FI68042C - 5-amino-2,4,6-trijod-isoftalsyra-bis-amid-derivat foer anvaendning i roentgenkontrastmedel - Google Patents
5-amino-2,4,6-trijod-isoftalsyra-bis-amid-derivat foer anvaendning i roentgenkontrastmedel Download PDFInfo
- Publication number
- FI68042C FI68042C FI802215A FI802215A FI68042C FI 68042 C FI68042 C FI 68042C FI 802215 A FI802215 A FI 802215A FI 802215 A FI802215 A FI 802215A FI 68042 C FI68042 C FI 68042C
- Authority
- FI
- Finland
- Prior art keywords
- bis
- amino
- acid
- formula
- triiodo
- Prior art date
Links
- -1 hydroxy, methoxy Chemical group 0.000 claims abstract description 49
- 239000002253 acid Substances 0.000 claims abstract description 39
- 150000001875 compounds Chemical class 0.000 claims abstract description 23
- 239000002872 contrast media Substances 0.000 claims abstract description 23
- 150000003839 salts Chemical class 0.000 claims abstract description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 18
- 239000001257 hydrogen Substances 0.000 claims abstract description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 17
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 12
- 229940039231 contrast media Drugs 0.000 claims abstract description 8
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 6
- 150000001470 diamides Chemical class 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 5
- 238000006698 hydrazinolysis reaction Methods 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims 4
- FTQWRYSLUYAIRQ-UHFFFAOYSA-N n-[(octadecanoylamino)methyl]octadecanamide Chemical class CCCCCCCCCCCCCCCCCC(=O)NCNC(=O)CCCCCCCCCCCCCCCCC FTQWRYSLUYAIRQ-UHFFFAOYSA-N 0.000 claims 2
- 101001061911 Homo sapiens Ras-related protein Rab-40A Proteins 0.000 claims 1
- 102100029553 Ras-related protein Rab-40A Human genes 0.000 claims 1
- 238000009472 formulation Methods 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 abstract description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 42
- 238000000354 decomposition reaction Methods 0.000 description 35
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 15
- 238000003756 stirring Methods 0.000 description 14
- FUOXCOHIWKJOMU-UHFFFAOYSA-N 5-[(2-aminoacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound NCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I FUOXCOHIWKJOMU-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 150000001768 cations Chemical class 0.000 description 11
- ASBGVYOIJLROJS-UHFFFAOYSA-N 5-[(2-chloroacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=C(I)C(NC(=O)CCl)=C(I)C(C(O)=O)=C1I ASBGVYOIJLROJS-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 8
- 230000003204 osmotic effect Effects 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000007112 amidation reaction Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- VYOOHKHKCXPMGS-UHFFFAOYSA-N 5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=C(I)C(C(=O)O)=C(I)C(NC(=O)CN2C(C3=CC=CC=C3C2=O)=O)=C1I VYOOHKHKCXPMGS-UHFFFAOYSA-N 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- 150000001450 anions Chemical class 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- UXIGWFXRQKWHHA-UHFFFAOYSA-N Iotalamic acid Chemical compound CNC(=O)C1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I UXIGWFXRQKWHHA-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 4
