FI76815C - Katjoniska latexer av kopolymerer baserade pao konjugerade diener. - Google Patents
Katjoniska latexer av kopolymerer baserade pao konjugerade diener. Download PDFInfo
- Publication number
- FI76815C FI76815C FI840339A FI840339A FI76815C FI 76815 C FI76815 C FI 76815C FI 840339 A FI840339 A FI 840339A FI 840339 A FI840339 A FI 840339A FI 76815 C FI76815 C FI 76815C
- Authority
- FI
- Finland
- Prior art keywords
- unsaturated
- cationic
- nitrogen compound
- substance
- weight
- Prior art date
Links
- 125000002091 cationic group Chemical group 0.000 claims abstract description 57
- 239000000178 monomer Substances 0.000 claims abstract description 39
- 239000006185 dispersion Substances 0.000 claims abstract description 29
- 229910017464 nitrogen compound Inorganic materials 0.000 claims abstract description 26
- 238000006243 chemical reaction Methods 0.000 claims abstract description 24
- 150000002830 nitrogen compounds Chemical group 0.000 claims abstract description 24
- 239000000126 substance Substances 0.000 claims abstract description 20
- 150000001993 dienes Chemical class 0.000 claims abstract description 17
- 229920000126 latex Polymers 0.000 claims abstract description 16
- 239000003999 initiator Substances 0.000 claims abstract description 13
- 229920001577 copolymer Polymers 0.000 claims abstract description 8
- 229920000642 polymer Polymers 0.000 claims abstract description 5
- 239000004816 latex Substances 0.000 claims abstract 10
- 239000012429 reaction media Substances 0.000 claims abstract 2
- -1 unsaturated amino ester Chemical class 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 238000006116 polymerization reaction Methods 0.000 claims description 14
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000002947 alkylene group Chemical group 0.000 claims description 7
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims description 7
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 150000001408 amides Chemical class 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 5
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims description 3
- 238000007720 emulsion polymerization reaction Methods 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- 239000012875 nonionic emulsifier Substances 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 claims description 2
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 claims description 2
- DNLZVNZIAOXDTF-UHFFFAOYSA-N 2-[(dimethylamino)methyl]prop-2-enamide Chemical compound CN(C)CC(=C)C(N)=O DNLZVNZIAOXDTF-UHFFFAOYSA-N 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 150000001805 chlorine compounds Chemical group 0.000 claims description 2
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 claims description 2
- CJSBUWDGPXGFGA-UHFFFAOYSA-N dimethyl-butadiene Natural products CC(C)=CC=C CJSBUWDGPXGFGA-UHFFFAOYSA-N 0.000 claims description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-O hydron;quinoline Chemical compound [NH+]1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-O 0.000 claims description 2
- RCLLINSDAJVOHP-UHFFFAOYSA-N n-ethyl-n',n'-dimethylprop-2-enehydrazide Chemical compound CCN(N(C)C)C(=O)C=C RCLLINSDAJVOHP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 claims description 2
- 229920001567 vinyl ester resin Polymers 0.000 claims description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- NMGPHUOPSWFUEB-UHFFFAOYSA-N 2-(butylamino)ethyl 2-methylprop-2-enoate Chemical compound CCCCNCCOC(=O)C(C)=C NMGPHUOPSWFUEB-UHFFFAOYSA-N 0.000 claims 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims 1
