-] NYWWLAGHUMTSBB-UHFFFAOYSA-N 0.000 description 1
- YLZYSVYZMDJYOT-UHFFFAOYSA-N 2-methoxypyrimidine Chemical compound COC1=NC=CC=N1 YLZYSVYZMDJYOT-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- COCFIBRMFPWUDW-UHFFFAOYSA-N 2-methylquinolin-4-amine Chemical compound C1=CC=CC2=NC(C)=CC(N)=C21 COCFIBRMFPWUDW-UHFFFAOYSA-N 0.000 description 1
- MFAZKHYKVSPPIB-UHFFFAOYSA-N 2-propyl-1h-quinazolin-4-one Chemical compound C1=CC=C2NC(CCC)=NC(=O)C2=C1 MFAZKHYKVSPPIB-UHFFFAOYSA-N 0.000 description 1
- NLDQGEZFOMVCOH-UHFFFAOYSA-N 2-propyl-1h-quinazoline-4-thione Chemical compound C1=CC=C2NC(CCC)=NC(=S)C2=C1 NLDQGEZFOMVCOH-UHFFFAOYSA-N 0.000 description 1
- FPEANFVVZUKNFU-UHFFFAOYSA-N 2-sulfanylbenzotriazole Chemical compound C1=CC=CC2=NN(S)N=C21 FPEANFVVZUKNFU-UHFFFAOYSA-N 0.000 description 1
- RGSWYEYNDJNXRK-UHFFFAOYSA-N 2-tert-butyl-3h-pyridin-4-one Chemical compound CC(C)(C)C1=NC=CC(=O)C1 RGSWYEYNDJNXRK-UHFFFAOYSA-N 0.000 description 1
- PLKNGGRZZIWWLD-UHFFFAOYSA-N 3,5-dioxo-2h-1,2,4-triazine-6-carboxylic acid Chemical compound OC(=O)C1=NN=C(O)N=C1O PLKNGGRZZIWWLD-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ULJCUMSGAKFVQL-UHFFFAOYSA-M 3-benzyl-2-bromo-1,3-thiazol-3-ium;bromide Chemical compound [Br-].S1C=C[N+](CC=2C=CC=CC=2)=C1Br ULJCUMSGAKFVQL-UHFFFAOYSA-M 0.000 description 1
- RPYICTHKCBXLBR-UHFFFAOYSA-M 3-bromo-4-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C(Br)=C1 RPYICTHKCBXLBR-UHFFFAOYSA-M 0.000 description 1
- QADXKWUCCGPQNR-UHFFFAOYSA-N 3-bromo-4-chloropyridine Chemical compound ClC1=CC=NC=C1Br QADXKWUCCGPQNR-UHFFFAOYSA-N 0.000 description 1
- XUDQJRFWODLIPM-UHFFFAOYSA-M 3-fluoro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC(F)=C1 XUDQJRFWODLIPM-UHFFFAOYSA-M 0.000 description 1
- CELKOWQJPVJKIL-UHFFFAOYSA-N 3-fluoropyridine Chemical compound FC1=CC=CN=C1 CELKOWQJPVJKIL-UHFFFAOYSA-N 0.000 description 1
- CCCGZCQYXYLDIH-UHFFFAOYSA-N 3-methoxy-5-methyl-1,2-oxazole Chemical compound COC=1C=C(C)ON=1 CCCGZCQYXYLDIH-UHFFFAOYSA-N 0.000 description 1
- KYBCQZHRJZJYCE-UHFFFAOYSA-N 4,6-dichloro-2-methylquinoline Chemical compound C1=C(Cl)C=CC2=NC(C)=CC(Cl)=C21 KYBCQZHRJZJYCE-UHFFFAOYSA-N 0.000 description 1
- JAOINXWEFKZYIL-UHFFFAOYSA-N 4-(1-methyl-2-oxoquinolin-4-yl)oxy-n-(4-methylpyridin-2-yl)butanamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CC1=CC=NC(NC(=O)CCCOC=2C3=CC=CC=C3N(C)C(=O)C=2)=C1 JAOINXWEFKZYIL-UHFFFAOYSA-N 0.000 description 1
- CQQSQBRPAJSTFB-UHFFFAOYSA-N 4-(bromomethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(CBr)C=C1 CQQSQBRPAJSTFB-UHFFFAOYSA-N 0.000 description 1
- XEATWTQXOLTEBX-UHFFFAOYSA-N 4-[(4-chloropyridin-1-ium-1-yl)methyl]benzoic acid;bromide Chemical compound [Br-].C1=CC(C(=O)O)=CC=C1C[N+]1=CC=C(Cl)C=C1 XEATWTQXOLTEBX-UHFFFAOYSA-N 0.000 description 1
- AYSCIYSRYOMFTP-UHFFFAOYSA-M 4-chloro-1,2-dimethylquinolin-1-ium;iodide Chemical compound [I-].C1=CC=CC2=[N+](C)C(C)=CC(Cl)=C21 AYSCIYSRYOMFTP-UHFFFAOYSA-M 0.000 description 1
- SRVQKTSYAQICEA-UHFFFAOYSA-M 4-chloro-1-(methoxymethyl)pyrimidin-1-ium;bromide Chemical compound [Br-].COC[N+]1=CC=C(Cl)N=C1 SRVQKTSYAQICEA-UHFFFAOYSA-M 0.000 description 1
- WLNYRZOIIKZHBJ-UHFFFAOYSA-M 4-chloro-1-(methylsulfanylmethyl)pyridin-1-ium;chloride Chemical compound [Cl-].CSC[N+]1=CC=C(Cl)C=C1 WLNYRZOIIKZHBJ-UHFFFAOYSA-M 0.000 description 1
- DKFIENATHYUDBX-UHFFFAOYSA-M 4-chloro-1-[(3-methoxyphenyl)methyl]pyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.COC1=CC=CC(C[N+]=2C=CC(Cl)=CC=2)=C1 DKFIENATHYUDBX-UHFFFAOYSA-M 0.000 description 1