- 230000001580 bacterial effect Effects 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- CPDMSMMXVNTHLC-UHFFFAOYSA-N 2,4,6-triiodo-5-[[2-(methylamino)acetyl]amino]benzene-1,3-dicarboxylic acid Chemical compound CNCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I CPDMSMMXVNTHLC-UHFFFAOYSA-N 0.000 description 3
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 3
- WOMTYMDHLQTCHY-UHFFFAOYSA-N 3-methylamino-1,2-propanediol Chemical compound CNCC(O)CO WOMTYMDHLQTCHY-UHFFFAOYSA-N 0.000 description 3
- HWPJOWDGPXJRRY-UHFFFAOYSA-N 5-(1,3-dioxoisoindol-2-yl)-4,6-diiodo-2-[(2-iodoacetyl)amino]benzene-1,3-dicarboxylic acid Chemical compound ICC(=O)NC1=C(C(=O)O)C(=C(C(=C1C(=O)O)I)N1C(C=2C(C1=O)=CC=CC=2)=O)I HWPJOWDGPXJRRY-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- SHWNNYZBHZIQQV-UHFFFAOYSA-J EDTA monocalcium diisodium salt Chemical compound [Na+].[Na+].[Ca+2].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O SHWNNYZBHZIQQV-UHFFFAOYSA-J 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000009435 amidation Effects 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000011049 filling Methods 0.000 description 3
- 238000003384 imaging method Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- ZDPKPVZLNQECET-UHFFFAOYSA-N 5-[(2-chloroacetyl)amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride Chemical compound ClCC(=O)NC1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I ZDPKPVZLNQECET-UHFFFAOYSA-N 0.000 description 2
- WEMFOEZLMVUKAN-UHFFFAOYSA-N 5-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=C(I)C(C(=O)O)=C(I)C(NC(=O)CCN2C(C3=CC=CC=C3C2=O)=O)=C1I WEMFOEZLMVUKAN-UHFFFAOYSA-N 0.000 description 2
- DOIQOEIAIWFUHI-UHFFFAOYSA-N 5-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=C(I)C(C(=O)Cl)=C(I)C(NC(=O)CN2C(C3=CC=CC=C3C2=O)=O)=C1I DOIQOEIAIWFUHI-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 238000007126 N-alkylation reaction Methods 0.000 description 2
- 239000007832 Na2SO4 Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000012154 double-distilled water Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 229960003194 meglumine Drugs 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- 210000001635 urinary tract Anatomy 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- WUBMNHCGXAPZGV-UHFFFAOYSA-N 2-[(2-chloro-2-oxoethyl)carbamoyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)NCC(Cl)=O WUBMNHCGXAPZGV-UHFFFAOYSA-N 0.000 description 1
- CJNZAXGUTKBIHP-UHFFFAOYSA-N 2-iodobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1I CJNZAXGUTKBIHP-UHFFFAOYSA-N 0.000 description 1
- OWLPKHRSZQWPON-UHFFFAOYSA-N 3-(methylamino)propane-1,2-diol;hydrochloride Chemical compound Cl.CNCC(O)CO OWLPKHRSZQWPON-UHFFFAOYSA-N 0.000 description 1
- UCBPBIDRSKKNCD-UHFFFAOYSA-N 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid Chemical compound NC=1C(=C(C(=C(C(=O)ONC(C)=O)C=1I)I)C(=O)O)I UCBPBIDRSKKNCD-UHFFFAOYSA-N 0.000 description 1
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 1
- YQOFPDVBJWLKIZ-UHFFFAOYSA-N 5-(2-aminopropanoylamino)-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound CC(N)C(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I YQOFPDVBJWLKIZ-UHFFFAOYSA-N 0.000 description 1
- LFNDMOOUPUTUIN-UHFFFAOYSA-N 5-(2-chloropropanoylamino)-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound CC(Cl)C(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I LFNDMOOUPUTUIN-UHFFFAOYSA-N 0.000 description 1