- 150000003863 ammonium salts Chemical class 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 claims 1
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 claims 1
- 150000002829 nitrogen Chemical class 0.000 claims 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims 1
- 239000002245 particle Substances 0.000 abstract description 20
- 239000002253 acid Substances 0.000 abstract description 3
- 239000000839 emulsion Substances 0.000 abstract description 3
- 230000000379 polymerizing effect Effects 0.000 abstract description 3
- 239000000203 mixture Substances 0.000 abstract description 2
- 229920001059 synthetic polymer Polymers 0.000 abstract 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 22
- 238000005259 measurement Methods 0.000 description 16
- 239000008367 deionised water Substances 0.000 description 12
- 229910021641 deionized water Inorganic materials 0.000 description 10
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- CCTFAOUOYLVUFG-UHFFFAOYSA-N 2-(1-amino-1-imino-2-methylpropan-2-yl)azo-2-methylpropanimidamide Chemical compound NC(=N)C(C)(C)N=NC(C)(C)C(N)=N CCTFAOUOYLVUFG-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- FLCAEMBIQVZWIF-UHFFFAOYSA-N 6-(dimethylamino)-2-methylhex-2-enamide Chemical compound CN(C)CCCC=C(C)C(N)=O FLCAEMBIQVZWIF-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- DLNWMWYCSOQYSQ-UHFFFAOYSA-M benzyl-hexadecyl-dimethylazanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 DLNWMWYCSOQYSQ-UHFFFAOYSA-M 0.000 description 4
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- YAJYJWXEWKRTPO-UHFFFAOYSA-N 2,3,3,4,4,5-hexamethylhexane-2-thiol Chemical compound CC(C)C(C)(C)C(C)(C)C(C)(C)S YAJYJWXEWKRTPO-UHFFFAOYSA-N 0.000 description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 150000002432 hydroperoxides Chemical class 0.000 description 2
- 239000012035 limiting reagent Substances 0.000 description 2
- 125000006353 oxyethylene group Chemical group 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- LUWYGSHLLJILJD-UHFFFAOYSA-M 1-benzyl-4-ethenylpyridin-1-ium;chloride Chemical compound [Cl-].C1=CC(C=C)=CC=[N+]1CC1=CC=CC=C1 LUWYGSHLLJILJD-UHFFFAOYSA-M 0.000 description 1
- CUCZCUYZXCDPPE-UHFFFAOYSA-N 1-ethenyl-3-methylbenzimidazol-3-ium Chemical compound C1=CC=C2[N+](C)=CN(C=C)C2=C1 CUCZCUYZXCDPPE-UHFFFAOYSA-N 0.000 description 1
- USISIIYRINWYCM-UHFFFAOYSA-M 1-ethenyl-3-methylimidazol-3-ium;bromide Chemical compound [Br-].CN1C=C[N+](C=C)=C1 USISIIYRINWYCM-UHFFFAOYSA-M 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical class C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- YWGPFQLSBBFPIT-UHFFFAOYSA-N 2-(ditert-butylamino)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCN(C(C)(C)C)C(C)(C)C YWGPFQLSBBFPIT-UHFFFAOYSA-N 0.000 description 1
- BEWCNXNIQCLWHP-UHFFFAOYSA-N 2-(tert-butylamino)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCNC(C)(C)C BEWCNXNIQCLWHP-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- UEHVUTURFVAVOU-UHFFFAOYSA-M 2-ethenyl-1-ethylpyridin-1-ium;chloride Chemical compound [Cl-].CC[N+]1=CC=CC=C1C=C UEHVUTURFVAVOU-UHFFFAOYSA-M 0.000 description 1
- AYMALQIRXBTCAW-UHFFFAOYSA-M 2-ethenyl-1-methylpyridin-1-ium;bromide Chemical compound [Br-].C[N+]1=CC=CC=C1C=C AYMALQIRXBTCAW-UHFFFAOYSA-M 0.000 description 1
- GFHWCDCFJNJRQR-UHFFFAOYSA-M 2-ethenyl-1-methylpyridin-1-ium;chloride Chemical compound [Cl-].C[N+]1=CC=CC=C1C=C GFHWCDCFJNJRQR-UHFFFAOYSA-M 0.000 description 1
- ORUAQDICEXCMRJ-UHFFFAOYSA-M 2-ethenyl-1-methylquinolin-1-ium;iodide Chemical compound [I-].C1=CC=C2[N+](C)=C(C=C)C=CC2=C1 ORUAQDICEXCMRJ-UHFFFAOYSA-M 0.000 description 1