- NNBBNSGBUPAWNH-UHFFFAOYSA-M 4-chloro-1-[(4-fluorophenyl)methyl]pyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C1=CC(F)=CC=C1C[N+]1=CC=C(Cl)C=C1 NNBBNSGBUPAWNH-UHFFFAOYSA-M 0.000 description 1
- ZRNQGCAIWFVUMO-UHFFFAOYSA-M 4-chloro-1-[(4-methylphenyl)methyl]pyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C1=CC(C)=CC=C1C[N+]1=CC=C(Cl)C=C1 ZRNQGCAIWFVUMO-UHFFFAOYSA-M 0.000 description 1
- LYBRKZJPXRUPPM-UHFFFAOYSA-M 4-chloro-1-[(4-nitrophenyl)methyl]pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC([N+](=O)[O-])=CC=C1C[N+]1=CC=C(Cl)C=C1 LYBRKZJPXRUPPM-UHFFFAOYSA-M 0.000 description 1
- VKXHJZFWVAJKAG-UHFFFAOYSA-M 4-chloro-1-cyclopropylpyridin-1-ium 4-methylbenzenesulfonate Chemical compound C1=CC(Cl)=CC=[N+]1C1CC1.CC1=CC=C(S([O-])(=O)=O)C=C1 VKXHJZFWVAJKAG-UHFFFAOYSA-M 0.000 description 1
- WYINNSOHYWDWJG-UHFFFAOYSA-N 4-chloro-1-ethylpyridin-1-ium Chemical compound CC[N+]1=CC=C(Cl)C=C1 WYINNSOHYWDWJG-UHFFFAOYSA-N 0.000 description 1
- YNCYXHUQSIVEBZ-UHFFFAOYSA-M 4-chloro-1-methyl-3-[(4-nitrophenyl)methoxy]pyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C(OCC=2C=CC(=CC=2)[N+]([O-])=O)=C1 YNCYXHUQSIVEBZ-UHFFFAOYSA-M 0.000 description 1
- SGRIQHLJRIMNLG-UHFFFAOYSA-N 4-chloro-1-methylpyridin-1-ium-2-amine;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C=C1N SGRIQHLJRIMNLG-UHFFFAOYSA-N 0.000 description 1
- XEMPAPZJPSDSQJ-UHFFFAOYSA-M 4-chloro-1-methylpyridin-1-ium-3-amine;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C(N)=C1 XEMPAPZJPSDSQJ-UHFFFAOYSA-M 0.000 description 1
- YNVSUEIOWWNWIE-UHFFFAOYSA-M 4-chloro-1-methylquinolin-1-ium;iodide Chemical compound [I-].C1=CC=C2[N+](C)=CC=C(Cl)C2=C1 YNVSUEIOWWNWIE-UHFFFAOYSA-M 0.000 description 1
- KWGPUDZXBORMGB-UHFFFAOYSA-N 4-chloro-1-oxidopyridin-1-ium-3-ol Chemical compound OC1=C[N+]([O-])=CC=C1Cl KWGPUDZXBORMGB-UHFFFAOYSA-N 0.000 description 1
- KTLQWVRFSFTPKW-UHFFFAOYSA-M 4-chloro-1-propylpyridin-1-ium 4-methylbenzenesulfonate Chemical compound CCC[N+]1=CC=C(Cl)C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 KTLQWVRFSFTPKW-UHFFFAOYSA-M 0.000 description 1
- HQAIROMRVBVWSK-UHFFFAOYSA-N 4-chloro-2-methylquinoline Chemical compound C1=CC=CC2=NC(C)=CC(Cl)=C21 HQAIROMRVBVWSK-UHFFFAOYSA-N 0.000 description 1
- GCCOVPIYBFPYOR-UHFFFAOYSA-N 4-chloro-3-[(4-nitrophenyl)methoxy]pyridine;hydrochloride Chemical compound Cl.C1=CC([N+](=O)[O-])=CC=C1COC1=CN=CC=C1Cl GCCOVPIYBFPYOR-UHFFFAOYSA-N 0.000 description 1
- HEAUUSUVCNXXDR-UHFFFAOYSA-M 4-chloro-3-fluoro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=C(Cl)C(F)=C1 HEAUUSUVCNXXDR-UHFFFAOYSA-M 0.000 description 1
- MSYPXENUSGPSGK-UHFFFAOYSA-M 4-chloro-3-methoxy-1-methylpyridin-1-ium;iodide Chemical compound [I-].COC1=C[N+](C)=CC=C1Cl MSYPXENUSGPSGK-UHFFFAOYSA-M 0.000 description 1
- DICAQTPGOQCCOH-UHFFFAOYSA-N 4-chloro-3-methoxypyridine Chemical compound COC1=CN=CC=C1Cl DICAQTPGOQCCOH-UHFFFAOYSA-N 0.000 description 1
- ACGWDTACRIOFGU-UHFFFAOYSA-M 4-chloro-6-fluoro-1,2-dimethylquinolin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C1=C(F)C=CC2=[N+](C)C(C)=CC(Cl)=C21 ACGWDTACRIOFGU-UHFFFAOYSA-M 0.000 description 1
- RQMWVVBHJMUJNZ-UHFFFAOYSA-N 4-chloropyridin-2-amine Chemical compound NC1=CC(Cl)=CC=N1 RQMWVVBHJMUJNZ-UHFFFAOYSA-N 0.000 description 1
- GTLFLMZOABSJSV-UHFFFAOYSA-N 4-chloropyridin-3-amine Chemical compound NC1=CN=CC=C1Cl GTLFLMZOABSJSV-UHFFFAOYSA-N 0.000 description 1
- GQORRJKLCCMNPX-UHFFFAOYSA-N 4-chloropyridin-3-ol Chemical compound OC1=CN=CC=C1Cl GQORRJKLCCMNPX-UHFFFAOYSA-N 0.000 description 1
- 150000005751 4-halopyridines Chemical class 0.000 description 1
- AEKCNKQSIRUADN-UHFFFAOYSA-N 4-methoxy-1-methylpyridin-1-ium-2-carboxamide;sulfate Chemical compound [O-]S([O-])(=O)=O.COC1=CC=[N+](C)C(C(N)=O)=C1.COC1=CC=[N+](C)C(C(N)=O)=C1 AEKCNKQSIRUADN-UHFFFAOYSA-N 0.000 description 1