- GEBVOUQKIMSWJH-UHFFFAOYSA-N 5-(3-aminopropanoylamino)-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound NCCC(=O)NC1=C(I)C(C(O)=O)=C(I)C(C(O)=O)=C1I GEBVOUQKIMSWJH-UHFFFAOYSA-N 0.000 description 1
- WFKCSJFBRFZCBN-UHFFFAOYSA-N 5-(3-chloropropanoylamino)-2,4,6-triiodobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=C(I)C(NC(=O)CCCl)=C(I)C(C(O)=O)=C1I WFKCSJFBRFZCBN-UHFFFAOYSA-N 0.000 description 1
- FBJVWRITWDYUAC-UHFFFAOYSA-N 5-amino-2,4,6-triiodobenzene-1,3-dicarbonyl chloride Chemical compound NC1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I FBJVWRITWDYUAC-UHFFFAOYSA-N 0.000 description 1
- WJXXCTSBMNYHHS-UHFFFAOYSA-N 5-aminobenzene-1,3-dicarbonyl chloride Chemical compound NC1=CC(C(Cl)=O)=CC(C(Cl)=O)=C1 WJXXCTSBMNYHHS-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- BGTOPKDVXDFTRP-UHFFFAOYSA-N CC(=O)NOC(=O)C1=C(C(=C(C(=C1I)C(=O)O)I)Br)I Chemical compound CC(=O)NOC(=O)C1=C(C(=C(C(=C1I)C(=O)O)I)Br)I BGTOPKDVXDFTRP-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- BAQCROVBDNBEEB-UBYUBLNFSA-N Metrizamide Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)N[C@@H]2[C@H]([C@H](O)[C@@H](CO)OC2O)O)=C1I BAQCROVBDNBEEB-UBYUBLNFSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 206010047095 Vascular pain Diseases 0.000 description 1
- REOLHJDOUUORKY-UHFFFAOYSA-J [Na+].[Na+].[Ca+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O Chemical compound [Na+].[Na+].[Ca+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O REOLHJDOUUORKY-UHFFFAOYSA-J 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000000266 alpha-aminoacyl group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000002583 angiography Methods 0.000 description 1
- 210000000709 aorta Anatomy 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 239000002038 ethyl acetate fraction Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 231100000171 higher toxicity Toxicity 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- VVDGWALACJEJKG-UHFFFAOYSA-N iodamide Chemical compound CC(=O)NCC1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I VVDGWALACJEJKG-UHFFFAOYSA-N 0.000 description 1
- 229960004901 iodamide Drugs 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 229960000929 iotalamic acid Drugs 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000005907 ketalization reaction Methods 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960000554 metrizamide Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000036407 pain Effects 0.000 description 1
- QMMOXUPEWRXHJS-UHFFFAOYSA-N pent-2-ene Chemical group CCC=CC QMMOXUPEWRXHJS-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 238000002601 radiography Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 229940083604 sodium iothalamate Drugs 0.000 description 1
- WCIMWHNSWLLELS-ZMWPDAOESA-M sodium;3-acetamido-2,6-bis(iodanyl)-4-iodo-5-(methylcarbamoyl)benzoate Chemical compound [Na+].CNC(=O)C1=C(I)C(NC(C)=O)=C([125I])C(C([O-])=O)=C1[125I] WCIMWHNSWLLELS-ZMWPDAOESA-M 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- ZEGFMFQPWDMMEP-UHFFFAOYSA-N strontium;sulfide Chemical compound [S-2].[Sr+2] ZEGFMFQPWDMMEP-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 210000005166 vasculature Anatomy 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Saccharide Compounds (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Steroid Compounds (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Dental Preparations (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792928417 DE2928417A1 (de) | 1979-07-12 | 1979-07-12 | Trijodierte basen |