- FKPGDIJJHNHJNF-UHFFFAOYSA-N 2-methylprop-2-enamide;hydrobromide Chemical compound Br.CC(=C)C(N)=O FKPGDIJJHNHJNF-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- SAZUJJWRWJTZNI-UHFFFAOYSA-N 3-(ditert-butylamino)propyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCN(C(C)(C)C)C(C)(C)C SAZUJJWRWJTZNI-UHFFFAOYSA-N 0.000 description 1
- CZCNWNDODBDUEX-UHFFFAOYSA-M 4-ethenyl-1-ethylpyridin-1-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.CC[N+]1=CC=C(C=C)C=C1 CZCNWNDODBDUEX-UHFFFAOYSA-M 0.000 description 1
- RTANHMOFHGSZQO-UHFFFAOYSA-N 4-methoxy-2,4-dimethylpentanenitrile Chemical compound COC(C)(C)CC(C)C#N RTANHMOFHGSZQO-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-O Imidazolium Chemical compound C1=C[NH+]=CN1 RAXXELZNTBOGNW-UHFFFAOYSA-O 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- AHHGHNLJJIYXJG-UHFFFAOYSA-N [Br-].CC(=C(C)C)[PH3+].COS(=O)(=O)[O-].CC(=C(C)C)[PH3+] Chemical compound [Br-].CC(=C(C)C)[PH3+].COS(=O)(=O)[O-].CC(=C(C)C)[PH3+] AHHGHNLJJIYXJG-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- LVGQIQHJMRUCRM-UHFFFAOYSA-L calcium bisulfite Chemical compound [Ca+2].OS([O-])=O.OS([O-])=O LVGQIQHJMRUCRM-UHFFFAOYSA-L 0.000 description 1
- 235000010260 calcium hydrogen sulphite Nutrition 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- GVXYYRZMASRTPS-UHFFFAOYSA-N dimethylsulfanium chloride Chemical compound [Cl-].C[SH+]C GVXYYRZMASRTPS-UHFFFAOYSA-N 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-N dithionous acid Chemical class OS(=O)S(O)=O GRWZHXKQBITJKP-UHFFFAOYSA-N 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- SCVMAXDVEVNLCQ-UHFFFAOYSA-N methyl hydrogen sulfate;2-methylprop-2-enamide Chemical compound COS(O)(=O)=O.CC(=C)C(N)=O SCVMAXDVEVNLCQ-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- BHORKNANLOFPFA-UHFFFAOYSA-N n-(hydroxymethyl)-n-(methoxymethyl)prop-2-enamide Chemical compound COCN(CO)C(=O)C=C BHORKNANLOFPFA-UHFFFAOYSA-N 0.000 description 1
- QYZFTMMPKCOTAN-UHFFFAOYSA-N n-[2-(2-hydroxyethylamino)ethyl]-2-[[1-[2-(2-hydroxyethylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide Chemical compound OCCNCCNC(=O)C(C)(C)N=NC(C)(C)C(=O)NCCNCCO QYZFTMMPKCOTAN-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- LDTLADDKFLAYJA-UHFFFAOYSA-L sodium metabisulphite Chemical class [Na+].[Na+].[O-]S(=O)OS([O-])=O LDTLADDKFLAYJA-UHFFFAOYSA-L 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F295/00—Macromolecular compounds obtained by polymerisation using successively different catalyst types without deactivating the intermediate polymer
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Graft Or Block Polymers (AREA)
- Polymerisation Methods In General (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Paper (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8301303 | 1983-01-28 | ||
| FR8301303A FR2540127B1 (enExample) | 1983-01-28 | 1983-01-28 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI840339A0 FI840339A0 (fi) | 1984-01-27 |
| FI840339L FI840339L (fi) | 1984-07-29 |
| FI76815B FI76815B (fi) | 1988-08-31 |
| FI76815C true FI76815C (fi) | 1988-12-12 |
Family
ID=9285369
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI840339A FI76815C (fi) | 1983-01-28 | 1984-01-27 | Katjoniska latexer av kopolymerer baserade pao konjugerade diener. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4791161A (enExample) |
| EP (1) | EP0118327B1 (enExample) |
| JP (1) | JPS59142217A (enExample) |
| AT (1) | ATE26722T1 (enExample) |
| BR (1) | BR8400343A (enExample) |
| CA (1) | CA1224584A (enExample) |
| DE (1) | DE3463273D1 (enExample) |
| DK (1) | DK37984A (enExample) |
| ES (1) | ES8500290A1 (enExample) |
| FI (1) | FI76815C (enExample) |
| FR (1) | FR2540127B1 (enExample) |