- IKNDUXJUWCMTPG-UHFFFAOYSA-N 4-methoxy-1-methylpyridin-1-ium-3-carboxamide;sulfate Chemical compound [O-]S([O-])(=O)=O.COC1=CC=[N+](C)C=C1C(N)=O.COC1=CC=[N+](C)C=C1C(N)=O IKNDUXJUWCMTPG-UHFFFAOYSA-N 0.000 description 1
- HSASPJKRUHQXJB-UHFFFAOYSA-N 4-methoxy-1-oxidopyridin-1-ium-2-carboxamide Chemical compound COC1=CC=[N+]([O-])C(C(N)=O)=C1 HSASPJKRUHQXJB-UHFFFAOYSA-N 0.000 description 1
- JOUKZHHGEKOOPZ-UHFFFAOYSA-N 4-methoxy-6-methyl-1,2-dihydropyrimidin-3-ium-3-amine;2,4,6-trimethylbenzenesulfonate Chemical compound COC1=CC(C)=[NH+]CN1N.CC1=CC(C)=C(S([O-])(=O)=O)C(C)=C1 JOUKZHHGEKOOPZ-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- DYHMIVKBJSIOCH-UHFFFAOYSA-N 4-methoxypyridine-2-carboxamide Chemical compound COC1=CC=NC(C(N)=O)=C1 DYHMIVKBJSIOCH-UHFFFAOYSA-N 0.000 description 1
- NXQLBCIJYNCZKC-UHFFFAOYSA-N 4-methoxypyridine-3-carboxamide Chemical compound COC1=CC=NC=C1C(N)=O NXQLBCIJYNCZKC-UHFFFAOYSA-N 0.000 description 1
- NDYDYCFFKFQTPA-UHFFFAOYSA-N 4-nitro-1-oxidopyridin-1-ium-3-ol Chemical compound OC1=C[N+]([O-])=CC=C1[N+]([O-])=O NDYDYCFFKFQTPA-UHFFFAOYSA-N 0.000 description 1
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 1
- YBGBTGGBNZEUJS-UHFFFAOYSA-N 5-chloro-1,3-thiazole Chemical compound ClC1=CN=CS1 YBGBTGGBNZEUJS-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- JTTKXEIHKDSIRC-UHFFFAOYSA-N 5-chloro-2-(chloromethyl)pyridine Chemical compound ClCC1=CC=C(Cl)C=N1 JTTKXEIHKDSIRC-UHFFFAOYSA-N 0.000 description 1
- FMXSYRBHGUMFBA-UHFFFAOYSA-N 6-amino-3-azaniumylidene-9-[2-carboxy-4-[6-[4-[4-[4-[4-[3-carboxy-6-[4-(trifluoromethyl)phenyl]naphthalen-1-yl]phenyl]piperidin-1-yl]butyl]triazol-1-yl]hexylcarbamoyl]phenyl]-5-sulfoxanthene-4-sulfonate Chemical compound Nc1ccc2c(-c3ccc(cc3C(O)=O)C(=O)NCCCCCCn3cc(CCCCN4CCC(CC4)c4ccc(cc4)-c4cc(cc5cc(ccc45)-c4ccc(cc4)C(F)(F)F)C(O)=O)nn3)c3ccc(=[NH2+])c(c3oc2c1S(O)(=O)=O)S([O-])(=O)=O FMXSYRBHGUMFBA-UHFFFAOYSA-N 0.000 description 1
- NZVXNANNSHSECK-UHFFFAOYSA-N 6-fluoro-1,2-dimethylquinolin-4-one Chemical compound FC1=CC=C2N(C)C(C)=CC(=O)C2=C1 NZVXNANNSHSECK-UHFFFAOYSA-N 0.000 description 1
- QAEPQDLTYLAQEJ-UHFFFAOYSA-M 7-chloro-1-methyl-4-methylsulfanylquinazolin-1-ium;iodide Chemical compound [I-].ClC1=CC=C2C(SC)=NC=[N+](C)C2=C1 QAEPQDLTYLAQEJ-UHFFFAOYSA-M 0.000 description 1
- PMLONMIODRHERC-UHFFFAOYSA-N 7-chloro-1h-quinazolin-4-one Chemical compound N1C=NC(=O)C=2C1=CC(Cl)=CC=2 PMLONMIODRHERC-UHFFFAOYSA-N 0.000 description 1
- YOVNGYWYUZMMPG-UHFFFAOYSA-N 7-chloro-1h-quinazoline-4-thione Chemical compound N1C=NC(=S)C=2C1=CC(Cl)=CC=2 YOVNGYWYUZMMPG-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 102220582664 Astrocytic phosphoprotein PEA-15_N14R_mutation Human genes 0.000 description 1
- QWOGBQHQNRJKQW-GUNDQUCTSA-N C1C(=C(N2[C@H](S1)C(C2=O)N)C(=O)O)CN=[N+]=[N-].Cl Chemical compound C1C(=C(N2[C@H](S1)C(C2=O)N)C(=O)O)CN=[N+]=[N-].Cl QWOGBQHQNRJKQW-GUNDQUCTSA-N 0.000 description 1
- IEUZDWMFWJKEQR-UHFFFAOYSA-N C1C=CC2=C(N1Br)C=CC=C2[N+](=O)[O-] Chemical compound C1C=CC2=C(N1Br)C=CC=C2[N+](=O)[O-] IEUZDWMFWJKEQR-UHFFFAOYSA-N 0.000 description 1
- PXJMSKKODDFGLN-JYUHDHNASA-N CC(C)(C)OC(C(C)(C)O/N=C(\C(Cl)=O)/C1=NN(NC(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)N=C1)=O Chemical compound CC(C)(C)OC(C(C)(C)O/N=C(\C(Cl)=O)/C1=NN(NC(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)N=C1)=O PXJMSKKODDFGLN-JYUHDHNASA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- PBAYDYUZOSNJGU-UHFFFAOYSA-N Chelidonic acid Chemical compound OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 1