| DE2928417 | 1979-07-12 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI802215A7 FI802215A7 (fi) | 1981-01-13 |
| FI68042B FI68042B (fi) | 1985-03-29 |
| FI68042C true FI68042C (fi) | 1985-07-10 |
Family
ID=6075678
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI802215A FI68042C (fi) | 1979-07-12 | 1980-07-10 | 5-amino-2,4,6-trijod-isoftalsyra-bis-amid-derivat foer anvaendning i roentgenkontrastmedel |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4283381A (Direct) |
| EP (1) | EP0022744B1 (Direct) |
| JP (1) | JPS5659717A (Direct) |
| AT (1) | ATE2834T1 (Direct) |
| AU (1) | AU536426B2 (Direct) |
| CA (1) | CA1129438A (Direct) |
| CS (1) | CS214834B2 (Direct) |
| DE (2) | DE2928417A1 (Direct) |
| DK (1) | DK154501C (Direct) |
| EG (1) | EG14884A (Direct) |
| ES (2) | ES8104792A1 (Direct) |
| FI (1) | FI68042C (Direct) |
| GR (1) | GR69303B (Direct) |
| HU (1) | HU182154B (Direct) |
| IE (1) | IE50064B1 (Direct) |
| IL (1) | IL60517A (Direct) |
| NO (1) | NO150719C (Direct) |
| PH (1) | PH16651A (Direct) |
| PT (1) | PT71547A (Direct) |
| YU (1) | YU177980A (Direct) |
| ZA (1) | ZA804192B (Direct) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3038853A1 (de) | 1980-10-10 | 1982-05-27 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue n-hydroxy-alkylierte dicarbonsaeure-bis-(3,5-dicarbamoyl-2,4,6-trijodanilide), deren herstellung und diese enthaltende roentgenkonstrastmittel (ii) |
| DE3150917A1 (de) * | 1981-12-18 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | "2-amino-1-(1,3-dioxolan-4-yl)-ethanol-verbindungen, deren herstellung und verwendung zur weiterverarbeitung" |
| FR2541676A1 (fr) * | 1983-02-25 | 1984-08-31 | Guerbet Sa | Composes non-ioniques a structures benzenique iodee ou bromee et produits opacifiants en contenant |
| GB8906130D0 (en) * | 1989-03-17 | 1989-05-04 | Nycomed As | Compositions |
| US5232685A (en) * | 1989-11-03 | 1993-08-03 | Schering Aktiengesellschaft | Nonionic x-ray contrast medium with high iodine content |
| US5614638A (en) * | 1989-11-29 | 1997-03-25 | Bracco International B.V. | Nonionic radiographic contrast agents |
| IL96324A (en) * | 1989-11-29 | 1995-01-24 | Squibb & Sons Inc | 5-Amino-2, 4, 6-triiodo-1, 3-benzenecarboxylic acid derivatives, processes for their preparation, and methods utilizing them as contrast agents |
| GB9020091D0 (en) * | 1990-09-14 | 1990-10-24 | Nycomed As | Contrast media |
| US5278311A (en) * | 1992-06-05 | 1994-01-11 | E. R. Squibb & Sons, Inc. | Nonionic radiographic contrast agents |
| CA2200495A1 (en) * | 1994-09-22 | 1996-03-28 | Guerbet S.A. | Polyiodo compounds, their preparation and their use in x-ray radiology |
| IT1299202B1 (it) * | 1998-05-08 | 2000-02-29 | Dibra Spa | Processo per la preparazione della s-n,n'-bis (2-idrossi-1- (idrossimetil)etil) -5-((2-idrossi-1-ossopropil)ammino)-2,4,6-triiodo |
| IT1312569B1 (it) * | 1999-05-21 | 2002-04-22 | Raffaele Ansovini | Uso dell'enzima gssg reduttasi per il trattamento terapeutico e laprofilassi di pazienti infettati da hiv. |
| US7790141B2 (en) * | 2003-08-11 | 2010-09-07 | Pathak Holdings, Llc | Radio-opaque compounds, compositions containing same and methods of their synthesis and use |