| IE (1) | IE56628B1 (enExample) |
| NO (1) | NO162290C (enExample) |
| PT (1) | PT78024B (enExample) |
| YU (1) | YU43664B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0751692B2 (ja) * | 1985-07-05 | 1995-06-05 | アクゾ・ナ−ムロ−ゼ・フエンノ−トシヤツプ | 導電性基体の塗装方法およびカチオン性バインダ−をベ−スとする水性塗料 |
| US5045576A (en) * | 1988-08-04 | 1991-09-03 | The Dow Chemical Company | Latex conversion to cationic form use, for example in cationic asphalt emulsion |
| US5250602A (en) * | 1990-01-31 | 1993-10-05 | Mitsui-Cyanamid, Ltd. | Polymer emulsion and method for preparing the same |
| US5260354A (en) * | 1992-03-06 | 1993-11-09 | Ppg Industries, Inc. | Additives for electrodepositable coating compositions |
| US5709714A (en) * | 1996-03-11 | 1998-01-20 | Rohm And Haas Company | Method of treating leather with amphoteric polymers |
| US6184287B1 (en) | 1999-01-26 | 2001-02-06 | Omnova Solutions Inc. | Polymeric latexes prepared in the presence of 2-acrylamido-2-methylpropanesulfonate |
| US7279452B2 (en) | 2000-06-12 | 2007-10-09 | Commun-I-Tec, Ltd. | Sanitizing applicator having a positively charged fabric cover |
| US6667290B2 (en) | 2001-09-19 | 2003-12-23 | Jeffrey S. Svendsen | Substrate treated with a binder comprising positive or neutral ions |
| US8193104B2 (en) * | 2001-11-30 | 2012-06-05 | Celanese International Corporation | Crosslinkable cationic emulsion binders and their use as a binder for nonwovens |
| EP1534760B9 (en) | 2002-08-09 | 2013-07-10 | Akzo Nobel Coatings International BV | Aci-capped quaternised polymer and compositions comprising such polymer |
| US20070015873A1 (en) * | 2005-07-13 | 2007-01-18 | Fenn David R | Electrodepositable aqueous resinous dispersions and methods for their preparation |
| CA2631526C (en) * | 2005-12-01 | 2010-11-23 | Halliburton Energy Services, Inc. | Wellbore sealant compositions containing cationic latexes and methods of using them |
| US7694738B2 (en) | 2005-12-01 | 2010-04-13 | Halliburton Energy Services, Inc. | Methods of using wellbore sealant compositions containing cationic latexes |
| US7687440B2 (en) | 2005-12-01 | 2010-03-30 | Halliburton Energy Services, Inc. | Wellbore sealant compositions containing cationic latexes |
| US7576042B2 (en) * | 2006-02-28 | 2009-08-18 | Halliburton Energy Services, Inc. | Salt water stable latex cement slurries |
| US9505937B2 (en) | 2012-05-16 | 2016-11-29 | Ppg Industries Ohio, Inc. | Anionic electrodepositable coating compositions capable of forming low gloss coatings |
| US9598588B2 (en) | 2012-05-16 | 2017-03-21 | Ppg Industries Ohio, Inc. | Cationic electrodepositable coating compositions capable of forming low gloss coatings |
| US20140162910A1 (en) | 2012-12-10 | 2014-06-12 | Halliburton Energy Services, Inc. | Wellbore Servicing Compositions and Methods of Making and Using Same |
| US10066146B2 (en) | 2013-06-21 | 2018-09-04 | Halliburton Energy Services, Inc. | Wellbore servicing compositions and methods of making and using same |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2512697A (en) * | 1944-03-24 | 1950-06-27 | Grotenhuis Theodore A Te | Method of making synthetic rubbercarbon black compositions without mastication |
| US2746943A (en) * | 1951-11-09 | 1956-05-22 | Phillips Petroleum Co | Polymer compositions and methods for producing the same |
| US2965594A (en) * | 1953-10-30 | 1960-12-20 | Ciba Ltd | Carboxylic acid ester containing a quaternar y nitrogen atom in the alcohol portion, and polymerization products thereof |
| US2870118A (en) * | 1955-02-22 | 1959-01-20 | Degussa | Process for polymerizing ethylenic organic compounds with redox system catalysts in the presence of betaine derivatives |