- LNNWYWYHUAXBMI-UHFFFAOYSA-N ClC1=CC=[N+](C(=C1)C)C Chemical compound ClC1=CC=[N+](C(=C1)C)C LNNWYWYHUAXBMI-UHFFFAOYSA-N 0.000 description 1
- JLJQMRXWUOSCRT-UHFFFAOYSA-N ClC=1N(CN=C(C=1)C)N Chemical compound ClC=1N(CN=C(C=1)C)N JLJQMRXWUOSCRT-UHFFFAOYSA-N 0.000 description 1
- LDUXMMSHEQAYMN-UHFFFAOYSA-N Cl[N+]1=CC=CC=C1 Chemical class Cl[N+]1=CC=CC=C1 LDUXMMSHEQAYMN-UHFFFAOYSA-N 0.000 description 1
- HZZVJAQRINQKSD-UHFFFAOYSA-N Clavulanic acid Natural products OC(=O)C1C(=CCO)OC2CC(=O)N21 HZZVJAQRINQKSD-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 101000760663 Hololena curta Mu-agatoxin-Hc1a Proteins 0.000 description 1
- 101000610640 Homo sapiens U4/U6 small nuclear ribonucleoprotein Prp3 Proteins 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- CVQUWLDCFXOXEN-UHFFFAOYSA-N Pyran-4-one Chemical compound O=C1C=COC=C1 CVQUWLDCFXOXEN-UHFFFAOYSA-N 0.000 description 1
- 101001110823 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L6-A Proteins 0.000 description 1
- 101000712176 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) 60S ribosomal protein L6-B Proteins 0.000 description 1
- 241000392514 Salmonella enterica subsp. enterica serovar Dublin Species 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 206010070863 Toxicity to various agents Diseases 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 102100040374 U4/U6 small nuclear ribonucleoprotein Prp3 Human genes 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- ITLHXEGAYQFOHJ-UHFFFAOYSA-N [diazo(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(=[N+]=[N-])C1=CC=CC=C1 ITLHXEGAYQFOHJ-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 238000002814 agar dilution Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940126575 aminoglycoside Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- GPRBEKHLDVQUJE-VINNURBNSA-N cefotaxime Chemical compound N([C@@H]1C(N2C(=C(COC(C)=O)CS[C@@H]21)C(O)=O)=O)C(=O)/C(=N/OC)C1=CSC(N)=N1 GPRBEKHLDVQUJE-VINNURBNSA-N 0.000 description 1
- 229960004261 cefotaxime Drugs 0.000 description 1
- WZOZEZRFJCJXNZ-ZBFHGGJFSA-N cefoxitin Chemical compound N([C@]1(OC)C(N2C(=C(COC(N)=O)CS[C@@H]21)C(O)=O)=O)C(=O)CC1=CC=CS1 WZOZEZRFJCJXNZ-ZBFHGGJFSA-N 0.000 description 1
- 229960002682 cefoxitin Drugs 0.000 description 1
- 229960002588 cefradine Drugs 0.000 description 1
- RDLPVSKMFDYCOR-UEKVPHQBSA-N cephradine Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CCC=CC1 RDLPVSKMFDYCOR-UEKVPHQBSA-N 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- JWMLCCRPDOIBAV-UHFFFAOYSA-N chloro(methylsulfanyl)methane Chemical compound CSCCl JWMLCCRPDOIBAV-UHFFFAOYSA-N 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- HZZVJAQRINQKSD-PBFISZAISA-N clavulanic acid Chemical compound OC(=O)[C@H]1C(=C/CO)/O[C@@H]2CC(=O)N21 HZZVJAQRINQKSD-PBFISZAISA-N 0.000 description 1
- 229960003324 clavulanic acid Drugs 0.000 description 1
- 239000003433 contraceptive agent Substances 0.000 description 1
- 230000002254 contraceptive effect Effects 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- OQBCSSWQGYWEHX-UHFFFAOYSA-M ethyl 3-[(4-chloropyridin-1-ium-1-yl)methyl]benzoate;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCOC(=O)C1=CC=CC(C[N+]=2C=CC(Cl)=CC=2)=C1 OQBCSSWQGYWEHX-UHFFFAOYSA-M 0.000 description 1
- CQBWPUJYGMSGDU-UHFFFAOYSA-N ethyl benzenecarboximidate Chemical compound CCOC(=N)C1=CC=CC=C1 CQBWPUJYGMSGDU-UHFFFAOYSA-N 0.000 description 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 210000003918 fraction a Anatomy 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000005298 iminyl group Chemical group 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- LULXBAGMGMJJRW-UHFFFAOYSA-N n,2-bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)CC(=O)N[Si](C)(C)C LULXBAGMGMJJRW-UHFFFAOYSA-N 0.000 description 1