| CN101654417B (zh) * | 2009-09-01 | 2012-06-20 | 江苏省原子医学研究所 | X线造影剂碘佛醇中间体的制备方法 |
| CN105461581A (zh) * | 2015-11-17 | 2016-04-06 | 浙江海洲制药有限公司 | 碘帕醇杂质a和杂质b的合成方法 |
| CN115806498B (zh) * | 2021-09-15 | 2024-09-10 | 大道隆达(北京)医药科技发展有限公司 | 5-氯乙酰胺基-2,4,6-三碘异酞酰氯的合成方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2776241A (en) * | 1952-08-06 | 1957-01-01 | Schering Ag | Injectable x-ray contrast agents comprising salts of n-acyl derivatives of 2, 4, 6-triiodo-3-aminobenzoic acid |
| US3178473A (en) * | 1962-03-02 | 1965-04-13 | Nyegaard & Co As | Process for the n-alkylation of acyl anilides halogen substituted in the nucleus |
| DE2031724C3 (de) * | 1969-06-27 | 1979-06-28 | Nyegaard & Co. A/S., Oslo | N-substituierte Trijodbenz- bzw. Jodmethansulfon-am'ide, Verfahren zu deren Herstellung und radiologische Zusammensetzungen |
| US4021481A (en) * | 1969-06-27 | 1977-05-03 | Nyegaard & Co. A/S | Amido derivatives of 2,4,6-triiodobenzoic acids containing at least one N-hydroxyalkyl and at least two hydroxyl groups |
| BE795555A (fr) * | 1972-02-16 | 1973-08-16 | Schering Ag | Amides de triiodo-isophtaloyl-monoamino-acide, leur procede de preparation et leur utilisation |
| GB1548594A (en) * | 1976-06-11 | 1979-07-18 | Nyegaard & Co As | Triiodoisophthalic acid amides |
| US4192859A (en) * | 1978-09-29 | 1980-03-11 | E. R. Squibb & Sons, Inc. | Contrast media containing liposomes as carriers |
-
1979
- 1979-07-12 DE DE19792928417 patent/DE2928417A1/de not_active Withdrawn
-
1980
- 1980-06-27 AT AT80730043T patent/ATE2834T1/de not_active IP Right Cessation
- 1980-06-27 EP EP80730043A patent/EP0022744B1/de not_active Expired
- 1980-06-27 DE DE8080730043T patent/DE3062428D1/de not_active Expired
- 1980-07-08 IL IL60517A patent/IL60517A/xx unknown
- 1980-07-10 PH PH24273A patent/PH16651A/en unknown
- 1980-07-10 CA CA355,900A patent/CA1129438A/en not_active Expired
- 1980-07-10 CS CS804924A patent/CS214834B2/cs unknown
- 1980-07-10 FI FI802215A patent/FI68042C/fi not_active IP Right Cessation
- 1980-07-10 AU AU60294/80A patent/AU536426B2/en not_active Ceased
- 1980-07-10 YU YU01779/80A patent/YU177980A/xx unknown
- 1980-07-10 GR GR62426A patent/GR69303B/el unknown
- 1980-07-11 DK DK300680A patent/DK154501C/da not_active IP Right Cessation
- 1980-07-11 JP JP9406480A patent/JPS5659717A/ja active Pending
- 1980-07-11 ES ES493302A patent/ES8104792A1/es not_active Expired
- 1980-07-11 ES ES493301A patent/ES8104791A1/es not_active Expired
- 1980-07-11 ZA ZA00804192A patent/ZA804192B/xx unknown
- 1980-07-11 US US06/167,597 patent/US4283381A/en not_active Expired - Lifetime
- 1980-07-11 NO NO802102A patent/NO150719C/no unknown
- 1980-07-11 PT PT71547A patent/PT71547A/pt unknown
- 1980-07-11 HU HU801748A patent/HU182154B/hu unknown
- 1980-07-11 IE IE1441/80A patent/IE50064B1/en unknown
- 1980-07-12 EG EG412/80A patent/EG14884A/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| YU177980A (en) | 1983-12-31 |
| EP0022744A2 (de) | 1981-01-21 |
| CS214834B2 (en) | 1982-06-25 |
| PH16651A (en) | 1983-12-06 |
| DK154501C (da) | 1989-04-10 |
| NO802102L (no) | 1981-01-13 |
| ES493301A0 (es) | 1981-05-16 |
| US4283381A (en) | 1981-08-11 |
| GR69303B (Direct) | 1982-05-14 |
| IL60517A0 (en) | 1980-09-16 |
| PT71547A (en) | 1980-08-01 |
| ZA804192B (en) | 1981-07-29 |