| US2808388A (en) * | 1955-07-29 | 1957-10-01 | Eastman Kodak Co | Hydrosols of acrylic esters and hydrophobic monomers polymerized with cationic or ampholytic hydrophilic copolymers and process for making same |
| BE634566A (enExample) * | 1957-10-21 | |||
| US3253941A (en) * | 1962-03-12 | 1966-05-31 | Staley Mfg Co A E | Aminoalkyl polymer floor polishing composition and remover |
| GB1020063A (en) * | 1963-10-03 | 1966-02-16 | Revertex Ltd | Improvements in or relating to aqueous resin emulsions |
| US3404114A (en) * | 1965-06-18 | 1968-10-01 | Dow Chemical Co | Method for preparing latexes having improved adhesive properties |
| US3399159A (en) * | 1967-02-06 | 1968-08-27 | Kendall & Co | Cationic latices and method of preparing same |
| US3635867A (en) * | 1967-12-05 | 1972-01-18 | Celanese Coatings Co | Polymerization process for making aqueous acrylic-containing emulsions |
| US3594453A (en) * | 1968-07-25 | 1971-07-20 | Texaco Inc | Method of producing alpha-methylstyrene resin |
| AU494547B2 (en) * | 1972-07-10 | 1977-10-20 | Johnson & Johnson | Hydrophilic random interpolymer compositions and method for making same |
| US4017440A (en) * | 1973-10-10 | 1977-04-12 | Rohm And Haas Company | Polymers stabilized with polymerizable vinylbenzyltrialkyl ammonium salt surfactant |
| US4064091A (en) * | 1974-08-09 | 1977-12-20 | The Kendall Co. | Process of forming a polymeric emulsion which comprises copolymerizing in aqueous dispersion an ethylenically-unsaturated monomer containing quaternary nitrogen |
| DE2452585B2 (de) * | 1974-11-06 | 1981-07-30 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung scherstabiler wäßriger Copolymerisat-Dispersionen |
| JPS52137482A (en) * | 1976-05-14 | 1977-11-16 | Kyoritsu Yuki Kogyo Kenkyusho:Kk | Preparation of acrylamide polymer |
| US4349641A (en) * | 1977-06-03 | 1982-09-14 | Hercules Incorporated | Organic pigments |
| JPS5837439B2 (ja) * | 1978-01-27 | 1983-08-16 | 花王株式会社 | 繊維の糊付け剤 |
| US4166882A (en) * | 1978-04-26 | 1979-09-04 | Ppg Industries, Inc. | Method of coating with aqueous thermosetting acrylic polymer latex of uniform particle size |
| US4314044A (en) * | 1979-01-22 | 1982-02-02 | Rohm And Haas Company | Process for preparing low molecular weight water-soluble polymers |
| JPS5598201A (en) * | 1979-01-22 | 1980-07-26 | Kuraray Co Ltd | Production of cationic emulsion |
| JPS6051488B2 (ja) * | 1979-04-16 | 1985-11-14 | 日本ペイント株式会社 | 両イオン性重合樹脂 |
| US4426489A (en) * | 1980-02-21 | 1984-01-17 | The Dow Chemical Company | Surface active polymeric surfactants containing side chain hydrophobes |
| US4337185A (en) * | 1980-06-23 | 1982-06-29 | The Dow Chemical Company | Process for making cationic structured particle latexes using reactive polymeric surfactants |
| US4304703A (en) * | 1980-06-23 | 1981-12-08 | Ppg Industries, Inc. | Cationic polymer dispersions and their method of preparation |
| DE3035375A1 (de) * | 1980-09-19 | 1982-05-06 | Röhm GmbH, 6100 Darmstadt | Emulgiermittelfreie waessrige kunststoffdispersion |
-
1983
- 1983-01-28 FR FR8301303A patent/FR2540127B1/fr not_active Expired
-
1984
- 1984-01-20 DE DE8484400120T patent/DE3463273D1/de not_active Expired
- 1984-01-20 EP EP84400120A patent/EP0118327B1/fr not_active Expired
- 1984-01-20 AT AT84400120T patent/ATE26722T1/de not_active IP Right Cessation
- 1984-01-25 YU YU130/84A patent/YU43664B/xx unknown
- 1984-01-26 NO NO840305A patent/NO162290C/no unknown
- 1984-01-27 DK DK37984A patent/DK37984A/da not_active Application Discontinuation
- 1984-01-27 FI FI840339A patent/FI76815C/fi not_active IP Right Cessation