- MDQYMNXMQMRKGB-UHFFFAOYSA-M n,n-dimethyl-2-(4-methylsulfinylpyridin-1-ium-1-yl)ethanamine;chloride Chemical compound [Cl-].CN(C)CC[N+]1=CC=C(S(C)=O)C=C1 MDQYMNXMQMRKGB-UHFFFAOYSA-M 0.000 description 1
- HSKNJSHFPPHTAQ-UHFFFAOYSA-N n-(2-chloroethyl)acetamide Chemical compound CC(=O)NCCCl HSKNJSHFPPHTAQ-UHFFFAOYSA-N 0.000 description 1
- OESDOFIWOSBLER-UHFFFAOYSA-O n-[(4-chloro-1-methylpyridin-1-ium-2-yl)methyl]acetamide Chemical compound CC(=O)NCC1=CC(Cl)=CC=[N+]1C OESDOFIWOSBLER-UHFFFAOYSA-O 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- LVSJDHGRKAEGLX-UHFFFAOYSA-N oxolane;2,2,2-trifluoroacetic acid Chemical compound C1CCOC1.OC(=O)C(F)(F)F LVSJDHGRKAEGLX-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- DBABZHXKTCFAPX-UHFFFAOYSA-N probenecid Chemical compound CCCN(CCC)S(=O)(=O)C1=CC=C(C(O)=O)C=C1 DBABZHXKTCFAPX-UHFFFAOYSA-N 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical class SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical class N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- PAGRPIWEWZODKJ-UHFFFAOYSA-N tert-butyl 2-(2-chloroimidazol-1-yl)acetate Chemical compound CC(C)(C)OC(=O)CN1C=CN=C1Cl PAGRPIWEWZODKJ-UHFFFAOYSA-N 0.000 description 1
- OTWCWIJBVPDNRS-UHFFFAOYSA-M tert-butyl 2-amino-3-(4-chloropyridin-1-ium-1-yl)propanoate;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CC(C)(C)OC(=O)C(N)C[N+]1=CC=C(Cl)C=C1 OTWCWIJBVPDNRS-UHFFFAOYSA-M 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- BFNYNEMRWHFIMR-UHFFFAOYSA-N tert-butyl 2-cyanoacetate Chemical compound CC(C)(C)OC(=O)CC#N BFNYNEMRWHFIMR-UHFFFAOYSA-N 0.000 description 1
- JCJCAEFVDYJKKI-UHFFFAOYSA-N tert-butyl 2-sulfanylbenzoate Chemical compound CC(C)(C)OC(=O)C1=CC=CC=C1S JCJCAEFVDYJKKI-UHFFFAOYSA-N 0.000 description 1
- GSJJCZSHYJNRPN-UHFFFAOYSA-N tert-butyl n-(2-sulfanylethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCS GSJJCZSHYJNRPN-UHFFFAOYSA-N 0.000 description 1
- KZBFNVDGLMJXJV-UHFFFAOYSA-N tert-butyl n-[(4-chloro-1-methylpyridin-1-ium-2-yl)methyl]carbamate;methyl sulfate Chemical compound COS([O-])(=O)=O.C[N+]1=CC=C(Cl)C=C1CNC(=O)OC(C)(C)C KZBFNVDGLMJXJV-UHFFFAOYSA-N 0.000 description 1
- CLIIHUOFOCDSDJ-UHFFFAOYSA-N tert-butyl n-[(4-chloropyridin-2-yl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1=CC(Cl)=CC=N1 CLIIHUOFOCDSDJ-UHFFFAOYSA-N 0.000 description 1
- CRRNBVYNBMRUMD-UHFFFAOYSA-N tert-butyl n-[2-(4-oxopyridin-1-yl)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCN1C=CC(=O)C=C1 CRRNBVYNBMRUMD-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical group C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- LEMXOCROJQSQFD-UHFFFAOYSA-N trimethyl(pyridin-4-yloxy)silane Chemical compound C[Si](C)(C)OC1=CC=NC=C1 LEMXOCROJQSQFD-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/57—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with a further substituent in position 7, e.g. cephamycines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D505/00—Heterocyclic compounds containing 5-oxa-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. oxacephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP83401135 | 1983-06-03 | ||
| EP83401135 | 1983-06-03 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI842211A0 FI842211A0 (fi) | 1984-06-01 |
| FI842211A7 FI842211A7 (fi) | 1984-12-04 |
| FI80043B FI80043B (fi) | 1989-12-29 |
| FI80043C true FI80043C (fi) | 1990-04-10 |
Family