| DK154501B (da) | 1988-11-21 |
| FI68042B (fi) | 1985-03-29 |
| EP0022744B1 (de) | 1983-03-23 |
| HU182154B (en) | 1983-12-28 |
| ES493302A0 (es) | 1981-05-16 |
| AU536426B2 (en) | 1984-05-10 |
| EG14884A (en) | 1985-06-30 |
| ES8104792A1 (es) | 1981-05-16 |
| ES8104791A1 (es) | 1981-05-16 |
| IE50064B1 (en) | 1986-02-05 |
| FI802215A7 (fi) | 1981-01-13 |
| NO150719B (no) | 1984-08-27 |
| ATE2834T1 (de) | 1983-04-15 |
| EP0022744A3 (en) | 1981-03-11 |
| JPS5659717A (en) | 1981-05-23 |
| DK300680A (da) | 1981-01-13 |
| DE3062428D1 (en) | 1983-04-28 |
| IL60517A (en) | 1984-06-29 |
| CA1129438A (en) | 1982-08-10 |
| IE801441L (en) | 1981-01-12 |
| DE2928417A1 (de) | 1981-01-29 |
| AU6029480A (en) | 1981-01-15 |
| NO150719C (no) | 1984-12-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI68042C (fi) | 5-amino-2,4,6-trijod-isoftalsyra-bis-amid-derivat foer anvaendning i roentgenkontrastmedel | |
| FI73199B (fi) | Trijoderade isoftalsyradiamider anvaendbara saosom skuggivande substanser i roentgenkontrastmedel, foerfarande foer framstaellning av dessa samt roentgenkontrastmedel som innehaoller dessa. | |
| US4367216A (en) | Triiodinated 5-aminoisophthalic acid derivatives | |
| US5075502A (en) | Nonionic x-ray contrast agents, compositions and methods | |
| IE882808L (en) | New dicarboxylic acid-bis-(3,5-dicarbamoyl-2,4,6-triiodoanilides), process for their production as well as X-ray contrast media containing them | |
| SK89393A3 (en) | New polyiodated compounds, method of preparation, contrast product containing them | |
| US6072069A (en) | Biodegradable nonionic contrast media | |
| EP0855997A1 (en) | Formyl derivatives as nonionic contrast media | |
| JP3249112B2 (ja) | 非イオン性化合物及び該化合物を含有する放射線造影剤組成物 | |
| FI93209B (fi) | Substituoituja dikarboksyylihappo-bis(3,5-dikarbamoyyli-2,4,6-trijodianilideja) menetelmä niiden valmistamiseksi sekä niiden käyttö röntgenvarjoaineiden valmistamiseksi | |
| IE45007B1 (en) | New iodinated isophthalamic acid derivatives | |
| US20100303734A1 (en) | Contrast agents | |
| EP0675105B1 (fr) | Composés polyiodés, procédé de préparation et composition de diagnostic | |
| CN101341119B (zh) | 具有二亚乙基三胺类金属螯合物结构的高级脂肪酸三酯和酰胺衍生物 | |
| EP0642492B1 (en) | 5,5'-/(1,3-propanediyl) bis-/imino(2-oxo-2,1-ethanediyl)acetylimino/bis(2,4,6-triiodo-1,3-benzenedicarboxyamides), and contrast media containing them | |
| HU201732B (en) | Process for producing triiodide benzene derivatives comprising non ionic iodine and contrast materials comprising such compounds | |
| IE49001B1 (en) | New 2,4,6 triiodoisophthalamic acid derivatives,their preparation and x-ray contrast agents based on these compounds | |
| US3772376A (en) | X-ray contrast agents | |
| EP1084712B1 (en) | X-ray contrast agents | |
| US4107286A (en) | Polyiods benzene derivatives and X-ray contrast media containing the same | |
| JPS63500522A (ja) | イオン性コントラスト媒体からの非イオン性ポリオ−ルコントラスト媒体 | |
| US4954348A (en) | Non-ionic polyol contrast media from ionic contrast media | |
| JPH0128011B2 (Direct) | ||
| FI58589B (fi) | Roentgenkontrastmedel innehaollande 3,6,9-trioxiundekan-1,11-dioyl-bis-(3-karboxi-2,4,6-trijod-anilid) eller salt daerav och foerfarande foer framstaellning av detta | |
| CS214835B2 (cs) | Způsob výroby bis-amidu kyseliny 5-amino-2,4,B-trijodizoftalové |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: SCHERING AKTIENGESELLSCHAFT |