- 1984-01-27 IE IE195/84A patent/IE56628B1/xx unknown
- 1984-01-27 CA CA000446188A patent/CA1224584A/fr not_active Expired
- 1984-01-27 ES ES529221A patent/ES8500290A1/es not_active Expired
- 1984-01-27 BR BR8400343A patent/BR8400343A/pt not_active IP Right Cessation
- 1984-01-27 PT PT78024A patent/PT78024B/pt not_active IP Right Cessation
- 1984-01-27 JP JP59012209A patent/JPS59142217A/ja active Granted
-
1986
- 1986-05-27 US US06/867,601 patent/US4791161A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| YU13084A (en) | 1986-06-30 |
| DK37984D0 (da) | 1984-01-27 |
| JPS625930B2 (enExample) | 1987-02-07 |
| FR2540127B1 (enExample) | 1985-03-29 |
| DK37984A (da) | 1984-07-29 |
| IE56628B1 (en) | 1991-10-23 |
| FI76815B (fi) | 1988-08-31 |
| FR2540127A1 (enExample) | 1984-08-03 |
| FI840339A0 (fi) | 1984-01-27 |
| NO162290C (no) | 1989-12-06 |
| PT78024A (fr) | 1984-02-01 |
| FI840339L (fi) | 1984-07-29 |
| CA1224584A (fr) | 1987-07-21 |
| EP0118327B1 (fr) | 1987-04-22 |
| US4791161A (en) | 1988-12-13 |
| ES529221A0 (es) | 1984-10-01 |
| PT78024B (fr) | 1986-03-27 |
| NO840305L (no) | 1984-07-30 |
| ES8500290A1 (es) | 1984-10-01 |
| NO162290B (no) | 1989-08-28 |
| BR8400343A (pt) | 1984-09-04 |
| JPS59142217A (ja) | 1984-08-15 |
| EP0118327A1 (fr) | 1984-09-12 |
| YU43664B (en) | 1989-10-31 |
| IE840195L (en) | 1984-07-28 |
| ATE26722T1 (de) | 1987-05-15 |
| DE3463273D1 (en) | 1987-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI76815C (fi) | Katjoniska latexer av kopolymerer baserade pao konjugerade diener. | |
| US3385839A (en) | Cation-active copolymers of hydroxyalkyl and primary amino-alkyl acrylates and methacrylates | |
| US3497482A (en) | Polymers of quaternary ammonium compounds | |
| CA2005668C (en) | Emulsified functionalized polymers | |
| FI76812B (fi) | Stabila och amfotera vattendispersioner av syntetiska polymerer. | |
| US3026293A (en) | Acrylamidic graft copolymers and their preparation | |
| US3403122A (en) | Emulsion polymerization of water insoluble omega-(n-perfluoroalkanesulfonyl) aminoalkyl acrylates or methacrylates | |
| US2677679A (en) | Quaternary ammonium polymers of the acrylic type | |
| US3008851A (en) | Novel quaternary ammonium compounds and methods of producing them | |
| US4808660A (en) | Latex containing copolymers having a plurality of activatable functional ester groups therein | |
| FI76813C (fi) | Stabila och amfotera latexer av kopolymerer baserade pao konjugerade diener. | |
| US3257281A (en) | Aerosol preparations for the treatment of the hair comprising hydrophilic salts of basic amides and esters | |
| US3262917A (en) | Acid salts of basic interpolymers comprising an amine-substituted amide or ester | |
| JPS63251409A (ja) | カチオン性オリゴマ− | |
| US3287305A (en) | Cationactive dispersions of finely divided water-insoluble cationactive polymers containing quaternary ammonium groups | |
| US2662877A (en) | Copolymers of acrylonitrile and allyl amines | |
| FI76814B (fi) | Katjoniska vattendispersioner av syntetiska polymerer. | |
| DE1814597A1 (de) | Mischpolymere aus N-Fettalkyl-diallyl-ammoniumchlorid | |
| JPS61261302A (ja) | カチオン性重合体ラテツクスの製造方法 | |
| CA1083155A (en) | Monomeric emulsion stabilizers containing an n- diallylacetamido or n-dimethallylacetamido radical | |
| US5250602A (en) | Polymer emulsion and method for preparing the same | |
| JPH03163108A (ja) | 両性高分子電解質およびその製造方法 | |
| GB1082365A (en) | Fibre-forming acrylonitrile polymers | |
| GB777488A (en) | New polymerizable quaternary ammonium compounds and their manufacture and use | |
| JPH0438741B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: RHONE-POULENC SPECIALITES CHIMIQUES |