ID=8191406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI842211A FI80043C (fi) | 1983-06-03 | 1984-06-01 | Foerfarande foer framstaellning av terapeutiskt anvaendbara substituerade 3-aminometylcefalossporiner och nya mellanprodukter. |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4678781A (Direct) |
| EP (1) | EP0127992B1 (Direct) |
| JP (1) | JPH0633283B2 (Direct) |
| KR (1) | KR910008352B1 (Direct) |
| AU (1) | AU585831B2 (Direct) |
| CA (1) | CA1272188A (Direct) |
| DE (1) | DE3486033T2 (Direct) |
| DK (1) | DK271584A (Direct) |
| ES (1) | ES533084A0 (Direct) |
| FI (1) | FI80043C (Direct) |
| GB (1) | GB8413152D0 (Direct) |
| GR (1) | GR81617B (Direct) |
| HU (1) | HU196811B (Direct) |
| IL (1) | IL71969A (Direct) |
| NO (1) | NO164301C (Direct) |
| NZ (1) | NZ208360A (Direct) |
| PH (1) | PH22334A (Direct) |
| PT (1) | PT78685B (Direct) |
| ZA (1) | ZA844052B (Direct) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4855420A (en) * | 1983-06-03 | 1989-08-08 | Ici Pharma | Cephalosporin derivatives |
| FI851934A7 (fi) * | 1984-05-30 | 1985-12-01 | Ici Plc | Kefalosporiinijohdannaisia. |
| US4868173A (en) * | 1984-11-20 | 1989-09-19 | Ici Pharma | Cephalosporin derivatives |
| EP0187456A1 (en) * | 1984-11-29 | 1986-07-16 | Ici Pharma | Cephalosporin derivatives |
| US4840945A (en) * | 1985-04-01 | 1989-06-20 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| GB8626245D0 (en) * | 1985-11-27 | 1986-12-03 | Ici Pharma | Cephalosporin compounds |
| US4684722A (en) * | 1986-01-06 | 1987-08-04 | E. R. Squibb & Sons, Inc. | Monosulfactams |
| GB8611823D0 (en) * | 1986-05-15 | 1986-06-25 | Ici Plc | Process |
| ZA877987B (en) * | 1986-11-12 | 1988-08-31 | Ici Pharma | Antibiotic compounds |
| DE3750673T2 (de) * | 1986-11-21 | 1995-03-16 | Ici Pharma | Cephalosporine, Verfahren zu ihrer Herstellung und pharmazeutische Präparate. |
| EP0272827A3 (en) * | 1986-12-23 | 1990-02-07 | ZENECA Pharma S.A. | 3-heterocyclicthiomethyl cephalosphorins |
| US5262410A (en) * | 1986-12-23 | 1993-11-16 | Ici Pharma | 3-heterocyclic thiomethyl cephalosporins |
| EP0300665B1 (en) * | 1987-07-23 | 1995-12-20 | ZENECA Pharma S.A. | Cephalosporin compounds, process for their preparation and their pharmaceutical compositions |
| ATE130299T1 (de) * | 1987-07-23 | 1995-12-15 | Zeneca Pharma Sa | Cephalosporinverbindungen, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische präparate. |
| GB8816519D0 (en) * | 1987-07-23 | 1988-08-17 | Ici Plc | Antibiotic compounds |
| US5232918A (en) * | 1987-07-23 | 1993-08-03 | Imperial Chemical Industries Plc | Cephalosporin derivatives |
| AT395854B (de) * | 1991-05-24 | 1993-03-25 | Biochemie Gmbh | Neues verfahren zur herstellung von 7-amino-3azidomethyl-3-cephem-4-carbonsaeure und deren derivate |
| US5817520A (en) * | 1991-12-20 | 1998-10-06 | Oxis International S.A. | Spectrophotometric methods for assaying total mercaptans, reduced glutathione (GSH) and mercaptans other than GSH in an aqueous medium reagents and kits for implementing same |
| DE19647413A1 (de) * | 1996-11-15 | 1998-05-20 | Hoechst Schering Agrevo Gmbh | Substituierte Stickstoff-Heterocyclen, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel |
| DE10225537A1 (de) * | 2002-06-10 | 2003-12-18 | Bayer Ag | N-alkylierte Thiazoliumsalze und Verfahren zu deren Herstellung |
| EP2966061B1 (en) | 2011-03-04 | 2017-05-03 | Life Technologies Corporation | Compounds and methods for conjugation of biomolecules |
| JP7158717B2 (ja) * | 2017-11-22 | 2022-10-24 | 国立大学法人九州工業大学 | 求電子的アジド化剤又はジアゾ化剤 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1584713A (Direct) * | 1967-01-18 | 1970-01-02 | ||
| GB1478055A (en) * | 1973-07-27 | 1977-06-29 | Erba Carlo Spa | Cephalosporin compounds |
| DE2715385A1 (de) * | 1976-04-14 | 1977-11-10 | Takeda Chemical Industries Ltd | Cephalosporinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel |
| FR2432521A1 (fr) | 1978-03-31 | 1980-02-29 | Roussel Uclaf | Nouvelles oximes o-substituees derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| DE2818263A1 (de) * | 1978-04-26 | 1979-11-08 | Bayer Ag | Beta-lactamantibiotika |
| GB2058791B (en) * | 1978-05-26 | 1982-11-24 | Glaxo Group Ltd | Cephalosporin antibiotics |
| GB1604724A (en) * | 1978-05-26 | 1981-12-16 | Glaxo Operations Ltd | 7-(2-aminothiazol-4-yl)-2-oxymino-acedamido)-cephem derivatives |
| GB2036738B (en) * | 1978-11-17 | 1983-01-19 | Glaxo Group Ltd | Cephalosporin antibiotics |
| GB2046261B (en) * | 1979-03-22 | 1983-07-20 | Glaxo Group Ltd | Cephalosporin antibiotics |
| DE3071707D1 (en) * | 1979-04-27 | 1986-09-25 | Merck & Co Inc | 7-n-heterocyclyl cephalosporins, a process for preparing and a pharmaceutical composition comprising the same |
| JPS57167993A (en) * | 1981-04-09 | 1982-10-16 | Yamanouchi Pharmaceut Co Ltd | Novel 3-((4-carboxy-3-hydroxyisothiazole-5-yl) thiomethyl)-delta3-cephem derivative |
| GB2103205A (en) * | 1981-06-15 | 1983-02-16 | Fujisawa Pharmaceutical Co | New cephem compounds |
| ZA824094B (en) * | 1981-06-19 | 1983-07-27 | Ici Plc | A process for the manufacture of cephalosporin derivative |
| JPS5876088A (ja) * | 1981-10-27 | 1983-05-09 | Nippon Paint Co Ltd | 固定化植物組織 |
| US4401668A (en) * | 1981-10-02 | 1983-08-30 | Eli Lilly And Company | Pyrazinium substituted cephalosporins |
| FR2516515A1 (fr) * | 1981-11-16 | 1983-05-20 | Sanofi Sa | Nouveaux derives de pyridinium thiomethyl cephalosporines, procede pour leur preparation et compositions pharmaceutiques les contenant |
| FR2530248A1 (fr) * | 1982-07-13 | 1984-01-20 | Sanofi Sa | Nouveaux derives des cephalosporines, leur procede de preparation et medicaments antibiotiques contenant lesdits derives |
| HU188874B (en) * | 1983-04-19 | 1986-05-28 | Biogal Gyogyszergyar,Hu | Process for producing new 7-acylamido-3-acylaminomethyl-ceph-3-eme-4-carboxylic acid derivatives and pharmaceutically acceptable salts thereof |
| US4560749A (en) * | 1983-11-18 | 1985-12-24 | Eli Lilly And Company | Cephem-3-imidates and 3-amidines |
| FI851934A7 (fi) * | 1984-05-30 | 1985-12-01 | Ici Plc | Kefalosporiinijohdannaisia. |
-
1984
- 1984-05-23 GB GB848413152A patent/GB8413152D0/en active Pending
- 1984-05-25 DE DE8484303585T patent/DE3486033T2/de not_active Expired - Fee Related
- 1984-05-25 EP EP84303585A patent/EP0127992B1/en not_active Expired - Lifetime
- 1984-05-28 ZA ZA844052A patent/ZA844052B/xx unknown
- 1984-05-30 IL IL71969A patent/IL71969A/xx unknown
- 1984-05-30 GR GR74879A patent/GR81617B/el unknown
- 1984-06-01 CA CA000455723A patent/CA1272188A/en not_active Expired - Lifetime
- 1984-06-01 ES ES533084A patent/ES533084A0/es active Granted
- 1984-06-01 DK DK271584A patent/DK271584A/da not_active Application Discontinuation
- 1984-06-01 AU AU28943/84A patent/AU585831B2/en not_active Ceased
- 1984-06-01 PT PT78685A patent/PT78685B/pt not_active IP Right Cessation
- 1984-06-01 FI FI842211A patent/FI80043C/fi not_active IP Right Cessation
- 1984-06-01 NZ NZ208360A patent/NZ208360A/en unknown
- 1984-06-01 NO NO842214A patent/NO164301C/no unknown
- 1984-06-01 HU HU842142A patent/HU196811B/hu not_active IP Right Cessation
- 1984-06-01 PH PH30751A patent/PH22334A/en unknown
- 1984-06-04 KR KR1019840003102A patent/KR910008352B1/ko not_active Expired
- 1984-06-04 US US06/616,891 patent/US4678781A/en not_active Expired - Fee Related
- 1984-06-04 JP JP59113221A patent/JPH0633283B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK271584D0 (da) | 1984-06-01 |
| HU196811B (en) | 1989-01-30 |
| PH22334A (en) | 1988-08-12 |
| GR81617B (Direct) | 1984-12-11 |
| FI842211A0 (fi) | 1984-06-01 |
| ES8601213A1 (es) | 1985-10-16 |
| FI842211A7 (fi) | 1984-12-04 |
| DE3486033T2 (de) | 1993-05-06 |
| PT78685A (Direct) | 1984-06-01 |
| CA1272188A (en) | 1990-07-31 |
| IL71969A0 (en) | 1984-09-30 |
| KR850000458A (ko) | 1985-02-27 |
| NO164301C (no) | 1990-09-19 |
| JPH0633283B2 (ja) | 1994-05-02 |
| AU585831B2 (en) | 1989-06-29 |
| KR910008352B1 (ko) | 1991-10-12 |
| AU2894384A (en) | 1984-12-06 |
| PT78685B (en) | 1986-10-21 |
| DE3486033D1 (de) | 1993-02-25 |
| FI80043B (fi) | 1989-12-29 |
| ZA844052B (en) | 1985-01-30 |
| DK271584A (da) | 1984-12-04 |
| US4678781A (en) | 1987-07-07 |
| NO842214L (no) | 1984-12-04 |
| NZ208360A (en) | 1988-01-08 |
| JPS6045584A (ja) | 1985-03-12 |
| HUT34499A (en) | 1985-03-28 |
| GB8413152D0 (en) | 1984-06-27 |
| IL71969A (en) | 1988-03-31 |
| EP0127992B1 (en) | 1993-01-13 |
| EP0127992A3 (en) | 1985-11-21 |
| ES533084A0 (es) | 1985-10-16 |
| EP0127992A2 (en) | 1984-12-12 |
| NO164301B (no) | 1990-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI80043C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara substituerade 3-aminometylcefalossporiner och nya mellanprodukter. | |
| JP4433383B2 (ja) | 広域セフェム化合物 | |
| FI115525B (fi) | Menetelmä kefalosporiinijohdannaisten valmistamiseksi ja menetelmässä käytettävät välituotteet | |
| HU186019B (en) | Process for preparing new cefem-carboxylic acid derivatives | |
| AU2003249503A1 (en) | Novel florfenicol-type antibiotics | |
| CZ281909B6 (cs) | Antibakteriální činidlo a farmaceutický prostředek, který je obsahuje | |
| KR100455544B1 (ko) | 세팔로스포린항생제 | |
| CA1225390A (en) | 3-bicyclicpyridinium-methyl cephalosporins | |
| EP0153709B1 (en) | Novel cephalosporin derivatives | |
| SK284962B6 (sk) | 7-Acylamino-3-(hydrazono)metylcefalosporíny, spôsob ich prípravy, medziprodukty na ich prípravu a farmaceutický prostriedok, ktorý ich obsahuje | |
| US4692443A (en) | 3-bicyclicpyridinium-methyl cephalosporins | |
| SE450384B (sv) | Nya cefemforeningar och forfarande for deras framstellning | |
| HU186289B (en) | Process for preparing 7-/cyylisted!-guanidino-cef-3-em compounds | |
| US4786633A (en) | Cephalosporin compounds | |
| CA1283096C (en) | Antibacterial compounds | |
| CS235508B2 (en) | Method of new 7-amino-3-formylmethyl-cephalosporine derivatives production | |
| PL140023B1 (en) | Process for preparing novel derivatives of 7-/(z)-2-/2-aminothiazolyl-4/-2-oxyiminoacetamide/-3-cephemo-4-carboxylic acid | |
| EP0376724A2 (en) | Cephalosporin compounds | |
| FI74020C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 7- -/ -syn-metoxiimino- -(2-aminotiazol-4-yl) acetamido/-3-/(1,2,3-tiadiazol-5-yltio)metyl/-3-cefem-4-karboxylsyraderivat | |
| FI85858B (fi) | Foerfarande foer framstaellning av farmaceutiska 3-kondenserade imidazoliumcefemfoereningar. | |
| JP3164390B2 (ja) | 抗菌剤 | |
| DE3686749T2 (de) | Cephalosporinverbindungen und sie enthaltende bakterizide. | |
| EP0315997B1 (en) | Cephalosporin compounds and antibacterial agents | |
| US4855420A (en) | Cephalosporin derivatives | |
| HU184805B (en) | Process for preparing new substituted alkyl-oximes derived from 7-/2-amino-4-thazolyl/-acetamido-cephalosporanic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: ICI PHARMA |